)<[^<]*)*<\/script>/gi,bO=/^(?:select|textarea)/i,bP=/\s+/,bQ=/([?&])_=[^&]*/,bR=/^([\w\+\.\-]+:)(?:\/\/([^\/?#:]*)(?::(\d+))?)?/,bS=f.fn.load,bT={},bU={},bV,bW,bX=["*/"]+["*"];try{bV=e.href}catch(bY){bV=c.createElement("a"),bV.href="",bV=bV.href}bW=bR.exec(bV.toLowerCase())||[],f.fn.extend({load:function(a,c,d){if(typeof a!="string"&&bS)return bS.apply(this,arguments);if(!this.length)return this;var e=a.indexOf(" ");if(e>=0){var g=a.slice(e,a.length);a=a.slice(0,e)}var h="GET";c&&(f.isFunction(c)?(d=c,c=b):typeof c=="object"&&(c=f.param(c,f.ajaxSettings.traditional),h="POST"));var i=this;f.ajax({url:a,type:h,dataType:"html",data:c,complete:function(a,b,c){c=a.responseText,a.isResolved()&&(a.done(function(a){c=a}),i.html(g?f("").append(c.replace(bN,"")).find(g):c)),d&&i.each(d,[c,b,a])}});return this},serialize:function(){return f.param(this.serializeArray())},serializeArray:function(){return this.map(function(){return this.elements?f.makeArray(this.elements):this}).filter(function(){return this.name&&!this.disabled&&(this.checked||bO.test(this.nodeName)||bI.test(this.type))}).map(function(a,b){var c=f(this).val();return c==null?null:f.isArray(c)?f.map(c,function(a,c){return{name:b.name,value:a.replace(bF,"\r\n")}}):{name:b.name,value:c.replace(bF,"\r\n")}}).get()}}),f.each("ajaxStart ajaxStop ajaxComplete ajaxError ajaxSuccess ajaxSend".split(" "),function(a,b){f.fn[b]=function(a){return this.on(b,a)}}),f.each(["get","post"],function(a,c){f[c]=function(a,d,e,g){f.isFunction(d)&&(g=g||e,e=d,d=b);return f.ajax({type:c,url:a,data:d,success:e,dataType:g})}}),f.extend({getScript:function(a,c){return f.get(a,b,c,"script")},getJSON:function(a,b,c){return f.get(a,b,c,"json")},ajaxSetup:function(a,b){b?b_(a,f.ajaxSettings):(b=a,a=f.ajaxSettings),b_(a,b);return a},ajaxSettings:{url:bV,isLocal:bJ.test(bW[1]),global:!0,type:"GET",contentType:"application/x-www-form-urlencoded",processData:!0,async:!0,accepts:{xml:"application/xml, text/xml",html:"text/html",text:"text/plain",json:"application/json, text/javascript","*":bX},contents:{xml:/xml/,html:/html/,json:/json/},responseFields:{xml:"responseXML",text:"responseText"},converters:{"* text":a.String,"text html":!0,"text json":f.parseJSON,"text xml":f.parseXML},flatOptions:{context:!0,url:!0}},ajaxPrefilter:bZ(bT),ajaxTransport:bZ(bU),ajax:function(a,c){function w(a,c,l,m){if(s!==2){s=2,q&&clearTimeout(q),p=b,n=m||"",v.readyState=a>0?4:0;var o,r,u,w=c,x=l?cb(d,v,l):b,y,z;if(a>=200&&a<300||a===304){if(d.ifModified){if(y=v.getResponseHeader("Last-Modified"))f.lastModified[k]=y;if(z=v.getResponseHeader("Etag"))f.etag[k]=z}if(a===304)w="notmodified",o=!0;else try{r=cc(d,x),w="success",o=!0}catch(A){w="parsererror",u=A}}else{u=w;if(!w||a)w="error",a<0&&(a=0)}v.status=a,v.statusText=""+(c||w),o?h.resolveWith(e,[r,w,v]):h.rejectWith(e,[v,w,u]),v.statusCode(j),j=b,t&&g.trigger("ajax"+(o?"Success":"Error"),[v,d,o?r:u]),i.fireWith(e,[v,w]),t&&(g.trigger("ajaxComplete",[v,d]),--f.active||f.event.trigger("ajaxStop"))}}typeof a=="object"&&(c=a,a=b),c=c||{};var d=f.ajaxSetup({},c),e=d.context||d,g=e!==d&&(e.nodeType||e instanceof f)?f(e):f.event,h=f.Deferred(),i=f.Callbacks("once memory"),j=d.statusCode||{},k,l={},m={},n,o,p,q,r,s=0,t,u,v={readyState:0,setRequestHeader:function(a,b){if(!s){var c=a.toLowerCase();a=m[c]=m[c]||a,l[a]=b}return this},getAllResponseHeaders:function(){return s===2?n:null},getResponseHeader:function(a){var c;if(s===2){if(!o){o={};while(c=bH.exec(n))o[c[1].toLowerCase()]=c[2]}c=o[a.toLowerCase()]}return c===b?null:c},overrideMimeType:function(a){s||(d.mimeType=a);return this},abort:function(a){a=a||"abort",p&&p.abort(a),w(0,a);return this}};h.promise(v),v.success=v.done,v.error=v.fail,v.complete=i.add,v.statusCode=function(a){if(a){var b;if(s<2)for(b in a)j[b]=[j[b],a[b]];else b=a[v.status],v.then(b,b)}return this},d.url=((a||d.url)+"").replace(bG,"").replace(bL,bW[1]+"//"),d.dataTypes=f.trim(d.dataType||"*").toLowerCase().split(bP),d.crossDomain==null&&(r=bR.exec(d.url.toLowerCase()),d.crossDomain=!(!r||r[1]==bW[1]&&r[2]==bW[2]&&(r[3]||(r[1]==="http:"?80:443))==(bW[3]||(bW[1]==="http:"?80:443)))),d.data&&d.processData&&typeof d.data!="string"&&(d.data=f.param(d.data,d.traditional)),b$(bT,d,c,v);if(s===2)return!1;t=d.global,d.type=d.type.toUpperCase(),d.hasContent=!bK.test(d.type),t&&f.active++===0&&f.event.trigger("ajaxStart");if(!d.hasContent){d.data&&(d.url+=(bM.test(d.url)?"&":"?")+d.data,delete d.data),k=d.url;if(d.cache===!1){var x=f.now(),y=d.url.replace(bQ,"$1_="+x);d.url=y+(y===d.url?(bM.test(d.url)?"&":"?")+"_="+x:"")}}(d.data&&d.hasContent&&d.contentType!==!1||c.contentType)&&v.setRequestHeader("Content-Type",d.contentType),d.ifModified&&(k=k||d.url,f.lastModified[k]&&v.setRequestHeader("If-Modified-Since",f.lastModified[k]),f.etag[k]&&v.setRequestHeader("If-None-Match",f.etag[k])),v.setRequestHeader("Accept",d.dataTypes[0]&&d.accepts[d.dataTypes[0]]?d.accepts[d.dataTypes[0]]+(d.dataTypes[0]!=="*"?", "+bX+"; q=0.01":""):d.accepts["*"]);for(u in d.headers)v.setRequestHeader(u,d.headers[u]);if(d.beforeSend&&(d.beforeSend.call(e,v,d)===!1||s===2)){v.abort();return!1}for(u in{success:1,error:1,complete:1})v[u](d[u]);p=b$(bU,d,c,v);if(!p)w(-1,"No Transport");else{v.readyState=1,t&&g.trigger("ajaxSend",[v,d]),d.async&&d.timeout>0&&(q=setTimeout(function(){v.abort("timeout")},d.timeout));try{s=1,p.send(l,w)}catch(z){if(s<2)w(-1,z);else throw z}}return v},param:function(a,c){var d=[],e=function(a,b){b=f.isFunction(b)?b():b,d[d.length]=encodeURIComponent(a)+"="+encodeURIComponent(b)};c===b&&(c=f.ajaxSettings.traditional);if(f.isArray(a)||a.jquery&&!f.isPlainObject(a))f.each(a,function(){e(this.name,this.value)});else for(var g in a)ca(g,a[g],c,e);return d.join("&").replace(bD,"+")}}),f.extend({active:0,lastModified:{},etag:{}});var cd=f.now(),ce=/(\=)\?(&|$)|\?\?/i;f.ajaxSetup({jsonp:"callback",jsonpCallback:function(){return f.expando+"_"+cd++}}),f.ajaxPrefilter("json jsonp",function(b,c,d){var e=b.contentType==="application/x-www-form-urlencoded"&&typeof b.data=="string";if(b.dataTypes[0]==="jsonp"||b.jsonp!==!1&&(ce.test(b.url)||e&&ce.test(b.data))){var g,h=b.jsonpCallback=f.isFunction(b.jsonpCallback)?b.jsonpCallback():b.jsonpCallback,i=a[h],j=b.url,k=b.data,l="$1"+h+"$2";b.jsonp!==!1&&(j=j.replace(ce,l),b.url===j&&(e&&(k=k.replace(ce,l)),b.data===k&&(j+=(/\?/.test(j)?"&":"?")+b.jsonp+"="+h))),b.url=j,b.data=k,a[h]=function(a){g=[a]},d.always(function(){a[h]=i,g&&f.isFunction(i)&&a[h](g[0])}),b.converters["script json"]=function(){g||f.error(h+" was not called");return g[0]},b.dataTypes[0]="json";return"script"}}),f.ajaxSetup({accepts:{script:"text/javascript, application/javascript, application/ecmascript, application/x-ecmascript"},contents:{script:/javascript|ecmascript/},converters:{"text script":function(a){f.globalEval(a);return a}}}),f.ajaxPrefilter("script",function(a){a.cache===b&&(a.cache=!1),a.crossDomain&&(a.type="GET",a.global=!1)}),f.ajaxTransport("script",function(a){if(a.crossDomain){var d,e=c.head||c.getElementsByTagName("head")[0]||c.documentElement;return{send:function(f,g){d=c.createElement("script"),d.async="async",a.scriptCharset&&(d.charset=a.scriptCharset),d.src=a.url,d.onload=d.onreadystatechange=function(a,c){if(c||!d.readyState||/loaded|complete/.test(d.readyState))d.onload=d.onreadystatechange=null,e&&d.parentNode&&e.removeChild(d),d=b,c||g(200,"success")},e.insertBefore(d,e.firstChild)},abort:function(){d&&d.onload(0,1)}}}});var cf=a.ActiveXObject?function(){for(var a in ch)ch[a](0,1)}:!1,cg=0,ch;f.ajaxSettings.xhr=a.ActiveXObject?function(){return!this.isLocal&&ci()||cj()}:ci,function(a){f.extend(f.support,{ajax:!!a,cors:!!a&&"withCredentials"in a})}(f.ajaxSettings.xhr()),f.support.ajax&&f.ajaxTransport(function(c){if(!c.crossDomain||f.support.cors){var d;return{send:function(e,g){var h=c.xhr(),i,j;c.username?h.open(c.type,c.url,c.async,c.username,c.password):h.open(c.type,c.url,c.async);if(c.xhrFields)for(j in c.xhrFields)h[j]=c.xhrFields[j];c.mimeType&&h.overrideMimeType&&h.overrideMimeType(c.mimeType),!c.crossDomain&&!e["X-Requested-With"]&&(e["X-Requested-With"]="XMLHttpRequest");try{for(j in e)h.setRequestHeader(j,e[j])}catch(k){}h.send(c.hasContent&&c.data||null),d=function(a,e){var j,k,l,m,n;try{if(d&&(e||h.readyState===4)){d=b,i&&(h.onreadystatechange=f.noop,cf&&delete ch[i]);if(e)h.readyState!==4&&h.abort();else{j=h.status,l=h.getAllResponseHeaders(),m={},n=h.responseXML,n&&n.documentElement&&(m.xml=n),m.text=h.responseText;try{k=h.statusText}catch(o){k=""}!j&&c.isLocal&&!c.crossDomain?j=m.text?200:404:j===1223&&(j=204)}}}catch(p){e||g(-1,p)}m&&g(j,k,m,l)},!c.async||h.readyState===4?d():(i=++cg,cf&&(ch||(ch={},f(a).unload(cf)),ch[i]=d),h.onreadystatechange=d)},abort:function(){d&&d(0,1)}}}});var ck={},cl,cm,cn=/^(?:toggle|show|hide)$/,co=/^([+\-]=)?([\d+.\-]+)([a-z%]*)$/i,cp,cq=[["height","marginTop","marginBottom","paddingTop","paddingBottom"],["width","marginLeft","marginRight","paddingLeft","paddingRight"],["opacity"]],cr;f.fn.extend({show:function(a,b,c){var d,e;if(a||a===0)return this.animate(cu("show",3),a,b,c);for(var g=0,h=this.length;g=i.duration+this.startTime){this.now=this.end,this.pos=this.state=1,this.update(),i.animatedProperties[this.prop]=!0;for(b in i.animatedProperties)i.animatedProperties[b]!==!0&&(g=!1);if(g){i.overflow!=null&&!f.support.shrinkWrapBlocks&&f.each(["","X","Y"],function(a,b){h.style["overflow"+b]=i.overflow[a]}),i.hide&&f(h).hide();if(i.hide||i.show)for(b in i.animatedProperties)f.style(h,b,i.orig[b]),f.removeData(h,"fxshow"+b,!0),f.removeData(h,"toggle"+b,!0);d=i.complete,d&&(i.complete=!1,d.call(h))}return!1}i.duration==Infinity?this.now=e:(c=e-this.startTime,this.state=c/i.duration,this.pos=f.easing[i.animatedProperties[this.prop]](this.state,c,0,1,i.duration),this.now=this.start+(this.end-this.start)*this.pos),this.update();return!0}},f.extend(f.fx,{tick:function(){var a,b=f.timers,c=0;for(;c-1,k={},l={},m,n;j?(l=e.position(),m=l.top,n=l.left):(m=parseFloat(h)||0,n=parseFloat(i)||0),f.isFunction(b)&&(b=b.call(a,c,g)),b.top!=null&&(k.top=b.top-g.top+m),b.left!=null&&(k.left=b.left-g.left+n),"using"in b?b.using.call(a,k):e.css(k)}},f.fn.extend({position:function(){if(!this[0])return null;var a=this[0],b=this.offsetParent(),c=this.offset(),d=cx.test(b[0].nodeName)?{top:0,left:0}:b.offset();c.top-=parseFloat(f.css(a,"marginTop"))||0,c.left-=parseFloat(f.css(a,"marginLeft"))||0,d.top+=parseFloat(f.css(b[0],"borderTopWidth"))||0,d.left+=parseFloat(f.css(b[0],"borderLeftWidth"))||0;return{top:c.top-d.top,left:c.left-d.left}},offsetParent:function(){return this.map(function(){var a=this.offsetParent||c.body;while(a&&!cx.test(a.nodeName)&&f.css(a,"position")==="static")a=a.offsetParent;return a})}}),f.each(["Left","Top"],function(a,c){var d="scroll"+c;f.fn[d]=function(c){var e,g;if(c===b){e=this[0];if(!e)return null;g=cy(e);return g?"pageXOffset"in g?g[a?"pageYOffset":"pageXOffset"]:f.support.boxModel&&g.document.documentElement[d]||g.document.body[d]:e[d]}return this.each(function(){g=cy(this),g?g.scrollTo(a?f(g).scrollLeft():c,a?c:f(g).scrollTop()):this[d]=c})}}),f.each(["Height","Width"],function(a,c){var d=c.toLowerCase();f.fn["inner"+c]=function(){var a=this[0];return a?a.style?parseFloat(f.css(a,d,"padding")):this[d]():null},f.fn["outer"+c]=function(a){var b=this[0];return b?b.style?parseFloat(f.css(b,d,a?"margin":"border")):this[d]():null},f.fn[d]=function(a){var e=this[0];if(!e)return a==null?null:this;if(f.isFunction(a))return this.each(function(b){var c=f(this);c[d](a.call(this,b,c[d]()))});if(f.isWindow(e)){var g=e.document.documentElement["client"+c],h=e.document.body;return e.document.compatMode==="CSS1Compat"&&g||h&&h["client"+c]||g}if(e.nodeType===9)return Math.max(e.documentElement["client"+c],e.body["scroll"+c],e.documentElement["scroll"+c],e.body["offset"+c],e.documentElement["offset"+c]);if(a===b){var i=f.css(e,d),j=parseFloat(i);return f.isNumeric(j)?j:i}return this.css(d,typeof a=="string"?a:a+"px")}}),a.jQuery=a.$=f,typeof define=="function"&&define.amd&&define.amd.jQuery&&define("jquery",[],function(){return f})})(window);
\ No newline at end of file
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/jquery-ui-1.8.10.custom.min.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/jquery-ui-1.8.10.custom.min.js
new file mode 100644
index 0000000..a7e1293
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/jquery-ui-1.8.10.custom.min.js
@@ -0,0 +1,233 @@
+/*!
+ * jQuery UI 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI
+ */
+(function(c,j){function k(a){return!c(a).parents().andSelf().filter(function(){return c.curCSS(this,"visibility")==="hidden"||c.expr.filters.hidden(this)}).length}c.ui=c.ui||{};if(!c.ui.version){c.extend(c.ui,{version:"1.8.10",keyCode:{ALT:18,BACKSPACE:8,CAPS_LOCK:20,COMMA:188,COMMAND:91,COMMAND_LEFT:91,COMMAND_RIGHT:93,CONTROL:17,DELETE:46,DOWN:40,END:35,ENTER:13,ESCAPE:27,HOME:36,INSERT:45,LEFT:37,MENU:93,NUMPAD_ADD:107,NUMPAD_DECIMAL:110,NUMPAD_DIVIDE:111,NUMPAD_ENTER:108,NUMPAD_MULTIPLY:106,
+NUMPAD_SUBTRACT:109,PAGE_DOWN:34,PAGE_UP:33,PERIOD:190,RIGHT:39,SHIFT:16,SPACE:32,TAB:9,UP:38,WINDOWS:91}});c.fn.extend({_focus:c.fn.focus,focus:function(a,b){return typeof a==="number"?this.each(function(){var d=this;setTimeout(function(){c(d).focus();b&&b.call(d)},a)}):this._focus.apply(this,arguments)},scrollParent:function(){var a;a=c.browser.msie&&/(static|relative)/.test(this.css("position"))||/absolute/.test(this.css("position"))?this.parents().filter(function(){return/(relative|absolute|fixed)/.test(c.curCSS(this,
+"position",1))&&/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0):this.parents().filter(function(){return/(auto|scroll)/.test(c.curCSS(this,"overflow",1)+c.curCSS(this,"overflow-y",1)+c.curCSS(this,"overflow-x",1))}).eq(0);return/fixed/.test(this.css("position"))||!a.length?c(document):a},zIndex:function(a){if(a!==j)return this.css("zIndex",a);if(this.length){a=c(this[0]);for(var b;a.length&&a[0]!==document;){b=a.css("position");
+if(b==="absolute"||b==="relative"||b==="fixed"){b=parseInt(a.css("zIndex"),10);if(!isNaN(b)&&b!==0)return b}a=a.parent()}}return 0},disableSelection:function(){return this.bind((c.support.selectstart?"selectstart":"mousedown")+".ui-disableSelection",function(a){a.preventDefault()})},enableSelection:function(){return this.unbind(".ui-disableSelection")}});c.each(["Width","Height"],function(a,b){function d(f,g,l,m){c.each(e,function(){g-=parseFloat(c.curCSS(f,"padding"+this,true))||0;if(l)g-=parseFloat(c.curCSS(f,
+"border"+this+"Width",true))||0;if(m)g-=parseFloat(c.curCSS(f,"margin"+this,true))||0});return g}var e=b==="Width"?["Left","Right"]:["Top","Bottom"],h=b.toLowerCase(),i={innerWidth:c.fn.innerWidth,innerHeight:c.fn.innerHeight,outerWidth:c.fn.outerWidth,outerHeight:c.fn.outerHeight};c.fn["inner"+b]=function(f){if(f===j)return i["inner"+b].call(this);return this.each(function(){c(this).css(h,d(this,f)+"px")})};c.fn["outer"+b]=function(f,g){if(typeof f!=="number")return i["outer"+b].call(this,f);return this.each(function(){c(this).css(h,
+d(this,f,true,g)+"px")})}});c.extend(c.expr[":"],{data:function(a,b,d){return!!c.data(a,d[3])},focusable:function(a){var b=a.nodeName.toLowerCase(),d=c.attr(a,"tabindex");if("area"===b){b=a.parentNode;d=b.name;if(!a.href||!d||b.nodeName.toLowerCase()!=="map")return false;a=c("img[usemap=#"+d+"]")[0];return!!a&&k(a)}return(/input|select|textarea|button|object/.test(b)?!a.disabled:"a"==b?a.href||!isNaN(d):!isNaN(d))&&k(a)},tabbable:function(a){var b=c.attr(a,"tabindex");return(isNaN(b)||b>=0)&&c(a).is(":focusable")}});
+c(function(){var a=document.body,b=a.appendChild(b=document.createElement("div"));c.extend(b.style,{minHeight:"100px",height:"auto",padding:0,borderWidth:0});c.support.minHeight=b.offsetHeight===100;c.support.selectstart="onselectstart"in b;a.removeChild(b).style.display="none"});c.extend(c.ui,{plugin:{add:function(a,b,d){a=c.ui[a].prototype;for(var e in d){a.plugins[e]=a.plugins[e]||[];a.plugins[e].push([b,d[e]])}},call:function(a,b,d){if((b=a.plugins[b])&&a.element[0].parentNode)for(var e=0;e0)return true;a[b]=1;d=a[b]>0;a[b]=0;return d},isOverAxis:function(a,b,d){return a>b&&a=9)&&!a.button)return this._mouseUp(a);if(this._mouseStarted){this._mouseDrag(a);
+return a.preventDefault()}if(this._mouseDistanceMet(a)&&this._mouseDelayMet(a))(this._mouseStarted=this._mouseStart(this._mouseDownEvent,a)!==false)?this._mouseDrag(a):this._mouseUp(a);return!this._mouseStarted},_mouseUp:function(a){c(document).unbind("mousemove."+this.widgetName,this._mouseMoveDelegate).unbind("mouseup."+this.widgetName,this._mouseUpDelegate);if(this._mouseStarted){this._mouseStarted=false;a.target==this._mouseDownEvent.target&&c.data(a.target,this.widgetName+".preventClickEvent",
+true);this._mouseStop(a)}return false},_mouseDistanceMet:function(a){return Math.max(Math.abs(this._mouseDownEvent.pageX-a.pageX),Math.abs(this._mouseDownEvent.pageY-a.pageY))>=this.options.distance},_mouseDelayMet:function(){return this.mouseDelayMet},_mouseStart:function(){},_mouseDrag:function(){},_mouseStop:function(){},_mouseCapture:function(){return true}})})(jQuery);
+;/*
+ * jQuery UI Position 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Position
+ */
+(function(c){c.ui=c.ui||{};var n=/left|center|right/,o=/top|center|bottom/,t=c.fn.position,u=c.fn.offset;c.fn.position=function(b){if(!b||!b.of)return t.apply(this,arguments);b=c.extend({},b);var a=c(b.of),d=a[0],g=(b.collision||"flip").split(" "),e=b.offset?b.offset.split(" "):[0,0],h,k,j;if(d.nodeType===9){h=a.width();k=a.height();j={top:0,left:0}}else if(d.setTimeout){h=a.width();k=a.height();j={top:a.scrollTop(),left:a.scrollLeft()}}else if(d.preventDefault){b.at="left top";h=k=0;j={top:b.of.pageY,
+left:b.of.pageX}}else{h=a.outerWidth();k=a.outerHeight();j=a.offset()}c.each(["my","at"],function(){var f=(b[this]||"").split(" ");if(f.length===1)f=n.test(f[0])?f.concat(["center"]):o.test(f[0])?["center"].concat(f):["center","center"];f[0]=n.test(f[0])?f[0]:"center";f[1]=o.test(f[1])?f[1]:"center";b[this]=f});if(g.length===1)g[1]=g[0];e[0]=parseInt(e[0],10)||0;if(e.length===1)e[1]=e[0];e[1]=parseInt(e[1],10)||0;if(b.at[0]==="right")j.left+=h;else if(b.at[0]==="center")j.left+=h/2;if(b.at[1]==="bottom")j.top+=
+k;else if(b.at[1]==="center")j.top+=k/2;j.left+=e[0];j.top+=e[1];return this.each(function(){var f=c(this),l=f.outerWidth(),m=f.outerHeight(),p=parseInt(c.curCSS(this,"marginLeft",true))||0,q=parseInt(c.curCSS(this,"marginTop",true))||0,v=l+p+(parseInt(c.curCSS(this,"marginRight",true))||0),w=m+q+(parseInt(c.curCSS(this,"marginBottom",true))||0),i=c.extend({},j),r;if(b.my[0]==="right")i.left-=l;else if(b.my[0]==="center")i.left-=l/2;if(b.my[1]==="bottom")i.top-=m;else if(b.my[1]==="center")i.top-=
+m/2;i.left=Math.round(i.left);i.top=Math.round(i.top);r={left:i.left-p,top:i.top-q};c.each(["left","top"],function(s,x){c.ui.position[g[s]]&&c.ui.position[g[s]][x](i,{targetWidth:h,targetHeight:k,elemWidth:l,elemHeight:m,collisionPosition:r,collisionWidth:v,collisionHeight:w,offset:e,my:b.my,at:b.at})});c.fn.bgiframe&&f.bgiframe();f.offset(c.extend(i,{using:b.using}))})};c.ui.position={fit:{left:function(b,a){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();b.left=
+d>0?b.left-d:Math.max(b.left-a.collisionPosition.left,b.left)},top:function(b,a){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();b.top=d>0?b.top-d:Math.max(b.top-a.collisionPosition.top,b.top)}},flip:{left:function(b,a){if(a.at[0]!=="center"){var d=c(window);d=a.collisionPosition.left+a.collisionWidth-d.width()-d.scrollLeft();var g=a.my[0]==="left"?-a.elemWidth:a.my[0]==="right"?a.elemWidth:0,e=a.at[0]==="left"?a.targetWidth:-a.targetWidth,h=-2*a.offset[0];b.left+=
+a.collisionPosition.left<0?g+e+h:d>0?g+e+h:0}},top:function(b,a){if(a.at[1]!=="center"){var d=c(window);d=a.collisionPosition.top+a.collisionHeight-d.height()-d.scrollTop();var g=a.my[1]==="top"?-a.elemHeight:a.my[1]==="bottom"?a.elemHeight:0,e=a.at[1]==="top"?a.targetHeight:-a.targetHeight,h=-2*a.offset[1];b.top+=a.collisionPosition.top<0?g+e+h:d>0?g+e+h:0}}}};if(!c.offset.setOffset){c.offset.setOffset=function(b,a){if(/static/.test(c.curCSS(b,"position")))b.style.position="relative";var d=c(b),
+g=d.offset(),e=parseInt(c.curCSS(b,"top",true),10)||0,h=parseInt(c.curCSS(b,"left",true),10)||0;g={top:a.top-g.top+e,left:a.left-g.left+h};"using"in a?a.using.call(b,g):d.css(g)};c.fn.offset=function(b){var a=this[0];if(!a||!a.ownerDocument)return null;if(b)return this.each(function(){c.offset.setOffset(this,b)});return u.call(this)}}})(jQuery);
+;/*
+ * jQuery UI Draggable 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Draggables
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.mouse.js
+ * jquery.ui.widget.js
+ */
+(function(d){d.widget("ui.draggable",d.ui.mouse,{widgetEventPrefix:"drag",options:{addClasses:true,appendTo:"parent",axis:false,connectToSortable:false,containment:false,cursor:"auto",cursorAt:false,grid:false,handle:false,helper:"original",iframeFix:false,opacity:false,refreshPositions:false,revert:false,revertDuration:500,scope:"default",scroll:true,scrollSensitivity:20,scrollSpeed:20,snap:false,snapMode:"both",snapTolerance:20,stack:false,zIndex:false},_create:function(){if(this.options.helper==
+"original"&&!/^(?:r|a|f)/.test(this.element.css("position")))this.element[0].style.position="relative";this.options.addClasses&&this.element.addClass("ui-draggable");this.options.disabled&&this.element.addClass("ui-draggable-disabled");this._mouseInit()},destroy:function(){if(this.element.data("draggable")){this.element.removeData("draggable").unbind(".draggable").removeClass("ui-draggable ui-draggable-dragging ui-draggable-disabled");this._mouseDestroy();return this}},_mouseCapture:function(a){var b=
+this.options;if(this.helper||b.disabled||d(a.target).is(".ui-resizable-handle"))return false;this.handle=this._getHandle(a);if(!this.handle)return false;return true},_mouseStart:function(a){var b=this.options;this.helper=this._createHelper(a);this._cacheHelperProportions();if(d.ui.ddmanager)d.ui.ddmanager.current=this;this._cacheMargins();this.cssPosition=this.helper.css("position");this.scrollParent=this.helper.scrollParent();this.offset=this.positionAbs=this.element.offset();this.offset={top:this.offset.top-
+this.margins.top,left:this.offset.left-this.margins.left};d.extend(this.offset,{click:{left:a.pageX-this.offset.left,top:a.pageY-this.offset.top},parent:this._getParentOffset(),relative:this._getRelativeOffset()});this.originalPosition=this.position=this._generatePosition(a);this.originalPageX=a.pageX;this.originalPageY=a.pageY;b.cursorAt&&this._adjustOffsetFromHelper(b.cursorAt);b.containment&&this._setContainment();if(this._trigger("start",a)===false){this._clear();return false}this._cacheHelperProportions();
+d.ui.ddmanager&&!b.dropBehaviour&&d.ui.ddmanager.prepareOffsets(this,a);this.helper.addClass("ui-draggable-dragging");this._mouseDrag(a,true);return true},_mouseDrag:function(a,b){this.position=this._generatePosition(a);this.positionAbs=this._convertPositionTo("absolute");if(!b){b=this._uiHash();if(this._trigger("drag",a,b)===false){this._mouseUp({});return false}this.position=b.position}if(!this.options.axis||this.options.axis!="y")this.helper[0].style.left=this.position.left+"px";if(!this.options.axis||
+this.options.axis!="x")this.helper[0].style.top=this.position.top+"px";d.ui.ddmanager&&d.ui.ddmanager.drag(this,a);return false},_mouseStop:function(a){var b=false;if(d.ui.ddmanager&&!this.options.dropBehaviour)b=d.ui.ddmanager.drop(this,a);if(this.dropped){b=this.dropped;this.dropped=false}if((!this.element[0]||!this.element[0].parentNode)&&this.options.helper=="original")return false;if(this.options.revert=="invalid"&&!b||this.options.revert=="valid"&&b||this.options.revert===true||d.isFunction(this.options.revert)&&
+this.options.revert.call(this.element,b)){var c=this;d(this.helper).animate(this.originalPosition,parseInt(this.options.revertDuration,10),function(){c._trigger("stop",a)!==false&&c._clear()})}else this._trigger("stop",a)!==false&&this._clear();return false},cancel:function(){this.helper.is(".ui-draggable-dragging")?this._mouseUp({}):this._clear();return this},_getHandle:function(a){var b=!this.options.handle||!d(this.options.handle,this.element).length?true:false;d(this.options.handle,this.element).find("*").andSelf().each(function(){if(this==
+a.target)b=true});return b},_createHelper:function(a){var b=this.options;a=d.isFunction(b.helper)?d(b.helper.apply(this.element[0],[a])):b.helper=="clone"?this.element.clone():this.element;a.parents("body").length||a.appendTo(b.appendTo=="parent"?this.element[0].parentNode:b.appendTo);a[0]!=this.element[0]&&!/(fixed|absolute)/.test(a.css("position"))&&a.css("position","absolute");return a},_adjustOffsetFromHelper:function(a){if(typeof a=="string")a=a.split(" ");if(d.isArray(a))a={left:+a[0],top:+a[1]||
+0};if("left"in a)this.offset.click.left=a.left+this.margins.left;if("right"in a)this.offset.click.left=this.helperProportions.width-a.right+this.margins.left;if("top"in a)this.offset.click.top=a.top+this.margins.top;if("bottom"in a)this.offset.click.top=this.helperProportions.height-a.bottom+this.margins.top},_getParentOffset:function(){this.offsetParent=this.helper.offsetParent();var a=this.offsetParent.offset();if(this.cssPosition=="absolute"&&this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],
+this.offsetParent[0])){a.left+=this.scrollParent.scrollLeft();a.top+=this.scrollParent.scrollTop()}if(this.offsetParent[0]==document.body||this.offsetParent[0].tagName&&this.offsetParent[0].tagName.toLowerCase()=="html"&&d.browser.msie)a={top:0,left:0};return{top:a.top+(parseInt(this.offsetParent.css("borderTopWidth"),10)||0),left:a.left+(parseInt(this.offsetParent.css("borderLeftWidth"),10)||0)}},_getRelativeOffset:function(){if(this.cssPosition=="relative"){var a=this.element.position();return{top:a.top-
+(parseInt(this.helper.css("top"),10)||0)+this.scrollParent.scrollTop(),left:a.left-(parseInt(this.helper.css("left"),10)||0)+this.scrollParent.scrollLeft()}}else return{top:0,left:0}},_cacheMargins:function(){this.margins={left:parseInt(this.element.css("marginLeft"),10)||0,top:parseInt(this.element.css("marginTop"),10)||0}},_cacheHelperProportions:function(){this.helperProportions={width:this.helper.outerWidth(),height:this.helper.outerHeight()}},_setContainment:function(){var a=this.options;if(a.containment==
+"parent")a.containment=this.helper[0].parentNode;if(a.containment=="document"||a.containment=="window")this.containment=[(a.containment=="document"?0:d(window).scrollLeft())-this.offset.relative.left-this.offset.parent.left,(a.containment=="document"?0:d(window).scrollTop())-this.offset.relative.top-this.offset.parent.top,(a.containment=="document"?0:d(window).scrollLeft())+d(a.containment=="document"?document:window).width()-this.helperProportions.width-this.margins.left,(a.containment=="document"?
+0:d(window).scrollTop())+(d(a.containment=="document"?document:window).height()||document.body.parentNode.scrollHeight)-this.helperProportions.height-this.margins.top];if(!/^(document|window|parent)$/.test(a.containment)&&a.containment.constructor!=Array){var b=d(a.containment)[0];if(b){a=d(a.containment).offset();var c=d(b).css("overflow")!="hidden";this.containment=[a.left+(parseInt(d(b).css("borderLeftWidth"),10)||0)+(parseInt(d(b).css("paddingLeft"),10)||0)-this.margins.left,a.top+(parseInt(d(b).css("borderTopWidth"),
+10)||0)+(parseInt(d(b).css("paddingTop"),10)||0)-this.margins.top,a.left+(c?Math.max(b.scrollWidth,b.offsetWidth):b.offsetWidth)-(parseInt(d(b).css("borderLeftWidth"),10)||0)-(parseInt(d(b).css("paddingRight"),10)||0)-this.helperProportions.width-this.margins.left,a.top+(c?Math.max(b.scrollHeight,b.offsetHeight):b.offsetHeight)-(parseInt(d(b).css("borderTopWidth"),10)||0)-(parseInt(d(b).css("paddingBottom"),10)||0)-this.helperProportions.height-this.margins.top]}}else if(a.containment.constructor==
+Array)this.containment=a.containment},_convertPositionTo:function(a,b){if(!b)b=this.position;a=a=="absolute"?1:-1;var c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName);return{top:b.top+this.offset.relative.top*a+this.offset.parent.top*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollTop():
+f?0:c.scrollTop())*a),left:b.left+this.offset.relative.left*a+this.offset.parent.left*a-(d.browser.safari&&d.browser.version<526&&this.cssPosition=="fixed"?0:(this.cssPosition=="fixed"?-this.scrollParent.scrollLeft():f?0:c.scrollLeft())*a)}},_generatePosition:function(a){var b=this.options,c=this.cssPosition=="absolute"&&!(this.scrollParent[0]!=document&&d.ui.contains(this.scrollParent[0],this.offsetParent[0]))?this.offsetParent:this.scrollParent,f=/(html|body)/i.test(c[0].tagName),e=a.pageX,g=a.pageY;
+if(this.originalPosition){if(this.containment){if(a.pageX-this.offset.click.leftthis.containment[2])e=this.containment[2]+this.offset.click.left;if(a.pageY-this.offset.click.top>this.containment[3])g=this.containment[3]+this.offset.click.top}if(b.grid){g=this.originalPageY+Math.round((g-this.originalPageY)/
+b.grid[1])*b.grid[1];g=this.containment?!(g-this.offset.click.topthis.containment[3])?g:!(g-this.offset.click.topthis.containment[2])?e:!(e-this.offset.click.left
').css({width:this.offsetWidth+"px",height:this.offsetHeight+"px",position:"absolute",opacity:"0.001",zIndex:1E3}).css(d(this).offset()).appendTo("body")})},
+stop:function(){d("div.ui-draggable-iframeFix").each(function(){this.parentNode.removeChild(this)})}});d.ui.plugin.add("draggable","opacity",{start:function(a,b){a=d(b.helper);b=d(this).data("draggable").options;if(a.css("opacity"))b._opacity=a.css("opacity");a.css("opacity",b.opacity)},stop:function(a,b){a=d(this).data("draggable").options;a._opacity&&d(b.helper).css("opacity",a._opacity)}});d.ui.plugin.add("draggable","scroll",{start:function(){var a=d(this).data("draggable");if(a.scrollParent[0]!=
+document&&a.scrollParent[0].tagName!="HTML")a.overflowOffset=a.scrollParent.offset()},drag:function(a){var b=d(this).data("draggable"),c=b.options,f=false;if(b.scrollParent[0]!=document&&b.scrollParent[0].tagName!="HTML"){if(!c.axis||c.axis!="x")if(b.overflowOffset.top+b.scrollParent[0].offsetHeight-a.pageY=0;h--){var i=c.snapElements[h].left,k=i+c.snapElements[h].width,j=c.snapElements[h].top,l=j+c.snapElements[h].height;if(i-e').css({position:this.element.css("position"),width:this.element.outerWidth(),height:this.element.outerHeight(),
+top:this.element.css("top"),left:this.element.css("left")}));this.element=this.element.parent().data("resizable",this.element.data("resizable"));this.elementIsWrapper=true;this.element.css({marginLeft:this.originalElement.css("marginLeft"),marginTop:this.originalElement.css("marginTop"),marginRight:this.originalElement.css("marginRight"),marginBottom:this.originalElement.css("marginBottom")});this.originalElement.css({marginLeft:0,marginTop:0,marginRight:0,marginBottom:0});this.originalResizeStyle=
+this.originalElement.css("resize");this.originalElement.css("resize","none");this._proportionallyResizeElements.push(this.originalElement.css({position:"static",zoom:1,display:"block"}));this.originalElement.css({margin:this.originalElement.css("margin")});this._proportionallyResize()}this.handles=a.handles||(!e(".ui-resizable-handle",this.element).length?"e,s,se":{n:".ui-resizable-n",e:".ui-resizable-e",s:".ui-resizable-s",w:".ui-resizable-w",se:".ui-resizable-se",sw:".ui-resizable-sw",ne:".ui-resizable-ne",
+nw:".ui-resizable-nw"});if(this.handles.constructor==String){if(this.handles=="all")this.handles="n,e,s,w,se,sw,ne,nw";var c=this.handles.split(",");this.handles={};for(var d=0;d');/sw|se|ne|nw/.test(f)&&g.css({zIndex:++a.zIndex});"se"==f&&g.addClass("ui-icon ui-icon-gripsmall-diagonal-se");this.handles[f]=".ui-resizable-"+f;this.element.append(g)}}this._renderAxis=function(h){h=h||this.element;for(var i in this.handles){if(this.handles[i].constructor==
+String)this.handles[i]=e(this.handles[i],this.element).show();if(this.elementIsWrapper&&this.originalElement[0].nodeName.match(/textarea|input|select|button/i)){var j=e(this.handles[i],this.element),k=0;k=/sw|ne|nw|se|n|s/.test(i)?j.outerHeight():j.outerWidth();j=["padding",/ne|nw|n/.test(i)?"Top":/se|sw|s/.test(i)?"Bottom":/^e$/.test(i)?"Right":"Left"].join("");h.css(j,k);this._proportionallyResize()}e(this.handles[i])}};this._renderAxis(this.element);this._handles=e(".ui-resizable-handle",this.element).disableSelection();
+this._handles.mouseover(function(){if(!b.resizing){if(this.className)var h=this.className.match(/ui-resizable-(se|sw|ne|nw|n|e|s|w)/i);b.axis=h&&h[1]?h[1]:"se"}});if(a.autoHide){this._handles.hide();e(this.element).addClass("ui-resizable-autohide").hover(function(){e(this).removeClass("ui-resizable-autohide");b._handles.show()},function(){if(!b.resizing){e(this).addClass("ui-resizable-autohide");b._handles.hide()}})}this._mouseInit()},destroy:function(){this._mouseDestroy();var b=function(c){e(c).removeClass("ui-resizable ui-resizable-disabled ui-resizable-resizing").removeData("resizable").unbind(".resizable").find(".ui-resizable-handle").remove()};
+if(this.elementIsWrapper){b(this.element);var a=this.element;a.after(this.originalElement.css({position:a.css("position"),width:a.outerWidth(),height:a.outerHeight(),top:a.css("top"),left:a.css("left")})).remove()}this.originalElement.css("resize",this.originalResizeStyle);b(this.originalElement);return this},_mouseCapture:function(b){var a=false;for(var c in this.handles)if(e(this.handles[c])[0]==b.target)a=true;return!this.options.disabled&&a},_mouseStart:function(b){var a=this.options,c=this.element.position(),
+d=this.element;this.resizing=true;this.documentScroll={top:e(document).scrollTop(),left:e(document).scrollLeft()};if(d.is(".ui-draggable")||/absolute/.test(d.css("position")))d.css({position:"absolute",top:c.top,left:c.left});e.browser.opera&&/relative/.test(d.css("position"))&&d.css({position:"relative",top:"auto",left:"auto"});this._renderProxy();c=m(this.helper.css("left"));var f=m(this.helper.css("top"));if(a.containment){c+=e(a.containment).scrollLeft()||0;f+=e(a.containment).scrollTop()||0}this.offset=
+this.helper.offset();this.position={left:c,top:f};this.size=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalSize=this._helper?{width:d.outerWidth(),height:d.outerHeight()}:{width:d.width(),height:d.height()};this.originalPosition={left:c,top:f};this.sizeDiff={width:d.outerWidth()-d.width(),height:d.outerHeight()-d.height()};this.originalMousePosition={left:b.pageX,top:b.pageY};this.aspectRatio=typeof a.aspectRatio=="number"?a.aspectRatio:
+this.originalSize.width/this.originalSize.height||1;a=e(".ui-resizable-"+this.axis).css("cursor");e("body").css("cursor",a=="auto"?this.axis+"-resize":a);d.addClass("ui-resizable-resizing");this._propagate("start",b);return true},_mouseDrag:function(b){var a=this.helper,c=this.originalMousePosition,d=this._change[this.axis];if(!d)return false;c=d.apply(this,[b,b.pageX-c.left||0,b.pageY-c.top||0]);if(this._aspectRatio||b.shiftKey)c=this._updateRatio(c,b);c=this._respectSize(c,b);this._propagate("resize",
+b);a.css({top:this.position.top+"px",left:this.position.left+"px",width:this.size.width+"px",height:this.size.height+"px"});!this._helper&&this._proportionallyResizeElements.length&&this._proportionallyResize();this._updateCache(c);this._trigger("resize",b,this.ui());return false},_mouseStop:function(b){this.resizing=false;var a=this.options,c=this;if(this._helper){var d=this._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName);d=f&&e.ui.hasScroll(d[0],"left")?0:c.sizeDiff.height;
+f=f?0:c.sizeDiff.width;f={width:c.helper.width()-f,height:c.helper.height()-d};d=parseInt(c.element.css("left"),10)+(c.position.left-c.originalPosition.left)||null;var g=parseInt(c.element.css("top"),10)+(c.position.top-c.originalPosition.top)||null;a.animate||this.element.css(e.extend(f,{top:g,left:d}));c.helper.height(c.size.height);c.helper.width(c.size.width);this._helper&&!a.animate&&this._proportionallyResize()}e("body").css("cursor","auto");this.element.removeClass("ui-resizable-resizing");
+this._propagate("stop",b);this._helper&&this.helper.remove();return false},_updateCache:function(b){this.offset=this.helper.offset();if(l(b.left))this.position.left=b.left;if(l(b.top))this.position.top=b.top;if(l(b.height))this.size.height=b.height;if(l(b.width))this.size.width=b.width},_updateRatio:function(b){var a=this.position,c=this.size,d=this.axis;if(b.height)b.width=c.height*this.aspectRatio;else if(b.width)b.height=c.width/this.aspectRatio;if(d=="sw"){b.left=a.left+(c.width-b.width);b.top=
+null}if(d=="nw"){b.top=a.top+(c.height-b.height);b.left=a.left+(c.width-b.width)}return b},_respectSize:function(b){var a=this.options,c=this.axis,d=l(b.width)&&a.maxWidth&&a.maxWidthb.width,h=l(b.height)&&a.minHeight&&a.minHeight>b.height;if(g)b.width=a.minWidth;if(h)b.height=a.minHeight;if(d)b.width=a.maxWidth;if(f)b.height=a.maxHeight;var i=this.originalPosition.left+this.originalSize.width,j=this.position.top+
+this.size.height,k=/sw|nw|w/.test(c);c=/nw|ne|n/.test(c);if(g&&k)b.left=i-a.minWidth;if(d&&k)b.left=i-a.maxWidth;if(h&&c)b.top=j-a.minHeight;if(f&&c)b.top=j-a.maxHeight;if((a=!b.width&&!b.height)&&!b.left&&b.top)b.top=null;else if(a&&!b.top&&b.left)b.left=null;return b},_proportionallyResize:function(){if(this._proportionallyResizeElements.length)for(var b=this.helper||this.element,a=0;a');var a=e.browser.msie&&e.browser.version<7,c=a?1:0;a=a?2:-1;this.helper.addClass(this._helper).css({width:this.element.outerWidth()+a,height:this.element.outerHeight()+a,position:"absolute",left:this.elementOffset.left-c+"px",top:this.elementOffset.top-c+"px",zIndex:++b.zIndex});this.helper.appendTo("body").disableSelection()}else this.helper=this.element},_change:{e:function(b,
+a){return{width:this.originalSize.width+a}},w:function(b,a){return{left:this.originalPosition.left+a,width:this.originalSize.width-a}},n:function(b,a,c){return{top:this.originalPosition.top+c,height:this.originalSize.height-c}},s:function(b,a,c){return{height:this.originalSize.height+c}},se:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},sw:function(b,a,c){return e.extend(this._change.s.apply(this,arguments),this._change.w.apply(this,[b,a,
+c]))},ne:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.e.apply(this,[b,a,c]))},nw:function(b,a,c){return e.extend(this._change.n.apply(this,arguments),this._change.w.apply(this,[b,a,c]))}},_propagate:function(b,a){e.ui.plugin.call(this,b,[a,this.ui()]);b!="resize"&&this._trigger(b,a,this.ui())},plugins:{},ui:function(){return{originalElement:this.originalElement,element:this.element,helper:this.helper,position:this.position,size:this.size,originalSize:this.originalSize,
+originalPosition:this.originalPosition}}});e.extend(e.ui.resizable,{version:"1.8.10"});e.ui.plugin.add("resizable","alsoResize",{start:function(){var b=e(this).data("resizable").options,a=function(c){e(c).each(function(){var d=e(this);d.data("resizable-alsoresize",{width:parseInt(d.width(),10),height:parseInt(d.height(),10),left:parseInt(d.css("left"),10),top:parseInt(d.css("top"),10),position:d.css("position")})})};if(typeof b.alsoResize=="object"&&!b.alsoResize.parentNode)if(b.alsoResize.length){b.alsoResize=
+b.alsoResize[0];a(b.alsoResize)}else e.each(b.alsoResize,function(c){a(c)});else a(b.alsoResize)},resize:function(b,a){var c=e(this).data("resizable");b=c.options;var d=c.originalSize,f=c.originalPosition,g={height:c.size.height-d.height||0,width:c.size.width-d.width||0,top:c.position.top-f.top||0,left:c.position.left-f.left||0},h=function(i,j){e(i).each(function(){var k=e(this),q=e(this).data("resizable-alsoresize"),p={},r=j&&j.length?j:k.parents(a.originalElement[0]).length?["width","height"]:["width",
+"height","top","left"];e.each(r,function(n,o){if((n=(q[o]||0)+(g[o]||0))&&n>=0)p[o]=n||null});if(e.browser.opera&&/relative/.test(k.css("position"))){c._revertToRelativePosition=true;k.css({position:"absolute",top:"auto",left:"auto"})}k.css(p)})};typeof b.alsoResize=="object"&&!b.alsoResize.nodeType?e.each(b.alsoResize,function(i,j){h(i,j)}):h(b.alsoResize)},stop:function(){var b=e(this).data("resizable"),a=b.options,c=function(d){e(d).each(function(){var f=e(this);f.css({position:f.data("resizable-alsoresize").position})})};
+if(b._revertToRelativePosition){b._revertToRelativePosition=false;typeof a.alsoResize=="object"&&!a.alsoResize.nodeType?e.each(a.alsoResize,function(d){c(d)}):c(a.alsoResize)}e(this).removeData("resizable-alsoresize")}});e.ui.plugin.add("resizable","animate",{stop:function(b){var a=e(this).data("resizable"),c=a.options,d=a._proportionallyResizeElements,f=d.length&&/textarea/i.test(d[0].nodeName),g=f&&e.ui.hasScroll(d[0],"left")?0:a.sizeDiff.height;f={width:a.size.width-(f?0:a.sizeDiff.width),height:a.size.height-
+g};g=parseInt(a.element.css("left"),10)+(a.position.left-a.originalPosition.left)||null;var h=parseInt(a.element.css("top"),10)+(a.position.top-a.originalPosition.top)||null;a.element.animate(e.extend(f,h&&g?{top:h,left:g}:{}),{duration:c.animateDuration,easing:c.animateEasing,step:function(){var i={width:parseInt(a.element.css("width"),10),height:parseInt(a.element.css("height"),10),top:parseInt(a.element.css("top"),10),left:parseInt(a.element.css("left"),10)};d&&d.length&&e(d[0]).css({width:i.width,
+height:i.height});a._updateCache(i);a._propagate("resize",b)}})}});e.ui.plugin.add("resizable","containment",{start:function(){var b=e(this).data("resizable"),a=b.element,c=b.options.containment;if(a=c instanceof e?c.get(0):/parent/.test(c)?a.parent().get(0):c){b.containerElement=e(a);if(/document/.test(c)||c==document){b.containerOffset={left:0,top:0};b.containerPosition={left:0,top:0};b.parentData={element:e(document),left:0,top:0,width:e(document).width(),height:e(document).height()||document.body.parentNode.scrollHeight}}else{var d=
+e(a),f=[];e(["Top","Right","Left","Bottom"]).each(function(i,j){f[i]=m(d.css("padding"+j))});b.containerOffset=d.offset();b.containerPosition=d.position();b.containerSize={height:d.innerHeight()-f[3],width:d.innerWidth()-f[1]};c=b.containerOffset;var g=b.containerSize.height,h=b.containerSize.width;h=e.ui.hasScroll(a,"left")?a.scrollWidth:h;g=e.ui.hasScroll(a)?a.scrollHeight:g;b.parentData={element:a,left:c.left,top:c.top,width:h,height:g}}}},resize:function(b){var a=e(this).data("resizable"),c=a.options,
+d=a.containerOffset,f=a.position;b=a._aspectRatio||b.shiftKey;var g={top:0,left:0},h=a.containerElement;if(h[0]!=document&&/static/.test(h.css("position")))g=d;if(f.left<(a._helper?d.left:0)){a.size.width+=a._helper?a.position.left-d.left:a.position.left-g.left;if(b)a.size.height=a.size.width/c.aspectRatio;a.position.left=c.helper?d.left:0}if(f.top<(a._helper?d.top:0)){a.size.height+=a._helper?a.position.top-d.top:a.position.top;if(b)a.size.width=a.size.height*c.aspectRatio;a.position.top=a._helper?
+d.top:0}a.offset.left=a.parentData.left+a.position.left;a.offset.top=a.parentData.top+a.position.top;c=Math.abs((a._helper?a.offset.left-g.left:a.offset.left-g.left)+a.sizeDiff.width);d=Math.abs((a._helper?a.offset.top-g.top:a.offset.top-d.top)+a.sizeDiff.height);f=a.containerElement.get(0)==a.element.parent().get(0);g=/relative|absolute/.test(a.containerElement.css("position"));if(f&&g)c-=a.parentData.left;if(c+a.size.width>=a.parentData.width){a.size.width=a.parentData.width-c;if(b)a.size.height=
+a.size.width/a.aspectRatio}if(d+a.size.height>=a.parentData.height){a.size.height=a.parentData.height-d;if(b)a.size.width=a.size.height*a.aspectRatio}},stop:function(){var b=e(this).data("resizable"),a=b.options,c=b.containerOffset,d=b.containerPosition,f=b.containerElement,g=e(b.helper),h=g.offset(),i=g.outerWidth()-b.sizeDiff.width;g=g.outerHeight()-b.sizeDiff.height;b._helper&&!a.animate&&/relative/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g});b._helper&&!a.animate&&
+/static/.test(f.css("position"))&&e(this).css({left:h.left-d.left-c.left,width:i,height:g})}});e.ui.plugin.add("resizable","ghost",{start:function(){var b=e(this).data("resizable"),a=b.options,c=b.size;b.ghost=b.originalElement.clone();b.ghost.css({opacity:0.25,display:"block",position:"relative",height:c.height,width:c.width,margin:0,left:0,top:0}).addClass("ui-resizable-ghost").addClass(typeof a.ghost=="string"?a.ghost:"");b.ghost.appendTo(b.helper)},resize:function(){var b=e(this).data("resizable");
+b.ghost&&b.ghost.css({position:"relative",height:b.size.height,width:b.size.width})},stop:function(){var b=e(this).data("resizable");b.ghost&&b.helper&&b.helper.get(0).removeChild(b.ghost.get(0))}});e.ui.plugin.add("resizable","grid",{resize:function(){var b=e(this).data("resizable"),a=b.options,c=b.size,d=b.originalSize,f=b.originalPosition,g=b.axis;a.grid=typeof a.grid=="number"?[a.grid,a.grid]:a.grid;var h=Math.round((c.width-d.width)/(a.grid[0]||1))*(a.grid[0]||1);a=Math.round((c.height-d.height)/
+(a.grid[1]||1))*(a.grid[1]||1);if(/^(se|s|e)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else if(/^(ne)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}else{if(/^(sw)$/.test(g)){b.size.width=d.width+h;b.size.height=d.height+a}else{b.size.width=d.width+h;b.size.height=d.height+a;b.position.top=f.top-a}b.position.left=f.left-h}}});var m=function(b){return parseInt(b,10)||0},l=function(b){return!isNaN(parseInt(b,10))}})(jQuery);
+;/*
+ * jQuery UI Dialog 1.8.10
+ *
+ * Copyright 2011, AUTHORS.txt (http://jqueryui.com/about)
+ * Dual licensed under the MIT or GPL Version 2 licenses.
+ * http://jquery.org/license
+ *
+ * http://docs.jquery.com/UI/Dialog
+ *
+ * Depends:
+ * jquery.ui.core.js
+ * jquery.ui.widget.js
+ * jquery.ui.button.js
+ * jquery.ui.draggable.js
+ * jquery.ui.mouse.js
+ * jquery.ui.position.js
+ * jquery.ui.resizable.js
+ */
+(function(c,j){var k={buttons:true,height:true,maxHeight:true,maxWidth:true,minHeight:true,minWidth:true,width:true},l={maxHeight:true,maxWidth:true,minHeight:true,minWidth:true};c.widget("ui.dialog",{options:{autoOpen:true,buttons:{},closeOnEscape:true,closeText:"close",dialogClass:"",draggable:true,hide:null,height:"auto",maxHeight:false,maxWidth:false,minHeight:150,minWidth:150,modal:false,position:{my:"center",at:"center",collision:"fit",using:function(a){var b=c(this).css(a).offset().top;b<0&&
+c(this).css("top",a.top-b)}},resizable:true,show:null,stack:true,title:"",width:300,zIndex:1E3},_create:function(){this.originalTitle=this.element.attr("title");if(typeof this.originalTitle!=="string")this.originalTitle="";this.options.title=this.options.title||this.originalTitle;var a=this,b=a.options,d=b.title||" ",e=c.ui.dialog.getTitleId(a.element),g=(a.uiDialog=c("
")).appendTo(document.body).hide().addClass("ui-dialog ui-widget ui-widget-content ui-corner-all "+b.dialogClass).css({zIndex:b.zIndex}).attr("tabIndex",
+-1).css("outline",0).keydown(function(i){if(b.closeOnEscape&&i.keyCode&&i.keyCode===c.ui.keyCode.ESCAPE){a.close(i);i.preventDefault()}}).attr({role:"dialog","aria-labelledby":e}).mousedown(function(i){a.moveToTop(false,i)});a.element.show().removeAttr("title").addClass("ui-dialog-content ui-widget-content").appendTo(g);var f=(a.uiDialogTitlebar=c("
")).addClass("ui-dialog-titlebar ui-widget-header ui-corner-all ui-helper-clearfix").prependTo(g),h=c('
").addClass("ui-dialog-buttonpane ui-widget-content ui-helper-clearfix"),g=c("
").addClass("ui-dialog-buttonset").appendTo(e);b.uiDialog.find(".ui-dialog-buttonpane").remove();typeof a==="object"&&a!==null&&c.each(a,function(){return!(d=true)});if(d){c.each(a,function(f,
+h){h=c.isFunction(h)?{click:h,text:f}:h;f=c('").addClass("ui-widget-overlay")).appendTo(document.body).css({width:this.width(),
+height:this.height()});c.fn.bgiframe&&b.bgiframe();this.instances.push(b);return b},destroy:function(a){var b=c.inArray(a,this.instances);b!=-1&&this.oldInstances.push(this.instances.splice(b,1)[0]);this.instances.length===0&&c([document,window]).unbind(".dialog-overlay");a.remove();var d=0;c.each(this.instances,function(){d=Math.max(d,this.css("z-index"))});this.maxZ=d},height:function(){var a,b;if(c.browser.msie&&c.browser.version<7){a=Math.max(document.documentElement.scrollHeight,document.body.scrollHeight);
+b=Math.max(document.documentElement.offsetHeight,document.body.offsetHeight);return a").addClass("ui-effects-wrapper").css({fontSize:"100%",background:"transparent",
+border:"none",margin:0,padding:0});c.wrap(b);b=c.parent();if(c.css("position")=="static"){b.css({position:"relative"});c.css({position:"relative"})}else{f.extend(a,{position:c.css("position"),zIndex:c.css("z-index")});f.each(["top","left","bottom","right"],function(d,e){a[e]=c.css(e);if(isNaN(parseInt(a[e],10)))a[e]="auto"});c.css({position:"relative",top:0,left:0,right:"auto",bottom:"auto"})}return b.css(a).show()},removeWrapper:function(c){if(c.parent().is(".ui-effects-wrapper"))return c.parent().replaceWith(c);
+return c},setTransition:function(c,a,b,d){d=d||{};f.each(a,function(e,g){unit=c.cssUnit(g);if(unit[0]>0)d[g]=unit[0]*b+unit[1]});return d}});f.fn.extend({effect:function(c){var a=k.apply(this,arguments),b={options:a[1],duration:a[2],callback:a[3]};a=b.options.mode;var d=f.effects[c];if(f.fx.off||!d)return a?this[a](b.duration,b.callback):this.each(function(){b.callback&&b.callback.call(this)});return d.call(this,b)},_show:f.fn.show,show:function(c){if(m(c))return this._show.apply(this,arguments);
+else{var a=k.apply(this,arguments);a[1].mode="show";return this.effect.apply(this,a)}},_hide:f.fn.hide,hide:function(c){if(m(c))return this._hide.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="hide";return this.effect.apply(this,a)}},__toggle:f.fn.toggle,toggle:function(c){if(m(c)||typeof c==="boolean"||f.isFunction(c))return this.__toggle.apply(this,arguments);else{var a=k.apply(this,arguments);a[1].mode="toggle";return this.effect.apply(this,a)}},cssUnit:function(c){var a=this.css(c),
+b=[];f.each(["em","px","%","pt"],function(d,e){if(a.indexOf(e)>0)b=[parseFloat(a),e]});return b}});f.easing.jswing=f.easing.swing;f.extend(f.easing,{def:"easeOutQuad",swing:function(c,a,b,d,e){return f.easing[f.easing.def](c,a,b,d,e)},easeInQuad:function(c,a,b,d,e){return d*(a/=e)*a+b},easeOutQuad:function(c,a,b,d,e){return-d*(a/=e)*(a-2)+b},easeInOutQuad:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a+b;return-d/2*(--a*(a-2)-1)+b},easeInCubic:function(c,a,b,d,e){return d*(a/=e)*a*a+b},easeOutCubic:function(c,
+a,b,d,e){return d*((a=a/e-1)*a*a+1)+b},easeInOutCubic:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a+b;return d/2*((a-=2)*a*a+2)+b},easeInQuart:function(c,a,b,d,e){return d*(a/=e)*a*a*a+b},easeOutQuart:function(c,a,b,d,e){return-d*((a=a/e-1)*a*a*a-1)+b},easeInOutQuart:function(c,a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a+b;return-d/2*((a-=2)*a*a*a-2)+b},easeInQuint:function(c,a,b,d,e){return d*(a/=e)*a*a*a*a+b},easeOutQuint:function(c,a,b,d,e){return d*((a=a/e-1)*a*a*a*a+1)+b},easeInOutQuint:function(c,
+a,b,d,e){if((a/=e/2)<1)return d/2*a*a*a*a*a+b;return d/2*((a-=2)*a*a*a*a+2)+b},easeInSine:function(c,a,b,d,e){return-d*Math.cos(a/e*(Math.PI/2))+d+b},easeOutSine:function(c,a,b,d,e){return d*Math.sin(a/e*(Math.PI/2))+b},easeInOutSine:function(c,a,b,d,e){return-d/2*(Math.cos(Math.PI*a/e)-1)+b},easeInExpo:function(c,a,b,d,e){return a==0?b:d*Math.pow(2,10*(a/e-1))+b},easeOutExpo:function(c,a,b,d,e){return a==e?b+d:d*(-Math.pow(2,-10*a/e)+1)+b},easeInOutExpo:function(c,a,b,d,e){if(a==0)return b;if(a==
+e)return b+d;if((a/=e/2)<1)return d/2*Math.pow(2,10*(a-1))+b;return d/2*(-Math.pow(2,-10*--a)+2)+b},easeInCirc:function(c,a,b,d,e){return-d*(Math.sqrt(1-(a/=e)*a)-1)+b},easeOutCirc:function(c,a,b,d,e){return d*Math.sqrt(1-(a=a/e-1)*a)+b},easeInOutCirc:function(c,a,b,d,e){if((a/=e/2)<1)return-d/2*(Math.sqrt(1-a*a)-1)+b;return d/2*(Math.sqrt(1-(a-=2)*a)+1)+b},easeInElastic:function(c,a,b,d,e){c=1.70158;var g=0,h=d;if(a==0)return b;if((a/=e)==1)return b+d;g||(g=e*0.3);if(h= 5 &&
+ location.href.indexOf('file://') >= 0;
+ }
+
+ var safariRegex = /Safari\/([0-9]+)/g;
+ var safariMatch = safariRegex.exec(useragent);
+ SAFARI = Boolean(safariMatch) && !CHROME; //because chrome also inserts safari string into user agent
+
+ var webkitRegex = /WebKit\//g ;
+ WEBKIT = Boolean(webkitRegex.exec(useragent));
+
+ FIREFOX = useragent.toLowerCase().indexOf('firefox') > -1;
+
+ var macRegex = /Mac/g ;
+ OS_MAC = Boolean(macRegex.exec(window.navigator.platform));
+
+ IOS = useragent.match(/iPhone/i) || useragent.match(/iPad/i) || useragent.match(/iPod/i);
+ ANDROID = useragent.match(/Android/i);
+
+ MOBILE_DEVICE = ANDROID || IOS
+ || navigator.userAgent.match(/webOS/i)
+ || navigator.userAgent.match(/BlackBerry/i)
+ || navigator.userAgent.match(/Tablet PC/i)
+ || navigator.userAgent.match(/Windows Phone/i);
+
+ if($.browser) {
+ if($.browser.msie) IE_10_AND_BELOW = true;
+ else IE_11_AND_ABOVE = useragent.toLowerCase().indexOf('trident') > -1;
+
+ BROWSER_VERSION = $.browser.version;
+ }
+
+ IE = IE_10_AND_BELOW || IE_11_AND_ABOVE;
+
+ //Used by sitemap and variables.js getLinkUrl functions so that they know
+ //whether to embed global variables in URL as query string or hash string
+ //_shouldSendVars persists the value for sitemap instead of re-checking every time
+ var _shouldSendVars;
+ var _shouldSendVarsToServer = function(url) {
+ if(typeof _shouldSendVars != 'undefined') {
+ return _shouldSendVars;
+ }
+
+ if(SAFARI || (IE_10_AND_BELOW && BROWSER_VERSION < 10)) {
+ var urlToCheck = typeof url != 'undefined' ? url : window.location.href;
+ var serverRegex = /http:\/\/127\.0\.0\.1:[0-9]{5}/g;
+ var serverMatch = serverRegex.exec(urlToCheck);
+ var previewRegex = /[0-9]{2}\.[0-9]{2}\.[0-9]{2}/g;
+ var previewMatch = previewRegex.exec(urlToCheck);
+ if(Boolean(serverMatch) && Boolean(previewMatch)) {
+ _shouldSendVars = true;
+ return _shouldSendVars;
+ }
+ }
+
+ _shouldSendVars = false;
+ return _shouldSendVars;
+ };
+ $axure.shouldSendVarsToServer = _shouldSendVarsToServer;
+})();
+
+(function() {
+ var _topMessageCenter;
+ var _messageCenter = {};
+ var _listeners = [];
+ var _stateListeners = [];
+ var _state = {};
+ var _eventObject = null;
+
+ var _queuedMessages = [];
+ var _initialized = false;
+
+ // this is for the non Chrome 5 local scenarios. The "top" message center will dispatch to all the bottom ones
+ var _childrenMessageCenters = [];
+
+ // create $axure if it hasn't been created
+ if (!window.$axure) window.$axure = function() {};
+ $axure.messageCenter = _messageCenter;
+
+ // isolate scope, and initialize _topMessageCenter.
+ (function() {
+ if (!CHROME_5_LOCAL) {
+ var topAxureWindow = window;
+ try {
+ while(topAxureWindow.parent && topAxureWindow.parent !== topAxureWindow
+ && topAxureWindow.parent.$axure) topAxureWindow = topAxureWindow.parent;
+ } catch(e) {}
+ _topMessageCenter = topAxureWindow.$axure.messageCenter;
+ }
+ })();
+
+ $(window.document).ready(function() {
+ if (CHROME_5_LOCAL) {
+ $('body').append("
" +
+ "
");
+
+ _eventObject = window.document.createEvent('Event');
+ _eventObject.initEvent('axureMessageSenderEvent', true, true);
+
+ $('#axureEventReceiverDiv').bind('axureMessageReceiverEvent', function () {
+ var request = JSON.parse($(this).text());
+ _handleRequest(request);
+ });
+ } else {
+ if (_topMessageCenter != _messageCenter) {
+ _topMessageCenter.addChildMessageCenter(_messageCenter);
+ console.log('adding from ' + window.location.toString());
+ }
+ }
+ });
+
+ var _handleRequest = function (request) {
+ // route the request to all the listeners
+ for(var i = 0; i < _listeners.length; i++) _listeners[i](request.message, request.data);
+
+ // now handle the queued messages if we're initializing
+ if (request.message == 'initialize') {
+ _initialized = true;
+ // send all the queued messages and return
+ for (var i = 0; i < _queuedMessages.length; i++) {
+ var qRequest = _queuedMessages[i];
+ _messageCenter.postMessage(qRequest.message, qRequest.data);
+ }
+ _queuedMessages = [];
+ }
+
+ // and then handle the set state messages, if necessary
+ if (request.message == 'setState') {
+ _state[request.data.key] = request.data.value;
+ for (var i = 0; i < _stateListeners.length; i++) {
+ var keyListener = _stateListeners[i];
+ // if thep passed a null or empty value, always post the message
+ if (!keyListener.key || keyListener.key == request.data.key) {
+ keyListener.listener(request.data.key, request.data.value);
+ }
+ }
+ }
+
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // This method allows for dispatching messages in the non-chromelocal scenario.
+ // Each child calls this on _topMessageCenter
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.addChildMessageCenter = function(messageCenter) {
+ _childrenMessageCenters[_childrenMessageCenters.length] = messageCenter;
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // This method allows for dispatching messages in the non-chromelocal scenario.
+ // Each child calls this on _topMessageCenter
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.dispatchMessage = function(message, data) {
+ _handleRequest({
+ message: message,
+ data: data
+ });
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.dispatchMessageRecursively = function(message, data) {
+ console.log("dispatched to " + window.location.toString());
+
+ // dispatch to the top center first
+ _messageCenter.dispatchMessage(message, data);
+
+ $('iframe').each(function(index, frame) {
+ //try,catch to handle permissions error in FF when loading pages from another domain
+ try {
+ if (frame.contentWindow.$axure && frame.contentWindow.$axure.messageCenter) {
+ frame.contentWindow.$axure.messageCenter.dispatchMessageRecursively(message, data);
+ }
+ }catch(e) {}
+ });
+ };
+
+ var _combineEventMessages = false;
+ var _compositeEventMessageData = [];
+ _messageCenter.startCombineEventMessages = function() {
+ _combineEventMessages = true;
+ }
+
+ _messageCenter.endCombineEventMessages = function () {
+ _messageCenter.sendCompositeEventMessage();
+ _combineEventMessages = false;
+ }
+
+ _messageCenter.sendCompositeEventMessage = function () {
+ _messageCenter.postMessage('axCompositeEventMessage', _compositeEventMessageData);
+ _compositeEventMessageData = [];
+ }
+
+ _messageCenter.postMessage = function (message, data) {
+ if(_combineEventMessages) {
+ if(message == 'axEvent' || message == 'axCase' || message == 'axAction' || message == 'axEventComplete') {
+ _compositeEventMessageData.push({ 'message': message, 'data': data });
+ if(_compositeEventMessageData.length >= 10) _messageCenter.sendCompositeEventMessage();
+ return;
+ }
+ }
+
+ if(!CHROME_5_LOCAL) {
+ _topMessageCenter.dispatchMessageRecursively(message, data);
+ } else {
+ var request = {
+ message: message,
+ data: data
+ };
+
+ if(_initialized) {
+ var senderDiv = window.document.getElementById('axureEventSenderDiv');
+ var messageText = JSON.stringify(request);
+ // console.log('sending event: ' + messageText);
+ senderDiv.innerText = messageText;
+ senderDiv.dispatchEvent(_eventObject);
+ // console.log('event sent');
+ } else {
+ _queuedMessages[_queuedMessages.length] = request;
+ }
+ }
+ };
+
+ _messageCenter.setState = function(key, value) {
+ var data = {
+ key: key,
+ value: value
+ };
+ _messageCenter.postMessage('setState', data);
+ };
+
+ _messageCenter.getState = function(key) {
+ return _state[key];
+ };
+
+ _messageCenter.addMessageListener = function(listener) {
+ _listeners[_listeners.length] = listener;
+ };
+
+ _messageCenter.addStateListener = function(key, listener) {
+ _stateListeners[_stateListeners.length] = {
+ key: key,
+ listener: listener
+ };
+ };
+
+})();
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/player/axplayer.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/player/axplayer.js
new file mode 100644
index 0000000..f9cb965
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/player/axplayer.js
@@ -0,0 +1,206 @@
+if (!window.$axure) window.$axure = function () { };
+if (typeof console == 'undefined') console = {
+ log: function () { }
+};
+if(window._axUtils) $axure.utils = _axUtils;
+
+$axure.loadDocument = function(document) {
+ $axure.document = document;
+};
+
+function setUpController() {
+
+ //$axure.utils = _axUtils;
+
+ var _page = {};
+ $axure.page = _page;
+
+ $axure.utils.makeBindable(_page, ['load']);
+
+ var _player = function() {
+ };
+ $axure.player = _player;
+
+ //-----------------------------------------
+ //Global Var array, getLinkUrl function and setGlobalVar listener are
+ //for use in setting global vars in page url string when clicking a
+ //page in the sitemap
+ //-----------------------------------------
+ var _globalVars = {};
+
+ //-----------------------------------------
+ //Used by getLinkUrl below to check if local server is running
+ //in order to send back the global variables as a query string
+ //in the page url
+ //-----------------------------------------
+ var _shouldSendVarsToServer = function () {
+ //If exception occurs (due to page in content frame being from a different domain, etc)
+ //then run the check without the url (which will end up checking against sitemap url)
+ try {
+ var mainFrame = document.getElementById("mainFrame");
+ return $axure.shouldSendVarsToServer(mainFrame.contentWindow.location.href);
+ } catch (e) {
+ return $axure.shouldSendVarsToServer();
+ }
+ };
+
+ var _getLinkUrl = function (baseUrl) {
+ var toAdd = '';
+ for(var globalVarName in _globalVars) {
+ var val = _globalVars[globalVarName];
+ if(val != null) {
+ if(toAdd.length > 0) toAdd += '&';
+ toAdd += globalVarName + '=' + encodeURIComponent(val);
+ }
+ }
+ return toAdd.length > 0 ? baseUrl + (_shouldSendVarsToServer() ? '?' : '#') + toAdd + "&CSUM=1" : baseUrl;
+ };
+ $axure.getLinkUrlWithVars = _getLinkUrl;
+
+ $axure.messageCenter.addMessageListener(function(message, data) {
+ if (message == 'setGlobalVar'){
+ _globalVars[data.globalVarName] = data.globalVarValue;
+ }
+ });
+
+ $axure.messageCenter.addStateListener('page.data', function (key, value) {
+ for (var subKey in value) {
+ _page[subKey] = value[subKey];
+ }
+ $axure.page.triggerEvent('load');
+ });
+
+ // ---------------------------------------------
+ // Navigates the main frame (setting the currently visible page). If the link is relative,
+ // this method should test if it is actually a axure rp page being loaded and properly set
+ // up all the controller for the page if it is
+ // ---------------------------------------------
+ _page.navigate = function (url, includeVariables) {
+ var mainFrame = document.getElementById("mainFrame");
+ //var mainFrame = window.parent.mainFrame;
+ // if this is a relative url...
+ var urlToLoad;
+ if (url.indexOf(':') < 0 || url[0] == '/') {
+ var winHref = window.location.href;
+ var page = winHref.substring(0, winHref.lastIndexOf('/') + 1) + url;
+ urlToLoad = page;
+ } else {
+ urlToLoad = url;
+ }
+ if (!includeVariables) {
+ mainFrame.contentWindow.location.href = urlToLoad;
+ return;
+ }
+ var urlWithVars = $axure.getLinkUrlWithVars(urlToLoad);
+ var currentData = $axure.messageCenter.getState('page.data');
+ var currentUrl = currentData && currentData.location;
+ if(currentUrl && currentUrl.indexOf('#') != -1) currentUrl = currentUrl.substring(0, currentUrl.indexOf('#'))
+
+ // this is so we can make sure the current frame reloads if the variables have changed
+ // by default, if the location is the same but the hash code is different, the browser will not
+ // trigger a reload
+ mainFrame.contentWindow.location.href =
+ currentUrl && urlToLoad.toLowerCase() != currentUrl.toLowerCase()
+ ? urlWithVars
+ : 'resources/reload.html#' + encodeURI(urlWithVars);
+
+ };
+
+ var pluginIds = [];
+ var plugins = {};
+ var currentVisibleHostId = null;
+ // ---------------------------------------------
+ // Adds a tool box frame from a url to the interface. This is useful for loading plugins
+ // settings is an object that supports the following properties:
+ // - id : the id of the element for the plugin
+ // - context : the context to create the plugin host for
+ // - title : the user-visible caption for the plugin
+ // ---------------------------------------------
+ _player.createPluginHost = function (settings) {
+ // right now we only understand an interface context
+ if (!(!settings.context || settings.context === 'interface')) {
+ throw ('unknown context type');
+ }
+ if (!settings.id) throw ('each plugin host needs an id');
+
+ var host = $('
')
+ .appendTo('#interfaceControlFrameHostContainer');
+
+ host.hide();
+
+ var headerLink = $('' + settings.title.toUpperCase() + ' ');
+
+ headerLink
+ .click($axure.utils.curry(interfaceControlHeaderButton_click, settings.id)).wrap('');
+
+ if((settings.id == 'feedbackHost' || settings.id == 'feedbackContainer') && pluginIds[pluginIds.length - 1] == 'debugHost') headerLink.parent().insertBefore('#debugHostBtn');
+ else headerLink.parent().appendTo('#interfaceControlFrameHeader');
+
+ pluginIds[pluginIds.length] = settings.id;
+ plugins[settings.id] = settings;
+
+ $(document).trigger('pluginCreated', [settings.gid]);
+ };
+
+ // private methods
+ var interfaceControlHeaderButton_click = function (id) {
+ var clickedPlugin = $('#interfaceControlFrameHeader a[pluginId=' + id + ']');
+ if(clickedPlugin.hasClass('selected')) {
+ clickedPlugin.removeClass('selected');
+ $('#' + id).hide();
+ _player.collapseToBar();
+
+ $(document).trigger('pluginShown',['']);
+ } else {
+ $('#interfaceControlFrameHeader a').removeClass('selected');
+ clickedPlugin.addClass('selected');
+
+ $('#' + currentVisibleHostId).hide();
+ $('#' + id).show();
+ currentVisibleHostId = id;
+ _player.expandFromBar();
+
+ $(document).trigger('pluginShown', [plugins[id].gid]);
+ }
+
+ $(document).trigger('ContainerHeightChange');
+ };
+
+ $axure.player.showPlugin = function(gid) {
+ for(var id in plugins) {
+ if(plugins[id].gid == gid) {
+ $('a[pluginId="' + id + '"]').click();
+ break;
+ }
+ }
+ };
+}
+
+function setUpDocumentStateManager() {
+ var mgr = $axure.prototype.documentStateManager = {};
+ $axure.utils.makeBindable(mgr, ['globalVariableChanged']);
+
+ mgr.globalVariableValues = {};
+
+ mgr.setGlobalVariable = function(varname, value, source) {
+ var arg = {};
+ arg.variableName = varname;
+ arg.newValue = value;
+ arg.oldValue = this.getGlobalVariable(varname);
+ arg.source = source;
+
+ mgr.globalVariableValues[varname] = value;
+ this.triggerEvent('globalVariableChanged', arg);
+ };
+
+ mgr.getGlobalVariable = function(varname) {
+ return mgr.globalVariableValues[varname];
+ };
+}
+
+
+function setUpPageStateManager() {
+ var mgr = $axure.prototype.pageStateManager = {};
+
+ mgr.panelToStateIds = {};
+}
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/player/splitter.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/player/splitter.js
new file mode 100644
index 0000000..9bda98a
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/player/splitter.js
@@ -0,0 +1,218 @@
+/*
+* jQuery.splitter.js - two-pane splitter window plugin
+*
+* version 1.51 (2009/01/09)
+*
+* Dual licensed under the MIT and GPL licenses:
+* http://www.opensource.org/licenses/mit-license.php
+* http://www.gnu.org/licenses/gpl.html
+*/
+
+/**
+* The splitter() plugin implements a two-pane resizable splitter window.
+* The selected elements in the jQuery object are converted to a splitter;
+* each selected element should have two child elements, used for the panes
+* of the splitter. The plugin adds a third child element for the splitbar.
+*
+* For more details see: http://methvin.com/splitter/
+*
+*
+* @example $('#MySplitter').splitter();
+* @desc Create a vertical splitter with default settings
+*
+* @example $('#MySplitter').splitter({type: 'h', accessKey: 'M'});
+* @desc Create a horizontal splitter resizable via Alt+Shift+M
+*
+* @name splitter
+* @type jQuery
+* @param Object options Options for the splitter (not required)
+* @cat Plugins/Splitter
+* @return jQuery
+* @author Dave Methvin (dave.methvin@gmail.com)
+*/
+;(function($){
+
+$.fn.splitter = function(args){
+ args = args || {};
+ return this.each(function() {
+ var zombie; // left-behind splitbar for outline resizes
+ function startSplitMouse(evt) {
+ if ( opts.outline )
+ zombie = zombie || bar.clone(false).insertAfter(A);
+ panes.css("-webkit-user-select", "none"); // Safari selects A/B text on a move
+ bar.addClass(opts.activeClass);
+ $('
').insertAfter(bar);
+ A._posSplit = A[0][opts.pxSplit] - evt[opts.eventPos];
+ $(document)
+ .bind("mousemove", doSplitMouse)
+ .bind("mouseup", endSplitMouse);
+ }
+ function doSplitMouse(evt) {
+ var newPos = A._posSplit+evt[opts.eventPos];
+ if ( opts.outline ) {
+ newPos = Math.max(0, Math.min(newPos, splitter._DA - bar._DA));
+ bar.css(opts.origin, newPos);
+ } else
+ resplit(newPos);
+ }
+ function endSplitMouse(evt) {
+ $('div.splitterMask').remove();
+ bar.removeClass(opts.activeClass);
+ var newPos = A._posSplit+evt[opts.eventPos];
+ if ( opts.outline ) {
+ zombie.remove(); zombie = null;
+ resplit(newPos);
+ }
+ panes.css("-webkit-user-select", "text"); // let Safari select text again
+ $(document)
+ .unbind("mousemove", doSplitMouse)
+ .unbind("mouseup", endSplitMouse);
+ }
+ function resplit(newPos) {
+ // Constrain new splitbar position to fit pane size limits
+ newPos = Math.max(A._min, splitter._DA - B._max,
+ Math.min(newPos, A._max, splitter._DA - bar._DA - B._min));
+ // Resize/position the two panes
+ bar._DA = bar[0][opts.pxSplit]; // bar size may change during dock
+
+ var posOffset = bar.is(':visible') ? bar._DA - 1 : 0;
+
+ bar.css(opts.origin, newPos - posOffset).css(opts.fixed, splitter._DF);
+ A.css(opts.origin, 0).css(opts.split, newPos).css(opts.fixed, splitter._DF);
+ B.css(opts.origin, newPos + bar._DA - posOffset)
+ .css(opts.split, splitter._DA-bar._DA-newPos).css(opts.fixed, splitter._DF);
+ // IE fires resize for us; all others pay cash
+ if ( !IE_10_AND_BELOW )
+ panes.trigger("resize");
+ }
+ function dimSum(jq, dims) {
+ // Opera returns -1 for missing min/max width, turn into 0
+ var sum = 0;
+ for ( var i=1; i < arguments.length; i++ )
+ sum += Math.max(parseInt(jq.css(arguments[i])) || 0, 0);
+ return sum;
+ }
+
+ // Determine settings based on incoming opts, element classes, and defaults
+ var vh = (args.splitHorizontal? 'h' : args.splitVertical? 'v' : args.type) || 'v';
+ var opts = $.extend({
+ activeClass: 'active', // class name for active splitter
+ pxPerKey: 8, // splitter px moved per keypress
+ tabIndex: 0, // tab order indicator
+ accessKey: '' // accessKey for splitbar
+ },{
+ v: { // Vertical splitters:
+ keyLeft: 39, keyRight: 37, cursor: "col-resize",
+ splitbarClass: "vsplitbar", outlineClass: "voutline",
+ type: 'v', eventPos: "pageX", origin: "left",
+ split: "width", pxSplit: "offsetWidth", side1: "Left", side2: "Right",
+ fixed: "height", pxFixed: "offsetHeight", side3: "Top", side4: "Bottom"
+ },
+ h: { // Horizontal splitters:
+ keyTop: 40, keyBottom: 38, cursor: "row-resize",
+ splitbarClass: "hsplitbar", outlineClass: "houtline",
+ type: 'h', eventPos: "pageY", origin: "top",
+ split: "height", pxSplit: "offsetHeight", side1: "Top", side2: "Bottom",
+ fixed: "width", pxFixed: "offsetWidth", side3: "Left", side4: "Right"
+ }
+ }[vh], args);
+
+ // Create jQuery object closures for splitter and both panes
+ var splitter = $(this).css({position: "relative"});
+ var panes = $(">*", splitter[0]).css({
+ position: "absolute", // positioned inside splitter container
+ "z-index": "1", // splitbar is positioned above
+ "-moz-outline-style": "none" // don't show dotted outline
+ });
+ var A = $(panes[0]); // left or top
+ var B = $(panes[1]); // right or bottom
+
+ // Focuser element, provides keyboard support; title is shown by Opera accessKeys
+ var focuser = $('
')
+ .insertAfter(A).css("z-index", "100").append(focuser)
+ .attr({"class": opts.splitbarClass, unselectable: "on"})
+ .css({position: "absolute", "user-select": "none", "-webkit-user-select": "none",
+ "-khtml-user-select": "none", "-moz-user-select": "none", "top": "0px"})
+ .bind("mousedown", startSplitMouse);
+ // Use our cursor unless the style specifies a non-default cursor
+ if ( /^(auto|default|)$/.test(bar.css("cursor")) )
+ bar.css("cursor", opts.cursor);
+
+ // Cache several dimensions for speed, rather than re-querying constantly
+ bar._DA = bar[0][opts.pxSplit];
+ splitter._PBF = $.boxModel? dimSum(splitter, "border"+opts.side3+"Width", "border"+opts.side4+"Width") : 0;
+ splitter._PBA = $.boxModel? dimSum(splitter, "border"+opts.side1+"Width", "border"+opts.side2+"Width") : 0;
+ A._pane = opts.side1;
+ B._pane = opts.side2;
+ $.each([A,B], function(){
+ this._min = opts["min"+this._pane] || dimSum(this, "min-"+opts.split);
+ this._max = opts["max"+this._pane] || dimSum(this, "max-"+opts.split) || 9999;
+ this._init = opts["size"+this._pane]===true ?
+ parseInt($.curCSS(this[0],opts.split)) : opts["size"+this._pane];
+ });
+
+ // Determine initial position, get from cookie if specified
+ var initPos = A._init;
+ if ( !isNaN(B._init) ) // recalc initial B size as an offset from the top or left side
+ initPos = splitter[0][opts.pxSplit] - splitter._PBA - B._init - bar._DA;
+ if ( opts.cookie ) {
+ if ( !$.cookie )
+ alert('jQuery.splitter(): jQuery cookie plugin required');
+ var ckpos = parseInt($.cookie(opts.cookie));
+ if ( !isNaN(ckpos) )
+ initPos = ckpos;
+ $(window).bind("unload", function(){
+ var state = String(bar.css(opts.origin)); // current location of splitbar
+ $.cookie(opts.cookie, state, {expires: opts.cookieExpires || 365,
+ path: opts.cookiePath || document.location.pathname});
+ });
+ }
+ if ( isNaN(initPos) ) // King Solomon's algorithm
+ initPos = Math.round((splitter[0][opts.pxSplit] - splitter._PBA - bar._DA)/2);
+
+ // Resize event propagation and splitter sizing
+ if ( opts.anchorToWindow ) {
+ // Account for margin or border on the splitter container and enforce min height
+ splitter._hadjust = dimSum(splitter, "borderTopWidth", "borderBottomWidth", "marginBottom");
+ splitter._hmin = Math.max(dimSum(splitter, "minHeight"), 20);
+ $(window).bind("resize", function(){
+ var top = splitter.offset().top;
+ var wh = $(window).height();
+ splitter.css("height", Math.max(wh-top-splitter._hadjust, splitter._hmin)+"px");
+ if ( !IE_10_AND_BELOW ) splitter.trigger("resize");
+ }).trigger("resize");
+ }
+ else if ( opts.resizeToWidth && !IE_10_AND_BELOW )
+ $(window).bind("resize", function(){
+ splitter.trigger("resize");
+ });
+
+ // Resize event handler; triggered immediately to set initial position
+ splitter.bind("resize", function(e, size){
+ // Custom events bubble in jQuery 1.3; don't Yo Dawg
+ if ( e.target != this ) return;
+ // Determine new width/height of splitter container
+ splitter._DF = splitter[0][opts.pxFixed] - splitter._PBF;
+ splitter._DA = splitter[0][opts.pxSplit] - splitter._PBA;
+ // Bail if splitter isn't visible or content isn't there yet
+ if ( splitter._DF <= 0 || splitter._DA <= 0 ) return;
+ // Re-divvy the adjustable dimension; maintain size of the preferred pane
+ resplit(!isNaN(size)? size : (!(opts.sizeRight||opts.sizeBottom)? A[0][opts.pxSplit] :
+ splitter._DA-B[0][opts.pxSplit]-bar._DA));
+ }).trigger("resize" , [initPos]);
+ });
+};
+
+})(jQuery);
\ No newline at end of file
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/prototypePost.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/prototypePost.js
new file mode 100644
index 0000000..f91eae7
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/prototypePost.js
@@ -0,0 +1,13176 @@
+// 8.0.0.3355. Generated 8/24/2017 4:38:58 AM UTC
+
+//***** messagecenter.js *****//
+if (typeof console == 'undefined') console = {
+ log: function () { }
+};
+
+// sniff chrome
+var CHROME_5_LOCAL = false;
+var CHROME = false;
+var SAFARI = false;
+var FIREFOX = false;
+var WEBKIT = false;
+var OS_MAC = false;
+var IOS = false;
+var ANDROID = false;
+var MOBILE_DEVICE = false;
+
+var IE = false;
+var IE_10_AND_BELOW = false; //ie 10 and lower
+var IE_11_AND_ABOVE = false; //ie 11 and above
+var BROWSER_VERSION = 5000;
+(function () {
+ if(!window.$axure) window.$axure = function() {};
+ var useragent = window.navigator.userAgent;
+
+ var edgeRegex = /Edge\/([0-9]+)/g;
+ var edgeMatch = edgeRegex.exec(useragent);
+ $axure.browser = { isEdge: Boolean(edgeMatch) };
+
+ if(!$axure.browser.isEdge) {
+ var chromeRegex = /Chrome\/([0-9]+).([0-9]+)/g;
+ var chromeMatch = chromeRegex.exec(useragent);
+ CHROME = Boolean(chromeMatch);
+ CHROME_5_LOCAL = chromeMatch &&
+ Number(chromeMatch[1]) >= 5 &&
+ location.href.indexOf('file://') >= 0;
+ }
+
+ var safariRegex = /Safari\/([0-9]+)/g;
+ var safariMatch = safariRegex.exec(useragent);
+ SAFARI = Boolean(safariMatch) && !CHROME; //because chrome also inserts safari string into user agent
+
+ var webkitRegex = /WebKit\//g ;
+ WEBKIT = Boolean(webkitRegex.exec(useragent));
+
+ FIREFOX = useragent.toLowerCase().indexOf('firefox') > -1;
+
+ var macRegex = /Mac/g ;
+ OS_MAC = Boolean(macRegex.exec(window.navigator.platform));
+
+ IOS = useragent.match(/iPhone/i) || useragent.match(/iPad/i) || useragent.match(/iPod/i);
+ ANDROID = useragent.match(/Android/i);
+
+ MOBILE_DEVICE = ANDROID || IOS
+ || navigator.userAgent.match(/webOS/i)
+ || navigator.userAgent.match(/BlackBerry/i)
+ || navigator.userAgent.match(/Tablet PC/i)
+ || navigator.userAgent.match(/Windows Phone/i);
+
+ if($.browser) {
+ if($.browser.msie) IE_10_AND_BELOW = true;
+ else IE_11_AND_ABOVE = useragent.toLowerCase().indexOf('trident') > -1;
+
+ BROWSER_VERSION = $.browser.version;
+ }
+
+ IE = IE_10_AND_BELOW || IE_11_AND_ABOVE;
+
+ //Used by sitemap and variables.js getLinkUrl functions so that they know
+ //whether to embed global variables in URL as query string or hash string
+ //_shouldSendVars persists the value for sitemap instead of re-checking every time
+ var _shouldSendVars;
+ var _shouldSendVarsToServer = function(url) {
+ if(typeof _shouldSendVars != 'undefined') {
+ return _shouldSendVars;
+ }
+
+ if(SAFARI || (IE_10_AND_BELOW && BROWSER_VERSION < 10)) {
+ var urlToCheck = typeof url != 'undefined' ? url : window.location.href;
+ var serverRegex = /http:\/\/127\.0\.0\.1:[0-9]{5}/g;
+ var serverMatch = serverRegex.exec(urlToCheck);
+ var previewRegex = /[0-9]{2}\.[0-9]{2}\.[0-9]{2}/g;
+ var previewMatch = previewRegex.exec(urlToCheck);
+ if(Boolean(serverMatch) && Boolean(previewMatch)) {
+ _shouldSendVars = true;
+ return _shouldSendVars;
+ }
+ }
+
+ _shouldSendVars = false;
+ return _shouldSendVars;
+ };
+ $axure.shouldSendVarsToServer = _shouldSendVarsToServer;
+})();
+
+(function() {
+ var _topMessageCenter;
+ var _messageCenter = {};
+ var _listeners = [];
+ var _stateListeners = [];
+ var _state = {};
+ var _eventObject = null;
+
+ var _queuedMessages = [];
+ var _initialized = false;
+
+ // this is for the non Chrome 5 local scenarios. The "top" message center will dispatch to all the bottom ones
+ var _childrenMessageCenters = [];
+
+ // create $axure if it hasn't been created
+ if (!window.$axure) window.$axure = function() {};
+ $axure.messageCenter = _messageCenter;
+
+ // isolate scope, and initialize _topMessageCenter.
+ (function() {
+ if (!CHROME_5_LOCAL) {
+ var topAxureWindow = window;
+ try {
+ while(topAxureWindow.parent && topAxureWindow.parent !== topAxureWindow
+ && topAxureWindow.parent.$axure) topAxureWindow = topAxureWindow.parent;
+ } catch(e) {}
+ _topMessageCenter = topAxureWindow.$axure.messageCenter;
+ }
+ })();
+
+ $(window.document).ready(function() {
+ if (CHROME_5_LOCAL) {
+ $('body').append("
" +
+ "
");
+
+ _eventObject = window.document.createEvent('Event');
+ _eventObject.initEvent('axureMessageSenderEvent', true, true);
+
+ $('#axureEventReceiverDiv').bind('axureMessageReceiverEvent', function () {
+ var request = JSON.parse($(this).text());
+ _handleRequest(request);
+ });
+ } else {
+ if (_topMessageCenter != _messageCenter) {
+ _topMessageCenter.addChildMessageCenter(_messageCenter);
+ console.log('adding from ' + window.location.toString());
+ }
+ }
+ });
+
+ var _handleRequest = function (request) {
+ // route the request to all the listeners
+ for(var i = 0; i < _listeners.length; i++) _listeners[i](request.message, request.data);
+
+ // now handle the queued messages if we're initializing
+ if (request.message == 'initialize') {
+ _initialized = true;
+ // send all the queued messages and return
+ for (var i = 0; i < _queuedMessages.length; i++) {
+ var qRequest = _queuedMessages[i];
+ _messageCenter.postMessage(qRequest.message, qRequest.data);
+ }
+ _queuedMessages = [];
+ }
+
+ // and then handle the set state messages, if necessary
+ if (request.message == 'setState') {
+ _state[request.data.key] = request.data.value;
+ for (var i = 0; i < _stateListeners.length; i++) {
+ var keyListener = _stateListeners[i];
+ // if thep passed a null or empty value, always post the message
+ if (!keyListener.key || keyListener.key == request.data.key) {
+ keyListener.listener(request.data.key, request.data.value);
+ }
+ }
+ }
+
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // This method allows for dispatching messages in the non-chromelocal scenario.
+ // Each child calls this on _topMessageCenter
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.addChildMessageCenter = function(messageCenter) {
+ _childrenMessageCenters[_childrenMessageCenters.length] = messageCenter;
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // This method allows for dispatching messages in the non-chromelocal scenario.
+ // Each child calls this on _topMessageCenter
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.dispatchMessage = function(message, data) {
+ _handleRequest({
+ message: message,
+ data: data
+ });
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.dispatchMessageRecursively = function(message, data) {
+ console.log("dispatched to " + window.location.toString());
+
+ // dispatch to the top center first
+ _messageCenter.dispatchMessage(message, data);
+
+ $('iframe').each(function(index, frame) {
+ //try,catch to handle permissions error in FF when loading pages from another domain
+ try {
+ if (frame.contentWindow.$axure && frame.contentWindow.$axure.messageCenter) {
+ frame.contentWindow.$axure.messageCenter.dispatchMessageRecursively(message, data);
+ }
+ }catch(e) {}
+ });
+ };
+
+ var _combineEventMessages = false;
+ var _compositeEventMessageData = [];
+ _messageCenter.startCombineEventMessages = function() {
+ _combineEventMessages = true;
+ }
+
+ _messageCenter.endCombineEventMessages = function () {
+ _messageCenter.sendCompositeEventMessage();
+ _combineEventMessages = false;
+ }
+
+ _messageCenter.sendCompositeEventMessage = function () {
+ _messageCenter.postMessage('axCompositeEventMessage', _compositeEventMessageData);
+ _compositeEventMessageData = [];
+ }
+
+ _messageCenter.postMessage = function (message, data) {
+ if(_combineEventMessages) {
+ if(message == 'axEvent' || message == 'axCase' || message == 'axAction' || message == 'axEventComplete') {
+ _compositeEventMessageData.push({ 'message': message, 'data': data });
+ if(_compositeEventMessageData.length >= 10) _messageCenter.sendCompositeEventMessage();
+ return;
+ }
+ }
+
+ if(!CHROME_5_LOCAL) {
+ _topMessageCenter.dispatchMessageRecursively(message, data);
+ } else {
+ var request = {
+ message: message,
+ data: data
+ };
+
+ if(_initialized) {
+ var senderDiv = window.document.getElementById('axureEventSenderDiv');
+ var messageText = JSON.stringify(request);
+ // console.log('sending event: ' + messageText);
+ senderDiv.innerText = messageText;
+ senderDiv.dispatchEvent(_eventObject);
+ // console.log('event sent');
+ } else {
+ _queuedMessages[_queuedMessages.length] = request;
+ }
+ }
+ };
+
+ _messageCenter.setState = function(key, value) {
+ var data = {
+ key: key,
+ value: value
+ };
+ _messageCenter.postMessage('setState', data);
+ };
+
+ _messageCenter.getState = function(key) {
+ return _state[key];
+ };
+
+ _messageCenter.addMessageListener = function(listener) {
+ _listeners[_listeners.length] = listener;
+ };
+
+ _messageCenter.addStateListener = function(key, listener) {
+ _stateListeners[_stateListeners.length] = {
+ key: key,
+ listener: listener
+ };
+ };
+
+})();
+
+//***** events.js *****//
+// ******* Features MANAGER ******** //
+
+$axure.internal(function($ax) {
+ var _features = $ax.features = {};
+ var _supports = _features.supports = {};
+ _supports.touchstart = typeof window.ontouchstart !== 'undefined';
+ _supports.touchmove = typeof window.ontouchmove !== 'undefined';
+ _supports.touchend = typeof window.ontouchend !== 'undefined';
+
+ _supports.mobile = _supports.touchstart && _supports.touchend && _supports.touchmove;
+ // Got this from http://stackoverflow.com/questions/11381673/javascript-solution-to-detect-mobile-browser
+ var check = navigator.userAgent.match(/Android/i)
+ || navigator.userAgent.match(/webOS/i)
+ || navigator.userAgent.match(/iPhone/i)
+ || navigator.userAgent.match(/iPad/i)
+ || navigator.userAgent.match(/iPod/i)
+ || navigator.userAgent.match(/BlackBerry/i)
+ || navigator.userAgent.match(/Tablet PC/i)
+ || navigator.userAgent.match(/Windows Phone/i);
+
+ _supports.windowsMobile = navigator.userAgent.match(/Tablet PC/i) || navigator.userAgent.match(/Windows Phone/i);
+
+ if(!check && _supports.mobile) {
+ _supports.touchstart = false;
+ _supports.touchmove = false;
+ _supports.touchend = false;
+ _supports.mobile = false;
+ }
+
+ var _eventNames = _features.eventNames = {};
+ _eventNames.mouseDownName = _supports.touchstart ? 'touchstart' : 'mousedown';
+ _eventNames.mouseUpName = _supports.touchend ? 'touchend' : 'mouseup';
+ _eventNames.mouseMoveName = _supports.touchmove ? 'touchmove' : 'mousemove';
+});
+
+// ******* EVENT MANAGER ******** //
+$axure.internal(function($ax) {
+ var _objectIdToEventHandlers = {};
+
+ var _jBrowserEvent = undefined;
+ $ax.setjBrowserEvent = function(event) {
+ _jBrowserEvent = event;
+ };
+
+ $ax.getjBrowserEvent = function() {
+ return _jBrowserEvent;
+ };
+
+ var _event = {};
+ $ax.event = _event;
+
+ //initilize state
+ _event.mouseOverObjectId = '';
+ _event.mouseDownObjectId = '';
+ _event.mouseOverIds = [];
+
+ var EVENT_NAMES = ['mouseenter', 'mouseleave', 'contextmenu', 'change', 'focus', 'blur'];
+
+
+ // Tap, double tap, and touch move, or synthetic.
+ if(!$ax.features.supports.mobile) {
+ EVENT_NAMES[EVENT_NAMES.length] = 'click';
+ EVENT_NAMES[EVENT_NAMES.length] = 'dblclick';
+ EVENT_NAMES[EVENT_NAMES.length] = 'mousemove';
+ }
+
+ // add the event names for the touch events
+ EVENT_NAMES[EVENT_NAMES.length] = $ax.features.eventNames.mouseDownName;
+ EVENT_NAMES[EVENT_NAMES.length] = $ax.features.eventNames.mouseUpName;
+
+ for(var i = 0; i < EVENT_NAMES.length; i++) {
+ var eventName = EVENT_NAMES[i];
+ //we need the function here to circumvent closure modifying eventName
+ _event[eventName] = (function(event_Name) {
+ return function(elementId, fn) {
+ var elementIdQuery = $jobj(elementId);
+ var type = $ax.getTypeFromElementId(elementId);
+
+ //we need specially track link events so we can enable and disable them along with
+ //their parent widgets
+ if(elementIdQuery.is('a')) _attachCustomObjectEvent(elementId, event_Name, fn);
+ //see notes below
+ else if($ax.IsTreeNodeObject(type)) _attachTreeNodeEvent(elementId, event_Name, fn);
+ else if ($ax.IsImageFocusable(type) && (event_Name == 'focus' || event_Name == 'blur')) {
+ var suitableChild;
+ var imgChild = $ax.repeater.applySuffixToElementId(elementId, '_img');
+ var divChild = $ax.repeater.applySuffixToElementId(elementId, '_div');
+
+ for (var j = 0; j < elementIdQuery[0].children.length; j++) {
+ if (elementIdQuery[0].children[j].id == imgChild) suitableChild = imgChild;
+ if (!suitableChild && elementIdQuery[0].children[j].id == divChild) suitableChild = divChild;
+ }
+ if(!suitableChild) suitableChild = imgChild;
+ _attachDefaultObjectEvent($jobj(suitableChild), elementId, event_Name, fn);
+ } else {
+ var inputId = $ax.INPUT(elementId);
+ var isInput = $jobj(inputId).length != 0;
+ var id = isInput && (event_Name == 'focus' || event_Name == 'blur') ? inputId : elementId;
+ _attachDefaultObjectEvent($jobj(id), elementId, event_Name, fn);
+ }
+ };
+ })(eventName);
+ }
+
+ var AXURE_TO_JQUERY_EVENT_NAMES = {
+ 'onMouseOver': 'mouseenter',
+ 'onMouseOut': 'mouseleave',
+ 'onContextMenu': 'contextmenu',
+ 'onChange': 'change',
+ 'onFocus': 'focus',
+ 'onLostFocus': 'blur'
+ };
+
+ // Tap, double tap, and touch move, or synthetic.
+ if(!$ax.features.supports.mobile) {
+ AXURE_TO_JQUERY_EVENT_NAMES.onClick = 'click';
+ AXURE_TO_JQUERY_EVENT_NAMES.onDoubleClick = 'dblclick';
+ AXURE_TO_JQUERY_EVENT_NAMES.onMouseMove = 'mousemove';
+ }
+
+ AXURE_TO_JQUERY_EVENT_NAMES.onMouseDown = $ax.features.eventNames.mouseDownName;
+ AXURE_TO_JQUERY_EVENT_NAMES.onMouseUp = $ax.features.eventNames.mouseUpName;
+ //for dp, if mouse entered without leaving, don't fire mouse enter again
+ var mouseEnterGuard = {};
+ var _attachEvents = function (diagramObject, elementId, doMouseEnterGuard) {
+
+ var inputId = $ax.repeater.applySuffixToElementId(elementId, '_input');
+ var id = $jobj(inputId).length ? inputId : elementId;
+
+ for(var eventName in diagramObject.interactionMap) {
+ var jQueryEventName = AXURE_TO_JQUERY_EVENT_NAMES[eventName];
+ if(!jQueryEventName) continue;
+
+ _event[jQueryEventName](id,
+ //this is needed to escape closure
+ (function(axEventObject) {
+ return function (e) {
+ if(e.type == 'mouseenter' && doMouseEnterGuard) {
+ if(mouseEnterGuard[elementId]) return;
+ else mouseEnterGuard[elementId] = true;
+ }
+
+ $ax.setjBrowserEvent(e);
+ // console.log(axEventObject.description);
+ var eventInfo = $ax.getEventInfoFromEvent($ax.getjBrowserEvent(), false, elementId);
+ _handleEvent(elementId, eventInfo, axEventObject);
+ };
+ })(diagramObject.interactionMap[eventName])
+ );
+
+ if(jQueryEventName.toLowerCase() == 'mouseenter' && doMouseEnterGuard) {
+ $jobj(elementId).on('mouseleave touchend', function() {
+ mouseEnterGuard[elementId] = false;
+ });
+ }
+ }
+
+ };
+
+ var _descriptionToKey = { 'OnFocus': 'onFocus', 'OnLostFocus': 'onLostFocus' };
+ var _createProxies = function(diagramObject, elementId) {
+ var createFocus = _needsProxy(diagramObject, elementId, 'onFocus');
+ var createLostFocus = _needsProxy(diagramObject, elementId, 'onLostFocus');
+
+ if(!createFocus && !createLostFocus) return;
+
+ if(!diagramObject.interactionMap) diagramObject.interactionMap = {};
+ if(createFocus) diagramObject.interactionMap.onFocus = { proxy: true, description: 'OnFocus' };
+ if(createLostFocus) diagramObject.interactionMap.onLostFocus = { proxy: true, description: 'OnLostFocus' };
+ }
+
+ var preventDefaultEvents = ['OnContextMenu', 'OnKeyUp', 'OnKeyDown'];
+ var allowBubble = ['OnFocus', 'OnResize', 'OnMouseOut', 'OnMouseOver'];
+
+ var _canClick = true;
+ var _startScroll = [];
+ var _setCanClick = function(canClick) {
+ _canClick = canClick;
+ if(_canClick) _startScroll = [$(window).scrollLeft(), $(window).scrollTop()];
+ };
+
+ var _getCanClick = function() {
+ if(!$ax.features.supports.mobile) return true;
+ var endScroll = [$(window).scrollLeft(), $(window).scrollTop()];
+ return _canClick && _startScroll[0] == endScroll[0] && _startScroll[1] == endScroll[1];
+ };
+
+ //var _notAllowedInvisible = function (type) {
+ // $ax.getTypeFromElementId(elementId);
+
+ // return !$ax.public.fn.IsReferenceDiagramObject(type) && !$ax.public.fn.IsLayer(type);
+ //}
+
+
+ var _notAllowedInvisible = function (id) {
+ var type = $ax.getTypeFromElementId(id);
+ if ($ax.public.fn.IsReferenceDiagramObject(type) || $ax.public.fn.IsLayer(type)) return false;
+ return !($ax.public.fn.IsVector(type) && _hasCompoundImage(id));
+ }
+
+ var _hasCompoundImage = function (id) {
+ var query = $jobj(id);
+ return $ax.public.fn.isCompoundVectorHtml(query[0]);
+ }
+
+ var _suppressedEvents = {}; // Suppressed for next occurance.
+ var _blockedEvents = {}; // Blocked until unblocked.
+ _event.addSuppressedEvent = function(id, event) {
+ if(!_suppressedEvents[id]) _suppressedEvents[id] = [];
+ var events = _suppressedEvents[id];
+ if(events.indexOf(event) != -1) return;
+ events.push(event);
+ }
+
+ _event.blockEvent = function(id, event) {
+ if(!_blockedEvents[id]) _blockedEvents[id] = {};
+ var events = _blockedEvents[id];
+ if(events[event]) ++events[event];
+ else events[event] = 1;
+ return function() { _unblockEvent(id, event); };
+ }
+
+ var _isSuppressedEvent = function(id, event) {
+ var suppressedEvents = _suppressedEvents[id];
+ var blockedEvents = _blockedEvents[id];
+ return (suppressedEvents && suppressedEvents.indexOf(event) != -1) || (blockedEvents && blockedEvents[event]);
+ }
+
+ var _removeSuppressedEvent = function(id, event) {
+ var events = _suppressedEvents[id];
+ if(!events) return;
+ if(events.length == 1) {
+ delete _suppressedEvents[id];
+ } else {
+ var eventIndex = events.indexOf(event);
+ for(var i = eventIndex + 1; i < events.length; i++) events[i - 1] = events[i];
+ events.pop();
+ }
+ }
+ var _unblockEvent = function(id, event) {
+ var events = _blockedEvents[id];
+ if(events) {
+ if(--events[event] > 0) return;
+ }
+ _removeSuppressedEvent(id, event);
+ }
+
+ var _unblockEvent = function(id, event) {
+ var events = _blockedEvents[id];
+ if(events) {
+ if(--events[event] > 0) return;
+ }
+ _removeSuppressedEvent(id, event);
+ }
+
+ var eventNesting = 0;
+ var eventNestingTime = new Date().getTime();
+
+ var _handleEvent = $ax.event.handleEvent = function (elementId, eventInfo, axEventObject, skipShowDescriptions, synthetic) {
+ var eventDescription = axEventObject.description;
+ if(_enteredWidgets[elementId] && eventDescription == 'OnMouseEnter') return; // Suppress entering a widget when already in widget (ie only)
+ if(_isSuppressedEvent(elementId, eventDescription)) {
+ _removeSuppressedEvent(elementId, eventDescription);
+ return;
+ }
+
+ if(axEventObject.proxy) {
+ var firingId = _widgetToFocusParent[elementId];
+ if(firingId) {
+ var firingObj = $obj(firingId);
+ var nextEventObj = firingObj.interactionMap && firingObj.interactionMap[_descriptionToKey[eventDescription]];
+ if(!nextEventObj) nextEventObj = axEventObject;
+ _handleEvent(firingId, eventInfo, nextEventObj, skipShowDescriptions, synthetic);
+ }
+ return;
+ }
+// var x = JSON.stringify(eventInfo);
+// var y = JSON.stringify(axEventObject);
+
+ var fireTime = new Date().getTime();
+
+ if(fireTime - eventNestingTime > 100) {
+ eventNestingTime = fireTime;
+ eventNesting = 0;
+ }
+
+ if(eventNesting === 0) {
+ $ax.recording.maybeRecordEvent(elementId, eventInfo, axEventObject, fireTime);
+ }
+
+ eventNesting += 1;
+
+ if(!_getCanClick() && (eventDescription == 'OnClick' || eventDescription == 'OnPageClick')) return;
+ // If you are supposed to suppress, do that right away.
+ if(suppressedEventStatus[eventDescription]) {
+ return;
+ }
+
+ var currentEvent = $ax.getjBrowserEvent();
+ if(!synthetic && currentEvent && currentEvent.originalEvent && currentEvent.originalEvent.handled && !eventInfo.isMasterEvent) return;
+ if(!synthetic && elementId && !$ax.style.getObjVisible(elementId) && _notAllowedInvisible(elementId)) return;
+
+ //if debug
+ var axObj = $obj(elementId);
+ var axObjLabel = axObj ? axObj.label : eventInfo.label;
+ var axObjType = axObj ? axObj.friendlyType : eventInfo.friendlyType;
+ if(!skipShowDescriptions || eventDescription == 'OnPageLoad') $ax.messageCenter.postMessage('axEvent', { 'label': axObjLabel, 'type': axObjType, 'event': axEventObject });
+
+ var bubble = true;
+ var showCaseDescriptions = !skipShowDescriptions && _shouldShowCaseDescriptions(axEventObject);
+ if(!showCaseDescriptions) {
+ //handle case descriptions
+ var caseGroups = [];
+ var currentCaseGroup = [];
+ caseGroups[0] = currentCaseGroup;
+
+ // Those refreshes not after a wait
+ var guaranteedRefreshes = {};
+
+ var caseGroupIndex = 0;
+ for(var i = 0; i < axEventObject.cases.length; i++) {
+ var currentCase = axEventObject.cases[i];
+ if(currentCase.isNewIfGroup && i != 0) {
+ caseGroupIndex++;
+ currentCaseGroup = [];
+ caseGroups[caseGroups.length] = currentCaseGroup;
+ // Joon: Isn't caseGroups.length always equal to caseGroupIndex?
+ }
+ currentCaseGroup[currentCaseGroup.length] = currentCase;
+
+ for(var j = 0; j < currentCase.actions.length; j++) {
+ var action = currentCase.actions[j];
+ if(action.action == 'wait') break;
+ if(action.action != 'refreshRepeater') continue;
+ for(var k = 0; k < action.repeatersToRefresh.length; k++) {
+ var id = $ax.getElementIdsFromPath(action.repeatersToRefresh[k], eventInfo)[0];
+ if(id) guaranteedRefreshes[id] = caseGroupIndex;
+ }
+ }
+ }
+
+ for(var i = 0; i < caseGroups.length; i++) {
+ var groupRefreshes = [];
+ for(var key in guaranteedRefreshes) {
+ if(guaranteedRefreshes[key] == i) groupRefreshes[groupRefreshes.length] = key;
+ }
+ bubble = _handleCaseGroup(eventInfo, caseGroups[i], groupRefreshes) && bubble;
+ }
+ } else {
+ _showCaseDescriptions(elementId, eventInfo, axEventObject, synthetic);
+ bubble = false;
+ }
+
+ // If not handled, synthetically bubble if you can
+ if(bubble && _widgetToFocusParent[elementId]) {
+ firingId = _widgetToFocusParent[elementId];
+ if(firingId) {
+ firingObj = $obj(firingId);
+ nextEventObj = firingObj.interactionMap && firingObj.interactionMap[_descriptionToKey[axEventObject.description]];
+ if(!nextEventObj) nextEventObj = axEventObject;
+ _handleEvent(firingId, eventInfo, nextEventObj, skipShowDescriptions, synthetic);
+ }
+ return;
+ }
+
+ // Only trigger a supression if it handled this event
+ if(!bubble && suppressingEvents[eventDescription]) {
+ suppressedEventStatus[suppressingEvents[eventDescription]] = true;
+ }
+
+ $ax.action.flushAllResizeMoveActions(eventInfo);
+
+ // This should not be needed anymore. All refreshes should be inserted, or handled earlier.
+ var repeaters = $ax.deepCopy($ax.action.repeatersToRefresh);
+ while($ax.action.repeatersToRefresh.length) $ax.action.repeatersToRefresh.pop();
+ for(i = 0; i < repeaters.length; i++) $ax.repeater.refreshRepeater(repeaters[i], eventInfo);
+
+ if(currentEvent && currentEvent.originalEvent) {
+ currentEvent.originalEvent.handled = !synthetic && !bubble && allowBubble.indexOf(eventDescription) == -1;
+ //currentEvent.originalEvent.donotdrag = currentEvent.donotdrag || (!bubble && eventDescription == 'OnMouseDown');
+
+ // Prevent default if necessary
+ if(currentEvent.originalEvent.handled && preventDefaultEvents.indexOf(eventDescription) != -1) {
+ currentEvent.preventDefault();
+ }
+ }
+
+ eventNesting -= 1;
+
+ if(!showCaseDescriptions) $ax.messageCenter.postMessage('axEventComplete');
+
+ };
+
+ var _handleScrollEvent = function (elementId, eventInfo, originalEvent, scrolledUp, scrolledDown, interactionMap, skipShowDescription, synthetic) {
+ if (!interactionMap) return;
+ if (interactionMap.onScroll) _handleEvent(elementId, eventInfo, interactionMap.onScroll, skipShowDescription, synthetic);
+
+ var wasHandled = originalEvent.handled;
+ if (interactionMap.onScrollUp && scrolledUp) {
+ originalEvent.handled = false;
+ _handleEvent(elementId, eventInfo, interactionMap.onScrollUp, skipShowDescription, synthetic);
+ } else if (interactionMap.onScrollDown && scrolledDown) {
+ originalEvent.handled = false;
+ _handleEvent(elementId, eventInfo, interactionMap.onScrollDown, skipShowDescription, synthetic);
+ }
+ originalEvent.handled |= wasHandled;
+ }
+
+ var _showCaseDescriptions = function(elementId, eventInfo, axEventObject, synthetic) {
+
+ if(axEventObject.cases.length == 0) return true;
+
+ var linksId = elementId + "linkBox";
+ $('#' + linksId).remove();
+
+ var $container = $("
");
+
+ if(!_isEventSimulating(axEventObject)) {
+ var copy = $ax.eventCopy(eventInfo);
+ for(var i = 0; i < axEventObject.cases.length; i++) {
+ var $link = $("" + axEventObject.cases[i].description + "
");
+ $link.click(function(j) {
+ return function () {
+ var currentCase = axEventObject.cases[j];
+ $ax.messageCenter.postMessage('axCase', { 'description': currentCase.description });
+ for(var k = 0; k < currentCase.actions.length; k++) {
+ $ax.messageCenter.postMessage('axAction', { 'description': currentCase.actions[k].description });
+ }
+ $ax.messageCenter.postMessage('axEventComplete');
+
+ var bubble = $ax.action.dispatchAction(copy, axEventObject.cases[j].actions);
+ $ax.action.flushAllResizeMoveActions(copy);
+ $('#' + linksId).remove();
+ return bubble;
+ };
+ } (i)
+ );
+
+ $container.append($link);
+ }
+ } else {
+ var fullDescription = axEventObject.description + ":" + fullDescription + "
");
+ $link.click(function() {
+ _handleEvent(elementId, eventInfo, axEventObject, true, synthetic);
+ $ax.messageCenter.postMessage('axEventComplete');
+ $('#' + linksId).remove();
+ return;
+ });
+ $container.append($link);
+ }
+ $container.mouseleave(function(e) { $ax.legacy.SuppressBubble(e); });
+ $('body').append($container);
+ _showCaseLinks(eventInfo, linksId);
+ };
+
+ var _showCaseLinks = function(eventInfo, linksId) {
+ var links = window.document.getElementById(linksId);
+
+ links.style.top = eventInfo.pageY;
+
+ var left = eventInfo.pageX;
+ links.style.left = left;
+ $ax.visibility.SetVisible(links, true);
+ $ax.legacy.BringToFront(linksId, true);
+ // Switch to using jquery if this is still needed. Really old legacy code, likely for a browser no longer supported.
+ //$ax.legacy.RefreshScreen();
+ };
+
+
+ var _shouldShowCaseDescriptions = function(axEventObject) {
+ if($ax.document.configuration.linkStyle == "alwaysDisplayTargets") return true;
+ if($ax.document.configuration.linkStyle == "neverDisplayTargets") return false;
+ if(axEventObject.cases.length == 0) return false;
+ if(_isEventSimulating(axEventObject)) return false;
+ if(axEventObject.cases.length >= 2) return true;
+ return false;
+ };
+
+ var _isEventSimulating = function(axEventObject) {
+ for(var i = 0; i < axEventObject.cases.length; i++) {
+ if(axEventObject.cases[i].condition) return true;
+ }
+ return false;
+ };
+
+ var _handleCaseGroup = function(eventInfo, caseGroup, groupRefreshes) {
+ for(var i = 0; i < caseGroup.length; i++) {
+ var currentCase = caseGroup[i];
+ if(!currentCase.condition || _processCondition(currentCase.condition, eventInfo)) {
+ $ax.messageCenter.postMessage('axCase', { 'description': currentCase.description });
+ for(var j = 0; j < currentCase.actions.length; j++) {
+ if(currentCase.actions[j].action != 'refreshRepeater') $ax.messageCenter.postMessage('axAction', { 'description': currentCase.actions[j].description });
+ }
+
+ for(var j = 0; j < currentCase.actions.length; j++) {
+ var action = currentCase.actions[j];
+ if(action.action == 'wait') break;
+ if(action.action != 'refreshRepeater') continue;
+ for(var k = 0; k < action.repeatersToRefresh.length; k++) {
+ var id = $ax.getElementIdsFromPath(action.repeatersToRefresh[i], eventInfo)[i];
+ if(id) {
+ var index = groupRefreshes.indexOf(id);
+ if(index != -1) $ax.splice(groupRefreshes, index);
+ }
+ }
+ }
+
+ // Any guaranteed refreshes that aren't accounted for must be run still.
+ $ax.action.tryRefreshRepeaters(groupRefreshes, eventInfo);
+
+ $ax.action.dispatchAction(eventInfo, currentCase.actions);
+ return false;
+ }
+ }
+
+ // Any guaranteed refreshes that aren't accounted for must be run still.
+ $ax.action.tryRefreshRepeaters(groupRefreshes, eventInfo);
+ return true;
+ };
+
+ var _processCondition = function(expr, eventInfo) {
+ return $ax.expr.evaluateExpr(expr, eventInfo);
+ };
+
+ var _attachTreeNodeEvent = function(elementId, eventName, fn) {
+ //we need to set the cursor here because we want to make sure that every tree node has the default
+ //cursor set and then it's overridden if it has a click
+ if(eventName == 'click') window.document.getElementById(elementId).style.cursor = 'pointer';
+
+ _attachCustomObjectEvent(elementId, eventName, fn);
+ };
+
+ var _attachDefaultObjectEvent = function(elementIdQuery, elementId, eventName, fn) {
+ var func = function() {
+ if(!$ax.style.IsWidgetDisabled(elementId)) return fn.apply(this, arguments);
+ return true;
+ };
+
+ var bind = !elementIdQuery[eventName];
+ if(bind) elementIdQuery.bind(eventName, func);
+ else elementIdQuery[eventName](func);
+ };
+
+ var _attachCustomObjectEvent = function(elementId, eventName, fn) {
+ var handlers = _objectIdToEventHandlers[elementId];
+ if(!handlers) _objectIdToEventHandlers[elementId] = handlers = {};
+
+ var fnList = handlers[eventName];
+ if(!fnList) handlers[eventName] = fnList = [];
+
+ fnList[fnList.length] = fn;
+ };
+
+ var _fireObjectEvent = function(elementId, event, originalArgs) {
+ var element = window.document.getElementById(elementId);
+
+ var handlerList = _objectIdToEventHandlers[elementId] && _objectIdToEventHandlers[elementId][event];
+ if(handlerList) {
+ for(var i = 0; i < handlerList.length; i++) handlerList[i].apply(element, originalArgs);
+ }
+
+ eventNesting -= 1;
+
+ };
+
+ var _layerToFocusableWidget = {};
+ var _widgetToFocusParent = {};
+ _event.layerMapFocus = function(layer, elementId) {
+ var mainObj = layer.objs[0];
+ // If first child non existant return
+ if (!mainObj) return;
+
+ var mainId = $ax.getElementIdFromPath([mainObj.id], { relativeTo: elementId });
+ _widgetToFocusParent[mainId] = elementId;
+
+ // If first child is a layer, call recursively
+ if ($ax.public.fn.IsLayer(mainObj.type)) {
+ _event.layerMapFocus(mainObj, mainId);
+ var baseId = _layerToFocusableWidget[mainId];
+ if(baseId) _layerToFocusableWidget[elementId] = baseId;
+ return;
+ }
+
+ _layerToFocusableWidget[elementId] = mainId;
+ }
+
+ var _needsProxy = function(obj, id, proxyName) {
+ // layers don't need on focus ever, proxies will handle them
+ if ($ax.public.fn.IsLayer(obj.type)) return false;
+ // If you already focus you don't need to force yourself to proxy.
+ if(obj.interactionMap && obj.interactionMap[proxyName]) return false;
+
+ var parentId = _widgetToFocusParent[id];
+ if(parentId) return _needsProxyHelper(parentId, proxyName);
+ return false;
+ }
+
+ var _needsProxyHelper = function(id, proxyName) {
+ var obj = $obj(id);
+ if(obj.interactionMap && obj.interactionMap[proxyName]) return true;
+
+ var parentId = _widgetToFocusParent[id];
+ if(parentId) return _needsProxyHelper(parentId, proxyName);
+ return false;
+ }
+
+ //for button shapes and images the img is focusable instead of the div to get better outlines
+ // For layers, we remember who their proxy is.
+ $ax.event.getFocusableWidgetOrChildId = function (elementId) {
+ var mappedId = _layerToFocusableWidget[elementId];
+ if (mappedId) elementId = mappedId;
+
+ var inputId = $ax.repeater.applySuffixToElementId(elementId, '_input');
+ var inputQuery = $jobj(inputId);
+ if(inputQuery.length > 0) return inputId;
+
+ var imgId = $ax.repeater.applySuffixToElementId(elementId, '_img');
+ var imgQuery = $jobj(imgId);
+ if (imgQuery.length > 0) return imgId;
+
+ var divId = $ax.repeater.applySuffixToElementId(elementId, '_div');
+ var divQuery = $jobj(divId);
+ if (divQuery.length > 0) return divId;
+
+ return elementId;
+ };
+
+ var _enteredWidgets = {};
+
+ // key is the suppressing event, and the value is the event that is supressed
+ var suppressingEvents = {};
+ // key is the event that will cancel the suppression, and value is the event that was being suppressed
+ var cancelSuppressions = {};
+ // suppressed event maps to true if it is supressed
+ var suppressedEventStatus = {};
+
+ var initSuppressingEvents = function () {
+ suppressingEvents['OnLongClick'] = 'OnClick';
+ cancelSuppressions['onMouseDown'] = 'OnClick';
+
+ // Have to cancel suppressed event here. Only works for non-synthetic events currently
+ for(var key in cancelSuppressions) {
+ var jEventName = AXURE_TO_JQUERY_EVENT_NAMES[key];
+ if(!jEventName) continue;
+ $('body').bind(jEventName, function () {
+ suppressedEventStatus[cancelSuppressions[key]] = false;
+ });
+ }
+ };
+
+ // TODO: It may be a good idea to split this into multiple functions, or at least pull out more similar functions into private methods
+ var _initializeObjectEvents = function(query, allowItem) {
+ query.each(function(dObj, elementId) {
+ var $element = $jobj(elementId);
+ var itemId = $ax.repeater.getItemIdFromElementId(elementId);
+
+ // Focus has to be done before on focus fires
+ // Set up focus
+ if ($ax.public.fn.IsTextArea(dObj.type) || $ax.public.fn.IsTextBox(dObj.type) || $ax.public.fn.IsCheckBox(dObj.type) || $ax.public.fn.IsRadioButton(dObj.type) ||
+ $ax.public.fn.IsListBox(dObj.type) || $ax.public.fn.IsComboBox(dObj.type) || $ax.public.fn.IsButton(dObj.type) ||
+ (dObj.tabbable && ($ax.public.fn.IsImageBox(dObj.type) || $ax.public.fn.IsVector(dObj.type) || $ax.IsTreeNodeObject(dObj.type) || $ax.public.fn.IsTableCell(dObj.type)))) {
+ var focusObj = $jobj($ax.event.getFocusableWidgetOrChildId(elementId));
+ focusObj.focus(function() {
+ window.lastFocusedControl = elementId;
+ });
+ }
+ // [MAS: Supressing events were here]
+ _createProxies(dObj, elementId);
+ var isDynamicPanel = $ax.public.fn.IsDynamicPanel(dObj.type);
+ if(dObj.interactionMap) {
+ _attachEvents(dObj, elementId, isDynamicPanel);
+ };
+
+ if (IE || $axure.browser.isEdge) {
+ $element.mouseenter(function() {
+ _enteredWidgets[elementId] = true;
+ }).mouseleave(function() {
+ _enteredWidgets[elementId] = false;
+ });
+ }
+
+ _attachIxStyleEvents(dObj, elementId, $element);
+
+ var $axElement = undefined;
+ // Unless you are pre eval - don't allow item and have an item id - then set enabled/selected through js as usual
+ if(allowItem || !itemId) {
+ //initialize disabled elements, do this first before selected, cause if a widget is disabled, we don't want to apply selected style anymore
+ if(($ax.public.fn.IsVector(dObj.type) || $ax.public.fn.IsImageBox(dObj.type) || isDynamicPanel || $ax.public.fn.IsLayer(dObj.type)) && dObj.disabled) {
+ if(!$axElement) $axElement = $ax('#' + elementId);
+ $axElement.enabled(false);
+ }
+
+ // Initialize selected elements if not in repeater
+ if(($ax.public.fn.IsVector(dObj.type) || $ax.public.fn.IsImageBox(dObj.type) || isDynamicPanel || $ax.public.fn.IsLayer(dObj.type)) && dObj.selected) {
+ if(!$axElement) $axElement = $ax('#' + elementId);
+ $axElement.selected(true);
+ }
+ } else {
+ // Otherwise everything should be set up correctly by pre-eval, except disabled is needed
+ if($element.hasClass('disabled')) {
+ $axElement = $ax('#' + elementId);
+ $axElement.enabled(false);
+ }
+ }
+
+ if(OS_MAC && WEBKIT) {
+ if ($ax.public.fn.IsComboBox(dObj.type) && dObj.disabled) {
+ $jobj($ax.INPUT(elementId)).css('color', 'grayText');
+ }
+ };
+
+ // Initialize Placeholders. Right now this is text boxes and text areas.
+ // Also, the assuption is being made that these widgets with the placeholder, have no other styles (this may change...)
+ var hasPlaceholder = dObj.placeholderText == '' ? true : Boolean(dObj.placeholderText);
+ if(($ax.public.fn.IsTextArea(dObj.type) || $ax.public.fn.IsTextBox(dObj.type)) && hasPlaceholder) {
+ // This is needed to initialize the placeholder state
+ var inputJobj = $jobj($ax.INPUT(elementId));
+ inputJobj.bind('focus', function () {
+ if(dObj.HideHintOnFocused) {
+ var id = this.id;
+ var inputIndex = id.indexOf('_input');
+ if (inputIndex == -1) return;
+ var inputId = id.substring(0, inputIndex);
+
+ if (!$ax.placeholderManager.isActive(inputId)) return;
+ $ax.placeholderManager.updatePlaceholder(inputId, false, true);
+ }
+ $ax.placeholderManager.moveCaret(this.id);
+ }).bind('mouseup', function() {
+ $ax.placeholderManager.moveCaret(this.id);
+ }).bind('blur', function() {
+ var id = this.id;
+ var inputIndex = id.indexOf('_input');
+ if(inputIndex == -1) return;
+ var inputId = id.substring(0, inputIndex);
+
+ if($jobj(id).val()) return;
+ $ax.placeholderManager.updatePlaceholder(inputId, true);
+ });
+
+ if(ANDROID) {
+ //input fires before keyup, to avoid flicker, supported in ie9 and above
+ inputJobj.bind('input', function() {
+ if(!dObj.HideHintOnFocused) { //hide on type
+ var id = this.id;
+ var inputIndex = id.indexOf('_input');
+ if(inputIndex == -1) return;
+ var inputId = id.substring(0, inputIndex);
+
+ if($ax.placeholderManager.isActive(inputId)) {
+ $ax.placeholderManager.updatePlaceholder(inputId, false, true);
+ } else if(!$jobj(id).val()) {
+ $ax.placeholderManager.updatePlaceholder(inputId, true, false);
+ $ax.placeholderManager.moveCaret(id, 0);
+ }
+ }
+ });
+ } else {
+ inputJobj.bind('keydown', function() {
+ if(!dObj.HideHintOnFocused) {
+ var id = this.id;
+ var inputIndex = id.indexOf('_input');
+ if(inputIndex == -1) return;
+ var inputId = id.substring(0, inputIndex);
+
+ if(!$ax.placeholderManager.isActive(inputId)) return;
+ $ax.placeholderManager.updatePlaceholder(inputId, false, true);
+ }
+ }).bind('keyup', function() {
+ var id = this.id;
+ var inputIndex = id.indexOf('_input');
+ if(inputIndex == -1) return;
+ var inputId = id.substring(0, inputIndex);
+
+ if($ax.placeholderManager.isActive(inputId)) return;
+ if(!dObj.HideHintOnFocused && !$jobj(id).val()) {
+ $ax.placeholderManager.updatePlaceholder(inputId, true);
+ $ax.placeholderManager.moveCaret(id, 0);
+ }
+ });
+ }
+
+ $ax.placeholderManager.registerPlaceholder(elementId, dObj.placeholderText, inputJobj.attr('type') == 'password');
+ $ax.placeholderManager.updatePlaceholder(elementId, !($jobj($ax.repeater.applySuffixToElementId(elementId, '_input')).val()));
+ }
+
+ // Initialize assigned submit buttons
+ if(dObj.submitButton) {
+ $element.keyup(function(e) {
+ if(e.keyCode == '13') {
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ var path = $ax.deepCopy(dObj.submitButton.path);
+ path[path.length] = dObj.submitButton.id;
+ var itemNum = $ax.repeater.getItemIdFromElementId(elementId);
+ var submitId = $ax.getScriptIdFromPath(path, scriptId);
+
+ if(itemNum && $ax.getParentRepeaterFromScriptId(submitId) == $ax.getParentRepeaterFromScriptId(scriptId)) {
+ submitId = $ax.repeater.createElementId(submitId, itemNum);
+ }
+ var inputId = $ax.INPUT(submitId);
+ if($jobj(inputId).length) submitId = inputId;
+
+ $ax.setjBrowserEvent(e);
+ $ax.event.fireClick(submitId);
+ }
+ }).keydown(function(e) {
+ if(e.keyCode == '13') {
+ e.preventDefault();
+ }
+ });
+ }
+
+ // Don't drag after mousing down on a plain text object
+ if ($ax.public.fn.IsTextArea(dObj.type) || $ax.public.fn.IsTextBox(dObj.type) || $ax.public.fn.IsListBox(dObj.type) ||
+ $ax.public.fn.IsComboBox(dObj.type) || $ax.public.fn.IsCheckBox(dObj.type) || $ax.public.fn.IsRadioButton(dObj.type)) {
+ $element.bind($ax.features.eventNames.mouseDownName, function(event) {
+ event.originalEvent.donotdrag = true;
+ });
+ }
+
+ if($ax.features.supports.mobile) {
+ $element.bind($ax.features.eventNames.mouseDownName, function() { _setCanClick(true); });
+
+ if (isDynamicPanel) {
+ $element.scroll(function() { _setCanClick(false); });
+ }
+ }
+
+ //initialize tree node cursors to default so they will override their parent
+ if ($ax.public.fn.IsTreeNodeObject(dObj.type) && !(dObj.interactionMap && dObj.interactionMap.onClick)) {
+ $element.css('cursor', 'default');
+ }
+
+ //initialize widgets that are clickable to have the pointer over them when hovering
+ if($ax.event.HasClick(dObj)) {
+ if($element) $element.css('cursor', 'pointer');
+ }
+
+ // TODO: not sure if we need this. It appears to be working without
+ //initialize panels for DynamicPanels
+ if (isDynamicPanel) {
+ $element.children().each(function() {
+ var parts = this.id.split('_');
+ var state = parts[parts.length - 1].substring(5);
+ if(state != 0) $ax.visibility.SetVisible(this, false);
+ });
+ }
+
+ //initialize TreeNodes
+ if ($ax.public.fn.IsTreeNodeObject(dObj.type)) {
+ if($element.hasClass('treeroot')) return;
+
+ var childrenId = elementId + '_children';
+ var children = $element.children('[id="' + childrenId + '"]:first');
+ if(children.length > 0) {
+ var plusMinusId = 'u' + (parseInt($ax.repeater.getScriptIdFromElementId(elementId).substring(1)) + 1);
+ if(itemId) plusMinusId = $ax.repeater.createElementId(plusMinusId, itemId);
+ if(!$jobj(plusMinusId).children().first().is('img')) plusMinusId = '';
+ $ax.tree.InitializeTreeNode(elementId, plusMinusId, childrenId);
+ }
+ $element.click(function() { $ax.tree.SelectTreeNode(elementId, true); });
+ }
+
+ //initialize submenus
+ if ($ax.public.fn.IsMenuObject(dObj.type)) {
+ if($element.hasClass('sub_menu')) {
+ var tableCellElementId = $ax.getElementIdFromPath([dObj.parentCellId], { relativeTo: elementId });
+ $ax.menu.InitializeSubmenu(elementId, tableCellElementId);
+ }
+ }
+
+ // Attach handles for dynamic panels that propagate styles to inner items.
+ if ((isDynamicPanel || $ax.public.fn.IsLayer(dObj.type)) && dObj.propagate) {
+ $element.mouseenter(function() {
+ dynamicPanelMouseOver(this.id);
+ }).mouseleave(function() {
+ dynamicPanelMouseLeave(this.id);
+ }).bind($ax.features.eventNames.mouseDownName, function() {
+ dynamicPanelMouseDown(this.id);
+ }).bind($ax.features.eventNames.mouseUpName, function() {
+ dynamicPanelMouseUp(this.id);
+ });
+ }
+
+ // These are the dynamic panel functions for propagating rollover styles and mouse down styles to inner objects
+ var dynamicPanelMouseOver = function(elementId, fromChild) {
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent) {
+ dynamicPanelMouseOver(parent.id, true);
+ if(parent.direct) return;
+ }
+ if($.inArray(elementId, _event.mouseOverIds) != -1) return;
+ // If this event is coming from a child, don't mark that it's actually entered.
+ // Only mark that this has been entered if this event has naturally been triggered. (For reason see mouseleave)
+ if(!fromChild) _event.mouseOverIds[_event.mouseOverIds.length] = elementId;
+ if(elementId == _event.mouseOverObjectId) return;
+ _event.mouseOverObjectId = elementId;
+ $ax.dynamicPanelManager.propagateMouseOver(elementId, true);
+ };
+ var dynamicPanelMouseLeave = function(elementId, fromChild) {
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent) {
+ dynamicPanelMouseLeave(parent.id, true);
+ if(parent.direct) return;
+ }
+ var index = $.inArray(elementId, _event.mouseOverIds);
+ // If index != -1, this has been natuarally entered. If naturally entered, then leaving child should not trigger leaving,
+ // but instead wait for natural mouse leave. If natural mouse enter never triggered, natural mouse leave won't so do this now.
+ if((index != -1) && fromChild) return;
+ $ax.splice(_event.mouseOverIds, index, 1);
+
+ if(elementId == _event.mouseOverObjectId) {
+ _event.mouseOverObjectId = '';
+ }
+ $ax.dynamicPanelManager.propagateMouseOver(elementId, false);
+ };
+
+ //attach handlers for button shape and tree node mouse over styles
+ // TODO: Can this really be removed? Trees seem to work with out (the generic hover case works for it).
+ // query.filter(function(obj) {
+ // return $ax.public.fn.IsVector(obj.type) && $ax.public.fn.IsTreeNodeObject(obj.parent.type) &&
+ // obj.parent.style && obj.parent.style.stateStyles &&
+ // obj.parent.style.stateStyles.mouseOver;
+ // }).mouseenter(function() {
+ // $ax.style.SetWidgetHover(this.id, true);
+ // }).mouseleave(function() {
+ // $ax.style.SetWidgetHover(this.id, false);
+ // });
+
+ //handle treeNodeObject events and prevent them from bubbling up. this is necessary because otherwise
+ //both a sub menu and it's parent would get a click
+ if ($ax.public.fn.IsTreeNodeObject(dObj.type)) {
+ $element.click(function() {
+ //todo -- this was bubbling, but then selecting a child tree node would bubble and select the parent (don't know if there is a better way)
+ _fireObjectEvent(this.id, 'click', arguments);
+ return false;
+ }).each(function() {
+ if(!this.style.cursor) {
+ this.style.cursor = 'default';
+ }
+ });
+ }
+
+ // Synthetic events
+
+ var map = dObj.interactionMap;
+ // Attach dynamic panel synthetic drag and swipe events
+ if(dObj.type == "dynamicPanel" && map && (
+ map.onDragStart || map.onDrag ||
+ map.onDragDrop || map.onSwipeLeft || map.onSwipeRight || map.onSwipeUp || map.onSwipeDown)) {
+
+ $element.bind($ax.features.eventNames.mouseDownName, function(e) { $ax.drag.StartDragWidget(e.originalEvent, elementId); });
+ }
+
+ // Attach dynamic panel synthetic scroll event
+ if (isDynamicPanel && map && (map.onScroll || map.onScrollUp || map.onScrollDown)) {
+ var diagrams = dObj.diagrams;
+ for(var i = 0; i < diagrams.length; i++) {
+ var panelId = $ax.repeater.applySuffixToElementId(elementId, '_state' + i);
+ (function(id) {
+ if ($('#' + id).data('lastScrollTop') == undefined) $('#' + id).data('lastScrollTop', '0');
+ _attachDefaultObjectEvent($('#' + id), elementId, 'scroll', function(e) {
+ $ax.setjBrowserEvent(e);
+ var currentEvent = $ax.getjBrowserEvent();
+ var eventInfoFromEvent = $ax.getEventInfoFromEvent(currentEvent, false, elementId);
+
+ var currentTop = $('#' + id).scrollTop();
+ var lastTop = $('#' + id).data('lastScrollTop');
+
+ _handleScrollEvent(elementId, eventInfoFromEvent, currentEvent.originalEvent, currentTop < lastTop, currentTop > lastTop, map);
+ $('#' + id).data('lastScrollTop', currentTop);
+ });
+ })(panelId);
+ }
+ }
+
+ // Attach synthetic hover event
+ if (map && map.onMouseHover) {
+ var MIN_HOVER_HOLD_TIME = 1000;
+
+ // So when the timeout fires, you know whether it is the same mouseenter that is active or not.
+ var hoverMouseCount = 0;
+ // Update eventInfo regularly, so position is accurate.
+ var hoverEventInfo;
+
+ $element.mouseenter(function(e) {
+ $ax.setjBrowserEvent(e);
+ hoverEventInfo = $ax.getEventInfoFromEvent($ax.getjBrowserEvent(), false, elementId);
+ (function(currCount) {
+ window.setTimeout(function() {
+ if(currCount == hoverMouseCount) _raiseSyntheticEvent(elementId, 'onMouseHover', false, hoverEventInfo, true);
+ }, MIN_HOVER_HOLD_TIME);
+ })(hoverMouseCount);
+ }).mouseleave(function(e) {
+ $ax.setjBrowserEvent(e);
+ hoverMouseCount++;
+ }).mousemove(function(e) {
+ $ax.setjBrowserEvent(e);
+ hoverEventInfo = $ax.getEventInfoFromEvent($ax.getjBrowserEvent(), false, elementId);
+ });
+ }
+
+ // Attach synthetic tap and hold event.
+ if (map && map.onLongClick) {
+ var MIN_LONG_CLICK_HOLD_TIME = 750;
+
+ // So when the timeout fires, you know whether it is the same mousedown that is active or not.
+ var longClickMouseCount = 0;
+
+ $element.bind($ax.features.eventNames.mouseDownName, function(e) {
+ (function(currCount) {
+ $ax.setjBrowserEvent(e);
+ var eventInfo = $ax.getEventInfoFromEvent($ax.getjBrowserEvent(), false, elementId);
+ window.setTimeout(function() {
+ if(currCount == longClickMouseCount) _raiseSyntheticEvent(elementId, 'onLongClick', false, eventInfo, true);
+ }, MIN_LONG_CLICK_HOLD_TIME);
+ if(e.preventDefault) e.preventDefault();
+ })(longClickMouseCount);
+ }).bind($ax.features.eventNames.mouseUpName, function(e) {
+ $ax.setjBrowserEvent(e);
+ longClickMouseCount++;
+ });
+ };
+
+
+ // Attach synthetic onSelectionChange event to droplist and listbox elements
+ if ($ax.event.HasSelectionChanged(dObj)) {
+ $element.bind('change', function(e) {
+ $ax.setjBrowserEvent(e);
+ _raiseSyntheticEvent(elementId, 'onSelectionChange');
+ });
+ };
+
+ // Highjack key up and key down to keep track of state of keyboard.
+ if($ax.event.HasKeyUpOrDown(dObj)) _event.initKeyEvents($element);
+
+ // Attach synthetic onTextChange event to textbox and textarea elements
+ if ($ax.event.HasTextChanged(dObj)) {
+ var element = $jobj($ax.INPUT(elementId));
+ $ax.updateElementText(elementId, element.val());
+ //Key down needed because when holding a key down, key up only fires once, but keydown fires repeatedly.
+ //Key up because last mouse down will only show the state before the last character.
+ element.bind('keydown', function(e) {
+ $ax.setjBrowserEvent(e);
+ $ax.event.TryFireTextChanged(elementId);
+ }).bind('keyup', function(e) {
+ $ax.setjBrowserEvent(e);
+ $ax.event.TryFireTextChanged(elementId);
+ });
+ };
+
+ // Attach synthetic onCheckedChange event to radiobutton and checkbox elements
+ if ($ax.public.fn.IsCheckBox(dObj.type) || $ax.public.fn.IsRadioButton(dObj.type)) {
+ var input = $jobj($ax.INPUT(elementId));
+ if ($ax.public.fn.IsRadioButton(dObj.type) && input.prop('checked')) {
+ $ax.updateRadioButtonSelected(input.attr('name'), elementId);
+ }
+
+ $element.bind('change', function(e) {
+ $ax.setjBrowserEvent(e);
+ var eTarget = e.target || e.srcElement;
+ _tryFireCheckedChanged(elementId, eTarget.checked);
+ });
+ };
+
+ var hasTap = map && (map.onClick || map.onDoubleClick);
+ var hasMove = map && map.onMouseMove;
+ _event.initMobileEvents(hasTap ? $element : $(),
+ hasMove ? $element : $(), elementId);
+
+
+ //attach link alternate styles
+ if(dObj.type == 'hyperlink') {
+ $element.mouseenter(function() {
+ var linkId = this.id;
+ if(_event.mouseOverIds.indexOf(linkId) != -1) return true;
+ _event.mouseOverIds[_event.mouseOverIds.length] = linkId;
+ var mouseOverObjectId = _event.mouseOverObjectId;
+ if(mouseOverObjectId && $ax.style.IsWidgetDisabled(mouseOverObjectId)) return true;
+
+ $ax.style.SetLinkHover(linkId);
+
+ var bubble = _fireObjectEvent(linkId, 'mouseenter', arguments);
+
+ $ax.annotation.updateLinkLocations($ax.GetParentIdFromLink(linkId));
+ return bubble;
+ }).mouseleave(function() {
+ var linkId = this.id;
+ $ax.splice(_event.mouseOverIds, _event.mouseOverIds.indexOf(linkId), 1);
+ var mouseOverObjectId = _event.mouseOverObjectId;
+ if(mouseOverObjectId && $ax.style.IsWidgetDisabled(mouseOverObjectId)) return true;
+
+ $ax.style.SetLinkNotHover(linkId);
+
+ var bubble = _fireObjectEvent(linkId, 'mouseleave', arguments);
+
+ $ax.annotation.updateLinkLocations($ax.GetParentIdFromLink(linkId));
+ return bubble;
+ }).bind($ax.features.eventNames.mouseDownName, function() {
+ var linkId = this.id;
+ var mouseOverObjectId = _event.mouseOverObjectId;
+ if($ax.style.IsWidgetDisabled(mouseOverObjectId)) return undefined;
+
+ if(mouseOverObjectId) $ax.style.SetWidgetMouseDown(mouseOverObjectId, true);
+ $ax.style.SetLinkMouseDown(linkId);
+
+ $ax.annotation.updateLinkLocations($ax.GetParentIdFromLink(linkId));
+
+ return false;
+ }).bind($ax.features.eventNames.mouseUpName, function() {
+ var linkId = this.id;
+ var mouseOverObjectId = _event.mouseOverObjectId;
+ if(mouseOverObjectId && $ax.style.IsWidgetDisabled(mouseOverObjectId)) return;
+
+ if(mouseOverObjectId) $ax.style.SetWidgetMouseDown(mouseOverObjectId, false);
+ $ax.style.SetLinkNotMouseDown(linkId);
+
+ $ax.annotation.updateLinkLocations($ax.GetParentIdFromLink(linkId));
+
+ }).click(function() {
+ var elementId = this.id;
+ var mouseOverObjectId = _event.mouseOverObjectId;
+ if(mouseOverObjectId && $ax.style.IsWidgetDisabled(mouseOverObjectId)) return undefined;
+
+ return _fireObjectEvent(elementId, 'click', arguments);
+ });
+ }
+
+ // Init inline frames
+ if (dObj.type == 'inlineFrame') {
+ var target = dObj.target;
+ var url = '';
+ if(target.includeVariables && target.url) {
+ var origSrc = target.url;
+ url = origSrc.toLowerCase().indexOf('http://') == -1 ? $ax.globalVariableProvider.getLinkUrl(origSrc) : origSrc;
+
+ } else if(target.urlLiteral) {
+ url = $ax.expr.evaluateExpr(target.urlLiteral, $ax.getEventInfoFromEvent(undefined, true, elementId), true);
+ }
+ if(url) $jobj($ax.INPUT(elementId)).attr('src', url);
+ };
+ });
+ }
+ $ax.initializeObjectEvents = _initializeObjectEvents;
+
+ $ax.event.updateIxStyleEvents = function(elementId) {
+ _dettachIxStyleEvents(elementId);
+ _attachIxStyleEvents($ax.getObjectFromElementId(elementId), elementId, $jobj(elementId), true);
+ }
+
+ function clearMouseDownIxStyle(e) {
+ if(_event.mouseDownObjectId) {
+ $('#' + _event.mouseDownObjectId).trigger(
+ { type: "mouseup",
+ checkMouseOver: e.data && e.data.checkMouseOver
+ }
+ );
+ }
+ }
+
+ var _dettachIxStyleEvents = function(elementId) {
+ var $element = $jobj(elementId);
+ $element.off('mouseenter.ixStyle')
+ .off('mouseleave.ixStyle')
+ .off($ax.features.eventNames.mouseDownName + '.ixStyle')
+ .off($ax.features.eventNames.mouseUpName + '.ixStyle');
+ }
+
+ var _attachIxStyleEvents = function(dObj, elementId, $element, ignoreHasIxStyles) {
+ //attach button shape alternate styles
+ var isDynamicPanel = $ax.public.fn.IsDynamicPanel(dObj.type);
+ var needsMouseFilter = (ignoreHasIxStyles || $ax.event.HasIxStyles(dObj))
+ && dObj.type != 'hyperlink' && !$ax.public.fn.IsLayer(dObj.type) && !isDynamicPanel && dObj.type != $ax.constants.TEXT_TYPE &&
+ !$ax.public.fn.IsRepeater(dObj.type) && !$ax.public.fn.IsCheckBox(dObj.type) && !$ax.public.fn.IsRadioButton(dObj.type)
+ && !$ax.public.fn.IsTreeNodeObject(dObj.type);
+ if(needsMouseFilter) {
+ //$element.mouseenter(function () {
+ $element.on('mouseenter.ixStyle', function () {
+ var elementId = this.id;
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent && parent.direct) return;
+ if($.inArray(elementId, _event.mouseOverIds) != -1) return;
+ _event.mouseOverIds[_event.mouseOverIds.length] = elementId;
+
+ if(elementId == _event.mouseOverObjectId) return;
+ _event.mouseOverObjectId = elementId;
+ $ax.style.SetWidgetHover(elementId, true);
+ $ax.annotation.updateLinkLocations(elementId);
+ //}).mouseleave(function () {
+ }).on('mouseleave.ixStyle', function () {
+ var elementId = this.id;
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent && parent.direct) return;
+ $ax.splice(_event.mouseOverIds, $.inArray(elementId, _event.mouseOverIds), 1);
+
+ if(elementId == _event.mouseOverObjectId) {
+ _event.mouseOverObjectId = '';
+ }
+ $ax.style.SetWidgetHover(elementId, false);
+ $ax.annotation.updateLinkLocations(elementId);
+ });
+
+ //$element.bind($ax.features.eventNames.mouseDownName, function () {
+ $element.on($ax.features.eventNames.mouseDownName + '.ixStyle', function () {
+ var elementId = this.id;
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent) {
+ dynamicPanelMouseDown(parent.id);
+ if(parent.direct) return;
+ }
+ _event.mouseDownObjectId = elementId;
+ //since we don't do mouse capture, it's possible that the mouseup not get triggered later
+ //in that case, detect the mouseup on document and dragend
+ $(document).one("mouseup", {checkMouseOver: true}, clearMouseDownIxStyle);
+ $("#" + elementId).one("dragend", clearMouseDownIxStyle);
+
+ $ax.style.SetWidgetMouseDown(this.id, true);
+ $ax.annotation.updateLinkLocations(elementId);
+ //}).bind($ax.features.eventNames.mouseUpName, function () {
+ }).on($ax.features.eventNames.mouseUpName + '.ixStyle', function (e) {
+ var elementId = this.id;
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent) {
+ dynamicPanelMouseUp(parent.id);
+ if(parent.direct) return;
+ }
+
+ $(document).off("mouseup", clearMouseDownIxStyle);
+ $("#" + _event.mouseDownObjectId).off("dragend", clearMouseDownIxStyle);
+
+ _event.mouseDownObjectId = '';
+ if(!$ax.style.ObjHasMouseDown(elementId)) return;
+
+ $ax.style.SetWidgetMouseDown(elementId, false, e.checkMouseOver);
+ $ax.annotation.updateLinkLocations(elementId);
+
+ //there used to be something we needed to make images click, because swapping out the images prevents the click
+ // this is a note that we can eventually delete.
+ });
+
+ }
+ };
+
+ var dynamicPanelMouseDown = function (elementId) {
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent) {
+ dynamicPanelMouseDown(parent.id);
+ if(parent.direct) return;
+ }
+ _event.mouseDownObjectId = elementId;
+ $ax.dynamicPanelManager.propagateMouseDown(elementId, true);
+ };
+
+ var dynamicPanelMouseUp = function (elementId) {
+ var parent = $ax.dynamicPanelManager.parentHandlesStyles(elementId);
+ if(parent) {
+ dynamicPanelMouseUp(parent.id);
+ if(parent.direct) return;
+ }
+ _event.mouseDownObjectId = '';
+ $ax.dynamicPanelManager.propagateMouseDown(elementId, false);
+ };
+
+ // Handle key up and key down events
+ (function() {
+ var _keyState = {};
+ _keyState.ctrl = false;
+ _keyState.alt = false;
+ _keyState.shift = false;
+ _keyState.keyCode = 0;
+ $ax.event.keyState = function() {
+ return $ax.deepCopy(_keyState);
+ };
+
+ var modifierCodes = [16, 17, 18];
+ var clearKeyCode = false;
+ $ax.event.initKeyEvents = function($query) {
+ $query.keydown(function (e) {
+ if(clearKeyCode) {
+ clearKeyCode = false;
+ _keyState.keyCode = 0;
+ }
+ var elementId = this.id;
+
+ _keyState.ctrl = e.ctrlKey;
+
+ _keyState.alt = e.altKey;
+
+ _keyState.shift = e.shiftKey;
+
+ // If a modifier was pressed, then don't set the keyCode;
+ if(modifierCodes.indexOf(e.keyCode) == -1) _keyState.keyCode = e.keyCode;
+
+ $ax.setjBrowserEvent(e);
+ if (!elementId) fireEventThroughContainers('onKeyDown', undefined, false, [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE, $ax.constants.REPEATER],
+ [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.LAYER_TYPE]);
+ else _raiseSyntheticEvent(elementId, 'onKeyDown', false, undefined, true);
+ });
+ $query.keyup(function(e) {
+ var elementId = this.id;
+
+ if (modifierCodes.indexOf(e.keyCode) == -1) clearKeyCode = true;
+ else if (clearKeyCode) {
+ clearKeyCode = false;
+ _keyState.keyCode = 0;
+ }
+
+ $ax.setjBrowserEvent(e);
+ // Fire event before updating modifiers.
+ if (!elementId) fireEventThroughContainers('onKeyUp', undefined, false, [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE, $ax.constants.REPEATER],
+ [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.LAYER_TYPE]);
+ else _raiseSyntheticEvent(elementId, 'onKeyUp', false, undefined, true);
+
+ //_keyState.ctrl = e.ctrlKey;
+
+ //_keyState.alt = e.altKey;
+
+ //_keyState.shift = e.shiftKey;
+
+ //// If a non-modifier was lifted, clear the keycode
+ ///if(modifierCodes.indexOf(e.keyCode) == -1) _keyState.keyCode = 0;
+ });
+ };
+ })();
+
+ // Handle adding mobile events
+ (function() {
+ // NOTE: Multi touch is NOT handled currently.
+ var CLICK_THRESHOLD_PX = 25;
+ var CLICK_THRESHOLD_PX_SQ = CLICK_THRESHOLD_PX * CLICK_THRESHOLD_PX;
+ var DBLCLICK_THRESHOLD_MS = 500;
+
+ // Location in page cooridinates
+ var tapDownLoc;
+ var lastClickEventTime;
+
+ _event.initMobileEvents = function($tapQuery, $moveQuery, elementId) {
+ if(!$ax.features.supports.mobile) return;
+
+ // Handle touch start
+ $tapQuery.bind('touchstart', function(e) {
+ // We do NOT support multiple touches. This isn't necessarily the touch we want.
+ var touch = e.originalEvent && e.originalEvent.changedTouches && e.originalEvent.changedTouches[0];
+ if(!touch) return;
+
+ tapDownLoc = [touch.pageX, touch.pageY];
+
+ var time = (new Date()).getTime();
+ if(time - lastClickEventTime < DBLCLICK_THRESHOLD_MS) {
+ var dObj = elementId === '' ? $ax.pageData.page : $ax.getObjectFromElementId(elementId);
+ var axEventObject = dObj && dObj.interactionMap && dObj.interactionMap['onDoubleClick'];
+ if(axEventObject) e.preventDefault(); //for Chrome on Android
+ }
+ }).bind('touchend', function(e) {
+ var touch = e.originalEvent && e.originalEvent.changedTouches && e.originalEvent.changedTouches[0];
+ if(!touch || !tapDownLoc || $ax.style.IsWidgetDisabled(elementId)) return;
+
+ var tapUpLoc = [touch.pageX, touch.pageY];
+ var xDiff = tapUpLoc[0] - tapDownLoc[0];
+ var yDiff = tapUpLoc[1] - tapDownLoc[1];
+
+ if((xDiff * xDiff + yDiff * yDiff) < CLICK_THRESHOLD_PX_SQ) {
+ $ax.setjBrowserEvent(e);
+ _raiseSyntheticEvent(elementId, 'onClick', false, undefined, true);
+
+ var time = (new Date()).getTime();
+ if(time - lastClickEventTime < DBLCLICK_THRESHOLD_MS) {
+ _raiseSyntheticEvent(elementId, 'onDoubleClick', false, undefined, true);
+ if(e.originalEvent && e.originalEvent.handled) e.preventDefault(); //for iOS
+ }
+ lastClickEventTime = time;
+ }
+ });
+
+ // Handles touch move
+ $moveQuery.bind('touchmove', function(e) {
+ $ax.setjBrowserEvent(e);
+ _raiseSyntheticEvent(elementId, 'onMouseMove', false, undefined, true);
+ if(e.originalEvent && e.originalEvent.handled) e.preventDefault();
+ });
+ };
+ })();
+
+ // Handle adding device independent click events to non-widgets
+ (function() {
+ var CLICK_THRESHOLD_PX = 25;
+ var CLICK_THRESHOLD_PX_SQ = CLICK_THRESHOLD_PX * CLICK_THRESHOLD_PX;
+
+ // Location in page cooridinates
+ var tapDownLoc;
+
+ _event.attachClick = function(query, clickHandler) {
+ if(!$ax.features.supports.mobile) {
+ query.click(clickHandler);
+ return;
+ }
+
+ $(query).bind('touchstart', function(e) {
+ // We do NOT support multiple touches. This isn't necessarily the touch we want.
+ var touch = e.originalEvent && e.originalEvent.changedTouches && e.originalEvent.changedTouches[0];
+ if(!touch) return;
+
+ tapDownLoc = [touch.pageX, touch.pageY];
+ });
+
+ $(query).bind('touchend', function(e) {
+ var touch = e.originalEvent && e.originalEvent.changedTouches && e.originalEvent.changedTouches[0];
+ if(!touch) return;
+
+ var tapUpLoc = [touch.pageX, touch.pageY];
+ var xDiff = tapUpLoc[0] - tapDownLoc[0];
+ var yDiff = tapUpLoc[1] - tapDownLoc[1];
+
+ if((xDiff * xDiff + yDiff * yDiff) < CLICK_THRESHOLD_PX_SQ) {
+ clickHandler();
+ }
+ });
+ };
+ })();
+
+ // Handle firing device independent click events on widgets
+ (function() {
+ _event.fireClick = function(elementId) {
+ if(!$ax.features.supports.mobile) {
+ $('#' + elementId).click();
+ return;
+ }
+ _raiseSyntheticEvent(elementId, 'onClick', false, undefined, true);
+ };
+ })();
+
+ var _mouseLocation = $ax.mouseLocation = { x: 0, y: 0 };
+ var _lastmouseLocation = $ax.lastMouseLocation = { x: 0, y: 0 };
+
+ var _updateMouseLocation = function(e, end) {
+ if(!e) return;
+
+ if(IE_10_AND_BELOW && typeof (e.type) == 'unknown') return;
+ if(e.type != 'mousemove' && e.type != 'touchstart' && e.type != 'touchmove' && e.type != 'touchend') return;
+
+ var newX;
+ var newY;
+ if(IE_10_AND_BELOW) {
+ newX = e.clientX + $('html').scrollLeft();
+ newY = e.clientY + $('html').scrollTop();
+ } else {
+ newX = e.pageX;
+ newY = e.pageY;
+ }
+ //var body = $('body');
+ //if(body.css('position') == 'relative') newX = Math.round(newX - Number(body.css('left').replace('px', '')) - Math.max(0, ($(window).width() - body.width()) / 2));
+
+ if(_mouseLocation.x == newX && _mouseLocation.y == newY) return;
+
+ _lastmouseLocation.x = _mouseLocation.x;
+ _lastmouseLocation.y = _mouseLocation.y;
+ _mouseLocation.x = newX;
+ _mouseLocation.y = newY;
+
+ $ax.geometry.tick(_mouseLocation.x, _mouseLocation.y, end);
+ };
+ _event.updateMouseLocation = _updateMouseLocation;
+
+ var _leavingState = function(stateId) {
+ var mouseOverIds = _event.mouseOverIds;
+ if(mouseOverIds.length == 0) return;
+
+ var stateQuery = $jobj(stateId);
+ for(var i = mouseOverIds.length - 1; i >= 0; i--) {
+ var id = mouseOverIds[i];
+ if(stateQuery.find('#' + id).length) {
+ $ax.splice(mouseOverIds, $.inArray(id, mouseOverIds), 1);
+ $ax.style.SetWidgetMouseDown(id, false);
+ $ax.style.SetWidgetHover(id, false);
+ }
+ }
+
+ };
+ _event.leavingState = _leavingState;
+
+ var _raiseSelectedEvents = function(elementId, value) {
+ $ax.event.raiseSyntheticEvent(elementId, 'onSelectedChange');
+ if(value) $ax.event.raiseSyntheticEvent(elementId, 'onSelect');
+ else $ax.event.raiseSyntheticEvent(elementId, 'onUnselect');
+ };
+ $ax.event.raiseSelectedEvents = _raiseSelectedEvents;
+
+ var _raiseSyntheticEvent = function(elementId, eventName, skipShowDescription, eventInfo, nonSynthetic) {
+ // Empty string used when this is an event directly on the page.
+ var dObj = elementId === '' ? $ax.pageData.page : $ax.getObjectFromElementId(elementId);
+ var axEventObject = dObj && dObj.interactionMap && dObj.interactionMap[eventName];
+ if(!axEventObject) return;
+
+ eventInfo = eventInfo || $ax.getEventInfoFromEvent($ax.getjBrowserEvent(), skipShowDescription, elementId);
+ // $ax.recording.maybeRecordEvent(elementId, eventInfo, axEventObject, new Date().getTime());
+ _handleEvent(elementId, eventInfo, axEventObject, false, !nonSynthetic);
+ };
+ $ax.event.raiseSyntheticEvent = _raiseSyntheticEvent;
+
+ var _hasSyntheticEvent = function(scriptId, eventName) {
+ var dObj = $ax.getObjectFromScriptId(scriptId);
+ var axEventObject = dObj && dObj.interactionMap && dObj.interactionMap[eventName];
+ return Boolean(axEventObject);
+ };
+ $ax.event.hasSyntheticEvent = _hasSyntheticEvent;
+
+ var _addEvent = function (target, eventType, handler, useCapture) {
+ //this return value is only for debug purpose
+ var succeed = undefined;
+ if(target.attachEvent) {
+ if($ax.features.supports.windowsMobile) {
+ succeed = target.attachEvent(eventType, handler);
+ } else {
+ succeed = target.attachEvent('on' + eventType, handler);
+ }
+ } else if(target.addEventListener) {
+ target.addEventListener(eventType, handler, useCapture);
+ succeed = true;
+ }
+
+ return succeed;
+ }
+ $ax.event.addEvent = _addEvent;
+
+ var _removeEvent = function(target, eventType, handler, useCapture, skipCheckingWindowsMobile) {
+ //this return value is only for debug purpose
+ var succeed = undefined;
+
+ if(target.detachEvent) {
+ if(!skipCheckingWindowsMobile && $ax.features.supports.windowsMobile) {
+ succeed = target.detachEvent(eventType, handler);
+ } else {
+ succeed = target.detachEvent('on' + eventType, handler);
+ }
+ } else if(target.removeEventListener) {
+ target.removeEventListener(eventType, handler, useCapture);
+ succeed = true;
+ }
+
+ return succeed;
+ }
+ $ax.event.removeEvent = _removeEvent;
+
+ var _initialize = function() {
+ $ax.repeater.load();
+
+ // Make sure key events for page are initialized first. That way they will update the value of key pressed before any other events occur.
+ _event.initKeyEvents($(window));
+
+ initSuppressingEvents();
+
+ // Anything with an item id is in a repeater and should be handled by that repeater.
+ _initializeObjectEvents($ax(function(obj, elementId) { return !$ax.repeater.getItemIdFromElementId(elementId); }));
+
+ //finally, process the pageload
+ _pageLoad();
+ // _loadDynamicPanelsAndMasters();
+ // $ax.repeater.init();
+
+ // and wipe out the basic links.
+ $('.basiclink').click(function() {
+ return false;
+ });
+ };
+ _event.initialize = _initialize;
+
+ $ax.event.HasIxStyles = function(diagramObject) {
+ if(diagramObject.style.stateStyles) return true;
+ if(diagramObject.adaptiveStyles) {
+ for(var viewId in diagramObject.adaptiveStyles) {
+ if(diagramObject.adaptiveStyles[viewId].stateStyles) return true;
+ }
+ }
+ return false;
+ };
+
+ $ax.event.HasTextChanged = function(diagramObject) {
+ if (!$ax.public.fn.IsTextBox(diagramObject.type) && !$ax.public.fn.IsTextArea(diagramObject.type)) return false;
+ var map = diagramObject.interactionMap;
+ return map && map.onTextChange;
+ };
+
+ $ax.event.TryFireTextChanged = function(elementId) {
+ var query = $jobj($ax.repeater.applySuffixToElementId(elementId, '_input'));
+ if(!$ax.hasElementTextChanged(elementId, query.val())) return;
+ $ax.updateElementText(elementId, query.val());
+
+ $ax.event.raiseSyntheticEvent(elementId, 'onTextChange');
+ };
+
+ $ax.event.HasSelectionChanged = function(diagramObject) {
+ if (!$ax.public.fn.IsListBox(diagramObject.type) && !$ax.public.fn.IsComboBox(diagramObject.type)) return false;
+ var map = diagramObject.interactionMap;
+ return map && map.onSelectionChange;
+ };
+
+ $ax.event.HasKeyUpOrDown = function (diagramObject) {
+ if($ax.public.fn.IsTextBox(diagramObject.type) || $ax.public.fn.IsTextArea(diagramObject.type)) return true;
+ var map = diagramObject.interactionMap;
+ return map && (map.onKeyUp || map.onKeyDown);
+ };
+
+ $ax.event.HasCheckedChanged = function(diagramObject) {
+ if (!$ax.public.fn.IsCheckBox(diagramObject.type) && !$ax.public.fn.IsRadioButton(diagramObject.type)) return false;
+ var map = diagramObject.interactionMap;
+ return map && map.onSelectedChange;
+ };
+
+ $ax.event.HasClick = function (diagramObject) {
+ var map = diagramObject.interactionMap;
+ return map && map.onClick;
+ };
+
+ var _tryFireCheckedChanged = $ax.event.TryFireCheckChanged = function(elementId, value) {
+ var isRadio = $ax.public.fn.IsRadioButton($obj(elementId).type);
+ if(isRadio) {
+ if(!value) {
+ $ax.updateRadioButtonSelected($jobj($ax.INPUT(elementId)).attr('name'), undefined);
+ } else {
+ var last = $ax.updateRadioButtonSelected($jobj($ax.INPUT(elementId)).attr('name'), elementId);
+
+ // If no change, this should not fire
+ if(last == elementId) return;
+
+ // Initially selecting one, last may be undefined
+ if(last) {
+ //here last is the previouse selected elementid
+ $ax.event.raiseSelectedEvents(last, false);
+ }
+ }
+ }
+
+ $ax.event.raiseSelectedEvents(elementId, value);
+ };
+
+ //onload everything now, not only dp and master
+ var _loadDynamicPanelsAndMasters = function(objects, path, itemId) {
+ fireEventThroughContainers('onLoad', objects, true, [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE],
+ [$ax.constants.ALL_TYPE], path, itemId);
+ };
+ $ax.loadDynamicPanelsAndMasters = _loadDynamicPanelsAndMasters;
+
+ var _viewChangePageAndMasters = function(forceSwitchTo) {
+ fireEventThroughContainers('onAdaptiveViewChange', undefined, true, [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE],
+ [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE]);
+ _postAdaptiveViewChanged(forceSwitchTo);
+ };
+ $ax.viewChangePageAndMasters = _viewChangePageAndMasters;
+
+ //if forceSwitchTo is true, we will also update the checkmark in sitemap.js
+ var _postAdaptiveViewChanged = function(forceSwitchTo) {
+ //only trigger adaptive view changed if the window is on the mainframe. Also triggered on init, even if default.
+ try {
+ if(window.name == 'mainFrame' ||
+ (!CHROME_5_LOCAL && window.parent.$ && window.parent.$('#mainFrame').length > 0)) {
+ var data = {
+ viewId: $ax.adaptive.currentViewId,
+ forceSwitchTo: forceSwitchTo
+ };
+ $axure.messageCenter.postMessage('adaptiveViewChange', data);
+ }
+ } catch(e) { }
+ };
+ $ax.postAdaptiveViewChanged = _postAdaptiveViewChanged;
+
+ var _postResize = $ax.postResize = function(e) {
+ $ax.setjBrowserEvent(e);
+ return fireEventThroughContainers('onResize', undefined, false, [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE, $ax.constants.REPEATER],
+ [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE]);
+ };
+
+ //fire events for table, menu and tree, including its sub items
+ var _fireEventsForTableMenuAndTree = function (object, event, skipShowDescription, eventInfo, path, synthetic) {
+ if (!path) path = [];
+ var pathCopy = path.slice();
+
+ pathCopy[path.length] = object.id;
+ var scriptId = $ax.getScriptIdFromPath(pathCopy);
+ $ax.event.raiseSyntheticEvent(scriptId, event, skipShowDescription, eventInfo, !synthetic);
+
+ if(object.objects) {
+ for(var index = 0; index < object.objects.length; index++) {
+ var subObj = object.objects[index];
+ if ($ax.public.fn.IsTableCell(subObj.type)) {
+ pathCopy[path.length] = subObj.id;
+ scriptId = $ax.getScriptIdFromPath(pathCopy);
+ $ax.event.raiseSyntheticEvent(scriptId, event, skipShowDescription, eventInfo, !synthetic);
+ } else if ($ax.public.fn.IsTable(object.type) || $ax.public.fn.IsMenuObject(object.type) || $ax.public.fn.IsTreeNodeObject(object.type)) {
+ _fireEventsForTableMenuAndTree(subObj, event, skipShowDescription, eventInfo, path, synthetic);
+ }
+ }
+ }
+ }
+
+ //remember the scroll bar position, so we can detect scroll up/down
+ var lastScrollTop;
+
+ var fireEventForPageOrMaster = function (elementId, eventName, interactionMap, isPage, skipShowDescription, synthetic) {
+ if(!interactionMap) return;
+
+ var axEvent = interactionMap[eventName];
+ var scrolling = eventName === "onScroll";
+ if (scrolling && !axEvent) axEvent = interactionMap.onScrollUp || interactionMap.onScrollDown;
+
+ if (axEvent) {
+ var currentEvent = $ax.getjBrowserEvent();
+ var eventInfo = $ax.getEventInfoFromEvent(currentEvent, skipShowDescription, elementId);
+
+ if(isPage) {
+ eventInfo.label = $ax.pageData.page.name;
+ eventInfo.friendlyType = 'Page';
+ } else eventInfo.isMasterEvent = true;
+
+ if(scrolling) _handleScrollEvent(elementId, eventInfo, currentEvent.originalEvent, _event.windowScrollingUp, _event.windowScrollingDown, interactionMap, skipShowDescription, synthetic);
+ else _handleEvent(elementId, eventInfo, axEvent, skipShowDescription, synthetic);
+ }
+ }
+ // Filters include page, referenceDiagramObject, dynamicPanel, and repeater.
+ var _callFilterCheck = function(callFilter, type) {
+ for(var index = 0; index < callFilter.length; index++) {
+ var currentType = callFilter[index];
+ if(currentType === $ax.constants.ALL_TYPE || currentType === type) return true;
+ }
+ return false;
+ };
+
+ var fireEventThroughContainers = function(eventName, objects, synthetic, searchFilter, callFilter, path, itemId) {
+ // TODO: may want to pass in this as a parameter. At that point, may want to convert some of them to an option parameter. For now this is the only case
+ var skipShowDescription = eventName == 'onLoad';
+
+ // If objects undefined, load page
+ if(!objects) {
+ if(_callFilterCheck(callFilter, $ax.constants.PAGE_TYPE)) {
+ //if scrolling, set direction, later master will know
+ if(eventName === "onScroll") {
+ var currentScrollTop = $(window).scrollTop();
+ _event.windowScrollingUp = currentScrollTop < lastScrollTop;
+ _event.windowScrollingDown = currentScrollTop > lastScrollTop;
+ }
+
+ fireEventForPageOrMaster('', eventName, $ax.pageData.page.interactionMap, true, skipShowDescription, synthetic);
+ }
+ if(searchFilter.indexOf($ax.constants.PAGE_TYPE) != -1) fireEventThroughContainers(eventName, $ax.pageData.page.diagram.objects, synthetic, searchFilter, callFilter);
+ //reset and save scrolling info at the end
+ if(currentScrollTop) {
+ lastScrollTop = currentScrollTop;
+ _event.windowScrollingUp = undefined;
+ _event.windowScrollingDown = undefined;
+ }
+
+ return;
+ }
+
+ if(!path) path = [];
+
+ var pathCopy = [];
+ for(var j = 0; j < path.length; j++) pathCopy[j] = path[j];
+
+ for(var i = 0; i < objects.length; i++) {
+ var obj = objects[i];
+ pathCopy[path.length] = obj.id;
+ if (!$ax.public.fn.IsReferenceDiagramObject(obj.type) && !$ax.public.fn.IsDynamicPanel(obj.type) && !$ax.public.fn.IsRepeater(obj.type) && !$ax.public.fn.IsLayer(obj.type)) {
+ if(_callFilterCheck(callFilter)) { //fire current event for all types
+ if ($ax.public.fn.IsTable(obj.type) || $ax.public.fn.IsMenuObject(obj.type) || $ax.public.fn.IsTreeNodeObject(obj.type)) {
+ _fireEventsForTableMenuAndTree(obj, eventName, skipShowDescription, undefined, path, !synthetic);
+ } else {
+ var scriptId = $ax.getScriptIdFromPath(pathCopy);
+ if(scriptId && itemId) scriptId = $ax.repeater.createElementId(scriptId, itemId);
+ $ax.event.raiseSyntheticEvent(scriptId, eventName, skipShowDescription, undefined, !synthetic);
+ }
+ }
+ continue;
+ }
+
+ var objId = $ax.getScriptIdFromPath(pathCopy);
+ // If limboed, move on to next item
+ if(!objId) continue;
+ if(itemId) objId = $ax.repeater.createElementId(objId, itemId);
+
+ if($ax.public.fn.IsReferenceDiagramObject(obj.type)) {
+ if(_callFilterCheck(callFilter, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE)) {
+ fireEventForPageOrMaster(objId, eventName, $ax.pageData.masters[obj.masterId].interactionMap, false, skipShowDescription, synthetic);
+ }
+ if(searchFilter.indexOf($ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE) != -1) fireEventThroughContainers(eventName, $ax.pageData.masters[obj.masterId].diagram.objects, synthetic, searchFilter, callFilter, pathCopy, itemId);
+ } else if($ax.public.fn.IsDynamicPanel(obj.type)) {
+ if(_callFilterCheck(callFilter, $ax.constants.DYNAMIC_PANEL_TYPE)) $ax.event.raiseSyntheticEvent(objId, eventName, skipShowDescription, undefined, !synthetic);
+
+ if(searchFilter.indexOf($ax.constants.DYNAMIC_PANEL_TYPE) != -1) {
+ var diagrams = obj.diagrams;
+ for(var j = 0; j < diagrams.length; j++) {
+ fireEventThroughContainers(eventName, diagrams[j].objects, synthetic, searchFilter, callFilter, path, itemId);
+ }
+ }
+ } else if($ax.public.fn.IsRepeater(obj.type)) {
+ // TODO: possible an option for repeater item? Now fires overall for the repeater
+ if(_callFilterCheck(callFilter, $ax.constants.REPEATER)) $ax.event.raiseSyntheticEvent(objId, eventName, skipShowDescription, undefined, !synthetic);
+ if(searchFilter.indexOf($ax.constants.REPEATER) != -1) {
+ var itemIds = $ax.getItemIdsForRepeater(objId);
+ for(var j = 0; j < itemIds.length; j++) {
+ fireEventThroughContainers(eventName, obj.objects, synthetic, searchFilter, callFilter, path, itemIds[j]);
+ }
+ }
+ } else if($ax.public.fn.IsLayer(obj.type)) {
+ if(_callFilterCheck(callFilter, $ax.constants.LAYER_TYPE)) $ax.event.raiseSyntheticEvent(objId, eventName, skipShowDescription, undefined, !synthetic);
+
+ if(obj.objs && obj.objs.length > 0) {
+ fireEventThroughContainers(eventName, obj.objs, synthetic, searchFilter, callFilter, path, itemId);
+ }
+ }
+ }
+
+ eventNesting -= 1;
+
+ }; // FOCUS stuff
+ (function() {
+
+ })();
+
+
+ var _pageLoad = function() {
+
+ // Map of axure event names to pair of what it should attach to, and what the jquery event name is.
+ var PAGE_AXURE_TO_JQUERY_EVENT_NAMES = {
+ 'onScroll': [window, 'scroll'],
+ 'onScrollUp': [window, 'scrollup'],
+ 'onScrollDown': [window, 'scrolldown'],
+ //'onResize': [window, 'resize'],
+ 'onContextMenu': [window, 'contextmenu']
+ };
+
+ var $win = $(window);
+ if(!$ax.features.supports.mobile) {
+ PAGE_AXURE_TO_JQUERY_EVENT_NAMES.onClick = ['html', 'click'];
+ PAGE_AXURE_TO_JQUERY_EVENT_NAMES.onDoubleClick = ['html', 'dblclick'];
+ PAGE_AXURE_TO_JQUERY_EVENT_NAMES.onMouseMove = ['html', 'mousemove'];
+ } else {
+ _event.initMobileEvents($win, $win, '');
+
+ $win.bind($ax.features.eventNames.mouseDownName, _updateMouseLocation);
+ $win.bind($ax.features.eventNames.mouseUpName, function(e) { _updateMouseLocation(e, true); });
+
+ $win.scroll(function() { _setCanClick(false); });
+ $win.bind($ax.features.eventNames.mouseDownName, (function() {
+ _setCanClick(true);
+ }));
+ }
+ $win.bind($ax.features.eventNames.mouseMoveName, _updateMouseLocation);
+ $win.scroll($ax.flyoutManager.reregisterAllFlyouts);
+
+ for(key in PAGE_AXURE_TO_JQUERY_EVENT_NAMES) {
+ if(!PAGE_AXURE_TO_JQUERY_EVENT_NAMES.hasOwnProperty(key)) continue;
+ (function(axureName) {
+ var jqueryEventNamePair = PAGE_AXURE_TO_JQUERY_EVENT_NAMES[axureName];
+ var actionName = jqueryEventNamePair[1];
+
+ if(actionName == "scrollup" || actionName == "scrolldown") return;
+
+ $(jqueryEventNamePair[0])[actionName](function (e) {
+ $ax.setjBrowserEvent(e);
+ return fireEventThroughContainers(axureName, undefined, false, [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE, $ax.constants.REPEATER],
+ [$ax.constants.PAGE_TYPE, $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE]);
+ });
+ })(key);
+ }
+
+ eventNesting -= 1;
+ lastScrollTop = 0;
+ };
+ _event.pageLoad = _pageLoad;
+
+
+});
+//***** recording.js *****//
+// ******* Recording MANAGER ******** //
+
+$axure.internal(function($ax) {
+ var _recording = $ax.recording = {};
+
+ $ax.recording.recordEvent = function(element, eventInfo, axEventObject, timeStamp) {
+
+ var elementHtml = $jobj(element);
+ var className = elementHtml.attr('class');
+ var inputValue;
+
+ if(className === 'ax_checkbox') {
+ inputValue = elementHtml.find('#' + element + '_input')[0].checked;
+ eventInfo.inputType = className;
+ eventInfo.inputValue = inputValue;
+ }
+
+ if(className === 'ax_text_field') {
+ inputValue = elementHtml.find('#' + element + '_input').val();
+ eventInfo.inputType = className;
+ eventInfo.inputValue = inputValue;
+ }
+
+
+ var scriptId = $ax.repeater.getScriptIdFromElementId(element);
+ var diagramObjectPath = $ax.getPathFromScriptId(scriptId);
+ var form = {
+ recordingId: $ax.recording.recordingId,
+ elementID: element,
+ eventType: axEventObject.description,
+ 'eventInfo': eventInfo,
+ // eventObject: axEventObject,
+ 'timeStamp': timeStamp,
+ 'path': diagramObjectPath
+// ,
+// 'trigger': function() {
+// $ax.event.handleEvent(element, eventInfo, axEventObject);
+// return false;
+// }
+ };
+
+ $ax.messageCenter.postMessage('logEvent', form);
+ };
+
+
+ $ax.recording.maybeRecordEvent = function(element, eventInfo, axEventObject, timeStamp) {
+ };
+
+
+ $ax.recording.recordingId = "";
+ $ax.recording.recordingName = "";
+
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ if(message === 'startRecording') {
+ $ax.recording.maybeRecordEvent = $ax.recording.recordEvent;
+ $ax.recording.recordingId = data.recordingId;
+ $ax.recording.recordingName = data.recordingName;
+ } else if(message === 'stopRecording') {
+ $ax.recording.maybeRecordEvent = function(element, eventInfo, axEventObject, timeStamp) {
+ };
+
+ }
+ else if(message === 'playEvent') {
+
+ var eventType = makeFirstLetterLower(data.eventType);
+ var inputElement;
+
+ var dObj = data.element === '' ? $ax.pageData.page : $ax.getObjectFromElementId(data.element);
+ if(!data.axEventObject) {
+ data.axEventObject = dObj && dObj.interactionMap && dObj.interactionMap[eventType];
+ }
+
+ data.eventInfo.thiswidget = $ax.getWidgetInfo(data.element);
+ data.eventInfo.item = $ax.getItemInfo(data.element);
+
+ if(data.eventInfo.inputType && data.eventInfo.inputType === 'ax_checkbox') {
+ inputElement = $jobj(data.element + '_input');
+ inputElement[0].checked = data.eventInfo.inputValue;
+ }
+
+ if(data.eventInfo.inputType && data.eventInfo.inputType === 'ax_text_field') {
+ inputElement = $jobj(data.element + '_input');
+ inputElement.val(data.eventInfo.inputValue);
+ }
+
+ $ax.event.handleEvent(data.element, data.eventInfo, data.axEventObject, false, true);
+ }
+ });
+
+ var makeFirstLetterLower = function(eventName) {
+ return eventName.substr(0, 1).toLowerCase() + eventName.substr(1);
+ };
+
+});
+//***** action.js *****//
+$axure.internal(function($ax) {
+ var _actionHandlers = {};
+ var _action = $ax.action = {};
+
+ var queueTypes = _action.queueTypes = {
+ none: 0,
+ move: 1,
+ setState: 2,
+ fade: 3,
+ resize: 4,
+ rotate: 5
+ };
+
+ var animationQueue = {};
+
+ // using array as the key doesn't play nice
+ var nextAnimationId = 1;
+ var animationsToCount = {};
+ var actionToActionGroups = {};
+ var getAnimation = function(id, type) {
+ return animationQueue[id] && animationQueue[id][type] && animationQueue[id][type][0];
+ };
+
+ var _addAnimation = _action.addAnimation = function (id, type, func, suppressFire) {
+
+ var wasEmpty = !getAnimation(id, type);
+ // Add the func to the queue. Create the queue if necessary.
+ var idQueue = animationQueue[id];
+ if(!idQueue) animationQueue[id] = idQueue = {};
+
+ var queue = idQueue[type];
+ if(!queue) idQueue[type] = queue = [];
+
+ queue[queue.length] = func;
+ // If it was empty, there isn't a callback waiting to be called on this. You have to fire it manually.
+ // If this is waiting on something, suppress it, and it will fire when it's ready
+ if(wasEmpty && !suppressFire) func();
+ };
+
+ var _addAnimations = function (animations) {
+ if(animations.length == 1) {
+ _addAnimation(animations[0].id, animations[0].type, animations[0].func);
+ return;
+ }
+ var allReady = true;
+ var readyCount = 0;
+ for(var i = 0; i < animations.length; i++) {
+ var animation = animations[i];
+ var thisReady = !getAnimation(animation.id, animation.type);
+ allReady = allReady && thisReady;
+ if (thisReady) readyCount++;
+ else {
+ var typeToGroups = actionToActionGroups[animation.id];
+ if (!typeToGroups) actionToActionGroups[animation.id] = typeToGroups = {};
+
+ var groups = typeToGroups[animation.type];
+ if (!groups) typeToGroups[animation.type] = groups = [];
+
+ groups[groups.length] = animations;
+ }
+ }
+
+ for(i = 0; i < animations.length; i++) {
+ animation = animations[i];
+ _addAnimation(animation.id, animation.type, animation.func, true);
+ }
+
+ if (allReady) {
+ for (i = 0; i < animations.length; i++) animations[i].func();
+ } else {
+ animations.id = nextAnimationId++;
+ animationsToCount[animations.id] = readyCount;
+ }
+ }
+
+ var _fireAnimationFromQueue = _action.fireAnimationFromQueue = function (id, type) {
+ // Remove the function that was just fired
+ if (animationQueue[id] && animationQueue[id][type]) $ax.splice(animationQueue[id][type], 0, 1);
+
+ // Fire the next func if there is one
+ var func = getAnimation(id, type);
+ if(func && !_checkFireActionGroup(id, type, func)) func();
+ };
+
+ var _checkFireActionGroup = function(id, type, func) {
+ var group = actionToActionGroups[id];
+ group = group && group[type];
+ if (!group || group.length == 0) return false;
+
+ var animations = group[0];
+ var found = false;
+ for (var i = 0; i < animations.length; i++) {
+ var animation = animations[i];
+ if (animation.id == id && animation.type == type) {
+ found = func == animation.func;
+ break;
+ }
+ }
+
+ // if found then update this action group, otherwise, keep waiting for right action to fire
+ if(!found) return false;
+ $ax.splice(group, 0, 1);
+ var count = animationsToCount[animations.id] + 1;
+ if(count != animations.length) {
+ animationsToCount[animations.id] = count;
+ return true;
+ }
+ delete animationsToCount[animations.id];
+
+ // Funcs is needed because an earlier func can try to cascade right away (when no animation for example) and will kill this func and move on to the
+ // next one (which may not even exist). If we get all funcs before calling any, then we know they are all the func we want.
+ var funcs = [];
+ for(i = 0; i < animations.length; i++) {
+ animation = animations[i];
+ funcs.push(getAnimation(animation.id, animation.type));
+ }
+ for(i = 0; i < funcs.length; i++) {
+ funcs[i]();
+ }
+
+ return true;
+ }
+
+ var _refreshing = [];
+ _action.refreshStart = function(repeaterId) { _refreshing.push(repeaterId); };
+ _action.refreshEnd = function() { _refreshing.pop(); };
+
+ // TODO: [ben] Consider moving this to repeater.js
+ var _repeatersToRefresh = _action.repeatersToRefresh = [];
+ var _ignoreAction = function(repeaterId) {
+ for(var i = 0; i < _refreshing.length; i++) if(_refreshing[i] == repeaterId) return true;
+ return false;
+ };
+
+ var _addRefresh = function(repeaterId) {
+ if(_repeatersToRefresh.indexOf(repeaterId) == -1) _repeatersToRefresh.push(repeaterId);
+ };
+
+ var _getIdToResizeMoveState = function(eventInfo) {
+ if(!eventInfo.idToResizeMoveState) eventInfo.idToResizeMoveState = {};
+ return eventInfo.idToResizeMoveState;
+ }
+
+ var _queueResizeMove = function (id, type, eventInfo, actionInfo) {
+ if (type == queueTypes.resize || type == queueTypes.rotate) $ax.public.fn.convertToSingleImage($jobj(id));
+
+ var idToResizeMoveState = _getIdToResizeMoveState(eventInfo);
+ if(!idToResizeMoveState[id]) {
+ idToResizeMoveState[id] = {};
+ idToResizeMoveState[id][queueTypes.move] = { queue: [], used: 0 };
+ idToResizeMoveState[id][queueTypes.resize] = { queue: [], used: 0 };
+ idToResizeMoveState[id][queueTypes.rotate] = { queue: [], used: 0 };
+ }
+ var state = idToResizeMoveState[id];
+
+ // If this is not a type being queued (no action of it's type waiting already) then if it is an instant, fire right away.
+ var myOptions = type == queueTypes.resize ? actionInfo : actionInfo.options;
+ if(!state[type].queue.length && (!myOptions.easing || myOptions.easing == 'none' || !myOptions.duration)) {
+ var func = type == queueTypes.resize ? _addResize : type == queueTypes.rotate ? _addRotate : _addMove;
+ func(id, eventInfo, actionInfo, { easing: 'none', duration: 0, stop: { instant: true } });
+ return;
+ }
+
+ // Check other 2 types to see if either is empty, if so, we can't do anything, so just queue it up
+ var otherType1 = type == queueTypes.move ? queueTypes.resize : queueTypes.move;
+ var otherType2 = type == queueTypes.rotate ? queueTypes.resize : queueTypes.rotate;
+ if (!state[otherType1].queue.length || !state[otherType2].queue.length) {
+ state[type].queue.push({ eventInfo: eventInfo, actionInfo: actionInfo });
+ } else {
+ var duration = myOptions.duration;
+ var used1 = state[otherType1].used;
+ var used2 = state[otherType2].used;
+
+ while(state[otherType1].queue.length && state[otherType2].queue.length && duration != 0) {
+ var other1 = state[otherType1].queue[0];
+ var otherOptions1 = otherType1 == queueTypes.resize ? other1.actionInfo : other1.actionInfo.options;
+ // If queue up action is a non animation, then don't combo it, just queue it and move on
+ if(!otherOptions1.easing || otherOptions1.easing == 'none' || !otherOptions1.duration) {
+ func = otherType1 == queueTypes.resize ? _addResize : otherType1 == queueTypes.rotate ? _addRotate : _addMove;
+ func(id, eventInfo, actionInfo, { easing: 'none', duration: 0, stop: { instant: true } });
+ continue;
+ }
+ var other2 = state[otherType2].queue[0];
+ var otherOptions2 = otherType2 == queueTypes.resize ? other2.actionInfo : other2.actionInfo.options;
+ // If queue up action is a non animation, then don't combo it, just queue it and move on
+ if(!otherOptions2.easing || otherOptions2.easing == 'none' || !otherOptions2.duration) {
+ func = otherType2 == queueTypes.resize ? _addResize : otherType2 == queueTypes.rotate ? _addRotate : _addMove;
+ func(id, eventInfo, actionInfo, { easing: 'none', duration: 0, stop: { instant: true } });
+ continue;
+ }
+
+ // Other duration is what is left over. When in queue it may be partly finished already
+ var otherDuration1 = otherOptions1.duration - used1;
+ var otherDuration2 = otherOptions2.duration - used2;
+
+ var resizeInfo = type == queueTypes.resize ? actionInfo : otherType1 == queueTypes.resize ? other1.actionInfo : other2.actionInfo;
+ var rotateInfo = type == queueTypes.rotate ? actionInfo : otherType1 == queueTypes.rotate ? other1.actionInfo : other2.actionInfo;
+ var moveInfo = type == queueTypes.move ? actionInfo : otherType1 == queueTypes.move ? other1.actionInfo : other2.actionInfo;
+ var options = { easing: moveInfo.options.easing, duration: Math.min(duration, otherDuration1, otherDuration2) };
+ // Start for self is whole duration - duration left, end is start plus duration of combo to be queued, length is duration
+ var stop = { start: myOptions.duration - duration, len: myOptions.duration };
+ stop.end = stop.start + options.duration;
+ // Start for other is used (will be 0 after 1st round), end is start plus length is duration of combo to be queued, length is other duration
+ var otherStop1 = { start: used1, end: options.duration + used1, len: otherOptions1.duration };
+ var otherStop2 = { start: used2, end: options.duration + used2, len: otherOptions2.duration };
+ options.stop = type == queueTypes.resize ? stop : otherType1 == queueTypes.resize ? otherStop1 : otherStop2;
+ options.moveStop = type == queueTypes.move ? stop : otherType1 == queueTypes.move ? otherStop1 : otherStop2;
+ options.rotateStop = type == queueTypes.rotate ? stop : otherType1 == queueTypes.rotate ? otherStop1 : otherStop2;
+
+ _addResize(id, eventInfo, resizeInfo, options, moveInfo, rotateInfo);
+
+ // Update duration for this animation
+ duration -= options.duration;
+ // For others update used and remove from queue if necessary
+ if(otherDuration1 == options.duration) {
+ $ax.splice(state[otherType1].queue, 0, 1);
+ used1 = 0;
+ } else used1 += options.duration;
+
+ if(otherDuration2 == options.duration) {
+ $ax.splice(state[otherType2].queue, 0, 1);
+ used2 = 0;
+ } else used2 += options.duration;
+ }
+
+ // Start queue for new type if necessary
+ if(duration) {
+ state[type].queue.push({ eventInfo: eventInfo, actionInfo: actionInfo });
+ state[type].used = myOptions.duration - duration;
+ }
+
+ // Update used for others
+ state[otherType1].used = used1;
+ state[otherType2].used = used2;
+ }
+ };
+
+ _action.flushAllResizeMoveActions = function (eventInfo) {
+ var idToResizeMoveState = _getIdToResizeMoveState(eventInfo);
+ for(var id in idToResizeMoveState) _flushResizeMoveActions(id, idToResizeMoveState);
+ };
+
+ var _flushResizeMoveActions = function(id, idToResizeMoveState) {
+ var state = idToResizeMoveState[id];
+ var move = state[queueTypes.move];
+ var moveInfo = move.queue[0];
+ var resize = state[queueTypes.resize];
+ var resizeInfo = resize.queue[0];
+ var rotate = state[queueTypes.rotate];
+ var rotateInfo = rotate.queue[0];
+ while (moveInfo || resizeInfo || rotateInfo) {
+ var eventInfo = moveInfo ? moveInfo.eventInfo : resizeInfo ? resizeInfo.eventInfo : rotateInfo.eventInfo;
+ moveInfo = moveInfo && moveInfo.actionInfo;
+ resizeInfo = resizeInfo && resizeInfo.actionInfo;
+ rotateInfo = rotateInfo && rotateInfo.actionInfo;
+
+ // Resize is used by default, then rotate
+ if(resizeInfo) {
+ // Check for instant resize
+ if(!resizeInfo.duration || resizeInfo.easing == 'none') {
+ _addResize(id, resize.queue[0].eventInfo, resizeInfo, { easing: 'none', duration: 0, stop: { instant: true } });
+ _updateResizeMoveUsed(id, queueTypes.resize, 0, idToResizeMoveState);
+ resizeInfo = resize.queue[0];
+ continue;
+ }
+
+ var duration = resizeInfo.duration - resize.used;
+ if(moveInfo) duration = Math.min(duration, moveInfo.options.duration - move.used);
+ if(rotateInfo) duration = Math.min(duration, rotateInfo.options.duration - rotate.used);
+
+ var baseOptions = moveInfo ? moveInfo.options : resizeInfo;
+ var options = { easing: baseOptions.easing, duration: duration };
+
+ options.stop = { start: resize.used, end: resize.used + duration, len: resizeInfo.duration };
+ if(moveInfo) options.moveStop = { start: move.used, end: move.used + duration, len: moveInfo.options.duration };
+ if(rotateInfo) options.rotateStop = { start: rotate.used, end: rotate.used + duration, len: rotateInfo.options.duration };
+
+ _addResize(id, eventInfo, resizeInfo, options, moveInfo, rotateInfo);
+
+ _updateResizeMoveUsed(id, queueTypes.resize, duration, idToResizeMoveState);
+ resizeInfo = resize.queue[0];
+ if(rotateInfo) {
+ _updateResizeMoveUsed(id, queueTypes.rotate, duration, idToResizeMoveState);
+ rotateInfo = rotate.queue[0];
+ }
+ if(moveInfo) {
+ _updateResizeMoveUsed(id, queueTypes.move, duration, idToResizeMoveState);
+ moveInfo = move.queue[0];
+ }
+ } else if (rotateInfo) {
+ // Check for instant rotate
+ if(!rotateInfo.options.duration || rotateInfo.options.easing == 'none') {
+ _addRotate(id, rotate.queue[0].eventInfo, rotateInfo, { easing: 'none', duration: 0, stop: { instant: true } });
+ _updateResizeMoveUsed(id, queueTypes.rotate, 0, idToResizeMoveState);
+ rotateInfo = rotate.queue[0];
+ continue;
+ }
+
+ duration = rotateInfo.options.duration - rotate.used;
+ if(moveInfo) duration = Math.min(duration, moveInfo.options.duration - move.used);
+
+ baseOptions = moveInfo ? moveInfo.options : rotateInfo.options;
+ options = { easing: baseOptions.easing, duration: duration };
+
+ options.stop = { start: rotate.used, end: rotate.used + duration, len: rotateInfo.options.duration };
+ if(moveInfo) options.moveStop = { start: move.used, end: move.used + duration, len: moveInfo.options.duration };
+
+ _addRotate(id, eventInfo, rotateInfo, options, moveInfo);
+
+ _updateResizeMoveUsed(id, queueTypes.rotate, duration, idToResizeMoveState);
+ rotateInfo = rotate.queue[0];
+ if(moveInfo) {
+ _updateResizeMoveUsed(id, queueTypes.move, duration, idToResizeMoveState);
+ moveInfo = move.queue[0];
+ }
+ } else {
+ if(!moveInfo.options.duration || moveInfo.options.easing == 'none') {
+ _addMove(id, eventInfo, moveInfo, { easing: 'none', duration: 0, stop: { instant: true } });
+ _updateResizeMoveUsed(id, queueTypes.move, 0, idToResizeMoveState);
+ moveInfo = move.queue[0];
+ continue;
+ }
+
+ duration = moveInfo.options.duration - move.used;
+ options = { easing: moveInfo.options.easing, duration: duration };
+ options.stop = { start: move.used, end: moveInfo.options.duration, len: moveInfo.options.duration };
+ _addMove(id, eventInfo, moveInfo, options);
+
+ _updateResizeMoveUsed(id, queueTypes.move, duration, idToResizeMoveState);
+ moveInfo = move.queue[0];
+ }
+ }
+ };
+
+ var _updateResizeMoveUsed = function(id, type, duration, idToResizeMoveState) {
+ var state = idToResizeMoveState[id][type];
+ state.used += duration;
+ var options = state.queue[0].actionInfo;
+ if(options.options) options = options.options;
+ var optionDur = (options.easing && options.easing != 'none' && options.duration) || 0;
+ if(optionDur <= state.used) {
+ $ax.splice(state.queue, 0, 1);
+ state.used = 0;
+ }
+ }
+
+ var _dispatchAction = $ax.action.dispatchAction = function(eventInfo, actions, currentIndex) {
+ currentIndex = currentIndex || 0;
+ //If no actions, you can bubble
+ if(currentIndex >= actions.length) return;
+ //actions are responsible for doing their own dispatching
+ _actionHandlers[actions[currentIndex].action](eventInfo, actions, currentIndex);
+ };
+
+ _actionHandlers.wait = function(eventInfo, actions, index) {
+ var action = actions[index];
+ var infoCopy = $ax.eventCopy(eventInfo);
+ window.setTimeout(function() {
+ infoCopy.now = new Date();
+ infoCopy.idToResizeMoveState = undefined;
+ _dispatchAction(infoCopy, actions, index + 1);
+ _action.flushAllResizeMoveActions(infoCopy);
+ }, action.waitTime);
+ };
+
+ _actionHandlers.expr = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ $ax.expr.evaluateExpr(action.expr, eventInfo); //this should be a block
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.setFunction = _actionHandlers.expr;
+
+ _actionHandlers.linkWindow = function(eventInfo, actions, index) {
+ linkActionHelper(eventInfo, actions, index);
+ };
+
+ _actionHandlers.closeCurrent = function(eventInfo, actions, index) {
+ $ax.closeWindow();
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.linkFrame = function(eventInfo, actions, index) {
+ linkActionHelper(eventInfo, actions, index);
+ };
+
+ _actionHandlers.setAdaptiveView = function(eventInfo, actions, index) {
+ var action = actions[index];
+ var view = action.setAdaptiveViewTo;
+
+ if(view) $ax.adaptive.setAdaptiveView(view);
+ };
+
+ var linkActionHelper = function(eventInfo, actions, index) {
+ var action = actions[index];
+ eventInfo.link = true;
+
+ if(action.linkType != 'frame') {
+ var includeVars = _includeVars(action.target, eventInfo);
+ if(action.target.targetType == "reloadPage") {
+ $ax.reload(action.target.includeVariables);
+ } else if(action.target.targetType == "backUrl") {
+ $ax.back();
+ }
+
+ var url = action.target.url;
+ if(!url && action.target.urlLiteral) {
+ url = $ax.expr.evaluateExpr(action.target.urlLiteral, eventInfo, true);
+ }
+
+ if(url) {
+ if(action.linkType == "popup") {
+ $ax.navigate({
+ url: url,
+ target: action.linkType,
+ includeVariables: includeVars,
+ popupOptions: action.popup
+ });
+ } else {
+ $ax.navigate({
+ url: url,
+ target: action.linkType,
+ includeVariables: includeVars
+ });
+ }
+ }
+ } else linkFrame(eventInfo, action);
+ eventInfo.link = false;
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ var _includeVars = function(target, eventInfo) {
+ if(target.includeVariables) return true;
+ // If it is a url literal, that is a string literal, that has only 1 sto, that is an item that is a page, include vars.
+ if(target.urlLiteral) {
+ var literal = target.urlLiteral;
+ var sto = literal.stos[0];
+ if(literal.exprType == 'stringLiteral' && literal.value.indexOf('[[') == 0 && literal.value.indexOf(']]' == literal.value.length - 2) && literal.stos.length == 1 && sto.sto == 'item' && eventInfo.item) {
+ var data = $ax.repeater.getData(eventInfo, eventInfo.item.repeater.elementId, eventInfo.item.index, sto.name, 'data');
+ if (data && $ax.public.fn.IsPage(data.type)) return true;
+ }
+ }
+ return false;
+ };
+
+ var linkFrame = function(eventInfo, action) {
+ for(var i = 0; i < action.framesToTargets.length; i++) {
+ var framePath = action.framesToTargets[i].framePath;
+ var target = action.framesToTargets[i].target;
+ var includeVars = _includeVars(target, eventInfo);
+
+ var url = target.url;
+ if(!url && target.urlLiteral) {
+ url = $ax.expr.evaluateExpr(target.urlLiteral, eventInfo, true);
+ }
+
+ var id = $ax.getElementIdsFromPath(framePath, eventInfo)[0];
+ if(id) $ax('#' + $ax.INPUT(id)).openLink(url, includeVars);
+ }
+ };
+
+ var _repeatPanelMap = {};
+
+ _actionHandlers.setPanelState = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.panelsToStates.length; i++) {
+ var panelToState = action.panelsToStates[i];
+ var stateInfo = panelToState.stateInfo;
+ var elementIds = $ax.getElementIdsFromPath(panelToState.panelPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+ // Need new scope for elementId and info
+ (function(elementId, stateInfo) {
+ _addAnimation(elementId, queueTypes.setState, function() {
+ var stateNumber = stateInfo.stateNumber;
+ if(stateInfo.setStateType == "value") {
+ var oldTarget = eventInfo.targetElement;
+ eventInfo.targetElement = elementId;
+ var stateName = $ax.expr.evaluateExpr(stateInfo.stateValue, eventInfo);
+ eventInfo.targetElement = oldTarget;
+
+ // Try for state name first
+ var states = $ax.getObjectFromElementId(elementId).diagrams;
+ var stateNameFound = false;
+ for(var k = 0; k < states.length; k++) {
+ if(states[k].label == stateName) {
+ stateNumber = k + 1;
+ stateNameFound = true;
+ }
+ }
+
+ // Now check for index
+ if(!stateNameFound) {
+ stateNumber = Number(stateName);
+ var panelCount = $('#' + elementId).children().length;
+
+ // Make sure number is not NaN, is in range, and is a whole number.
+ // Wasn't a state name or number, so return
+ if(isNaN(stateNumber) || stateNumber <= 0 || stateNumber > panelCount || Math.round(stateNumber) != stateNumber) return _fireAnimationFromQueue(elementId, queueTypes.setState);
+ }
+ } else if(stateInfo.setStateType == 'next' || stateInfo.setStateType == 'previous') {
+ var info = $ax.deepCopy(stateInfo);
+ var repeat = info.repeat;
+
+ // Only map it, if repeat exists.
+ if(typeof (repeat) == 'number') _repeatPanelMap[elementId] = info;
+ return _progessPanelState(elementId, info, info.repeatSkipFirst);
+ }
+ delete _repeatPanelMap[elementId];
+
+ // If setting to current (to stop repeat) break here
+ if(stateInfo.setStateType == 'current') return _fireAnimationFromQueue(elementId, queueTypes.setState);
+
+ $ax('#' + elementId).SetPanelState(stateNumber, stateInfo.options, stateInfo.showWhenSet);
+ });
+ })(elementId, stateInfo);
+ }
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ var _progessPanelState = function(id, info, skipFirst) {
+ var direction = info.setStateType;
+ var loop = info.loop;
+ var repeat = info.repeat;
+ var options = info.options;
+
+ var hasRepeat = typeof (repeat) == 'number';
+ var currentStateId = $ax.visibility.GetPanelState(id);
+ var stateNumber = '';
+ if(currentStateId != '') {
+ currentStateId = $ax.repeater.getScriptIdFromElementId(currentStateId);
+ var currentStateNumber = Number(currentStateId.substr(currentStateId.indexOf('state') + 5));
+ if(direction == "next") {
+ stateNumber = currentStateNumber + 2;
+
+ if(stateNumber > $ax.visibility.GetPanelStateCount(id)) {
+ if(loop) stateNumber = 1;
+ else {
+ delete _repeatPanelMap[id];
+ return _fireAnimationFromQueue(id, queueTypes.setState);
+ }
+ }
+ } else if(direction == "previous") {
+ stateNumber = currentStateNumber;
+ if(stateNumber <= 0) {
+ if(loop) stateNumber = $ax.visibility.GetPanelStateCount(id);
+ else {
+ delete _repeatPanelMap[id];
+ return _fireAnimationFromQueue(id, queueTypes.setState);
+ }
+ }
+ }
+
+ if(hasRepeat && _repeatPanelMap[id] != info) return _fireAnimationFromQueue(id, queueTypes.setState);
+
+ if (!skipFirst) $ax('#' + id).SetPanelState(stateNumber, options, info.showWhenSet);
+ else _fireAnimationFromQueue(id, queueTypes.setState);
+
+ if(hasRepeat) {
+ var animate = options && options.animateIn;
+ if(animate && animate.easing && animate.easing != 'none' && animate.duration > repeat) repeat = animate.duration;
+ animate = options && options.animateOut;
+ if(animate && animate.easing && animate.easing != 'none' && animate.duration > repeat) repeat = animate.duration;
+
+ window.setTimeout(function() {
+ // Either new repeat, or no repeat anymore.
+ if(_repeatPanelMap[id] != info) return;
+ _addAnimation(id, queueTypes.setState, function() {
+ _progessPanelState(id, info, false);
+ });
+ }, repeat);
+ } else delete _repeatPanelMap[id];
+ }
+ };
+
+ _actionHandlers.fadeWidget = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.objectsToFades.length; i++) {
+ var fadeInfo = action.objectsToFades[i].fadeInfo;
+ var elementIds = $ax.getElementIdsFromPath(action.objectsToFades[i].objectPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+ // Need new scope for elementId and info
+ (function(elementId, fadeInfo) {
+ _addAnimation(elementId, queueTypes.fade, function() {
+ if(fadeInfo.fadeType == "hide") {
+ $ax('#' + elementId).hide(fadeInfo.options);
+ } else if(fadeInfo.fadeType == "show") {
+ $ax('#' + elementId).show(fadeInfo.options, eventInfo);
+ } else if(fadeInfo.fadeType == "toggle") {
+ $ax('#' + elementId).toggleVisibility(fadeInfo.options);
+ }
+ });
+ })(elementId, fadeInfo);
+ }
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.setOpacity = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.objectsToSetOpacity.length; i++) {
+ var opacityInfo = action.objectsToSetOpacity[i].opacityInfo;
+ var elementIds = $ax.getElementIdsFromPath(action.objectsToSetOpacity[i].objectPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+
+ (function(elementId, opacityInfo) {
+ _addAnimation(elementId, queueTypes.fade, function () {
+ var oldTarget = eventInfo.targetElement;
+ eventInfo.targetElement = elementId;
+ var opacity = $ax.expr.evaluateExpr(opacityInfo.opacity, eventInfo);
+ eventInfo.targetElement = oldTarget;
+ opacity = Math.min(100, Math.max(0, opacity));
+ $ax('#' + elementId).setOpacity(opacity/100, opacityInfo.easing, opacityInfo.duration);
+ })
+ })(elementId, opacityInfo);
+ }
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ }
+
+ _actionHandlers.moveWidget = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.objectsToMoves.length; i++) {
+ var moveInfo = action.objectsToMoves[i].moveInfo;
+ var elementIds = $ax.getElementIdsFromPath(action.objectsToMoves[i].objectPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+ _queueResizeMove(elementId, queueTypes.move, eventInfo, moveInfo);
+ //_addMove(eventInfo, elementId, moveInfo, eventInfo.dragInfo);
+ }
+ }
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ var _compoundChildrenShallow = function (id) {
+ var deep = [];
+ var children = $ax('#' + id).getChildren()[0].children;
+ var piecePrefix = id + 'p';
+
+ for (var i = 0; i < children.length; i++) {
+ if(children[i].substring(0, id.length + 1) == piecePrefix) {
+ deep.push(children[i]);
+ }
+ }
+ return deep;
+ };
+
+ var _addMove = function (elementId, eventInfo, moveInfo, optionsOverride) {
+ var eventInfoCopy = $ax.eventCopy(eventInfo);
+ var idToResizeMoveState = _getIdToResizeMoveState(eventInfoCopy);
+ eventInfoCopy.targetElement = elementId;
+
+ var options = $ax.deepCopy(moveInfo.options);
+ options.easing = optionsOverride.easing;
+ options.duration = optionsOverride.duration;
+ options.dragInfo = eventInfo.dragInfo;
+
+ if($ax.public.fn.IsLayer($obj(elementId).type)) {
+ var childrenIds = $ax.public.fn.getLayerChildrenDeep(elementId, true);
+ if(childrenIds.length == 0) return;
+
+ var animations = [];
+
+ // Get move delta once, then apply to all children
+ animations.push({
+ id: elementId,
+ type: queueTypes.move,
+ func: function() {
+ var layerInfo = $ax.public.fn.getWidgetBoundingRect(elementId);
+ var deltaLoc = _getMoveLoc(elementId, moveInfo, eventInfoCopy, optionsOverride.stop, idToResizeMoveState[elementId], options, layerInfo);
+// $ax.event.raiseSyntheticEvent(elementId, "onMove");
+ $ax.visibility.pushContainer(elementId, false);
+
+ options.onComplete = function () {
+ _fireAnimationFromQueue(elementId, queueTypes.move);
+ $ax.visibility.popContainer(elementId, false);
+ };
+
+ $ax('#' + elementId).moveBy(deltaLoc.x, deltaLoc.y, options);
+ }
+ });
+
+ //for(var i = 0; i < childrenIds.length; i++) {
+ // (function(childId) {
+ // animations.push({
+ // id: childId,
+ // type: queueTypes.move,
+ // func: function () {
+ // // Nop, while trying to move as container
+ // //$ax.event.raiseSyntheticEvent(childId, "onMove");
+ // //if($ax.public.fn.IsLayer($obj(childId).type)) _fireAnimationFromQueue(childId, queueTypes.move);
+ // //else $ax('#' + childId).moveBy(deltaLoc.x, deltaLoc.y, moveInfo.options);
+ // }
+ // });
+ // })(childrenIds[i]);
+ //}
+ _addAnimations(animations);
+ } else {
+ _addAnimation(elementId, queueTypes.move, function() {
+ var loc = _getMoveLoc(elementId, moveInfo, eventInfoCopy, optionsOverride.stop, idToResizeMoveState[elementId], options);
+
+// $ax.event.raiseSyntheticEvent(elementId, "onMove");
+ if(loc.moveTo) $ax('#' + elementId).moveTo(loc.x, loc.y, options);
+ else $ax('#' + elementId).moveBy(loc.x, loc.y, options);
+ });
+ }
+ };
+
+ var _moveSingleWidget = function (elementId, delta, options, onComplete) {
+ if(!delta.x && !delta.y) {
+ $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.move);
+ return;
+ }
+ var fixedInfo = $ax.dynamicPanelManager.getFixedInfo(elementId);
+ var xProp = 'left';
+ var xDiff = '+=';
+ if(fixedInfo) {
+ if(fixedInfo.horizontal == 'right') {
+ xProp = 'right';
+ xDiff = '-=';
+ } else if(fixedInfo.horizontal == 'center') {
+ xProp = 'margin-left';
+ }
+ }
+ var yProp = 'top';
+ var yDiff = '+=';
+ if(fixedInfo) {
+ if(fixedInfo.vertical == 'bottom') {
+ yProp = 'bottom';
+ yDiff = '-=';
+ } else if(fixedInfo.vertical == 'middle') {
+ yProp = 'margin-top';
+ }
+ }
+
+ var css = {};
+ css[xProp] = xDiff + delta.x;
+ css[yProp] = yDiff + delta.y;
+ var moveInfo = $ax.move.PrepareForMove(elementId, delta.x, delta.y,false, options);
+ $jobjAll(elementId).animate(css, {
+ duration: options.duration,
+ easing: options.easing,
+ queue: false,
+ complete: function () {
+ if(onComplete) onComplete();
+ if(moveInfo.rootLayer) $ax.visibility.popContainer(moveInfo.rootLayer, false);
+ $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.move);
+ }
+ });
+ }
+
+ var _getMoveLoc = function (elementId, moveInfo, eventInfoCopy, stopInfo, comboState, options, layerInfo) {
+ var moveTo = false;
+ var moveWithThis = false;
+ var xValue = 0;
+ var yValue = 0;
+ var moveResult = comboState.moveResult;
+ var widgetDragInfo = eventInfoCopy.dragInfo;
+ var jobj = $jobj(elementId);
+
+ var startX;
+ var startY;
+
+ switch(moveInfo.moveType) {
+ case "location":
+ // toRatio is ignoring anything before start since that has already taken effect we just know whe have from start to len to finish
+ // getting to the location we want to get to.
+ var toRatio = stopInfo.instant ? 1 : (stopInfo.end - stopInfo.start) / (stopInfo.len - stopInfo.start);
+
+ // If result already caluculated, don't recalculate again, other calculate and save
+ if (moveResult) {
+ xValue = moveResult.x;
+ yValue = moveResult.y;
+ } else {
+ comboState.moveResult = moveResult = { x: $ax.expr.evaluateExpr(moveInfo.xValue, eventInfoCopy), y: $ax.expr.evaluateExpr(moveInfo.yValue, eventInfoCopy) };
+ xValue = moveResult.x;
+ yValue = moveResult.y;
+ }
+ // If this is final stop for this move, then clear out the result so next move won't use it
+ if(stopInfo.instant || stopInfo.end == stopInfo.len) comboState.moveResult = undefined;
+
+ if (layerInfo) {
+ startX = layerInfo.left;
+ startY = layerInfo.top;
+ //} else if ($ax.public.fn.isCompoundVectorHtml(jobj[0])) {
+ // var dimensions = $ax.public.fn.compoundWidgetDimensions(jobj);
+ // startX = dimensions.left;
+ // startY = dimensions.top;
+ } else {
+ startX = $ax('#' + elementId).locRelativeIgnoreLayer(false);
+ startY = $ax('#' + elementId).locRelativeIgnoreLayer(true);
+ if(jobj.css('position') == 'fixed') {
+ startX -= $(window).scrollLeft();
+ startY -= $(window).scrollTop();
+ }
+ }
+
+ xValue = xValue == '' ? 0 : (xValue - startX) * toRatio;
+ yValue = yValue == '' ? 0 : (yValue - startY) * toRatio;
+
+ break;
+ case "delta":
+ var ratio = stopInfo.instant ? 1 : (stopInfo.end - stopInfo.start) / stopInfo.len;
+
+ // See case location above
+ if(moveResult) {
+ xValue = moveResult.x * ratio;
+ yValue = moveResult.y * ratio;
+ } else {
+ comboState.moveResult = moveResult = { x: $ax.expr.evaluateExpr(moveInfo.xValue, eventInfoCopy), y: $ax.expr.evaluateExpr(moveInfo.yValue, eventInfoCopy) };
+ xValue = moveResult.x * ratio;
+ yValue = moveResult.y * ratio;
+ }
+ if (stopInfo.instant || stopInfo.end == stopInfo.len) comboState.moveResult = undefined;
+
+ break;
+ case "drag":
+ xValue = widgetDragInfo.xDelta;
+ yValue = widgetDragInfo.yDelta;
+ break;
+ case "dragX":
+ xValue = widgetDragInfo.xDelta;
+ yValue = 0;
+ break;
+ case "dragY":
+ xValue = 0;
+ yValue = widgetDragInfo.yDelta;
+ break;
+ case "locationBeforeDrag":
+ var location = widgetDragInfo.movedWidgets[eventInfoCopy.targetElement];
+ if (location) {
+ var axObj = $ax('#' + eventInfoCopy.targetElement);
+ xValue = location.x - axObj.left();
+ yValue = location.y - axObj.top();
+ } else {
+ _fireAnimationFromQueue(eventInfoCopy.srcElement, queueTypes.move);
+ return { x: 0, y: 0 };
+ }
+ //moveTo = true;
+ break;
+ case "withThis":
+ moveWithThis = true;
+ var widgetMoveInfo = $ax.move.GetWidgetMoveInfo();
+ var srcElementId = $ax.getElementIdsFromEventAndScriptId(eventInfoCopy, eventInfoCopy.srcElement)[0];
+ var delta = widgetMoveInfo[srcElementId];
+ options.easing = delta.options.easing;
+ options.duration = delta.options.duration;
+ xValue = delta.x;
+ yValue = delta.y;
+ break;
+ }
+
+ if (options && options.boundaryExpr) {
+ //$ax.public.fn.removeCompound(jobj);
+
+ if(jobj.css('position') == 'fixed') {
+ //swap page coordinates with fixed coordinates
+ options.boundaryExpr.leftExpr.value = options.boundaryExpr.leftExpr.value.replace('.top', '.topfixed').replace('.left', '.leftfixed').replace('.bottom', '.bottomfixed').replace('.right', '.rightfixed');
+ options.boundaryExpr.leftExpr.stos[0].leftSTO.prop = options.boundaryExpr.leftExpr.stos[0].leftSTO.prop + 'fixed';
+ options.boundaryStos.boundaryScope.direcval0.value = options.boundaryStos.boundaryScope.direcval0.value.replace('.top', '.topfixed').replace('.left', '.leftfixed').replace('.bottom', '.bottomfixed').replace('.right', '.rightfixed');
+ options.boundaryStos.boundaryScope.direcval0.stos[0].leftSTO.prop = options.boundaryStos.boundaryScope.direcval0.stos[0].leftSTO.prop + 'fixed';
+ }
+
+ if(moveWithThis && (xValue || yValue)) {
+ _updateLeftExprVariable(options.boundaryExpr, xValue.toString(), yValue.toString());
+ }
+
+ if(!$ax.expr.evaluateExpr(options.boundaryExpr, eventInfoCopy)) {
+ var boundaryStoInfo = options.boundaryStos;
+ if(boundaryStoInfo) {
+ if(moveWithThis) {
+ var stoScopes = boundaryStoInfo.boundaryScope;
+ if(stoScopes) {
+ for(var s in stoScopes) {
+ var boundaryScope = stoScopes[s];
+ if(!boundaryScope.localVariables) continue;
+
+ if(boundaryScope.localVariables.withx) boundaryScope.localVariables.withx.value = xValue.toString();
+ if(boundaryScope.localVariables.withy) boundaryScope.localVariables.withy.value = yValue.toString();
+ }
+ }
+ }
+
+ if(layerInfo) {
+ startX = layerInfo.left;
+ startY = layerInfo.top;
+ } else {
+ startX = $ax('#' + elementId).locRelativeIgnoreLayer(false);
+ startY = $ax('#' + elementId).locRelativeIgnoreLayer(true);
+ if(jobj.css('position') == 'fixed') {
+ startX -= $(window).scrollLeft();
+ startY -= $(window).scrollTop();
+ }
+ }
+
+ if(boundaryStoInfo.ySto) {
+ var currentTop = layerInfo ? layerInfo.top : startY;
+ var newTop = $ax.evaluateSTO(boundaryStoInfo.ySto, boundaryStoInfo.boundaryScope, eventInfoCopy);
+ if(moveTo) yValue = newTop;
+ else yValue = newTop - currentTop;
+ }
+
+ if(boundaryStoInfo.xSto) {
+ var currentLeft = layerInfo ? layerInfo.left : startX;
+ var newLeft = $ax.evaluateSTO(boundaryStoInfo.xSto, boundaryStoInfo.boundaryScope, eventInfoCopy);
+ if(moveTo) xValue = newLeft;
+ else xValue = newLeft - currentLeft;
+ }
+ }
+ }
+
+ //$ax.public.fn.restoreCompound(jobj);
+ }
+
+ return { x: Number(xValue), y: Number(yValue), moveTo: moveTo };
+ };
+
+ //we will have something like [[Target.right + withX]] for leftExpr, and this function set the value of withX
+ var _updateLeftExprVariable = function (exprTree, xValue, yValue) {
+ if(exprTree.leftExpr && !exprTree.leftExpr.op) {
+ var localVars = exprTree.leftExpr.localVariables;
+ if(localVars) {
+ if(localVars.withx) localVars.withx.value = xValue;
+ if(localVars.withy) localVars.withy.value = yValue;
+ }
+ }
+
+ //traversal
+ if(exprTree.op) {
+ if(exprTree.leftExpr) _updateLeftExprVariable(exprTree.leftExpr, xValue, yValue);
+ if(exprTree.rightExpr) _updateLeftExprVariable(exprTree.rightExpr, xValue, yValue);
+ }
+ }
+
+ var widgetRotationFilter = [
+ $ax.constants.IMAGE_BOX_TYPE, $ax.constants.IMAGE_MAP_REGION_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE,
+ $ax.constants.VECTOR_SHAPE_TYPE, $ax.constants.VERTICAL_LINE_TYPE, $ax.constants.HORIZONTAL_LINE_TYPE
+ ];
+ _actionHandlers.rotateWidget = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.objectsToRotate.length; i++) {
+ var rotateInfo = action.objectsToRotate[i].rotateInfo;
+ var elementIds = $ax.getElementIdsFromPath(action.objectsToRotate[i].objectPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+ _queueResizeMove(elementId, queueTypes.rotate, eventInfo, rotateInfo);
+ }
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ var _addRotate = function (elementId, eventInfo, rotateInfo, options, moveInfo) {
+ var idToResizeMoveState = _getIdToResizeMoveState(eventInfo);
+ rotateInfo = $ax.deepCopy(rotateInfo);
+ rotateInfo.options.easing = options.easing;
+ rotateInfo.options.duration = options.duration;
+
+ var eventInfoCopy = $ax.eventCopy(eventInfo);
+ eventInfoCopy.targetElement = elementId;
+
+ //calculate degree value at start of animation
+ var rotateDegree;
+ var offset = {};
+ var eval = function(boundingRect) {
+ rotateDegree = parseFloat($ax.expr.evaluateExpr(rotateInfo.degree, eventInfoCopy));
+ offset.x = Number($ax.expr.evaluateExpr(rotateInfo.offsetX, eventInfoCopy));
+ offset.y = Number($ax.expr.evaluateExpr(rotateInfo.offsetY, eventInfoCopy));
+ if(!rotateInfo.options.clockwise) rotateDegree = -rotateDegree;
+
+ _updateOffset(offset, rotateInfo.anchor, boundingRect);
+ }
+
+ if(moveInfo) {
+ var moveOptions = { dragInfo: eventInfoCopy.dragInfo, duration: options.duration, easing: options.easing, boundaryExpr: moveInfo.options.boundaryExpr, boundaryStos: moveInfo.options.boundaryStos };
+ }
+
+ var obj = $obj(elementId);
+
+ if($ax.public.fn.IsLayer(obj.type)) {
+ var childrenIds = $ax.public.fn.getLayerChildrenDeep(elementId, true, true);
+ if(childrenIds.length == 0) return;
+
+ var animations = [];
+ //get center point of the group, and degree delta
+ var centerPoint, degreeDelta, moveDelta;
+ animations.push({
+ id: elementId,
+ type: queueTypes.rotate,
+ func: function () {
+ var boundingRect = $axure.fn.getWidgetBoundingRect(elementId);
+ eval(boundingRect);
+ centerPoint = boundingRect.centerPoint;
+ centerPoint.x += offset.x;
+ centerPoint.y += offset.y;
+ degreeDelta = _initRotateLayer(elementId, rotateInfo, rotateDegree, options, options.stop);
+ _fireAnimationFromQueue(elementId, queueTypes.rotate);
+
+ moveDelta = { x: 0, y: 0 };
+ if (moveInfo) {
+ moveDelta = _getMoveLoc(elementId, moveInfo, eventInfoCopy, options.moveStop, idToResizeMoveState[elementId], moveOptions, boundingRect);
+ if (moveDelta.moveTo) {
+ moveDelta.x -= $ax.getNumFromPx($jobj(elementId).css('left'));
+ moveDelta.y -= $ax.getNumFromPx($jobj(elementId).css('top'));
+ }
+ $ax.event.raiseSyntheticEvent(elementId, 'onMove');
+ }
+ }
+ });
+
+ for(var idIndex = 0; idIndex < childrenIds.length; idIndex++) {
+ var childId = childrenIds[idIndex];
+ (function(id) {
+ var childObj = $obj(id);
+ var rotate = $.inArray(childObj.type, widgetRotationFilter) != -1;
+
+ var isLayer = $ax.public.fn.IsLayer(childObj.type);
+ animations.push({
+ id: id,
+ type: queueTypes.rotate,
+ func: function() {
+ $ax.event.raiseSyntheticEvent(id, "onRotate");
+ if(isLayer) _fireAnimationFromQueue(id, queueTypes.rotate);
+ else $ax('#' + id).circularMoveAndRotate(degreeDelta, options, centerPoint.x, centerPoint.y, rotate, moveDelta);
+ }
+ });
+ if(!isLayer) animations.push({ id: id, type: queueTypes.move, func: function() {} });
+ })(childId);
+ }
+
+ _addAnimations(animations);
+ } else {
+ animations = [];
+ animations.push({
+ id: elementId,
+ type: queueTypes.rotate,
+ func: function () {
+ var jobj = $jobj(elementId);
+ var unrotatedDim = { width: $ax.getNumFromPx(jobj.css('width')), height: $ax.getNumFromPx(jobj.css('height')) };
+ eval(unrotatedDim);
+ var delta = { x: 0, y: 0 };
+ if(moveInfo) {
+ delta = _getMoveLoc(elementId, moveInfo, eventInfoCopy, options.moveStop, idToResizeMoveState[elementId], moveOptions);
+ if(delta.moveTo) {
+ delta.x -= $ax.getNumFromPx($jobj(elementId).css('left'));
+ delta.y -= $ax.getNumFromPx($jobj(elementId).css('top'));
+ }
+ }
+
+ $ax.event.raiseSyntheticEvent(elementId, 'onRotate');
+ if(offset.x == 0 && offset.y == 0) _rotateSingle(elementId, rotateDegree, rotateInfo.rotateType == 'location', delta, options, options.stop, true);
+ else _rotateSingleOffset(elementId, rotateDegree, rotateInfo.rotateType == 'location', delta, { x: offset.x, y: offset.y }, options, options.stop);
+ if(moveInfo) $ax.event.raiseSyntheticEvent(elementId, 'onMove');
+ }
+ });
+ animations.push({ id: elementId, type: queueTypes.move, func: function () { } });
+
+ _addAnimations(animations);
+ }
+ }
+
+ var _updateOffset = function(offset, anchor, boundingRect) {
+ if (anchor.indexOf('left') != -1) offset.x -= boundingRect.width / 2;
+ if (anchor.indexOf('right') != -1) offset.x += boundingRect.width / 2;
+ if (anchor.indexOf('top') != -1) offset.y -= boundingRect.height / 2;
+ if (anchor.indexOf('bottom') != -1) offset.y += boundingRect.height / 2;
+ }
+
+ var _rotateSingle = function(elementId, rotateDegree, rotateTo, delta, options, stop, handleMove) {
+ var degreeDelta = _applyRotateStop(rotateDegree, $ax.move.getRotationDegree(elementId), rotateTo, stop);
+ $ax('#' + elementId).rotate(degreeDelta, options.easing, options.duration, false, true);
+ if(handleMove) {
+ if (delta.x || delta.y) _moveSingleWidget(elementId, delta, options);
+ else $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.move);
+ }
+ };
+
+ var _rotateSingleOffset = function (elementId, rotateDegree, rotateTo, delta, offset, options, stop, resizeOffset) {
+ var obj = $obj(elementId);
+ var currRotation = $ax.move.getRotationDegree(elementId);
+
+ // Need to fix offset. Want to to stay same place on widget after rotation, so need to take the offset and rotate it to where it should be.
+ if(currRotation) {
+ offset = $axure.fn.getPointAfterRotate(currRotation, offset, { x: 0, y: 0 });
+ }
+
+ var degreeDelta = _applyRotateStop(rotateDegree, currRotation, rotateTo, stop);
+ var widgetCenter = $axure.fn.getWidgetBoundingRect(elementId).centerPoint;
+
+ var rotate = $.inArray(obj.type, widgetRotationFilter) != -1;
+ $ax('#' + elementId).circularMoveAndRotate(degreeDelta, options, widgetCenter.x + offset.x, widgetCenter.y + offset.y, rotate, delta, resizeOffset);
+ }
+
+ var _applyRotateStop = function(rotateDegree, currRotation, to, stop) {
+ var degreeDelta;
+ var ratio;
+ if(to) {
+ degreeDelta = rotateDegree - currRotation;
+ ratio = stop.instant ? 1 : (stop.end - stop.start) / (stop.len - stop.start);
+ } else {
+ degreeDelta = rotateDegree;
+ ratio = stop.instant ? 1 : (stop.end - stop.start) / stop.len;
+ }
+
+ return degreeDelta * ratio;
+ }
+
+
+ var _initRotateLayer = function(elementId, rotateInfo, rotateDegree, options, stop) {
+ var layerDegree = $jobj(elementId).data('layerDegree');
+ if (layerDegree === undefined) layerDegree = 0;
+ else layerDegree = parseFloat(layerDegree);
+
+ var to = rotateInfo.rotateType == 'location';
+ var newDegree = to ? rotateDegree : layerDegree + rotateDegree;
+ var degreeDelta = newDegree - layerDegree;
+
+ var ratio = stop.instant ? 1 : (stop.end - stop.start) / (stop.len - stop.start);
+ degreeDelta *= ratio;
+
+ $jobj(elementId).data('layerDegree', newDegree);
+ $ax.event.raiseSyntheticEvent(elementId, "onRotate");
+
+ return degreeDelta;
+ }
+
+ _actionHandlers.setWidgetSize = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.objectsToResize.length; i++) {
+ var resizeInfo = action.objectsToResize[i].sizeInfo;
+ var objPath = action.objectsToResize[i].objectPath;
+ if(objPath == 'thisItem') {
+ var thisId = eventInfo.srcElement;
+ var repeaterId = $ax.getParentRepeaterFromElementId(thisId);
+ var itemId = $ax.repeater.getItemIdFromElementId(thisId);
+ var currSize = $ax.repeater.getItemSize(repeaterId, itemId);
+ var newSize = _getSizeFromInfo(resizeInfo, eventInfo, currSize.width, currSize.height);
+ $ax.repeater.setItemSize(repeaterId, itemId, newSize.width, newSize.height);
+
+ continue;
+ }
+
+ var elementIds = $ax.getElementIdsFromPath(objPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+ _queueResizeMove(elementId, queueTypes.resize, eventInfo, resizeInfo);
+ //_addResize(elementId, resizeInfo);
+ }
+ }
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ // Move info undefined unless this move/resize actions are being merged
+ var _addResize = function(elementId, eventInfo, resizeInfo, options, moveInfo, rotateInfo) {
+ var axObject = $obj(elementId);
+ resizeInfo = $ax.deepCopy(resizeInfo);
+ resizeInfo.easing = options.easing;
+ resizeInfo.duration = options.duration;
+
+ var eventInfoCopy = $ax.eventCopy(eventInfo);
+ eventInfoCopy.targetElement = elementId;
+
+ var moves = moveInfo || resizeInfo.anchor != "top left" || ($ax.public.fn.IsDynamicPanel(axObject.type) &&
+ ((axObject.fixedHorizontal && axObject.fixedHorizontal == 'center') || (axObject.fixedVertical && axObject.fixedVertical == 'middle'))) ||
+ (rotateInfo && (rotateInfo.offsetX || rotateInfo.offsetY));
+
+ if(moveInfo) {
+ var moveOptions = { dragInfo: eventInfoCopy.dragInfo, duration: options.duration, easing: options.easing, boundaryExpr: moveInfo.options.boundaryExpr, boundaryStos: moveInfo.options.boundaryStos };
+ }
+
+ var idToResizeMoveState = _getIdToResizeMoveState(eventInfoCopy);
+
+ var animations = [];
+ if($ax.public.fn.IsLayer(axObject.type)) {
+ moves = true; // Assume widgets will move will layer, even though not all widgets may move
+ var childrenIds = $ax.public.fn.getLayerChildrenDeep(elementId, true, true);
+ if(childrenIds.length === 0) return;
+ // Need to wait to calculate new size, until time to animate, but animates are in separate queues
+ // best option seems to be to calculate in a "animate" for the layer itself and all children will use that.
+ // May just have to be redundant if this doesn't work well.
+
+ var boundingRect, widthChangedPercent, heightChangedPercent, unchanged, deltaLoc, degreeDelta, resizeOffset;
+ animations.push({
+ id: elementId,
+ type: queueTypes.resize,
+ func: function () {
+ $ax.visibility.pushContainer(elementId, false);
+ boundingRect = $ax.public.fn.getWidgetBoundingRect(elementId);
+ var size = _getSizeFromInfo(resizeInfo, eventInfoCopy, boundingRect.width, boundingRect.height, elementId);
+ deltaLoc = { x: 0, y: 0 };
+
+ var stop = options.stop;
+ var ratio = stop.instant ? 1 : (stop.end - stop.start) / (stop.len - stop.start);
+ widthChangedPercent = Math.round(size.width - boundingRect.width) / boundingRect.width * ratio;
+ heightChangedPercent = Math.round(size.height - boundingRect.height) / boundingRect.height * ratio;
+ resizeOffset = _applyAnchorToResizeOffset(widthChangedPercent * boundingRect.width, heightChangedPercent * boundingRect.height, resizeInfo.anchor);
+ if(stop.instant || stop.end == stop.len) idToResizeMoveState[elementId].resizeResult = undefined;
+
+ unchanged = widthChangedPercent === 0 && heightChangedPercent === 0;
+ $ax.event.raiseSyntheticEvent(elementId, 'onResize');
+ _fireAnimationFromQueue(elementId, queueTypes.resize);
+ }
+ });
+
+ if(moveInfo) animations.push({
+ id: elementId,
+ type: queueTypes.move,
+ func: function() {
+ deltaLoc = _getMoveLoc(elementId, moveInfo, eventInfoCopy, options.moveStop, idToResizeMoveState[elementId], moveOptions, boundingRect);
+ $ax.visibility.pushContainer(elementId, false);
+ _fireAnimationFromQueue(elementId, queueTypes.move);
+ $ax.event.raiseSyntheticEvent(elementId, 'onMove');
+ }
+ });
+ if (rotateInfo) animations.push({
+ id: elementId,
+ type: queueTypes.rotate,
+ func: function () {
+ resizeOffset = _applyAnchorToResizeOffset(widthChangedPercent * boundingRect.width, heightChangedPercent * boundingRect.height, resizeInfo.anchor);
+ var rotateDegree = parseFloat($ax.expr.evaluateExpr(rotateInfo.degree, eventInfoCopy));
+ degreeDelta = _initRotateLayer(elementId, rotateInfo, rotateDegree, options, options.rotateStop);
+ _fireAnimationFromQueue(elementId, queueTypes.rotate);
+ $ax.event.raiseSyntheticEvent(elementId, 'onRotate');
+ }
+ });
+
+ var completeCount = childrenIds.length*2; // Because there is a resize and move complete, it needs to be doubled
+ for(var idIndex = 0; idIndex < childrenIds.length; idIndex++) {
+ // Need to use scoping trick here to make sure childId doesn't change on next loop
+ (function(childId) {
+ //use ax obj to get width and height, jquery css give us the value without border
+ var isLayer = $ax.public.fn.IsLayer($obj(childId).type);
+ var rotate = $.inArray($obj(childId).type, widgetRotationFilter) != -1;
+ animations.push({
+ id: childId,
+ type: queueTypes.resize,
+ func: function() {
+ //$ax.event.raiseSyntheticEvent(childId, 'onResize');
+ if(isLayer) {
+ completeCount -= 2;
+ _fireAnimationFromQueue(childId, queueTypes.resize);
+ $ax.event.raiseSyntheticEvent(childId, 'onResize');
+ } else {
+ var currDeltaLoc = { x: deltaLoc.x, y: deltaLoc.y };
+ var resizeDeltaMove = { x: 0, y: 0 };
+ var css = _getCssForResizingLayerChild(childId, resizeInfo.anchor, boundingRect, widthChangedPercent, heightChangedPercent, resizeDeltaMove);
+ var onComplete = function() {
+ if(--completeCount == 0) $ax.visibility.popContainer(elementId, false);
+ };
+ $ax('#' + childId).resize(css, resizeInfo, true, moves, onComplete);
+ if(rotateInfo) {
+ var offset = { x: Number($ax.expr.evaluateExpr(rotateInfo.offsetX, eventInfoCopy)), y: Number($ax.expr.evaluateExpr(rotateInfo.offsetY, eventInfo)) };
+ _updateOffset(offset, resizeInfo.anchor, boundingRect);
+ var centerPoint = { x: boundingRect.centerPoint.x + offset.x, y: boundingRect.centerPoint.y + offset.y };
+ $ax('#' + childId).circularMoveAndRotate(degreeDelta, options, centerPoint.x, centerPoint.y, rotate, currDeltaLoc, resizeOffset, resizeDeltaMove, onComplete);
+ } else {
+ currDeltaLoc.x += resizeDeltaMove.x;
+ currDeltaLoc.y += resizeDeltaMove.y;
+ _moveSingleWidget(childId, currDeltaLoc, options, onComplete);
+ }
+ }
+ }
+ });
+ if(!isLayer) animations.push({ id: childId, type: queueTypes.move, func: function () {} });
+ if(!isLayer && rotateInfo) animations.push({ id: childId, type: queueTypes.rotate, func: function () {} });
+ })(childrenIds[idIndex]);
+ }
+ } else {
+ // Not func, obj with func
+ animations.push({
+ id: elementId,
+ type: queueTypes.resize,
+ func: function() {
+ //textarea can be resized manully by the user, but doesn't update div size yet, so doing this for now.
+ //alternatively axquery get for size can account for this
+
+ var sizeId = $ax.public.fn.IsTextArea(axObject.type) ? $jobj(elementId).children('textarea').attr('id') : elementId;
+ var oldSize = $ax('#' + sizeId).size();
+ var oldWidth = oldSize.width;
+ var oldHeight = oldSize.height;
+
+ var stop = options.stop;
+ var ratio = stop.instant ? 1 : (stop.end - stop.start) / (stop.len - stop.start);
+
+ var size = _getSizeFromInfo(resizeInfo, eventInfoCopy, oldWidth, oldHeight, elementId);
+ var newWidth = size.width;
+ var newHeight = size.height;
+ var deltaWidth = Math.round(newWidth - oldWidth) * ratio;
+ var deltaHeight = Math.round(newHeight - oldHeight) * ratio;
+ newWidth = oldWidth + deltaWidth;
+ newHeight = oldHeight + deltaHeight;
+
+ var delta = { x: 0, y: 0 };
+ if(moveInfo) {
+ delta = _getMoveLoc(elementId, moveInfo, eventInfoCopy, options.moveStop, idToResizeMoveState[elementId], moveOptions);
+ if (delta.moveTo) {
+ delta.x -= $ax.getNumFromPx($jobj(elementId).css('left'));
+ delta.y -= $ax.getNumFromPx($jobj(elementId).css('top'));
+ }
+ }
+
+ var rotateHandlesMove = false;
+ var offset = { x: 0, y: 0 };
+ if(rotateInfo) {
+ offset.x = Number($ax.expr.evaluateExpr(rotateInfo.offsetX, eventInfoCopy));
+ offset.y = Number($ax.expr.evaluateExpr(rotateInfo.offsetY, eventInfoCopy));
+ _updateOffset(offset, rotateInfo.anchor, $axure.fn.getWidgetBoundingRect(elementId));
+ rotateHandlesMove = Boolean(rotateInfo && (offset.x || offset.y || rotateInfo.anchor != 'center'));
+ $ax.event.raiseSyntheticEvent(elementId, 'onRotate');
+ }
+
+ var css = null;
+ var rootLayer = null;
+ if(deltaHeight != 0 || deltaWidth != 0) {
+ rootLayer = $ax.move.getRootLayer(elementId);
+ if(rootLayer) $ax.visibility.pushContainer(rootLayer, false);
+ css = _getCssForResizingWidget(elementId, eventInfoCopy, resizeInfo.anchor, newWidth, newHeight, oldWidth, oldHeight, delta, options.stop, !rotateHandlesMove);
+ idToResizeMoveState[elementId].resizeResult = undefined;
+ }
+
+ if(rotateInfo) {
+ var rotateDegree = parseFloat($ax.expr.evaluateExpr(rotateInfo.degree, eventInfoCopy));
+
+ if(rotateHandlesMove) {
+ var resizeOffset = _applyAnchorToResizeOffset(deltaWidth, deltaHeight, rotateInfo.anchor);
+ _rotateSingleOffset(elementId, rotateDegree, rotateInfo.rotateType == 'location', delta, offset, options, options.rotateStop, resizeOffset);
+ } else {
+ // Not handling move so pass in nop delta
+ _rotateSingle(elementId, rotateDegree, rotateInfo.rotateType == 'location', { x: 0, y: 0 }, options, options.rotateStop);
+ if (moves) _fireAnimationFromQueue(elementId, queueTypes.move);
+ }
+ } else if(!css && moves) _moveSingleWidget(elementId, delta, options);
+
+ // Have to do it down here to make sure move info is registered
+ if(moveInfo) $ax.event.raiseSyntheticEvent(elementId, 'onMove');
+
+ //$ax.event.raiseSyntheticEvent(elementId, 'onResize');
+ if (css) {
+ $ax('#' + elementId).resize(css, resizeInfo, true, moves, function () {
+ if(rootLayer) $ax.visibility.popContainer(rootLayer, false);
+ });
+ } else {
+ _fireAnimationFromQueue(elementId, queueTypes.resize);
+
+ $ax.event.raiseSyntheticEvent(elementId, 'onResize');
+ }
+ }
+ });
+ // Nop move (move handled by resize)
+ if(rotateInfo) animations.push({ id: elementId, type: queueTypes.rotate, func: function () { } });
+ if(moves) animations.push({ id: elementId, type: queueTypes.move, func: function () { } });
+ }
+
+ _addAnimations(animations);
+ };
+
+ var _applyAnchorToResizeOffset = function (deltaWidth, deltaHeight, anchor) {
+ var offset = {};
+ if (anchor.indexOf('left') != -1) offset.x = -deltaWidth / 2;
+ else if (anchor.indexOf('right') != -1) offset.x = deltaWidth / 2;
+ if (anchor.indexOf('top') != -1) offset.y = -deltaHeight / 2;
+ else if (anchor.indexOf('bottom') != -1) offset.y = deltaHeight / 2;
+
+ return offset;
+ }
+
+ //var _getOldAndNewSize = function (resizeInfo, eventInfo, targetElement) {
+ // var axObject = $obj(targetElement);
+ // var oldWidth, oldHeight;
+ // //textarea can be resized manully by the user, use the textarea child to get the current size
+ // //because this new size may not be reflected on its parents yet
+ // if ($ax.public.fn.IsTextArea(axObject.type)) {
+ // var jObject = $jobj(elementId);
+ // var textObj = $ax('#' + jObject.children('textarea').attr('id'));
+ // //maybe we shouldn't use ax obj to get width and height here anymore...
+ // oldWidth = textObj.width();
+ // oldHeight = textObj.height();
+ // } else {
+ // oldWidth = $ax('#' + elementId).width();
+ // oldHeight = $ax('#' + elementId).height();
+ // }
+
+ // var size = _getSizeFromInfo(resizeInfo, eventInfo, oldHeight, oldWidth, elementId);
+ // return { oldWidth: oldWidth, oldHeight: oldHeight, newWidth: size.width, newHeight: size.height, change: oldWidth != size.width || oldHeight != size.height };
+ //}
+
+ var _getSizeFromInfo = function(resizeInfo, eventInfo, oldWidth, oldHeight, targetElement) {
+ var oldTarget = eventInfo.targetElement;
+ eventInfo.targetElement = targetElement;
+
+ var state = _getIdToResizeMoveState(eventInfo)[targetElement];
+ if(state && state.resizeResult) return state.resizeResult;
+
+ var width = $ax.expr.evaluateExpr(resizeInfo.width, eventInfo);
+ var height = $ax.expr.evaluateExpr(resizeInfo.height, eventInfo);
+ eventInfo.targetElement = oldTarget;
+
+
+ // If either one is not a number, use the old value
+ width = width != "" ? Number(width) : oldWidth;
+ height = height != "" ? Number(height) : oldHeight;
+
+ width = isNaN(width) ? oldWidth : width;
+ height = isNaN(height) ? oldHeight : height;
+
+ // can't be negative
+ var result = { width: Math.max(width, 0), height: Math.max(height, 0) };
+ if(state) state.resizeResult = result;
+ return result;
+ }
+
+ //var _queueResize = function (elementId, css, resizeInfo) {
+ // var resizeFunc = function() {
+ // $ax('#' + elementId).resize(css, resizeInfo, true);
+ // //$ax.public.fn.resize(elementId, css, resizeInfo, true);
+ // };
+ // var obj = $obj(elementId);
+ // var moves = resizeInfo.anchor != "top left" || ($ax.public.fn.IsDynamicPanel(obj.type) && ((obj.fixedHorizontal && obj.fixedHorizontal == 'center') || (obj.fixedVertical && obj.fixedVertical == 'middle')))
+ // if(!moves) {
+ // _addAnimation(elementId, queueTypes.resize, resizeFunc);
+ // } else {
+ // var animations = [];
+ // animations[0] = { id: elementId, type: queueTypes.resize, func: resizeFunc };
+ // animations[1] = { id: elementId, type: queueTypes.move, func: function() {}}; // Nop func - resize handles move and firing from queue
+ // _addAnimations(animations);
+ // }
+ //};
+
+ //should clean this function and
+ var _getCssForResizingWidget = function (elementId, eventInfo, anchor, newWidth, newHeight, oldWidth, oldHeight, delta, stop, handleMove) {
+ var ratio = stop.instant ? 1 : (stop.end - stop.start) / (stop.len - stop.start);
+ var deltaWidth = (newWidth - oldWidth) * ratio;
+ var deltaHeight = (newHeight - oldHeight) * ratio;
+ if(stop.instant || stop.end == stop.len) {
+ var idToResizeMoveState = _getIdToResizeMoveState(eventInfo);
+ if(idToResizeMoveState[elementId]) idToResizeMoveState[elementId].resizeResult = undefined;
+ }
+
+ var css = {};
+ css.height = oldHeight + deltaHeight;
+
+ var obj = $obj(elementId);
+ //if it's 100% width, don't change its width
+ if($ax.dynamicPanelManager.isPercentWidthPanel(obj)) var is100Dp = true;
+ else css.width = oldWidth + deltaWidth;
+
+ var jobj = $jobj(elementId);
+ //if this is pinned dp, we will mantain the pin, no matter how you resize it; so no need changes left or top
+ //NOTE: currently only pinned DP has position == fixed
+ if(jobj.css('position') == 'fixed') {
+ if(obj.fixedHorizontal && obj.fixedHorizontal == 'center') css['margin-left'] = '+=' + delta.x;
+ if(obj.fixedVertical && obj.fixedVertical == 'middle') css['margin-top'] = '+=' + delta.y;
+ return css;
+ }
+
+ // If it is pinned, but temporarily not fixed because it is wrappen in a container, then just make sure to anchor it correctly
+ if(obj.fixedVertical) {
+ if(obj.fixedVertical == 'middle') anchor = obj.fixedHorizontal;
+ else anchor = obj.fixedVertical + (obj.fixedHorizontal == 'center' ? '' : ' ' + obj.fixedHorizontal);
+
+ }
+
+ //use position relative to parents
+ //var position = obj.generateCompound ? $ax.public.fn.getWidgetBoundingRect(elementId) : $ax.public.fn.getPositionRelativeToParent(elementId);
+
+
+ var locationShift;
+ switch(anchor) {
+ case "top left":
+ locationShift = { x: 0, y: 0 }; break;
+ case "top":
+ locationShift = { x: -deltaWidth / 2.0, y: 0.0 }; break;
+ case "top right":
+ locationShift = { x: -deltaWidth, y: 0.0 }; break;
+ case "left":
+ locationShift = { x: 0.0, y: -deltaHeight / 2.0 }; break;
+ case "center":
+ locationShift = { x: -deltaWidth / 2.0, y: -deltaHeight / 2.0 }; break;
+ case "right":
+ locationShift = { x: -deltaWidth, y: -deltaHeight / 2.0 }; break;
+ case "bottom left":
+ locationShift = { x: 0.0, y: -deltaHeight }; break;
+ case "bottom":
+ locationShift = { x: -deltaWidth/2.0, y: -deltaHeight }; break;
+ case "bottom right":
+ locationShift = { x: -deltaWidth, y: -deltaHeight }; break;
+ }
+
+ if(handleMove) {
+ if(jobj.css('position') === 'absolute') {
+ css.left = $ax.getNumFromPx(jobj.css('left')) + locationShift.x + delta.x;
+ css.top = $ax.getNumFromPx(jobj.css('top')) + locationShift.y + delta.y;
+ } else {
+ var axQuery = $ax('#' + elementId);
+ css.left = axQuery.left(true) + locationShift.x + delta.x;
+ css.top = axQuery.top(true) + locationShift.y + delta.y;
+ }
+ } else {
+ delta.x += locationShift.x;
+ delta.y += locationShift.y;
+ }
+
+ return css;
+ };
+
+
+ var _getCssForResizingLayerChild = function (elementId, anchor, layerBoundingRect, widthChangedPercent, heightChangedPercent, deltaLoc) {
+ var boundingRect = $ax.public.fn.getWidgetBoundingRect(elementId);
+ var childCenterPoint = boundingRect.centerPoint;
+
+ var currentSize = $ax('#' + elementId).size();
+ var newWidth = currentSize.width + currentSize.width * widthChangedPercent;
+ var newHeight = currentSize.height + currentSize.height * heightChangedPercent;
+
+ var css = {};
+ css.height = newHeight;
+
+ var obj = $obj(elementId);
+ //if it's 100% width, don't change its width and left
+ var changeLeft = true;
+ if($ax.dynamicPanelManager.isPercentWidthPanel(obj)) changeLeft = false;
+ else css.width = newWidth;
+
+ var jobj = $jobj(elementId);
+ //if this is pinned dp, we will mantain the pin, no matter how you resize it; so no need changes left or top
+ //NOTE: currently only pinned DP has position == fixed
+ if(jobj.css('position') == 'fixed') return css;
+ //use bounding rect position relative to parents to calculate delta
+ var axObj = $ax('#' + elementId);
+ // This will be absolute world coordinates, but we want body coordinates.
+ var currentLeft = axObj.locRelativeIgnoreLayer(false);
+ var currentTop = axObj.locRelativeIgnoreLayer(true);
+
+ var resizable = $ax.public.fn.IsResizable(obj.type);
+ if(anchor.indexOf("top") > -1) {
+ var topDelta = (currentTop - layerBoundingRect.top) * heightChangedPercent;
+ if(!resizable && Math.round(topDelta)) topDelta += currentSize.height * heightChangedPercent;
+ } else if(anchor.indexOf("bottom") > -1) {
+ if(resizable) topDelta = (currentTop - layerBoundingRect.bottom) * heightChangedPercent;
+ else {
+ var bottomDelta = Math.round(currentTop + currentSize.height - layerBoundingRect.bottom) * heightChangedPercent;
+ if(bottomDelta) topDelta = bottomDelta - currentSize.height * heightChangedPercent;
+ else topDelta = 0;
+ }
+ } else { //center vertical
+ if(resizable) topDelta = (childCenterPoint.y - layerBoundingRect.centerPoint.y)*heightChangedPercent - currentSize.height*heightChangedPercent/2;
+ else {
+ var centerTopChange = Math.round(childCenterPoint.y - layerBoundingRect.centerPoint.y)*heightChangedPercent;
+ if(centerTopChange > 0) topDelta = centerTopChange + Math.abs(currentSize.height * heightChangedPercent / 2);
+ else if(centerTopChange < 0) topDelta = centerTopChange - Math.abs(currentSize.height * heightChangedPercent / 2);
+ else topDelta = 0;
+ }
+ }
+
+ if(changeLeft) {
+ if(anchor.indexOf("left") > -1) {
+ var leftDelta = (currentLeft - layerBoundingRect.left) * widthChangedPercent;
+ if(!resizable && Math.round(leftDelta)) leftDelta += currentSize.width * widthChangedPercent;
+ } else if(anchor.indexOf("right") > -1) {
+ if(resizable) leftDelta = (currentLeft - layerBoundingRect.right) * widthChangedPercent;
+ else {
+ var rightDelta = Math.round(currentLeft + currentSize.width - layerBoundingRect.right) * widthChangedPercent;
+ if(rightDelta) leftDelta = rightDelta - currentSize.width * widthChangedPercent;
+ else leftDelta = 0;
+ }
+ } else { //center horizontal
+ if(resizable) leftDelta = (childCenterPoint.x - layerBoundingRect.centerPoint.x)*widthChangedPercent - currentSize.width*widthChangedPercent/2;
+ else {
+ var centerLeftChange = Math.round(childCenterPoint.x - layerBoundingRect.centerPoint.x) * widthChangedPercent;
+ if(centerLeftChange > 0) leftDelta = centerLeftChange + Math.abs(currentSize.width * widthChangedPercent / 2);
+ else if(centerLeftChange < 0) leftDelta = centerLeftChange - Math.abs(currentSize.width * widthChangedPercent / 2);
+ else leftDelta = 0;
+ }
+ }
+ }
+
+ if(topDelta) deltaLoc.y += topDelta;
+ if(leftDelta && changeLeft) deltaLoc.x += leftDelta;
+
+ return css;
+ };
+
+ _actionHandlers.setPanelOrder = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.panelPaths.length; i++) {
+ var func = action.panelPaths[i].setOrderInfo.bringToFront ? 'bringToFront' : 'sendToBack';
+ var elementIds = $ax.getElementIdsFromPath(action.panelPaths[i].panelPath, eventInfo);
+ for(var j = 0; j < elementIds.length; j++) $ax('#' + elementIds[j])[func]();
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.modifyDataSetEditItems = function(eventInfo, actions, index) {
+ var action = actions[index];
+ var add = action.repeatersToAddTo;
+ var repeaters = add || action.repeatersToRemoveFrom;
+ var itemId;
+ for(var i = 0; i < repeaters.length; i++) {
+ var data = repeaters[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(data.path, eventInfo)[0];
+ if(!id) continue;
+
+ if(data.addType == 'this') {
+ var scriptId = $ax.repeater.getScriptIdFromElementId(eventInfo.srcElement);
+ itemId = $ax.repeater.getItemIdFromElementId(eventInfo.srcElement);
+ var repeaterId = $ax.getParentRepeaterFromScriptId(scriptId);
+ if(add) $ax.repeater.addEditItems(repeaterId, [itemId]);
+ else $ax.repeater.removeEditItems(repeaterId, [itemId]);
+ } else if(data.addType == 'all') {
+ var allItems = $ax.repeater.getAllItemIds(id);
+ if(add) $ax.repeater.addEditItems(id, allItems);
+ else $ax.repeater.removeEditItems(id, allItems);
+ } else {
+ var oldTarget = eventInfo.targetElement;
+ var itemIds = $ax.repeater.getAllItemIds(id);
+ var itemIdsToAdd = [];
+ for(var j = 0; j < itemIds.length; j++) {
+ itemId = itemIds[j];
+ eventInfo.targetElement = $ax.repeater.createElementId(id, itemId);
+ if($ax.expr.evaluateExpr(data.query, eventInfo) == "true") {
+ itemIdsToAdd[itemIdsToAdd.length] = String(itemId);
+ }
+ eventInfo.targetElement = oldTarget;
+ }
+ if(add) $ax.repeater.addEditItems(id, itemIdsToAdd);
+ else $ax.repeater.removeEditItems(id, itemIdsToAdd);
+ }
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _action.repeaterInfoNames = { addItemsToDataSet: 'dataSetsToAddTo', deleteItemsFromDataSet: 'dataSetItemsToRemove', updateItemsInDataSet: 'dataSetsToUpdate',
+ addFilterToRepeater: 'repeatersToAddFilter', removeFilterFromRepeater: 'repeatersToRemoveFilter',
+ addSortToRepeater: 'repeaterToAddSort', removeSortFromRepeater: 'repeaterToRemoveSort',
+ setRepeaterToPage: 'repeatersToSetPage', setItemsPerRepeaterPage: 'repeatersToSetItemCount'
+ };
+
+ _actionHandlers.addItemsToDataSet = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.dataSetsToAddTo.length; i++) {
+ var datasetInfo = action.dataSetsToAddTo[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(datasetInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+ var dataset = datasetInfo.data;
+
+ for(var j = 0; j < dataset.length; j++) $ax.repeater.addItem(id, $ax.deepCopy(dataset[j]), eventInfo);
+ if(dataset.length) _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.deleteItemsFromDataSet = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.dataSetItemsToRemove.length; i++) {
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var deleteInfo = action.dataSetItemsToRemove[i];
+ var id = $ax.getElementIdsFromPath(deleteInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+ $ax.repeater.deleteItems(id, eventInfo, deleteInfo.type, deleteInfo.rule);
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.updateItemsInDataSet = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.dataSetsToUpdate.length; i++) {
+ var dataSet = action.dataSetsToUpdate[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(dataSet.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ $ax.repeater.updateEditItems(id, dataSet.props, eventInfo, dataSet.type, dataSet.rule);
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.setRepeaterToDataSet = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToSet.length; i++) {
+ var setRepeaterInfo = action.repeatersToSet[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(setRepeaterInfo.path, eventInfo)[0];
+ if(!id) continue;
+ $ax.repeater.setDataSet(id, setRepeaterInfo.localDataSetId);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.addFilterToRepeater = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToAddFilter.length; i++) {
+ var addFilterInfo = action.repeatersToAddFilter[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(addFilterInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ $ax.repeater.addFilter(id, addFilterInfo.removeOtherFilters, addFilterInfo.label, addFilterInfo.filter, eventInfo.srcElement);
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.removeFilterFromRepeater = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToRemoveFilter.length; i++) {
+ var removeFilterInfo = action.repeatersToRemoveFilter[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(removeFilterInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ if(removeFilterInfo.removeAll) $ax.repeater.removeFilter(id);
+ else if(removeFilterInfo.filterName != '') {
+ $ax.repeater.removeFilter(id, removeFilterInfo.filterName);
+ }
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.addSortToRepeater = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToAddSort.length; i++) {
+ var addSortInfo = action.repeatersToAddSort[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(addSortInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ $ax.repeater.addSort(id, addSortInfo.label, addSortInfo.columnName, addSortInfo.ascending, addSortInfo.toggle, addSortInfo.sortType);
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.removeSortFromRepeater = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToRemoveSort.length; i++) {
+ var removeSortInfo = action.repeatersToRemoveSort[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(removeSortInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ if(removeSortInfo.removeAll) $ax.repeater.removeSort(id);
+ else if(removeSortInfo.sortName != '') $ax.repeater.removeSort(id, removeSortInfo.sortName);
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.setRepeaterToPage = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToSetPage.length; i++) {
+ var setPageInfo = action.repeatersToSetPage[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(setPageInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ var oldTarget = eventInfo.targetElement;
+ eventInfo.targetElement = id;
+ $ax.repeater.setRepeaterToPage(id, setPageInfo.pageType, setPageInfo.pageValue, eventInfo);
+ eventInfo.targetElement = oldTarget;
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.setItemsPerRepeaterPage = function(eventInfo, actions, index) {
+ var action = actions[index];
+
+ for(var i = 0; i < action.repeatersToSetItemCount.length; i++) {
+ var setItemCountInfo = action.repeatersToSetItemCount[i];
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(setItemCountInfo.path, eventInfo)[0];
+ if(!id || _ignoreAction(id)) continue;
+
+ if(setItemCountInfo.noLimit) $ax.repeater.setNoItemLimit(id);
+ else $ax.repeater.setItemLimit(id, setItemCountInfo.itemCountValue, eventInfo);
+ _addRefresh(id);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.refreshRepeater = function(eventInfo, actions, index) {
+ // We use this as a psudo action now.
+ var action = actions[index];
+ for (var i = 0; i < action.repeatersToRefresh.length; i++) {
+ // Grab the first one because repeaters must have only element id, as they cannot be inside repeaters
+ // or none if unplaced
+ var id = $ax.getElementIdsFromPath(action.repeatersToRefresh[i], eventInfo)[0];
+ if(id) _tryRefreshRepeater(id, eventInfo);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ var _tryRefreshRepeater = function(id, eventInfo) {
+ var idIndex = _repeatersToRefresh.indexOf(id);
+ if(idIndex == -1) return;
+
+ $ax.splice(_repeatersToRefresh, idIndex, 1);
+ $ax.repeater.refreshRepeater(id, eventInfo);
+ };
+
+ _action.tryRefreshRepeaters = function(ids, eventInfo) {
+ for(var i = 0; i < ids.length; i++) _tryRefreshRepeater(ids[i], eventInfo);
+ };
+
+ _actionHandlers.scrollToWidget = function(eventInfo, actions, index) {
+ var action = actions[index];
+ var elementIds = $ax.getElementIdsFromPath(action.objectPath, eventInfo);
+ if(elementIds.length > 0) $ax('#' + elementIds[0]).scroll(action.options);
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+
+ _actionHandlers.enableDisableWidgets = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.pathToInfo.length; i++) {
+ var elementIds = $ax.getElementIdsFromPath(action.pathToInfo[i].objectPath, eventInfo);
+ var enable = action.pathToInfo[i].enableDisableInfo.enable;
+ for(var j = 0; j < elementIds.length; j++) $ax('#' + elementIds[j]).enabled(enable);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.setImage = function(eventInfo, actions, index) {
+ var oldTarget = eventInfo.targetElement;
+ var action = actions[index];
+ var view = $ax.adaptive.currentViewId;
+
+ eventInfo.image = true;
+ for(var i = 0; i < action.imagesToSet.length; i++) {
+ var imgInfo = action.imagesToSet[i];
+ imgInfo = view ? imgInfo.adaptive[view] : imgInfo.base;
+ var elementIds = $ax.getElementIdsFromPath(action.imagesToSet[i].objectPath, eventInfo);
+
+ for(var j = 0; j < elementIds.length; j++) {
+ var elementId = elementIds[j];
+
+ eventInfo.targetElement = elementId;
+ var evaluatedImgs = _evaluateImages(imgInfo, eventInfo);
+
+ var img = evaluatedImgs.normal;
+ if($ax.style.IsWidgetDisabled(elementId)) {
+ if(imgInfo.disabled) img = evaluatedImgs.disabled;
+ } else if($ax.style.IsWidgetSelected(elementId)) {
+ if(imgInfo.selected) img = evaluatedImgs.selected;
+ } else if($ax.event.mouseDownObjectId == elementId && imgInfo.mouseDown) img = evaluatedImgs.mouseDown;
+ else if($ax.event.mouseOverIds.indexOf(elementId) != -1 && imgInfo.mouseOver) {
+ img = evaluatedImgs.mouseOver;
+ //Update mouseOverObjectId
+ var currIndex = $ax.event.mouseOverIds.indexOf($ax.event.mouseOverObjectId);
+ var imgIndex = $ax.event.mouseOverIds.indexOf(elementId);
+ if(currIndex < imgIndex) $ax.event.mouseOverObjectId = elementId;
+ } else if(imgInfo.mouseOver && elementId == eventInfo.srcElement) {
+ img = evaluatedImgs.mouseOver;
+ }
+
+ // $('#' + $ax.repeater.applySuffixToElementId(elementId, '_img')).attr('src', img);
+ $jobj($ax.GetImageIdFromShape(elementId)).attr('src', img);
+
+ //Set up overrides
+ $ax.style.mapElementIdToImageOverrides(elementId, evaluatedImgs);
+ $ax.style.updateElementIdImageStyle(elementId);
+
+ if(evaluatedImgs.mouseOver || evaluatedImgs.mouseDown) $ax.event.updateIxStyleEvents(elementId);
+ }
+ }
+ eventInfo.targetElement = oldTarget;
+ eventInfo.image = false;
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ var _evaluateImages = function(imgInfo, eventInfo) {
+ var retVal = {};
+ for(var state in imgInfo) {
+ if(!imgInfo.hasOwnProperty(state)) continue;
+ var img = imgInfo[state][$ax.adaptive.getSketchKey()] || $ax.expr.evaluateExpr(imgInfo[state].literal, eventInfo);
+ if(!img) img = $axure.utils.getTransparentGifPath();
+ retVal[state] = img;
+ }
+ return retVal;
+ };
+
+ $ax.clearRepeaterImageOverrides = function(repeaterId) {
+ var childIds = $ax.getChildElementIdsForRepeater(repeaterId);
+ for(var i = childIds; i < childIds.length; i++) $ax.style.deleteElementIdToImageOverride(childIds[i]);
+ };
+
+ _actionHandlers.setFocusOnWidget = function(eventInfo, actions, index) {
+ var action = actions[index];
+ if(action.objectPaths.length > 0) {
+ var elementIds = $ax.getElementIdsFromPath(action.objectPaths[0], eventInfo);
+ if(elementIds.length > 0) {
+ $ax('#' + elementIds[0]).focus();
+ //if select text and not in placeholder mode, then select all text
+ if(action.selectText && !$ax.placeholderManager.isActive(elementIds[0])) {
+ var elementChildren = document.getElementById(elementIds[0]).children;
+ //find the input or textarea element
+ for(var i = 0; i < elementChildren.length; i++) {
+ if (elementChildren[i].id.indexOf('_input') == -1) continue;
+ var elementTagName = elementChildren[i].tagName;
+ if(elementTagName && (elementTagName.toLowerCase() == "input" || elementTagName.toLowerCase() == "textarea")) {
+ elementChildren[i].select();
+ }
+ }
+ }
+ }
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.expandCollapseTree = function(eventInfo, actions, index) {
+ var action = actions[index];
+ for(var i = 0; i < action.pathToInfo.length; i++) {
+ var pair = action.pathToInfo[i];
+ var elementIds = $ax.getElementIdsFromPath(pair.treeNodePath, eventInfo);
+ for(var j = 0; j < elementIds.length; j++) $ax('#' + elementIds[j]).expanded(pair.expandCollapseInfo.expand);
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.other = function(eventInfo, actions, index) {
+ var action = actions[index];
+ $ax.navigate({
+ url: $axure.utils.getOtherPath() + "#other=" + encodeURI(action.otherDescription),
+ target: "popup",
+ includeVariables: false,
+ popupOptions: action.popup
+ });
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+
+ _actionHandlers.fireEvents = function(eventInfo, actions, index) {
+ var action = actions[index];
+ //look for the nearest element id
+
+ var objId = eventInfo.srcElement;
+ var thisWidget = eventInfo.thiswidget;
+ var obj = $ax.getObjectFromElementId(objId);
+ var rdoId = obj ? $ax.getRdoParentFromElementId(objId) : "";
+ var rdo = $ax.getObjectFromElementId(rdoId);
+ var page = rdo ? $ax.pageData.masters[rdo.masterId] : $ax.pageData.page;
+
+ // Check if rdo should be this
+ var oldIsMasterEvent = eventInfo.isMasterEvent;
+ if (obj && $ax.public.fn.IsReferenceDiagramObject(obj.type) && eventInfo.isMasterEvent) {
+ rdoId = objId;
+ rdo = obj;
+ page = $ax.pageData.masters[rdo.masterId];
+ }
+
+ for(var i = 0; i < action.firedEvents.length; i++) {
+ var firedEvent = action.firedEvents[i];
+ var isPage = firedEvent.objectPath.length == 0;
+ var targetObjIds = isPage ? [rdoId] : $ax.getElementIdsFromPath(firedEvent.objectPath, eventInfo);
+ for (var j = 0; j < targetObjIds.length; j++) {
+ var targetObjId = targetObjIds[j];
+ var targetObj = isPage ? rdo : $ax.getObjectFromElementId(targetObjId);
+
+ eventInfo.srcElement = targetObjId || '';
+ eventInfo.thiswidget = $ax.getWidgetInfo(eventInfo.srcElement);
+
+ eventInfo.isMasterEvent = false;
+ var raisedEvents = firedEvent.raisedEventIds;
+ if(raisedEvents) {
+ for(var k = 0; k < raisedEvents.length; k++) {
+ var event = targetObj.interactionMap && targetObj.interactionMap.raised && targetObj.interactionMap.raised[raisedEvents[k]];
+ if(event) $ax.event.handleEvent(targetObjId, eventInfo, event, false, true);
+ }
+ }
+
+ if(isPage) {
+ eventInfo.isMasterEvent = true;
+ eventInfo.label = $ax.pageData.page.name;
+ eventInfo.friendlyType = 'Page';
+ }
+
+ var firedTarget = isPage ? page : targetObj;
+ var firedEventNames = firedEvent.firedEventNames;
+ if(firedEventNames) {
+ for(k = 0; k < firedEventNames.length; k++) {
+ event = firedTarget.interactionMap && firedTarget.interactionMap[firedEventNames[k]];
+ if(event) $ax.event.handleEvent(isPage ? '' : targetObjId, eventInfo, event, false, true);
+ }
+ }
+ if(isPage) eventInfo.isMasterEvent = oldIsMasterEvent;
+ }
+ eventInfo.srcElement = objId;
+ eventInfo.thiswidget = thisWidget;
+
+ eventInfo.isMasterEvent = oldIsMasterEvent;
+ }
+
+ _dispatchAction(eventInfo, actions, index + 1);
+ };
+});
+
+//***** expr.js *****//
+// ******* Expr MANAGER ******** //
+$axure.internal(function($ax) {
+ var _expr = $ax.expr = {};
+ var _binOpHandlers = {
+ '&&': function(left, right) { return _binOpOverride(left, right, function(left) { return $ax.getBool(left) && $ax.getBool(right()); }); },
+ '||': function(left, right) { return _binOpOverride(left, right, function(left) { return $ax.getBool(left) || $ax.getBool(right()); }); },
+ '==': function(left, right) { return isEqual(left, right, true); },
+ '!=': function(left, right) { return !isEqual(left, right, true); },
+ '>': function(left, right) { return _binOpNum(left, right, function(left, right) { return left > right; }); },
+ '<': function(left, right) { return _binOpNum(left, right, function(left, right) { return left < right; }); },
+ '>=': function(left, right) { return _binOpNum(left, right, function(left, right) { return left >= right; }); },
+ '<=': function(left, right) { return _binOpNum(left, right, function(left, right) { return left <= right; }); }
+ };
+
+ var checkOps = function(left, right) {
+ return left == undefined || right == undefined;
+ };
+
+ var isEqual = function (left, right, isFunction) {
+ if (isFunction) {
+ //if left and right is function, then get the value
+ //otherwise left and right should be already the value we want
+ left = left();
+ right = right();
+ }
+
+ if(checkOps(left, right)) return false;
+
+ if(left instanceof Date && right instanceof Date) {
+ if(left.getMilliseconds() != right.getMilliseconds()) return false;
+ if(left.getSeconds() != right.getSeconds()) return false;
+ if(left.getMinutes() != right.getMinutes()) return false;
+ if(left.getHours() != right.getHours()) return false;
+ if(left.getDate() != right.getDate()) return false;
+ if(left.getMonth() != right.getMonth()) return false;
+ if(left.getYear() != right.getYear()) return false;
+ return true;
+ }
+
+ if(left instanceof Object && right instanceof Object) {
+ var prop;
+ // Go through all of lefts properties and compare them to rights.
+ for(prop in left) {
+ if(!left.hasOwnProperty(prop)) continue;
+ // If left has a property that the right doesn't they are not equal.
+ if(!right.hasOwnProperty(prop)) return false;
+ // If any of their properties are not equal, they are not equal.
+ if(!isEqual(left[prop], right[prop], false)) return false;
+ }
+
+ for(prop in right) {
+ // final check to make sure right doesn't have some extra properties that make them not equal.
+ if(left.hasOwnProperty(prop) != right.hasOwnProperty(prop)) return false;
+ }
+
+ return true;
+ }
+ return $ax.getBool(left) == $ax.getBool(right);
+ };
+
+ var _binOpOverride = function(left, right, func) {
+ left = left();
+ if(left == undefined) return false;
+ var res = func(left, right);
+ return res == undefined ? false : res;
+ };
+
+ var _binOpNum = function(left, right, func) {
+ var left = left();
+ var right = right();
+ if(checkOps(left, right)) return false;
+
+ return func(left, Number(right));
+ };
+
+ var _exprHandlers = {};
+ _exprHandlers.array = function(expr, eventInfo) {
+ var returnVal = [];
+ for(var i = 0; i < expr.items.length; i++) {
+ returnVal[returnVal.length] = _evaluateExpr(expr.items[i], eventInfo);
+ }
+ return returnVal;
+ };
+
+ _exprHandlers.binaryOp = function(expr, eventInfo) {
+ var left = function() { return expr.leftExpr && _evaluateExpr(expr.leftExpr, eventInfo); };
+ var right = function() { return expr.rightExpr && _evaluateExpr(expr.rightExpr, eventInfo); };
+
+ if(left == undefined || right == undefined) return false;
+ return _binOpHandlers[expr.op](left, right);
+ };
+
+ _exprHandlers.block = function(expr, eventInfo) {
+ var subExprs = expr.subExprs;
+ for(var i = 0; i < subExprs.length; i++) {
+ _evaluateExpr(subExprs[i], eventInfo); //ignore the result
+ }
+ };
+
+ _exprHandlers.booleanLiteral = function(expr) {
+ return expr.value;
+ };
+
+ _exprHandlers.nullLiteral = function() { return null; };
+
+ _exprHandlers.pathLiteral = function(expr, eventInfo) {
+ if(expr.isThis) return [eventInfo.srcElement];
+ if(expr.isFocused && window.lastFocusedControl) {
+ $ax('#' + window.lastFocusedControl).focus();
+ return [window.lastFocusedControl];
+ }
+ if(expr.isTarget) return [eventInfo.targetElement];
+
+ return $ax.getElementIdsFromPath(expr.value, eventInfo);
+ };
+
+ _exprHandlers.panelDiagramLiteral = function(expr, eventInfo) {
+ var elementIds = $ax.getElementIdsFromPath(expr.panelPath, eventInfo);
+ var elementIdsWithSuffix = [];
+ var suffix = '_state' + expr.panelIndex;
+ for(var i = 0; i < elementIds.length; i++) {
+ elementIdsWithSuffix[i] = $ax.repeater.applySuffixToElementId(elementIds[i], suffix);
+ }
+ return String($jobj(elementIdsWithSuffix).data('label'));
+ };
+
+ _exprHandlers.fcall = function(expr, eventInfo) {
+ var oldTarget = eventInfo.targetElement;
+ var targets = [];
+ var fcallArgs = [];
+ var exprArgs = expr.arguments;
+ for(var i = 0; i < expr.arguments.length; i++) {
+ var exprArg = exprArgs[i];
+ var fcallArg = '';
+ if(targets.length) {
+ for(var j = 0; j < targets.length; j++) {
+ if(exprArg == null) {
+ fcallArgs[j][i] = null;
+ continue;
+ }
+ eventInfo.targetElement = targets[j];
+ fcallArg = _evaluateExpr(exprArg, eventInfo);
+ if(typeof (fcallArg) == 'undefined') return '';
+ fcallArgs[j][i] = fcallArg;
+ }
+ } else {
+ if(exprArg == null) {
+ fcallArgs[i] = null;
+ continue;
+ }
+ fcallArg = _evaluateExpr(exprArg, eventInfo);
+ if(typeof (fcallArg) == 'undefined') return '';
+ fcallArgs[i] = fcallArg;
+ }
+
+ // We do support null exprArgs...
+ // TODO: This makes 2 assumptions that may change in the future. 1. The pathLiteral is the always the first arg. 2. there is always only 1 pathLiteral
+ if(exprArg && exprArg.exprType == 'pathLiteral') {
+ targets = fcallArg;
+
+ // fcallArgs is now an array of an array of args
+ for(j = 0; j < targets.length; j++) fcallArgs[j] = [[fcallArg[j]]];
+ }
+ }
+
+ // we want to preserve the target element from outside this function.
+ eventInfo.targetElement = oldTarget;
+
+ var retval = '';
+ if(targets.length) {
+ // Go backwards so retval is the first item.
+ for(i = targets.length - 1; i >= 0; i--) {
+ var args = fcallArgs[i];
+ // Add event info to the end
+ args[args.length] = eventInfo;
+ retval = _exprFunctions[expr.functionName].apply(this, args);
+ }
+ } else fcallArgs[fcallArgs.length] = eventInfo;
+ return targets.length ? retval : _exprFunctions[expr.functionName].apply(this, fcallArgs);
+ };
+
+ _exprHandlers.globalVariableLiteral = function(expr) {
+ return expr.variableName;
+ };
+
+ _exprHandlers.keyPressLiteral = function(expr) {
+ var keyInfo = {};
+ keyInfo.keyCode = expr.keyCode;
+ keyInfo.ctrl = expr.ctrl;
+ keyInfo.alt = expr.alt;
+ keyInfo.shift = expr.shift;
+
+ return keyInfo;
+ };
+
+ _exprHandlers.adaptiveViewLiteral = function(expr) {
+ return expr.id;
+ };
+
+ _exprHandlers.optionLiteral = function(expr) {
+ return expr.value;
+ }
+
+ var _substituteSTOs = function(expr, eventInfo) {
+ //first evaluate the local variables
+ var scope = {};
+ for(var varName in expr.localVariables) {
+ scope[varName] = $ax.expr.evaluateExpr(expr.localVariables[varName], eventInfo);
+ }
+
+ // TODO: [ben] Date and data object (obj with info for url or image) both need to return non-strings.
+ var i = 0;
+ var retval;
+ var retvalString = expr.value.replace(/\[\[(?!\[)(.*?)\]\](?=\]*)/g, function(match) {
+ var sto = expr.stos[i++];
+ if(sto.sto == 'error') return match;
+ try {
+ var result = $ax.evaluateSTO(sto, scope, eventInfo);
+ } catch(e) {
+ return match;
+ }
+
+ if((result instanceof Object) && i == 1 && expr.value.substring(0, 2) == '[[' &&
+ expr.value.substring(expr.value.length - 2) == ']]') {
+ // If the result was an object, this was the first result, and the whole thing was this expresion.
+ retval = result;
+ }
+ return ((result instanceof Object) && (result.label || result.text)) || result;
+ });
+ // If more than one group returned, the object is not valid
+ if(i != 1) retval = false;
+ return retval || retvalString;
+ };
+
+ _exprHandlers.htmlLiteral = function (expr, eventInfo) {
+ eventInfo.htmlLiteral = true;
+ var html = _substituteSTOs(expr, eventInfo);
+ eventInfo.htmlLiteral = false
+ return html;
+ };
+
+ _exprHandlers.stringLiteral = function(expr, eventInfo) {
+ return _substituteSTOs(expr, eventInfo);
+ };
+
+ var _exprFunctions = {};
+
+ _exprFunctions.SetCheckState = function(elementIds, value) {
+ var toggle = value == 'toggle';
+ var boolValue = Boolean(value) && value != 'false';
+
+ for(var i = 0; i < elementIds.length; i++) {
+ var query = $ax('#' + elementIds[i]);
+ query.selected(toggle ? !query.selected() : boolValue);
+ }
+ };
+
+ _exprFunctions.SetSelectedOption = function(elementIds, value) {
+ for(var i = 0; i < elementIds.length; i++) {
+ var elementId = elementIds[i];
+ var obj = $jobj($ax.INPUT(elementId));
+
+ if(obj.val() == value) return;
+ obj.val(value);
+
+ if($ax.event.HasSelectionChanged($ax.getObjectFromElementId(elementId))) $ax.event.raiseSyntheticEvent(elementId, 'onSelectionChange');
+ }
+ };
+
+ _exprFunctions.SetGlobalVariableValue = function(varName, value) {
+ $ax.globalVariableProvider.setVariableValue(varName, value);
+ };
+
+ _exprFunctions.SetWidgetFormText = function(elementIds, value) {
+ for(var i = 0; i < elementIds.length; i++) {
+ var elementId = elementIds[i];
+ var inputId = $ax.repeater.applySuffixToElementId(elementId, '_input');
+
+ var obj = $jobj(inputId);
+ if(obj.val() == value || (value == '' && $ax.placeholderManager.isActive(elementId))) return;
+ obj.val(value);
+ $ax.placeholderManager.updatePlaceholder(elementId, !value);
+ if($ax.event.HasTextChanged($ax.getObjectFromElementId(elementId))) $ax.event.TryFireTextChanged(elementId);
+ }
+ };
+
+ _exprFunctions.SetFocusedWidgetText = function(elementId, value) {
+ if(window.lastFocusedControl) {
+ var elementId = window.lastFocusedControl;
+ var type = $obj(elementId).type;
+ if ($ax.public.fn.IsTextBox(type) || $ax.public.fn.IsTextArea(type)) _exprFunctions.SetWidgetFormText([elementId], value);
+ else _exprFunctions.SetWidgetRichText([elementId], value, true);
+ }
+ };
+
+ _exprFunctions.GetRtfElementHeight = function(rtfElement) {
+ if(rtfElement.innerHTML == '') rtfElement.innerHTML = ' ';
+ return rtfElement.offsetHeight;
+ };
+
+ _exprFunctions.SetWidgetRichText = function(ids, value, plain) {
+ // Converts dates, widgetinfo, and the like to strings.
+ value = _exprFunctions.ToString(value);
+
+ //Replace any newlines with line breaks
+ var finalValue = value.replace(/\r\n/g, '
').append(span).html();;
+ if(ps.length > 1) {
+ for(var i = 1; i < ps.length; i++) {
+ $(ps[i]).remove();
+ }
+ }
+ } else {
+ var p = $('
');
+ p.append(span);
+ element.innerHTML = $('
').append(p).html();
+ }
+ } else element.innerHTML = finalValue;
+ });
+
+ if(!plain) $ax.style.CacheOriginalText(id, true);
+ }
+ };
+
+ _exprFunctions.GetCheckState = function(ids) {
+ return $ax('#' + ids[0]).selected();
+ };
+
+ _exprFunctions.GetSelectedOption = function (ids) {
+ var inputs = $jobj($ax.INPUT(ids[0]));
+ return inputs.length ? inputs[0].value : '';
+ };
+
+ _exprFunctions.GetNum = function(str) {
+ //Setting a GlobalVariable to some blank text then setting a widget to the value of that variable would result in 0 not ""
+ //I have fixed this another way so commenting this should be fine now
+ //if (!str) return "";
+ return isNaN(str) ? str : Number(str);
+ };
+
+ _exprFunctions.GetGlobalVariableValue = function(id) {
+ return $ax.globalVariableProvider.getVariableValue(id);
+ };
+
+ _exprFunctions.GetGlobalVariableLength = function(id) {
+ return _exprFunctions.GetGlobalVariableValue(id).length;
+ };
+
+ _exprFunctions.GetWidgetText = function(ids) {
+ if($ax.placeholderManager.isActive(ids[0])) return '';
+ var input = $ax.INPUT(ids[0]);
+ return $ax('#' + ($jobj(input).length ? input : ids[0])).text();
+ };
+
+ _exprFunctions.GetFocusedWidgetText = function() {
+ if(window.lastFocusedControl) {
+ return $ax('#' + window.lastFocusedControl).text();
+ } else {
+ return "";
+ }
+ };
+
+ _exprFunctions.GetWidgetValueLength = function(ids) {
+ var id = ids[0];
+ if(!id) return undefined;
+ if($ax.placeholderManager.isActive(id)) return 0;
+ var obj = $jobj($ax.INPUT(id));
+ if(!obj.length) obj = $jobj(id);
+ var val = obj[0].value || _exprFunctions.GetWidgetText([id]);
+ return val.length;
+ };
+
+ _exprFunctions.GetPanelState = function(ids) {
+ var id = ids[0];
+ if(!id) return undefined;
+ var stateId = $ax.visibility.GetPanelState(id);
+ return stateId && String($jobj(stateId).data('label'));
+ };
+
+ _exprFunctions.GetWidgetVisibility = function(ids) {
+ var id = ids[0];
+ if(!id) return undefined;
+ return $ax.visibility.IsIdVisible(id);
+ };
+
+ // ***************** Validation Functions ***************** //
+
+ _exprFunctions.IsValueAlpha = function(val) {
+ var isAlphaRegex = new RegExp("^[a-z\\s]+$", "gi");
+ return isAlphaRegex.test(val);
+ };
+
+ _exprFunctions.IsValueNumeric = function(val) {
+ var isNumericRegex = new RegExp("^[0-9,\\.\\s]+$", "gi");
+ return isNumericRegex.test(val);
+ };
+
+ _exprFunctions.IsValueAlphaNumeric = function(val) {
+ var isAlphaNumericRegex = new RegExp("^[0-9a-z\\s]+$", "gi");
+ return isAlphaNumericRegex.test(val);
+ };
+
+ _exprFunctions.IsValueOneOf = function(val, values) {
+ for(var i = 0; i < values.length; i++) {
+ var option = values[i];
+ if(val == option) return true;
+ }
+ //by default, return false
+ return false;
+ };
+
+ _exprFunctions.IsValueNotAlpha = function(val) {
+ return !_exprFunctions.IsValueAlpha(val);
+ };
+
+ _exprFunctions.IsValueNotNumeric = function(val) {
+ return !_exprFunctions.IsValueNumeric(val);
+ };
+
+ _exprFunctions.IsValueNotAlphaNumeric = function(val) {
+ return !_exprFunctions.IsValueAlphaNumeric(val);
+ };
+
+ _exprFunctions.IsValueNotOneOf = function(val, values) {
+ return !_exprFunctions.IsValueOneOf(val, values);
+ };
+
+ _exprFunctions.GetKeyPressed = function(eventInfo) {
+ return eventInfo.keyInfo;
+ };
+
+ _exprFunctions.GetCursorRectangles = function() {
+ var rects = new Object();
+ rects.lastRect = new $ax.drag.Rectangle($ax.lastMouseLocation.x, $ax.lastMouseLocation.y, 1, 1);
+ rects.currentRect = new $ax.drag.Rectangle($ax.mouseLocation.x, $ax.mouseLocation.y, 1, 1);
+ return rects;
+ };
+
+ _exprFunctions.GetWidgetRectangles = function (elementIds, eventInfo) {
+ var elementId = elementIds[0];
+ var rects = new Object();
+ var jObj = $jobj(elementId);
+ var invalid = jObj.length == 0;
+ var parent = jObj;
+ // Or are in valid if no obj can be found, or if it is not visible.
+ while(parent.length != 0 && !parent.is('body')) {
+ if(parent.css('display') == 'none') {
+ invalid = true;
+ break;
+ }
+ parent = parent.parent();
+ }
+ if(invalid) {
+ rects.lastRect = rects.currentRect = new $ax.drag.Rectangle(-1, -1, -1, -1);
+ return rects;
+ }
+
+ var axObj = $ax('#' + elementId);
+ rects.lastRect = new $ax.drag.Rectangle(
+ axObj.left(),
+ axObj.top(),
+ axObj.width(),
+ axObj.height());
+
+ rects.currentRect = rects.lastRect;
+ return rects;
+ };
+
+ _exprFunctions.GetWidget = function(elementId) {
+ return $ax.getWidgetInfo(elementId[0]);
+ };
+
+ _exprFunctions.GetAdaptiveView = function() {
+ return $ax.adaptive.currentViewId || '';
+ };
+
+ _exprFunctions.IsEntering = function(movingRects, targetRects) {
+ return !movingRects.lastRect.IntersectsWith(targetRects.currentRect) && movingRects.currentRect.IntersectsWith(targetRects.currentRect);
+ };
+
+ _exprFunctions.IsLeaving = function(movingRects, targetRects) {
+ return movingRects.lastRect.IntersectsWith(targetRects.currentRect) && !movingRects.currentRect.IntersectsWith(targetRects.currentRect);
+ };
+
+ var _IsOver = _exprFunctions.IsOver = function(movingRects, targetRects) {
+ return movingRects.currentRect.IntersectsWith(targetRects.currentRect);
+ };
+
+ _exprFunctions.IsNotOver = function(movingRects, targetRects) {
+ return !_IsOver(movingRects, targetRects);
+ };
+
+ _exprFunctions.ValueContains = function(inputString, value) {
+ return inputString.indexOf(value) > -1;
+ };
+
+ _exprFunctions.ValueNotContains = function(inputString, value) {
+ return !_exprFunctions.ValueContains(inputString, value);
+ };
+
+ _exprFunctions.ToString = function(value) {
+ if(value.isWidget) {
+ return value.text;
+ }
+ return String(value);
+ };
+
+ var _evaluateExpr = $ax.expr.evaluateExpr = function(expr, eventInfo, toString) {
+ if(expr === undefined || expr === null) return undefined;
+ var result = _exprHandlers[expr.exprType](expr, eventInfo);
+ return toString ? _exprFunctions.ToString(result) : result;
+ };
+
+
+});
+//***** geometry.js *****//
+// ******* Region MANAGER ******** //
+$axure.internal(function($ax) {
+ var _geometry = $ax.geometry = {};
+ var regionMap = {};
+ var regionList = [];
+
+ var _unregister = function(label) {
+ var regionIndex = regionList.indexOf(label);
+ if(regionIndex != -1) {
+ var end = $ax.splice(regionList, regionIndex + 1);
+ $ax.splice(regionList, regionIndex, regionList.length - regionIndex);
+ regionList = regionList.concat(end);
+ }
+ delete regionMap[label];
+ };
+ _geometry.unregister = _unregister;
+
+ var clear = function() {
+ regionMap = {};
+ regionList = [];
+ };
+
+ var _polygonRegistered = function(label) {
+ return Boolean(regionMap[label]);
+ };
+ _geometry.polygonRegistered = _polygonRegistered;
+
+ // Must be counterclockwise, or enter/exit will be wrong
+ var _registerPolygon = function(label, points, callback, info) {
+ var regionIndex = regionList.indexOf(label);
+ if(regionIndex == -1) regionList.push(label);
+ regionMap[label] = { points: points, callback: callback, info: info };
+ };
+ _geometry.registerPolygon = _registerPolygon;
+
+ var _getPolygonInfo = function(label) {
+ if(!_polygonRegistered(label)) return undefined;
+ return regionMap[label].info;
+ };
+ _geometry.getPolygonInfo = _getPolygonInfo;
+
+
+
+ var _genRect = function(info, roundHalfPixel) {
+ var x = info.pagex();
+ var y = info.pagey();
+ var w = info.width();
+ var h = info.height();
+
+ if(roundHalfPixel) {
+ if(x % 1 != 0) {
+ x = Math.floor(x);
+ w++;
+ }
+ if(y % 1 != 0) {
+ y = Math.floor(y);
+ h++;
+ }
+ }
+
+ var r = x + w;
+ var b = y + h;
+
+ var rect = {
+ X: function() { return x; },
+ Y: function() { return y; },
+ Wigth: function() { return w; },
+ Height: function() { return h; },
+ Left: function() { return x; },
+ Right: function() { return r; },
+ Top: function() { return y; },
+ Bottom: function() { return b; }
+ };
+ return rect;
+ };
+ _geometry.genRect = _genRect;
+
+ var _genPoint = function(x, y) {
+ return { x: x, y: y };
+ };
+ _geometry.genPoint = _genPoint;
+
+ var oldPoint = _genPoint(0, 0);
+ _geometry.tick = function(x, y, end) {
+ var lastPoint = oldPoint;
+ var nextPoint = oldPoint = _genPoint(x, y);
+ var line = { p1: lastPoint, p2: nextPoint };
+ if(!regionList.length) return;
+
+ for(var i = 0; i < regionList.length; i++) {
+ var region = regionMap[regionList[i]];
+ var points = region.points;
+ if(!region.checked) {
+ if(!_checkInside(points, $ax.mouseLocation)) {
+ region.callback({ outside: true });
+ continue;
+ }
+ region.checked = true;
+ }
+ for(var j = 0; j < points.length; j++) {
+ var startSegment = points[j];
+ var endSegment = points[(j + 1) % points.length];
+ var intersectInfo = linesIntersect(line, { p1: startSegment, p2: endSegment });
+ if(intersectInfo) {
+ region.callback(intersectInfo);
+ break;
+ }
+ }
+ }
+
+ if(end) clear();
+ };
+
+ // Info if the one line touches the other (even barely), false otherwise
+ // Info includes point, if l1 is entering or exiting l2, and any ties that happened, or parallel info
+ var linesIntersect = function(l1, l2) {
+ var retval = {};
+ var ties = {};
+
+ var l1p1 = l1.p1.x < l1.p2.x || (l1.p1.x == l1.p2.x && l1.p1.y < l1.p2.y) ? l1.p1 : l1.p2;
+ var l1p2 = l1.p1.x < l1.p2.x || (l1.p1.x == l1.p2.x && l1.p1.y < l1.p2.y) ? l1.p2 : l1.p1;
+ var m1 = (l1p2.y - l1p1.y) / (l1p2.x - l1p1.x);
+
+ var l2p1 = l2.p1.x < l2.p2.x || (l2.p1.x == l2.p2.x && l2.p1.y < l2.p2.y) ? l2.p1 : l2.p2;
+ var l2p2 = l2.p1.x < l2.p2.x || (l2.p1.x == l2.p2.x && l2.p1.y < l2.p2.y) ? l2.p2 : l2.p1;
+ var m2 = (l2p2.y - l2p1.y) / (l2p2.x - l2p1.x);
+
+ var l1Vert = l1.p1.x == l1.p2.x;
+ var l2Vert = l2.p1.x == l2.p2.x;
+ if(l1Vert || l2Vert) {
+ if(l1Vert && l2Vert) {
+ // If the lines don't follow the same path, return
+ if(l1p1.x != l2p1.x) return false;
+ // if they never meet, return
+ if(l1p2.y < l2p1.y || l1p1.y > l2p2.y) return false;
+ var firstVert = l1p1.y >= l2p1.y ? l1p1 : l2p1;
+ var secondVert = l1p2.y <= l2p2.y ? l1p2 : l2p2;
+ // First is from the perspective of l1
+ retval.parallel = {
+ first: l1p1 == l1.p1 ? firstVert : secondVert,
+ second: l1p2 == l1.p2 ? secondVert : firstVert,
+ sameDirection: (l1p1 == l1.p1) == (l2p1 == l2.p1)
+ };
+
+ return retval;
+ }
+
+ var x1 = l2Vert ? l1p1.x : l2p1.x;
+ var x2 = l2Vert ? l1p2.x : l2p2.x;
+ var xVert = l2Vert ? l2p1.x : l1p1.x;
+
+ var y = l2Vert ? l1p1.y + (xVert - x1) * m1 : l2p1.y + (xVert - x1) * m2;
+ var y1 = l2Vert ? l2p1.y : l1p1.y;
+ var y2 = l2Vert ? l2p2.y : l1p2.y;
+ if(xVert >= x1 && xVert <= x2 && y >= y1 && y <= y2) {
+ retval.point = { x: xVert, y: y };
+ retval.exiting = l2Vert == (y1 == (l2Vert ? l2.p1.y : l1.p1.y)) == (x1 == (l2Vert ? l1.p1.x : l2.p1.x));
+ retval.entering = !retval.exiting;
+
+ // Calculate ties
+ if(x1 == xVert) {
+ ties[l2Vert ? 'l1' : 'l2'] = (x1 == (l2Vert ? l1.p1.x : l2.p1.x)) ? 'start' : 'end';
+ retval.ties = ties;
+ } else if(x2 == xVert) {
+ ties[l2Vert ? 'l1' : 'l2'] = (x2 == (l2Vert ? l1.p2.x : l2.p2.x)) ? 'end' : 'start';
+ retval.ties = ties;
+ }
+ if(y1 == y) {
+ ties[l2Vert ? 'l2' : 'l1'] = (y1 == (l2Vert ? l2.p1.y : l1.p1.y)) ? 'start' : 'end';
+ retval.ties = ties;
+ } else if(y2 == y) {
+ ties[l2Vert ? 'l2' : 'l1'] = (y2 == (l2Vert ? l2.p2.y : l1.p2.y)) ? 'end' : 'start';
+ retval.ties = ties;
+ }
+
+ return retval;
+ }
+ return false;
+ }
+ // If here, no vertical lines
+
+ if(m1 == m2) {
+ // If the lines don't follow the same path, return
+ if(l1p1.y != (l2p1.y + (l1p1.x - l2p1.x) * m1)) return false;
+ // if they never meet, return
+ if(l1p2.x < l2p1.x || l1p1.x > l2p2.x) return false;
+ var first = l1p1.x >= l2p1.x ? l1p1 : l2p1;
+ var second = l1p2.x <= l2p2.x ? l1p2 : l2p2;
+ // First is from the perspective of l1
+ retval.parallel = {
+ first: l1p1 == l1.p1 ? first : second,
+ second: l1p2 == l1.p2 ? second : first,
+ sameDirection: (l1p1 == l1.p1) == (l2p1 == l2.p1)
+ };
+
+ return retval;
+ }
+
+ var x = (l2p1.y - l2p1.x * m2 - l1p1.y + l1p1.x * m1) / (m1 - m2);
+
+ // Check if x is out of bounds
+ if(x >= l1p1.x && x <= l1p2.x && x >= l2p1.x && x <= l2p2.x) {
+ var y = l1p1.y + (x - l1p1.x) * m1;
+ retval.point = { x: x, y: y };
+ retval.entering = m1 > m2 == (l1p1 == l1.p1) == (l2p1 == l2.p1);
+ retval.exiting = !retval.entering;
+
+ // Calculate ties
+ if(l1.p1.x == x) {
+ ties.l1 = 'start';
+ retval.ties = ties;
+ } else if(l1.p2.x == x) {
+ ties.l1 = 'end';
+ retval.ties = ties;
+ }
+ if(l2.p1.x == x) {
+ ties.l2 = 'start';
+ retval.ties = ties;
+ } else if(l2.p2.x == x) {
+ ties.l2 = 'end';
+ retval.ties = ties;
+ }
+
+ return retval;
+ }
+ return false;
+ };
+
+ var _checkInsideRegion = function(label, point) {
+ if(!_polygonRegistered(label)) return false;
+
+ return _checkInside(regionMap[label].points, point || $ax.mouseLocation);
+ };
+ _geometry.checkInsideRegion = _checkInsideRegion;
+
+ // Returns true if point is inside the polygon, including ties
+ var _checkInside = function(polygon, point) {
+ // Make horizontal line wider than the polygon, with the y of point to test location
+ var firstX = polygon[0].x;
+ var secondX = firstX;
+ var i;
+ for(i = 1; i < polygon.length; i++) {
+ var polyX = polygon[i].x;
+ firstX = Math.min(firstX, polyX);
+ secondX = Math.max(secondX, polyX);
+ }
+ var line = {
+ p1: _genPoint(--firstX, point.y),
+ p2: _genPoint(++secondX, point.y)
+ };
+
+ // If entered true, with closest intersection says you are inside the polygon.
+ var entered = false;
+ // Closest is the closest intersection to the left of the point
+ var closest = line.p1.x;
+ // This is for if intersections hit the same point, to find out which is correct
+ var cos = -2;
+
+ var getCos = function(line) {
+ var x = line.p2.x - line.p1.x;
+ var y = line.p2.y - line.p1.y;
+ return x / Math.sqrt(x * x + y * y);
+ };
+
+ for(i = 0; i < polygon.length; i++) {
+ var polyLine = { p1: polygon[i], p2: polygon[(i + 1) % polygon.length] };
+ var intersectInfo = linesIntersect(line, polyLine);
+ if(!intersectInfo) continue;
+
+ if(intersectInfo.parallel) {
+ // Only really care about this if it actually touches the point
+ if(intersectInfo.parallel.first.x <= point.x && intersectInfo.parallel.second.x >= point.x) return true;
+ continue;
+ }
+
+ var intersectionX = intersectInfo.point.x;
+ if(intersectionX > point.x || intersectionX < closest) continue;
+ if(intersectionX == point.x) return true;
+
+ // If closer than last time, reset cosine.
+ if(intersectionX != closest) cos = -2;
+
+ // For getting cosine, need to possibly reverse the direction of polyLine.
+ if(intersectInfo.ties) {
+ // Tie must be on l2, if the ties is end, reverse so cosine indicates how close the angle is to that of 'point' from here.
+ if(intersectInfo.ties.l2 == 'end') polyLine = { p1: polyLine.p2, p2: polyLine.p1 };
+ } else {
+ // It is on both side, so you can take the larger one
+ if(polyLine.p1.x > polyLine.p2.x) polyLine = { p1: polyLine.p2, p2: polyLine.p1 };
+ }
+ var currCos = getCos(polyLine);
+ if(currCos > cos) {
+ cos = currCos;
+ closest = intersectionX;
+ entered = intersectInfo.entering;
+ }
+ }
+ return entered;
+ };
+ _geometry.checkInside = _checkInside;
+});
+//***** flyout.js *****//
+// ******* Flyout MANAGER ******** //
+$axure.internal(function($ax) {
+ var _flyoutManager = $ax.flyoutManager = {};
+
+ var getFlyoutLabel = function(panelId) {
+ return panelId + '_flyout';
+ };
+
+ var _unregisterPanel = function(panelId, keepShown) {
+ $ax.geometry.unregister(getFlyoutLabel(panelId));
+ if(panelToSrc[panelId]) {
+ $ax.style.RemoveRolloverOverride(panelToSrc[panelId]);
+ delete panelToSrc[panelId];
+ }
+ if(!keepShown) {
+ $ax.action.addAnimation(panelId, $ax.action.queueTypes.fade, function() {
+ $ax('#' + panelId).hide();
+ });
+ }
+ };
+ _flyoutManager.unregisterPanel = _unregisterPanel;
+
+ var genPoint = $ax.geometry.genPoint;
+
+ var _updateFlyout = function(panelId) {
+ var label = getFlyoutLabel(panelId);
+ if(!$ax.geometry.polygonRegistered(label)) return;
+ var info = $ax.geometry.getPolygonInfo(label);
+ var rects = info && info.rects;
+
+ var targetWidget = $ax.getWidgetInfo(panelId);
+ rects.target = $ax.geometry.genRect(targetWidget);
+
+ // Src will stay the same, just updating
+ $ax.flyoutManager.registerFlyout(rects, panelId, panelToSrc[panelId]);
+
+ if(!$ax.geometry.checkInsideRegion(label)) _unregisterPanel(panelId);
+ };
+ _flyoutManager.updateFlyout = _updateFlyout;
+
+ var panelToSrc = {};
+ var _registerFlyout = function(rects, panelId, srcId) {
+ var label = _getFlyoutLabel(panelId);
+ var callback = function(info) {
+ // If leaving object or already outside it, then unregister, otherwise just return
+ if(!info.exiting && !info.outside) return;
+ _unregisterPanel(panelId);
+ };
+ var points = [];
+
+ var lastSrcId = panelToSrc[panelId];
+ if(lastSrcId != srcId) {
+ if(lastSrcId) $ax.style.RemoveRolloverOverride(lastSrcId);
+ if(srcId) {
+ $ax.style.AddRolloverOverride(srcId);
+ panelToSrc[panelId] = srcId;
+ } else delete panelToSrc[panelId];
+ }
+
+ // rects should be one or two rectangles
+ if(!rects.src) {
+ var rect = rects.target;
+ points.push(genPoint(rect.Left(), rect.Top()));
+ points.push(genPoint(rect.Right(), rect.Top()));
+ points.push(genPoint(rect.Right(), rect.Bottom()));
+ points.push(genPoint(rect.Left(), rect.Bottom()));
+ } else {
+ var r0 = rects.src;
+ var r1 = rects.target;
+
+ // Right left of right, left right of left, top below top, bottom above bottom
+ var rlr = r0.Right() <= r1.Right();
+ var lrl = r0.Left() >= r1.Left();
+ var tbt = r0.Top() >= r1.Top();
+ var bab = r0.Bottom() <= r1.Bottom();
+
+ var info = { rlr: rlr, lrl: lrl, tbt: tbt, bab: bab };
+
+ if((rlr && lrl) || (tbt && bab)) {
+ points = getSmallPolygon(r0, r1, info);
+ } else {
+ points = getLargePolygon(r0, r1, info);
+ }
+ }
+
+ $ax.geometry.registerPolygon(label, points, callback, { rects: rects });
+ };
+ _flyoutManager.registerFlyout = _registerFlyout;
+
+ var _getFlyoutLabel = function(panelId) {
+ return panelId + '_flyout';
+ };
+
+ var _reregisterAllFlyouts = function() {
+ for(var panelId in panelToSrc) _reregisterFlyout(panelId);
+ };
+ _flyoutManager.reregisterAllFlyouts = _reregisterAllFlyouts;
+
+ var _reregisterFlyout = function(panelId) {
+ var rects = $ax.geometry.getPolygonInfo(getFlyoutLabel(panelId)).rects;
+ _registerFlyout(rects, panelId, panelToSrc[panelId]);
+ };
+
+ // This is the reduced size polygon connecting r0 to r1 by means of horizontal or vertical lines.
+ var getSmallPolygon = function(r0, r1, info) {
+ var points = [];
+
+ // NOTE: currently I make the assumption that if horizontal/vertical connecting lines from the src hit the target
+ // Meaning if horizontal, rlr and lrl are true, and if vertical, tbt and bab are true.
+
+ var r0Left = r0.Left();
+ var r0Right = r0.Right();
+ var r0Top = r0.Top();
+ var r0Bottom = r0.Bottom();
+ var r1Left = r1.Left();
+ var r1Right = r1.Right();
+ var r1Top = r1.Top();
+ var r1Bottom = r1.Bottom();
+
+ points.push(genPoint(r1Left, r1Top));
+
+ if(!info.tbt) {
+ points.push(genPoint(r0Left, r1Top));
+ points.push(genPoint(r0Left, r0Top));
+ points.push(genPoint(r0Right, r0Top));
+ points.push(genPoint(r0Right, r1Top));
+ }
+
+ points.push(genPoint(r1Right, r1Top));
+
+ if(!info.rlr) {
+ points.push(genPoint(r1Right, r0Top));
+ points.push(genPoint(r0Right, r0Top));
+ points.push(genPoint(r0Right, r0Bottom));
+ points.push(genPoint(r1Right, r0Bottom));
+ }
+
+ points.push(genPoint(r1Right, r1Bottom));
+
+ if(!info.bab) {
+ points.push(genPoint(r0Right, r1Bottom));
+ points.push(genPoint(r0Right, r0Bottom));
+ points.push(genPoint(r0Left, r0Bottom));
+ points.push(genPoint(r0Left, r1Bottom));
+ }
+
+ points.push(genPoint(r1Left, r1Bottom));
+
+ if(!info.lrl) {
+ points.push(genPoint(r1Left, r0Bottom));
+ points.push(genPoint(r0Left, r0Bottom));
+ points.push(genPoint(r0Left, r0Top));
+ points.push(genPoint(r1Left, r0Top));
+ }
+
+ return points;
+ };
+
+ // This is the original algorithm that connects the most extream corners to make polygon
+ var getLargePolygon = function(r0, r1, info) {
+ var points = [];
+
+ var r0Left = r0.Left();
+ var r0Right = r0.Right();
+ var r0Top = r0.Top();
+ var r0Bottom = r0.Bottom();
+ var r1Left = r1.Left();
+ var r1Right = r1.Right();
+ var r1Top = r1.Top();
+ var r1Bottom = r1.Bottom();
+
+ // Top lefts
+ if(info.tbt) {
+ if(!info.lrl) points.push(genPoint(r0Left, r0Top));
+ points.push(genPoint(r1Left, r1Top));
+ } else {
+ if(info.lrl) points.push(genPoint(r1Left, r1Top));
+ points.push(genPoint(r0Left, r0Top));
+ }
+
+ // Top rights
+ if(info.tbt) {
+ points.push(genPoint(r1Right, r1Top));
+ if(!info.rlr) points.push(genPoint(r0Right, r0Top));
+ } else {
+ points.push(genPoint(r0Right, r0Top));
+ if(info.rlr) points.push(genPoint(r1Right, r1Top));
+ }
+
+ // Bottom rights
+ if(info.bab) {
+ if(!info.rlr) points.push(genPoint(r0Right, r0Bottom));
+ points.push(genPoint(r1Right, r1Bottom));
+ } else {
+ if(info.rlr) points.push(genPoint(r1Right, r1Bottom));
+ points.push(genPoint(r0Right, r0Bottom));
+ }
+
+ // Bottom Lefts
+ if(info.bab) {
+ points.push(genPoint(r1Left, r1Bottom));
+ if(!info.lrl) points.push(genPoint(r0Left, r0Bottom));
+ } else {
+ points.push(genPoint(r0Left, r0Bottom));
+ if(info.lrl) points.push(genPoint(r1Left, r1Bottom));
+ }
+ return points;
+ };
+});
+
+// ******* Placeholder Manager ********* //
+
+$axure.internal(function($ax) {
+ var _placeholderManager = $ax.placeholderManager = {};
+ var idToPlaceholderInfo = {};
+
+ var _registerPlaceholder = function(elementId, text, password) {
+ idToPlaceholderInfo[elementId] = { text: text, password: password, active: false };
+ };
+ _placeholderManager.registerPlaceholder = _registerPlaceholder;
+
+ _placeholderManager.refreshPlaceholder = function (elementId) {
+ var info = idToPlaceholderInfo[elementId];
+ if (!info || !info.active) return;
+ $ax.style.SetWidgetPlaceholder(elementId, true, info.text, info.password);
+ }
+
+ var _updatePlaceholder = function(elementId, active, clearText) {
+ var inputId = $ax.repeater.applySuffixToElementId(elementId, '_input');
+
+ var info = idToPlaceholderInfo[elementId];
+ if(!info || info.active == active) return;
+ info.active = active;
+
+ if(active) var value = info.text;
+ else if(!ANDROID) value = clearText ? '' : document.getElementById(inputId).value;
+ else {
+ var currentText = document.getElementById(inputId).value;
+ if(!clearText) value = currentText;
+ else if(currentText == info.text) value = "";
+ else {
+ var lastIndex = currentText.lastIndexOf(info.text);
+ //here i am assuming the text is always inserted in front
+ value = currentText.substring(0, lastIndex);
+ }
+ }
+
+ $ax.style.SetWidgetPlaceholder(elementId, active, value, info.password);
+ };
+ _placeholderManager.updatePlaceholder = _updatePlaceholder;
+
+ var _isActive = function(elementId) {
+ var info = idToPlaceholderInfo[elementId];
+ return Boolean(info && info.active);
+ };
+ _placeholderManager.isActive = _isActive;
+
+ var _selectRange = function(elementId, start, end) {
+ $jobj(elementId).each(function() {
+ if(this.setSelectionRange) {
+ var validTypes = ["text", "search", "url", "tel", "password"];
+ if(this.tagName.toLowerCase() != "input" || validTypes.indexOf(this.type) > -1) {
+ this.focus();
+ this.setSelectionRange(start, end);
+ }
+ } else if(this.createTextRange) {
+ var range = this.createTextRange();
+ range.collapse(true);
+ range.moveEnd('character', end);
+ range.moveStart('character', start);
+ range.select();
+ }
+ });
+ };
+ _placeholderManager.selectRange = _selectRange;
+
+ var _moveCaret = function(id, index) {
+ var inputIndex = id.indexOf('_input');
+ if(inputIndex == -1) return;
+ var inputId = id.substring(0, inputIndex);
+
+ if(!_isActive(inputId)) return;
+ _selectRange(id, index, index);
+ };
+ _placeholderManager.moveCaret = _moveCaret;
+});
+//***** ie.js *****//
+
+// ******* Internet Explorer MANAGER ******** //
+//this is to handle all the stupid IE Stuff
+$axure.internal(function($ax) {
+ if(!IE_10_AND_BELOW) return;
+
+ var _ieColorManager = {};
+ if(Number(BROWSER_VERSION) < 9) $ax.ieColorManager = _ieColorManager;
+
+ var _applyIEFixedPosition = function() {
+ if(Number(BROWSER_VERSION) >= 7) return;
+
+ $axure(function(diagramObject) { return diagramObject.fixedVertical; }).$()
+ .appendTo($('body'))
+ .css('position', 'absolute').css('margin-left', 0 + 'px').css('margin-top', 0 + 'px');
+
+ var handleScroll = function() {
+ $axure(function(diagramObject) { return diagramObject.fixedVertical; })
+ .each(function(diagramObject, elementId) {
+ var win = $(window);
+ var windowWidth = win.width();
+ var windowHeight = win.height();
+ var windowScrollLeft = win.scrollLeft();
+ var windowScrollTop = win.scrollTop();
+
+ var newLeft = 0;
+ var newTop = 0;
+ var elementQuery = $('#' + elementId);
+ var elementAxQuery = $ax('#' + elementId);
+ var width = elementAxQuery.width();
+ var height = elementAxQuery.height();
+
+ var horz = diagramObject.fixedHorizontal;
+ if(horz == 'left') {
+ newLeft = windowScrollLeft + diagramObject.fixedMarginHorizontal;
+ } else if(horz == 'center') {
+ newLeft = windowScrollLeft + ((windowWidth - width) / 2) + diagramObject.fixedMarginHorizontal;
+ } else if(horz == 'right') {
+ newLeft = windowScrollLeft + windowWidth - width - diagramObject.fixedMarginHorizontal;
+ }
+
+ var vert = diagramObject.fixedVertical;
+ if(vert == 'top') {
+ newTop = windowScrollTop + diagramObject.fixedMarginVertical;
+ } else if(vert == 'middle') {
+ newTop = windowScrollTop + ((windowHeight - height) / 2) + diagramObject.fixedMarginVertical;
+ } else if(vert == 'bottom') {
+ newTop = windowScrollTop + windowHeight - height - diagramObject.fixedMarginVertical;
+ }
+ elementQuery.css('top', newTop + 'px').css('left', newLeft + 'px');
+ });
+ };
+
+ $(window).scroll(handleScroll);
+ $axure.resize(handleScroll);
+ handleScroll();
+ };
+
+ var _applyBackground = function() {
+ if(Number(BROWSER_VERSION) >= 9) return;
+
+ var styleChain = $ax.adaptive.getAdaptiveIdChain($ax.adaptive.currentViewId);
+ var argb = _getArgb($ax.pageData.page, styleChain);
+ var hexColor = _getHexColor(argb, false);
+ if(hexColor) $('body').css('background-color', hexColor);
+
+ _applyBackgroundToQuery($ax('*'));
+ };
+
+ var _applyBackgroundToQuery = function(query) {
+ if(Number(BROWSER_VERSION) >= 9) return;
+
+ var styleChain = $ax.adaptive.getAdaptiveIdChain($ax.adaptive.currentViewId);
+ query.each(function(obj, elementId) {
+ if ($ax.public.fn.IsDynamicPanel(obj.type)) {
+ var stateCount = obj.diagrams.length;
+ for(var j = 0; j < stateCount; j++) {
+ var stateId = $ax.repeater.applySuffixToElementId(elementId, '_state' + j);
+ var argb = _getArgb(obj.diagrams[j], styleChain);
+ var hexColor = _getHexColor(argb, true);
+ if(hexColor) $jobj(stateId).css('background-color', hexColor);
+ }
+ } else if ($ax.public.fn.IsRepeater(obj.type)) {
+
+ }
+ });
+ };
+ _ieColorManager.applyBackground = _applyBackgroundToQuery;
+
+ var _getArgb = function(diagram, styleChain) {
+ var argb = undefined;
+ for(var i = 0; i < styleChain.length && !argb; i++) {
+ var style = diagram.adaptiveStyles[styleChain[i]];
+ argb = style.fill && style.fill.color;
+ }
+ if(!argb) argb = diagram.style.fill.color;
+ return argb;
+ };
+
+ var gMult = 256;
+ var rMult = gMult * 256;
+ var aMult = rMult * 256;
+
+ var _getHexColor = function(argb, allowWhite) {
+ var a = Math.floor(argb / aMult);
+ argb -= a * aMult;
+
+ var r = Math.floor(argb / rMult);
+ argb -= r * rMult;
+
+ var g = Math.floor(argb / gMult);
+ var b = argb - g * gMult;
+
+ return _getColorFromArgb(a, r, g, b, allowWhite);
+ };
+
+ var _getColorFromArgb = function(a, r, g, b, allowWhite) {
+ if(Number(BROWSER_VERSION) >= 9) return undefined;
+
+ //convert the color with alpha to a color with no alpha (assuming white background)
+ r = Math.min((r * a) / 255 + 255 - a, 255);
+ g = Math.min((g * a) / 255 + 255 - a, 255);
+ b = Math.min((b * a) / 255 + 255 - a, 255);
+
+ if(a == 0) return undefined;
+ if(!allowWhite && (r == 255 && g == 255 && b == 255)) return undefined;
+
+ var color = '#';
+ color += Math.floor(r / 16).toString(16);
+ color += Math.floor(r % 16).toString(16);
+ color += Math.floor(g / 16).toString(16);
+ color += Math.floor(g % 16).toString(16);
+ color += Math.floor(b / 16).toString(16);
+ color += Math.floor(b % 16).toString(16);
+ return color;
+ };
+ _ieColorManager.getColorFromArgb = _getColorFromArgb;
+
+ var getIEOffset = function(transform, rect) {
+ var translatedVertexes = [
+ $axure.utils.Vector2D(0, 0), //we dont translate, so the orgin is fixed
+ transform.mul($axure.utils.Vector2D(0, rect.height)),
+ transform.mul($axure.utils.Vector2D(rect.width, 0)),
+ transform.mul($axure.utils.Vector2D(rect.width, rect.height))];
+
+ var minX = 0, minY = 0, maxX = 0, maxY = 0;
+ $.each(translatedVertexes, function(index, p) {
+ minX = Math.min(minX, p.x);
+ minY = Math.min(minY, p.y);
+ maxX = Math.max(maxX, p.x);
+ maxY = Math.max(maxY, p.y);
+ });
+
+ return $axure.utils.Vector2D(
+ (maxX - minX - rect.width) / 2,
+ (maxY - minY - rect.height) / 2);
+ };
+
+ var _filterFromTransform = function(transform) {
+ return "progid:DXImageTransform.Microsoft.Matrix(M11=" + transform.m11 +
+ ", M12=" + transform.m12 + ", M21=" + transform.m21 +
+ ", M22=" + transform.m22 + ", SizingMethod='auto expand')";
+ };
+
+ var _applyIERotation = function() {
+ if(Number(BROWSER_VERSION) >= 9) return;
+
+ $axure(function(diagramObject) {
+ return ((diagramObject.style.rotation && Math.abs(diagramObject.style.rotation) > 0.1)
+ || (diagramObject.style.textRotation && Math.abs(diagramObject.style.textRotation) > 0.1))
+ && !diagramObject.isContained;
+ }).each(function(diagramObject, elementId) {
+ var rotation = diagramObject.style.rotation || 0;
+ var $element = $('#' + elementId);
+ var axElement = $ax('#' + elementId);
+ var width = axElement.width();
+ var height = axElement.height();
+ var originX = width / 2;
+ var originY = height / 2;
+
+ var shapeIeOffset;
+ $element.children().each(function() {
+ var $child = $(this);
+ var axChild = $ax('#' + $child.attr('id'));
+ var childWidth = axChild.width();
+ var childHeight = axChild.height() + $child.position().top;
+ var centerX = $child.position().left + (childWidth / 2);
+ var centerY = $child.position().top + (childHeight / 2);
+ var deltaX = centerX - originX;
+ var deltaY = centerY - originY;
+
+ var effectiveRotation = rotation;
+ var textObject = $ax.getObjectFromElementId($child.attr('id'));
+ if(textObject) {
+ if(textObject.style.textRotation) effectiveRotation = textObject.style.textRotation;
+ else return;
+ }
+
+ var transform = $ax.utils.Matrix2D.identity().rotate(effectiveRotation);
+ var filter = _filterFromTransform(transform);
+
+ $child.css('filter', filter)
+ .width(childWidth + 1)
+ .height(childHeight + 1);
+
+ var p = transform.mul($ax.utils.Vector2D(deltaX, deltaY));
+ var ieOffset = getIEOffset(transform, { width: childWidth, height: childHeight });
+ if(!textObject) {
+ shapeIeOffset = ieOffset;
+ } else {
+ // This is a close approximation, but not exact
+ if(diagramObject.style.verticalAlignment != 'top') ieOffset.y -= shapeIeOffset.y + Math.abs(shapeIeOffset.x);
+ }
+
+ $child.css("margin-left", -ieOffset.x - deltaX + p.x).css("margin-top", -ieOffset.y - deltaY + p.y);
+ });
+ });
+ };
+
+ var _fixIEStretchBackground = function() {
+ if(Number(BROWSER_VERSION) >= 9) return;
+ var pageStyle = $ax.adaptive.getPageStyle();
+ if(!pageStyle.imageRepeat || pageStyle.imageRepeat == 'auto') return;
+
+ $('body').css('background-image', 'none');
+ var viewId = $ax.adaptive.currentViewId;
+ var imageInfo = viewId ? $ax.pageData.viewIdToBackgroundImageInfo && $ax.pageData.viewIdToBackgroundImageInfo[viewId] : $ax.pageData.defaultBackgroundImageInfo;
+ if(imageInfo && imageInfo.path) {
+ if($('#bg_img').length == 0) $('body').append('
');
+ // container.html(html);
+ // container.attr('id', '' + repeaterId + '_container');
+ // container.css({ position: 'absolute' });
+ // container.offset({ left: -obj.x, top: -obj.y });
+
+ var div = $('
');
+ div.html(html);
+ div.find('.' + $ax.visibility.HIDDEN_CLASS).removeClass($ax.visibility.HIDDEN_CLASS);
+ div.find('.' + $ax.visibility.UNPLACED_CLASS).removeClass($ax.visibility.UNPLACED_CLASS);
+
+ var paddingTop = _getAdaptiveProp(propMap, 'paddingTop', viewId);
+ var paddingLeft = _getAdaptiveProp(propMap, 'paddingLeft', viewId);
+ var paddingY = paddingTop + _getAdaptiveProp(propMap, 'paddingBottom', viewId);
+ var paddingX = paddingLeft + _getAdaptiveProp(propMap, 'paddingRight', viewId);
+
+ var spacingX = _getAdaptiveProp(propMap, 'horizontalSpacing', viewId);
+ var xOffset = offset.width + spacingX;
+ var spacingY = _getAdaptiveProp(propMap, 'verticalSpacing', viewId);
+ var yOffset = offset.height + spacingY;
+ div.css({
+ width: offset.width,
+ height: offset.height
+ });
+
+ _applyColorCss(background, div);
+ var altDiv = div;
+ if(hasAltColor) altDiv = _applyColorCss(altColor, div.clone());
+
+ // Hide repeater, if shown, while updating.
+ var shown = $ax.visibility.IsIdVisible(repeaterId);
+ if(shown) document.getElementById(repeaterId).style.visibility = 'hidden';
+
+ //clean up old items as late as possible
+ removeItems(repeaterId);
+ resetItemSizes(repeaterId, offset, bounds, orderedIds, vertical, wrap);
+
+ var i = 0;
+ var startTop = paddingTop;
+ var startLeft = paddingLeft;
+ if(repeaterObj.css('box-sizing') == 'border-box') {
+ startTop -= $ax.getNumFromPx(repeaterObj.css('border-top-width')) || 0;
+ startLeft -= $ax.getNumFromPx(repeaterObj.css('border-left-width')) || 0;
+ }
+ var top = startTop;
+ var left = startLeft;
+ for(pos = start; pos < end; pos++) {
+ itemId = orderedIds[pos];
+
+ var itemElementId = _createElementId(repeaterId, itemId);
+ $ax.addItemIdToRepeater(itemId, repeaterId);
+
+ ids.push(itemElementId);
+ var processId = function(full, prop, id) {
+ var elementId = _createElementId('u' + id, itemId);
+ //If there is a suffix (ex. _img), then don't push the id.
+ if (id.indexOf('_') <= 0 && id.indexOf('p') == -1) ids.push(elementId);
+ return prop + '="' + elementId + '"';
+ };
+
+ var copy = (useAlt ? altDiv : div).clone();
+ useAlt = !useAlt;
+ copy.attr('id', itemElementId);
+ copy.html(div.html().replace(/(id|for)="?u([0-9]+(p([0-9]){3})?(_[_a-z0-9]*)?)"?/g, processId));
+ if(obj.repeaterPropMap.isolateRadio) {
+ var radioButtons = copy.find(':radio');
+ for(var radioIndex = 0; radioIndex < radioButtons.length; radioIndex++) {
+ var radio = $(radioButtons[radioIndex]);
+ var oldName = radio.attr('name') || '';
+ // Can't use create element id because there could be an underscore in name
+ if(oldName) radio.attr('name', oldName + '-' + itemId);
+ }
+ }
+
+
+ copy.css({
+ 'position': 'absolute',
+ 'top': top + 'px',
+ 'left': left + 'px',
+ 'width': obj.width + 'px',
+ 'height': obj.height + 'px'
+ });
+ $('#' + repeaterId).append(copy);
+
+ i++;
+ if(wrap != -1 && i % wrap == 0) {
+ if(vertical) {
+ top = startTop;
+ left += xOffset;
+ } else {
+ left = startLeft;
+ top += yOffset;
+ }
+ } else if (vertical) top += yOffset;
+ else left += xOffset;
+ }
+
+ var shownCount = end - start;
+ var repeaterSize = { width: paddingX, height: paddingY};
+ if(shownCount > 0) {
+ var primaryCount = wrap == -1 ? shownCount : Math.min(shownCount, wrap);
+ var secondaryCount = wrap == -1 ? 1 : Math.ceil(shownCount / wrap);
+
+ var widthCount = vertical ? secondaryCount : primaryCount;
+ var heightCount = vertical ? primaryCount : secondaryCount;
+ repeaterSize.width += offset.width + (widthCount - 1) * xOffset;
+ repeaterSize.height += offset.height + (heightCount - 1) * yOffset;
+ }
+ repeaterObj.css(repeaterSize);
+
+ // Had to move this here because it sets up cursor: pointer on inline links,
+ // but must be done before style cached when adaptive view is set.
+ // TODO: Should be able to combine this with initialization done in pregen items. Just need to have ids and template ids be the same.
+ for(var i = 0; i < ids.length; i++) $ax.initializeObjectEvents($ax('#' + ids[i]), true);
+ }
+
+ var query = _getItemQuery(repeaterId);
+ if(viewId) $ax.adaptive.applyView(viewId, query);
+ else $ax.visibility.resetLimboAndHiddenToDefaults(_getItemQuery(repeaterId, preevalMap));
+
+ $ax.annotation.InitializeAnnotations(query);
+
+ for(var index = 0; index < ids.length; index++) {
+ var id = ids[index];
+ var childObj = $obj(id);
+ var childJobj = $jobj(id);
+ var childItemId = _getItemIdFromElementId(id);
+
+ if(obj.repeaterPropMap.isolateSelection && childJobj.attr('selectiongroup')) {
+ childJobj.attr('selectiongroup', _createElementId(childJobj.attr('selectiongroup'), childItemId));
+ }
+ if ($ax.ieColorManager) $ax.ieColorManager.applyBackground($ax('#' + id));
+ $ax.style.initializeObjectTextAlignment($ax('#' + id));
+ $ax.applyHighlight($ax('#' + id), true);
+ }
+
+ $ax.messageCenter.startCombineEventMessages();
+ $ax.cacheRepeaterInfo(repeaterId, $ax.getWidgetInfo(repeaterId));
+
+ // Now load
+ for(pos = start; pos < end; pos++) {
+ itemId = orderedIds[pos];
+ itemElementId = _createElementId(repeaterId, itemId);
+ if(!preevalMap[orderedIds[pos]]) $ax.event.raiseSyntheticEvent(itemElementId, 'onItemLoad', true);
+ $ax.loadDynamicPanelsAndMasters(obj.objects, path, itemId);
+ }
+
+ $ax.removeCachedRepeaterInfo(repeaterId);
+ $ax.messageCenter.endCombineEventMessages();
+
+ // Reshow repeater if it was originally shown (load is complete by now)
+ if(shown && !itemsPregen) document.getElementById(repeaterId).style.visibility = 'inherit';
+
+ $ax.dynamicPanelManager.fitParentPanel(repeaterId);
+
+ // Right now we assume only one refresh at a time. If we can manually trigger refreshes, that may possibly change.
+ $ax.action.refreshEnd();
+ };
+ _repeaterManager.refreshRepeater = _refreshRepeater;
+
+ var _getItemQuery = function(repeaterId, preevalMap) {
+ var query = $ax(function (diagramObject, elementId) {
+ // Also need to check that this in not preeval
+ if(preevalMap) {
+ var itemId = _getItemIdFromElementId(elementId);
+ if(preevalMap[itemId]) return false;
+ }
+
+ // All objects with the repeater as their parent, except the repeater itself.
+ var scriptId = _getScriptIdFromElementId(elementId);
+ return $ax.getParentRepeaterFromScriptId(scriptId) == repeaterId && scriptId != repeaterId;
+ });
+
+ return query;
+ }
+
+ _repeaterManager.refreshAllRepeaters = function() {
+ $ax('*').each(function(diagramObject, elementId) {
+ if(!$ax.public.fn.IsRepeater(diagramObject.type)) return;
+ if($ax.visibility.isElementIdLimboOrInLimboContainer(elementId)) return;
+ _initPageInfo(diagramObject, elementId);
+ _refreshRepeater(elementId, $ax.getEventInfoFromEvent($ax.getjBrowserEvent()));
+ });
+ };
+
+ _repeaterManager.refreshRepeaters = function(ids, eventInfo) {
+ for(var i = 0; i < ids.length; i++) _refreshRepeater(ids[i], eventInfo);
+ };
+
+ var _initPageInfo = function(obj, elementId) {
+ var pageInfo = {};
+ var map = obj.repeaterPropMap;
+
+ var currentViewId = $ax.adaptive.currentViewId || '';
+ var itemsPerPage = _getAdaptiveProp(map, 'itemsPerPage', currentViewId);
+ if(itemsPerPage == -1) pageInfo.noLimit = true;
+ else {
+ pageInfo.itemsPerPage = itemsPerPage;
+ pageInfo.currPage = _getAdaptiveProp(map, 'currPage', currentViewId);
+ }
+ repeaterToPageInfo[elementId] = pageInfo;
+ };
+
+ _repeaterManager.initialize = function() {
+ $ax(function (obj) {
+ return $ax.public.fn.IsRepeater(obj.type);
+ }).each(function (obj, repeaterId) {
+ _initPregen(repeaterId);
+ });
+ }
+
+ var _initPregen = function(repeaterId) {
+ var obj = $ax.getObjectFromScriptId(repeaterId);
+ var propMap = obj.repeaterPropMap;
+
+ //If there is no wrap, then set it to be above the number of rows
+ var viewId = $ax.adaptive.currentViewId || '';
+ var wrap = _getAdaptiveProp(propMap, 'wrap', viewId);
+ var vertical = _getAdaptiveProp(propMap, 'vertical', viewId);
+
+ var orderedIds = [];
+ var ids = [];
+ var background = _getAdaptiveProp(propMap, 'backColor', viewId);
+ var hasAltColor = _getAdaptiveProp(propMap, 'hasAltColor', viewId);
+ var altColor = hasAltColor ? _getAdaptiveProp(propMap, 'altColor', viewId) : undefined;
+ var useAlt = false;
+
+ var bounds = _getVisibleDataBounds(repeaterToPageInfo[repeaterId], obj.data.length);
+ var start = bounds[0];
+ var end = bounds[1];
+
+ // Starts empty
+ if(start == end) {
+ $ax.action.refreshEnd(repeaterId);
+ return;
+ }
+ var unprocessedBaseIds = $jobj($ax.repeater.createElementId(repeaterId, start + 1)).html().match(/(id|for)="?u([0-9]+)/g);
+ var baseIds = [];
+ if(unprocessedBaseIds) {
+ for(var i = 0; i < unprocessedBaseIds.length; i++) {
+ var val = unprocessedBaseIds[i].split('=')[1].substr(1);
+ if(baseIds.indexOf(val) == -1) baseIds.push(val);
+ }
+ }
+
+ for(var itemNum = start; itemNum < end; itemNum++) {
+ ids.push($ax.repeater.createElementId(repeaterId, itemNum + 1));
+ for(i = 0; i < baseIds.length; i++) ids.push($ax.repeater.createElementId(baseIds[i], itemNum + 1));
+ var itemId = itemNum + 1;
+ orderedIds[itemNum] = itemId;
+
+ var itemDiv = $jobj($ax.repeater.createElementId(repeaterId, itemNum + 1));
+ _applyColorCss(useAlt ? altColor : background, itemDiv);
+ if(hasAltColor) useAlt = !useAlt;
+ }
+
+ resetItemSizes(repeaterId, undefined, bounds, orderedIds, vertical, wrap);
+ };
+
+ var _applyColorCss = function(json, div) {
+ var args = json.r + ', ' + json.g + ', ' + json.b;
+ var background = json.a == 0 ? '' : json.a == 1 ? 'rgb(' + args + ')' : 'rgba(' + args + ', ' + json.a + ')';
+ if($ax.ieColorManager && json.a != 0 && json.a != 1) {
+ var ieColor = $ax.ieColorManager.getColorFromArgb(json.a * 255, json.r, json.g, json.b, true);
+ if(ieColor) background = ieColor;
+ }
+ div.css('background-color', background);
+ return div;
+ };
+
+ var _getAdaptiveProp = _repeaterManager.getAdaptiveProp = function(map, prop, viewId) {
+ var viewChain = $ax.adaptive.getAdaptiveIdChain(viewId);
+ for(var i = viewChain.length - 1; i >= 0; i--) {
+ viewId = viewChain[i];
+ var viewProps = map[viewId];
+ if(viewProps.hasOwnProperty(prop)) return viewProps[prop];
+ }
+
+ var base = map[''];
+ if(base.hasOwnProperty(prop)) return base[prop];
+ return map['default'][prop];
+ };
+
+ _repeaterManager.getItemCount = function(repeaterId) {
+ var data = repeaterToActiveDataSet[repeaterId].length;
+ var info = repeaterToPageInfo[repeaterId];
+ if(!info.noLimit) {
+ var start = Math.min(data, info.itemsPerPage * info.currPage);
+ var end = Math.min(data, start + info.itemsPerPage);
+ data = end - start;
+ }
+ return data;
+ };
+
+ _repeaterManager.setDisplayProps = function(obj, repeaterId, itemIndex) {
+ var data = repeaterToActiveDataSet[repeaterId];
+ var info = repeaterToPageInfo[repeaterId];
+ var start = 0;
+ var end = data.length;
+ if(!info.noLimit) {
+ start = Math.min(end, info.itemsPerPage * (info.currPage - 1));
+ end = Math.min(end, start + info.itemsPerPage);
+ }
+ var count = end - start;
+ var index = -1;
+ for(var i = 0; i < count; i++) {
+ if(data[start + i].index == itemIndex) index = i + 1;
+ }
+ if(index == -1) return;
+ obj.index = index;
+ obj.isfirst = index == 1;
+ obj.islast = index == end - start;
+ obj.iseven = index % 2 == 0;
+ obj.isodd = index % 2 == 1;
+ };
+
+ var _getVisibleDataBounds = function(pageInfo, count) {
+ var retval = [0, count];
+ if(!pageInfo.noLimit) {
+ var end = pageInfo.itemsPerPage * pageInfo.currPage;
+ var start = end - pageInfo.itemsPerPage;
+
+ // If past the end, move to last page
+ if(start >= count) {
+ pageInfo.currPage = Math.floor((count - 1) / pageInfo.itemsPerPage) + 1;
+ if(pageInfo.currPage <= 0) pageInfo.currPage = 1;
+
+ end = pageInfo.itemsPerPage * pageInfo.currPage;
+ start = end - pageInfo.itemsPerPage;
+ }
+ end = Math.min(end, count);
+ retval[0] = start;
+ retval[1] = end;
+ }
+ return retval;
+ };
+
+ _repeaterManager.getVisibleDataCount = function(repeaterId) {
+ var bounds = _getVisibleDataBounds(repeaterToPageInfo[repeaterId], repeaterToActiveDataSet[repeaterId].length);
+ return bounds[1] - bounds[0];
+ };
+
+ _repeaterManager.getDataCount = function(repeaterId) {
+ return repeaterToCurrentDataSet[repeaterId].length;
+ };
+
+ var _getFilteredDataCount = _repeaterManager.getFilteredDataCount = function(repeaterId) {
+ return repeaterToActiveDataSet[repeaterId].length;
+ };
+
+ _repeaterManager.getPageCount = function(repeaterId) {
+ var info = repeaterToPageInfo[repeaterId];
+ return info.noLimit ? 1 : Math.ceil(_getFilteredDataCount(repeaterId) / info.itemsPerPage);
+ };
+
+ _repeaterManager.getPageIndex = function(repeaterId) {
+ var info = repeaterToPageInfo[repeaterId];
+ return info.noLimit ? 1 : info.currPage;
+ };
+
+ var getActiveDataSet = function(repeaterId) {
+ var active = $ax.deepCopy(repeaterToCurrentDataSet[repeaterId]);
+ // Set up 1 indexing each item.
+ for(var i = 0; i < active.length; i++) active[i].index = i + 1;
+ return active;
+ };
+
+ var getOrderedIds = function(repeaterId, eventInfo) {
+ var data = repeaterToActiveDataSet[repeaterId] = getActiveDataSet(repeaterId);
+
+ // Filter first so less to sort
+ applyFilter(repeaterId, data, eventInfo);
+
+ // Sort next
+ var sorts = repeaterToSorts[repeaterId] || [];
+ if(sorts.length != 0 && data.length > 1) {
+ // TODO: Make this generic and factor out if we want to use it elsewhere...
+ // Compare is a function that takes 2 arguments, and returns a number. A high number means the second should go first
+ // Otherwise the first stays first.
+ var mergesort = function(list, start, end, compare) {
+ var middle = Math.floor((start + end) / 2);
+ if(middle - start > 1) mergesort(list, start, middle, compare);
+ if(end - middle > 1) mergesort(list, middle, end, compare);
+ var index1 = start;
+ var index2 = middle;
+ var tempList = [];
+ while(index1 < middle && index2 < end) {
+ tempList[tempList.length] = list[compare(list[index1], list[index2]) > 0 ? index2++ : index1++];
+ }
+ while(index1 < middle) tempList[tempList.length] = list[index1++];
+ while(index2 < end) tempList[tempList.length] = list[index2++];
+
+ // transfer from temp list to the real list.
+ for(var i = 0; i < tempList.length; i++) list[start + i] = tempList[i];
+ };
+ // Compare is the tie breaking function to us if necessary.
+ var getComparator = function(columnName, ascending, type, compare) {
+ // If this needs to be sped up, break up into several smaller functions conditioned off of type
+ return function(row1, row2) {
+ // If column undefined have it be empty string, NaN, or invalid date
+ //// If column undefined, no way to measure this, so call it a tie.
+ //if(row1[columnName] === undefined || row2[columnName] === undefined) return 0;
+
+ var text1 = (row1[columnName] && row1[columnName].text) || '';
+ var text2 = (row2[columnName] && row2[columnName].text) || '';
+
+ // This means we are case insensitive, so lowercase everything to kill casing
+ if(type == 'Text') {
+ text1 = text1.toLowerCase();
+ text2 = text2.toLowerCase();
+ }
+
+ //If tied, go to tie breaker
+ if(text1 == text2) {
+ if(compare) return compare(row1, row2);
+ // Actually a tie.
+ return 0;
+ }
+ if(type == 'Text' || type == 'Text (Case Sensitive)') {
+ if(text1 < text2 ^ ascending) return 1;
+ else return -1;
+ } else if(type == 'Number') {
+ var num1 = text1 == '' ? NaN : Number(text1);
+ var num2 = text2 == '' ? NaN : Number(text2);
+
+ if(isNaN(num1) && isNaN(num2)) return 0;
+ if(isNaN(num1) || isNaN(num2)) return isNaN(num1) ? 1 : -1;
+ if(num1 < num2 ^ ascending) return 1;
+ else return -1;
+ } else if(type == 'Date - YYYY-MM-DD' || type == 'Date - MM/DD/YYYY') {
+ var func = type == 'Date - YYYY-MM-DD' ? getDate1 : getDate2;
+ var date1 = func(text1);
+ var date2 = func(text2);
+ if(!date1.valid && !date2.valid) return 0;
+ if(!date1.valid || !date2.valid) return date1.valid ? -1 : 1;
+ var diff = date2.year - date1.year;
+ if(diff == 0) diff = date2.month - date1.month;
+ if(diff == 0) diff = date2.day - date1.day;
+ if(diff == 0) return 0;
+ return diff > 0 ^ ascending ? 1 : -1;
+ }
+ console.log('unhandled sort type');
+ return 0;
+ };
+ };
+ var compareFunc = null;
+ for(var i = 0; i < sorts.length; i++) compareFunc = getComparator(sorts[i].columnName, sorts[i].ascending, sorts[i].sortType, compareFunc);
+
+ mergesort(data, 0, data.length, compareFunc);
+ }
+
+ var ids = [];
+ for(i = 0; i < data.length; i++) ids[i] = data[i].index;
+
+ return ids;
+ };
+
+ var getDate1 = function(text) {
+ var date = { valid: false };
+ var sections = text.split('-');
+ if(sections.length == 1) sections = text.split('/');
+ if(sections.length != 3) return date;
+ date.year = Number(sections[0]);
+ date.month = Number(sections[1]);
+ date.day = Number(sections[2]);
+ date.valid = !isNaN(date.year);
+ date.valid &= !isNaN(date.month) && date.month > 0 && date.month <= 12;
+ date.valid &= !isNaN(date.day) && date.day > 0 && date.day <= daysPerMonth(date.month, date.year);
+ return date;
+ };
+
+ var getDate2 = function(text) {
+ var date = { valid: false };
+ var sections = text.split('-');
+ if(sections.length == 1) sections = text.split('/');
+ if(sections.length != 3) return date;
+ date.month = Number(sections[0]);
+ date.day = Number(sections[1]);
+ date.year = Number(sections[2]);
+ date.valid = !isNaN(date.year);
+ date.valid &= !isNaN(date.month) && date.month > 0 && date.month <= 12;
+ date.valid &= !isNaN(date.day) && date.day > 0 && date.day <= daysPerMonth(date.month, date.year);
+ return date;
+ };
+
+ var daysPerMonth = function(month, year) {
+ if(month == 9 || month == 4 || month == 6 || month == 11) return 30;
+ if(month != 2) return 31;
+
+ if(year % 4 != 0) return 28;
+ if(year % 100 != 0) return 29;
+ return year % 400 == 0 ? 29 : 28;
+ };
+
+ var applyFilter = function(repeaterId, data, eventInfo) {
+ var dataFiltered = [];
+ var filters = repeaterToFilters[repeaterId] || [];
+ if (filters.length != 0) {
+ if(!eventInfo) eventInfo = $ax.getBasicEventInfo();
+ var oldTarget = eventInfo.targetElement;
+ var oldSrc = eventInfo.srcElement;
+ var oldThis = eventInfo.thiswidget;
+ var oldItem = eventInfo.item;
+
+ var idToWidgetInfo = {};
+
+ outer:
+ for(var i = 1; i <= data.length; i++) {
+ for(var j = 0; j < filters.length; j++) {
+ eventInfo.targetElement = _createElementId(repeaterId, i);
+ eventInfo.srcElement = filters[j].thisId;
+ if(!idToWidgetInfo[eventInfo.srcElement]) idToWidgetInfo[eventInfo.srcElement] = $ax.getWidgetInfo(eventInfo.srcElement);
+ eventInfo.thiswidget = idToWidgetInfo[eventInfo.srcElement];
+ eventInfo.item = $ax.getItemInfo(eventInfo.srcElement);
+
+ if($ax.expr.evaluateExpr(filters[j].filter, eventInfo) != 'true') continue outer;
+ }
+ dataFiltered[dataFiltered.length] = data[i - 1];
+ }
+
+ for(i = 0; i < dataFiltered.length; i++) data[i] = dataFiltered[i];
+ while(data.length > dataFiltered.length) data.pop();
+
+ eventInfo.targetElement = oldTarget;
+ eventInfo.srcElement = oldSrc;
+ eventInfo.thiswidget = oldThis;
+ eventInfo.item = oldItem;
+ }
+ };
+
+ var _addFilter = function(repeaterId, removeOtherFilters, label, filter, thisId) {
+ if(removeOtherFilters) _removeFilter(repeaterId);
+
+ var filterList = repeaterToFilters[repeaterId];
+ if(!filterList) repeaterToFilters[repeaterId] = filterList = [];
+
+ var filterObj = { filter: filter, thisId: thisId };
+ if(label) filterObj.label = label;
+ filterList[filterList.length] = filterObj;
+ };
+ _repeaterManager.addFilter = _addFilter;
+
+ var _removeFilter = function(repeaterId, label) {
+ var filterList = repeaterToFilters[repeaterId];
+ // If no list, nothing to remove
+ if(!filterList) return;
+
+ // If no label, remove everything
+ if(!label) {
+ repeaterToFilters[repeaterId] = [];
+ return;
+ }
+
+ for(var i = filterList.length - 1; i >= 0; i--) {
+ var filterObj = filterList[i];
+ if(filterObj.label && filterObj.label == label) $ax.splice(filterList, i, 1);
+ }
+ };
+ _repeaterManager.removeFilter = _removeFilter;
+
+ var _addSort = function(repeaterId, label, columnName, ascending, toggle, sortType) {
+ var sortList = repeaterToSorts[repeaterId];
+ if(!sortList) repeaterToSorts[repeaterId] = sortList = [];
+
+ for(var i = 0; i < sortList.length; i++) {
+ if(columnName == sortList[i].columnName) {
+ var lastSortObj = $ax.splice(sortList, i, 1)[0];
+ if(toggle) ascending = !lastSortObj.ascending;
+ break;
+ }
+ }
+
+ var sortObj = { columnName: columnName, ascending: ascending, sortType: sortType };
+
+ if(label) sortObj.label = label;
+ sortList[sortList.length] = sortObj;
+ };
+ _repeaterManager.addSort = _addSort;
+
+ var _removeSort = function(repeaterId, label) {
+ var sortList = repeaterToSorts[repeaterId];
+ // If no list, nothing to remove
+ if(!sortList) return;
+
+ // If no label, remove everything
+ if(!label) {
+ repeaterToSorts[repeaterId] = [];
+ return;
+ }
+
+ for(var i = sortList.length - 1; i >= 0; i--) {
+ var sortObj = sortList[i];
+ if(sortObj.label && sortObj.label == label) $ax.splice(sortList, i, 1);
+ }
+ };
+ _repeaterManager.removeSort = _removeSort;
+
+ var _setRepeaterToPage = function(repeaterId, type, value, eventInfo) {
+ var pageInfo = repeaterToPageInfo[repeaterId];
+ // page doesn't matter if there is no limit.
+ if(pageInfo.noLimit) return;
+
+ var dataSet = repeaterToActiveDataSet[repeaterId];
+ if(!dataSet) dataSet = repeaterToCurrentDataSet[repeaterId];
+ var lastPage = Math.max(1, Math.ceil(dataSet.length / pageInfo.itemsPerPage));
+
+ if(type == 'Value') {
+ var val = Number($ax.expr.evaluateExpr(value, eventInfo));
+ // if invalid, default to 1, otherwise, clamp the value
+ if(isNaN(val)) val = 1;
+ else if(val < 1) val = 1;
+ else if(val > lastPage) val = lastPage;
+
+ pageInfo.currPage = val;
+ } else if(type == 'Previous') {
+ if(pageInfo.currPage > 1) pageInfo.currPage--;
+ } else if(type == 'Next') {
+ if(pageInfo.currPage < lastPage) pageInfo.currPage++;
+ } else if(type == 'Last') {
+ pageInfo.currPage = lastPage;
+ } else {
+ console.log('Unknown type');
+ }
+ };
+ _repeaterManager.setRepeaterToPage = _setRepeaterToPage;
+
+ var _setNoItemLimit = function(repeaterId) {
+ var pageInfo = repeaterToPageInfo[repeaterId];
+ delete pageInfo.currPage;
+ delete pageInfo.itemsPerPage;
+ pageInfo.noLimit = true;
+ };
+ _repeaterManager.setNoItemLimit = _setNoItemLimit;
+
+ var _setItemLimit = function(repeaterId, value, eventInfo) {
+ var pageInfo = repeaterToPageInfo[repeaterId];
+
+ if(pageInfo.noLimit) {
+ pageInfo.noLimit = false;
+ pageInfo.currPage = 1;
+ }
+
+ var oldTarget = eventInfo.targetElement;
+ eventInfo.targetElement = repeaterId;
+ var itemLimit = Number($ax.expr.evaluateExpr(value, eventInfo));
+ eventInfo.targetElement = oldTarget;
+ if(isNaN(itemLimit)) itemLimit = 20;
+ else if(itemLimit < 1) itemLimit = 1;
+ pageInfo.itemsPerPage = itemLimit;
+ };
+ _repeaterManager.setItemLimit = _setItemLimit;
+
+ var removeItems = function(repeaterId) {
+ var elementIds = $ax.getChildElementIdsForRepeater(repeaterId);
+ var itemId = $ax.getItemIdsForRepeater(repeaterId);
+ for(var i = 0; i < itemId.length; i++) $jobj(_createElementId(repeaterId, itemId[i])).remove();
+ $ax.visibility.clearLimboAndHiddenIds(elementIds);
+ $ax.clearItemsForRepeater(repeaterId);
+ };
+
+ var repeaterSizes = {};
+ var resetItemSizes = function (repeaterId, itemSize, bounds, ids, vertical, wrap) {
+ var calcItem = !itemSize;
+ if(calcItem) itemSize = {};
+
+ var repeaterMap = {};
+ repeaterMap.vert = vertical;
+ var sizesMap = {};
+ var sizes = [];
+ var currSizes = wrap == -1 ? sizes : [];
+ for(var i = 0; i + bounds[0] < bounds[1]; i++) {
+ var itemId = ids[i + bounds[0]];
+ if(calcItem) {
+ var itemJobj = $jobj(_createElementId(repeaterId, itemId));
+ itemSize.width = $ax.getNumFromPx(itemJobj.css('width'));
+ itemSize.height = $ax.getNumFromPx(itemJobj.css('height'));
+ }
+
+ var size = { itemId: itemId, width: itemSize.width, height: itemSize.height };
+ currSizes.push(size);
+ sizesMap[size.itemId] = size;
+ if(currSizes.length == wrap) {
+ sizes.push(currSizes);
+ currSizes = [];
+ }
+ }
+ if (wrap != -1 && currSizes.length > 0) sizes.push(currSizes);
+ repeaterMap.sizes = sizes;
+ repeaterMap.sizesMap = sizesMap;
+ repeaterSizes[repeaterId] = repeaterMap;
+ };
+
+ _repeaterManager.getItemSize = function(repeaterId, itemId) {
+ var repeaterSize = repeaterSizes[repeaterId];
+ if (!repeaterSize) return false;
+ return repeaterSize.sizesMap[itemId];
+ }
+
+ _repeaterManager.setItemSize = function (repeaterId, itemId, width, height) {
+ var repeaterSize = repeaterSizes[repeaterId];
+ if(!repeaterSize) return false;
+ var size = repeaterSize.sizesMap[itemId];
+ var deltaX = width - size.width;
+ var deltaY = height - size.height;
+ if(!deltaX && !deltaY) return false;
+
+ repeaterSize.resized = true;
+
+ if(deltaX) _pushItems(repeaterId, itemId, deltaX, false, true);
+ if(deltaY) _pushItems(repeaterId, itemId, deltaY, true, true);
+
+ if(deltaX || deltaY) $ax.event.raiseSyntheticEvent(_createElementId(repeaterId, itemId), 'onItemResize');
+
+ return true;
+ }
+
+ var _pushItems = _repeaterManager.pushItems = function (repeaterId, itemId, delta, vertical, suppressFire) {
+ if(delta == 0) return;
+
+ // Update repeater item size
+ var prop = vertical ? 'height' : 'width';
+ var itemObj = $jobj(_createElementId(repeaterId, itemId));
+ itemObj.css(prop, $ax.getNumFromPx(itemObj.css(prop)) + delta);
+
+ var repeaterObj = $jobj(repeaterId);
+ var repeaterMap = repeaterSizes[repeaterId];
+ var sizes = repeaterMap.sizes;
+ var wrap = sizes[0].length != undefined;
+ var vert = repeaterMap.vert;
+
+ // Not wrapping, has to push in primary direction
+ if (!wrap && vert != vertical) {
+ var before = 0;
+ var after = 0;
+ var limit = 0;
+ for(var i = 0; i < sizes.length; i++) {
+ var size = sizes[i];
+ if(size.itemId == itemId) {
+ before = size[prop];
+ size[prop] += delta;
+ after = size[prop];
+ } else {
+ limit = limit ? Math.max(limit, size[prop]) : size[prop];
+ }
+ }
+
+ // Repeater delta is because an item can increase secondary direction, but if another item is already larger, then repeater size isn't effected.
+ var repeaterDelta = delta;
+ if(sizes.length != 1) {
+ if(after >= limit) repeaterDelta = after - Math.max(limit, before);
+ else if(before > limit) repeaterDelta = limit - before;
+ else repeaterDelta = 0;
+ }
+
+ _updateRepeaterSize(prop, repeaterObj, repeaterDelta, vert);
+
+ if(!suppressFire) $ax.event.raiseSyntheticEvent(_createElementId(repeaterId, itemId), 'onItemResize');
+ return;
+ }
+
+ var index = 0;
+ var index2 = 0;
+ // Get the indices first
+ if(wrap) {
+ outer:
+ for(; index < sizes.length; index++) {
+ var innerSizes = sizes[index];
+ for(index2 = 0; index2 < innerSizes.length; index2++) if(innerSizes[index2].itemId == itemId) break outer;
+ }
+ } else {
+ for(; index < sizes.length; index++) if(sizes[index].itemId == itemId) break;
+ }
+ // Find out who is being pushed
+ var itemIdsEffected = [];
+ if (vert == vertical) {
+ // To check for repeater resize, non-wrap is easy, for wrap you have to see if your new size is enough to effect the size given other col/row sizes.
+ repeaterDelta = delta;
+ if(wrap && sizes.length > 1) {
+ var viewId = $ax.adaptive.currentViewId || '';
+ var spacing = _getAdaptiveProp($obj(repeaterId).repeaterPropMap, (vert ? 'vertical' : 'horizontal') + 'Spacing', viewId);
+ for(i = 0; i < sizes.length; i++) {
+ var rowColSize = 0;
+ var rowCol = sizes[i];
+ for(var j = 0; j < rowCol.length; j++) {
+ if(j != 0) rowColSize += spacing;
+ rowColSize += rowCol[j][prop];
+ }
+
+ if(i == index) {
+ before = rowColSize;
+ after = before + delta;
+ } else {
+ limit = limit ? Math.max(limit, rowColSize) : rowColSize;
+ }
+ }
+
+ if(after >= limit) repeaterDelta = after - Math.max(limit, before);
+ else if (before > limit) repeaterDelta = limit - before;
+ else repeaterDelta = 0;
+ }
+
+ if (repeaterDelta) {
+ _updateRepeaterSize(prop, repeaterObj, repeaterDelta, vert);
+ }
+
+ // Done the hard part, calculating/updating new repeater size. Now just resize items and find what to push.
+ var array = wrap ? sizes[index] : sizes;
+ i = wrap ? index2 : index;
+ array[i][prop] += delta;
+
+ for(i++; i < array.length; i++) itemIdsEffected.push(array[i].itemId);
+ } else {
+ // Secondary push is more interesting. See how much your primary row/column is already pushing, if that changes
+ // then effect all rows/columns after it
+
+ // Get the biggest one in the current row/column, ignoring the one we're changing
+ var biggest = 0;
+ var currSizes = sizes[index];
+ for(i = 0; i < currSizes.length; i++) {
+ if (i == index2) continue;
+
+ biggest = Math.max(biggest, currSizes[i][prop]);
+ }
+
+ var beforeSize = Math.max(biggest, currSizes[index2][prop]);
+ currSizes[index2][prop] += delta;
+ var afterSize = Math.max(biggest, currSizes[index2][prop]);
+
+ // Nothing pushed/pulled
+ if (afterSize == beforeSize) return;
+
+ for(i = index + 1; i < sizes.length; i++) {
+ currSizes = sizes[i];
+ for(j = 0; j < currSizes.length; j++) itemIdsEffected.push(currSizes[j].itemId);
+ }
+
+ // Delta is only how much the whole row/column changed
+ delta = afterSize - beforeSize;
+
+ // Repeater resize secondary is determined by the effective delta.
+ _updateRepeaterSize(prop, repeaterObj, delta, vert);
+ }
+
+ for(i = 0; i < itemIdsEffected.length; i++) {
+ var currItemId = itemIdsEffected[i];
+ var elementId = _createElementId(repeaterId, currItemId);
+ var loc = vertical ? 'top' : 'left';
+ var jobj = $jobj(elementId);
+ var currVal = Number(jobj.css(loc).replace('px', ''));
+ jobj.css(loc, currVal + delta);
+ }
+
+ if(!suppressFire) $ax.event.raiseSyntheticEvent(_createElementId(repeaterId, itemId), 'onItemResize');
+ }
+
+ var _updateRepeaterSize = function(prop, jobj, delta, vert) {
+ if (delta == 0) return;
+ var val = $ax.getNumFromPx(jobj.css(prop)) + delta;
+ var border = 0;
+ if(vert) border += $ax.getNumFromPx(jobj.css('border-top-width')) + $ax.getNumFromPx(jobj.css('border-bottom-width'));
+ else border += $ax.getNumFromPx(jobj.css('border-left-width')) + $ax.getNumFromPx(jobj.css('border-right-width'));
+ val += border;
+ jobj.css(prop, val);
+ $ax.dynamicPanelManager.fitParentPanel(jobj.attr('id'));
+ }
+
+ var _getDataFromDataSet = function (eventInfo, repeaterId, itemId, propName, type) {
+ var row = undefined;
+ var deleteMap = eventInfo && eventInfo.repeaterDeleteMap && eventInfo.repeaterDeleteMap[repeaterId];
+ if(deleteMap) row = deleteMap.idToRow[itemId];
+
+ if(!row) {
+ var itemNum = _getRealItemId(eventInfo, repeaterId, Number(itemId));
+ row = repeaterToCurrentDataSet[repeaterId][itemNum];
+ }
+ // Default to obj with text as empty string, as we don't generate the data for empty props
+ var data = row[propName] || { text: '' };
+ //For now text is always the default. May change this to depend on context.
+ switch(type) {
+ case 'data': return data.type == 'text' ? data.text : data
+ case 'img': return (data.img && data.img[$ax.adaptive.getSketchKey()]) || data.text;
+ default: return (type && data[type]) || data.text;
+ }
+ //return type == 'data' && data.type != 'text' ? data : (type && data[type]) || data['text'];
+ };
+ _repeaterManager.getData = _getDataFromDataSet;
+
+ _repeaterManager.hasData = function(id, propName) {
+ if(!_getItemIdFromElementId(id)) return false;
+ var repeaterId = $ax.getParentRepeaterFromScriptId(_getScriptIdFromElementId(id));
+ return Boolean(repeaterToCurrentDataSet[repeaterId] && repeaterToCurrentDataSet[repeaterId].props.indexOf(propName) != -1);
+ };
+
+ var _getEventDeleteData = function(eventInfo, repeaterId) {
+ var repeaterDeleteMap = eventInfo.repeaterDeleteMap;
+ if(!repeaterDeleteMap) repeaterDeleteMap = eventInfo.repeaterDeleteMap = {};
+
+ var myDeleteMap = repeaterDeleteMap[repeaterId];
+ if(!myDeleteMap) {
+ myDeleteMap = repeaterDeleteMap[repeaterId] = {};
+ myDeleteMap.deletedIds = [];
+ myDeleteMap.idToRow = {};
+ }
+
+ return myDeleteMap;
+ };
+
+ var _getRealItemId = function(eventInfo, repeaterId, itemId) {
+ var deletedBefore = 0;
+ var map = eventInfo.repeaterDeleteMap && eventInfo.repeaterDeleteMap[repeaterId];
+ var deletedIds = map && map.deletedIds;
+ if(!deletedIds) return itemId - 1;
+
+ for(var i = 0; i < deletedIds.length; i++) if (deletedIds[i] < itemId) deletedBefore++;
+ return itemId - deletedBefore - 1;
+ }
+
+ var _addItemToDataSet = function(repeaterId, row, itemEventInfo) {
+ itemEventInfo.data = true;
+ var oldTarget = itemEventInfo.targetElement;
+ itemEventInfo.targetElement = repeaterId;
+ var dataSet = repeaterToLocalDataSet[repeaterId];
+
+ for(var propName in row) {
+ if(!row.hasOwnProperty(propName)) continue;
+ var prop = row[propName];
+ if(prop.type == 'literal') {
+ var retval = $ax.expr.evaluateExpr(prop.literal, itemEventInfo);
+ if(typeof (retval) == 'string' || retval instanceof Date) retval = { type: 'text', text: retval };
+ row[propName] = retval;
+ }
+ }
+
+ itemEventInfo.targetElement = oldTarget;
+ dataSet[dataSet.length] = row;
+ itemEventInfo.data = false;
+ };
+ _repeaterManager.addItem = _addItemToDataSet;
+
+ var _deleteItemsFromDataSet = function(repeaterId, eventInfo, type, rule) {
+ var dataSet = repeaterToCurrentDataSet[repeaterId];
+ var deleteDataMap = _getEventDeleteData(eventInfo, repeaterId);
+ var items;
+
+ // Should always be this, marked, or rule.
+ if(type == 'this') items = [_getItemIdFromElementId(eventInfo.srcElement)];
+ else if(type == 'marked') items = $ax.deepCopy(repeaterToEditItems[repeaterId]);
+ else {
+ // This should be rule
+ var visibleData = repeaterToCurrentDataSet[repeaterId];
+ items = [];
+ var oldTarget = eventInfo.targetElement;
+ for(var i = 0; i < visibleData.length + deleteDataMap.deletedIds.length; i++) {
+ var index = i + 1;
+ if(deleteDataMap.deletedIds.indexOf(index) != -1) continue;
+
+ eventInfo.targetElement = _createElementId(repeaterId, index);
+ if($ax.expr.evaluateExpr(rule, eventInfo).toLowerCase() != 'true') continue;
+ items.push(index);
+ }
+ eventInfo.targetElement = oldTarget;
+ }
+ // Want them decending
+ items.sort(function(a, b) { return b - a; });
+ var editItems = repeaterToEditItems[repeaterId];
+
+ for(i = 0; i < items.length; i++) {
+ var itemId = items[i];
+
+ // Don't delete already deletedItem
+ if(deleteDataMap.deletedIds.indexOf(itemId) != -1) continue;
+
+ var deletedRow = $ax.splice(dataSet, _getRealItemId(eventInfo, repeaterId, itemId), 1)[0];
+ deleteDataMap.deletedIds.push(itemId);
+ deleteDataMap.idToRow[itemId] = deletedRow;
+ for(var j = editItems.length - 1; j >= 0; j--) {
+ var editItem = editItems[j];
+ if(editItem == itemId) $ax.splice(editItems, j, 1);
+ else if(editItem > itemId) editItems[j] = editItem - 1;
+ }
+ }
+ };
+ _repeaterManager.deleteItems = _deleteItemsFromDataSet;
+
+ var _updateEditItemsInDataSet = function(repeaterId, propMap, eventInfo, type, rule) {
+ var oldTarget = eventInfo.targetElement;
+ var dataSet = repeaterToCurrentDataSet[repeaterId];
+ var items;
+
+ // Should always be this, marked, or rule.
+ if(type == 'this') items = [_getItemIdFromElementId(eventInfo.srcElement)];
+ else if(type == 'marked') items = repeaterToEditItems[repeaterId];
+ else {
+ // This should be rule
+ var currData = repeaterToCurrentDataSet[repeaterId];
+ items = [];
+ oldTarget = eventInfo.targetElement;
+ for(var i = 0; i < currData.length; i++) {
+ var index = i + 1;
+ eventInfo.targetElement = _createElementId(repeaterId, index);
+ if($ax.expr.evaluateExpr(rule, eventInfo).toLowerCase() != 'true') continue;
+ items.push(index);
+ }
+ eventInfo.targetElement = oldTarget;
+ }
+
+ eventInfo.data = true;
+ for(var prop in propMap) {
+ if(!propMap.hasOwnProperty(prop)) continue;
+ for(i = 0; i < items.length; i++) {
+ var data = propMap[prop];
+ var item = items[i];
+ if(data.type == 'literal') {
+ eventInfo.targetElement = _createElementId(repeaterId, item);
+ data = $ax.expr.evaluateExpr(data.literal, eventInfo);
+ if(typeof (data) == 'object' && data.isWidget) data = data.text;
+ if(typeof (data) == 'string') data = { type: 'text', text: data };
+ }
+ dataSet[_getRealItemId(eventInfo, repeaterId, item)][prop] = data;
+ }
+ }
+ eventInfo.targetElement = oldTarget;
+ eventInfo.data = false;
+ };
+ _repeaterManager.updateEditItems = _updateEditItemsInDataSet;
+
+ var _getAllItemIds = function(repeaterId) {
+ var retval = [];
+ var currDataSet = repeaterToCurrentDataSet[repeaterId];
+ for(var i = 0; i < currDataSet.length; i++) retval.push(i + 1);
+ return retval;
+ };
+ _repeaterManager.getAllItemIds = _getAllItemIds;
+
+ var _addEditItemToRepeater = function(repeaterId, itemIds) {
+ for(var i = 0; i < itemIds.length; i++) {
+ var itemId = Number(itemIds[i]);
+ var items = repeaterToEditItems[repeaterId];
+ if(items.indexOf(itemId) == -1) items[items.length] = itemId;
+ }
+ };
+ _repeaterManager.addEditItems = _addEditItemToRepeater;
+
+ var _removeEditItemFromRepeater = function(repeaterId, itemIds) {
+ for(var i = 0; i < itemIds.length; i++) {
+ var itemId = itemIds[i];
+ var items = repeaterToEditItems[repeaterId];
+ var index = items.indexOf(Number(itemId));
+ if(index != -1) $ax.splice(items, index, 1);
+ }
+ };
+ _repeaterManager.removeEditItems = _removeEditItemFromRepeater;
+
+ _repeaterManager.isEditItem = function(repeaterId, itemId) {
+ var items = repeaterToEditItems[repeaterId];
+ return items.indexOf(Number(itemId)) != -1;
+ };
+
+ var _createElementId = function(scriptId, itemId) {
+ if(!itemId) return scriptId;
+ var i = scriptId.indexOf('_');
+ var sections = i > -1 ? [scriptId.substring(0, i), scriptId.substring(i + 1)] : [scriptId];
+ var retval = sections[0] + '-' + itemId;
+ return sections.length > 1 ? retval + '_' + sections[1] : retval;
+ };
+ _repeaterManager.createElementId = _createElementId;
+
+ var _getElementId = function(scriptId, childId) {
+ var elementId = scriptId;
+ if($ax.getParentRepeaterFromScriptId(scriptId)) {
+ // Must be in the same item as the child
+ var itemId = $ax.repeater.getItemIdFromElementId(childId);
+ elementId = $ax.repeater.createElementId(scriptId, itemId);
+ }
+ return elementId;
+ };
+ _repeaterManager.getElementId = _getElementId;
+
+ var _getScriptIdFromElementId = function(elementId) {
+ if(!elementId) return elementId;
+ var sections = elementId.split('-');
+ var retval = sections[0];
+ if(sections.length <= 1) return retval;
+ sections = sections[1].split('_');
+ return sections.length > 1 ? retval + '_' + sections[1] : retval;
+ };
+ _repeaterManager.getScriptIdFromElementId = _getScriptIdFromElementId;
+
+ var _getItemIdFromElementId = function(elementId) {
+ var sections = elementId.split('-');
+ if(sections.length < 2) return '';
+ sections = sections[1].split('_');
+ return sections[0];
+ };
+ _repeaterManager.getItemIdFromElementId = _getItemIdFromElementId;
+
+ // TODO: Just inline this if we keep it this way.
+ var _applySuffixToElementId = function(id, suffix) {
+ return id + suffix;
+ // return _createElementId(_getScriptIdFromElementId(id) + suffix, _getItemIdFromElementId(id));
+ };
+ _repeaterManager.applySuffixToElementId = _applySuffixToElementId;
+
+ var _removeSuffixFromElementId = function(id) {
+ if (id.indexOf('_') != -1) return id.split('_', 1)[0];
+ return id;
+ }
+ _repeaterManager.removeSuffixFromElementId = _removeSuffixFromElementId;
+
+ // var _getRepeaterSize = function(repeaterId) {
+ // var itemCount = ($ax.getItemIdsForRepeater(repeaterId) || []).length;
+ // if(itemCount == 0) return { width: 0, height: 0 };
+
+ // var repeater = $obj(repeaterId);
+ // // Width and height per item;
+ // var width = repeater.width;
+ // var height = repeater.height;
+
+ // var viewId = $ax.adaptive.currentViewId || '';
+ // var widthIncrement = width + _getAdaptiveProp(repeater.repeaterPropMap, 'horizontalSpacing', viewId);
+ // var heightIncrement = height + _getAdaptiveProp(repeater.repeaterPropMap, 'verticalSpacing', viewId);
+
+ // var wrap = _getAdaptiveProp(repeater.repeaterPropMap, 'wrap', viewId);
+ // var vertical = _getAdaptiveProp(repeater.repeaterPropMap, 'vertical', viewId);
+
+ // if(wrap == -1 || itemCount <= wrap) {
+ // if(vertical) height += heightIncrement * (itemCount - 1);
+ // else width += widthIncrement * (itemCount - 1);
+ // } else {
+ // var primaryDim = wrap;
+ // var secondaryDim = Math.ceil(itemCount / primaryDim);
+
+ // if(vertical) {
+ // height += heightIncrement * (primaryDim - 1);
+ // width += widthIncrement * (secondaryDim - 1);
+ // } else {
+ // width += widthIncrement * (primaryDim - 1);
+ // height += heightIncrement * (secondaryDim - 1);
+ // }
+ // }
+ // return { width: width, height: height };
+ // };
+ // _repeaterManager.getRepeaterSize = _getRepeaterSize;
+
+});
+
+// ******* Dynamic Panel Manager ******** //
+$axure.internal(function($ax) {
+ // TODO: Probably a lot of the dynamic panel functions from pagescript should be moved here at some point...
+ var _dynamicPanelManager = $ax.dynamicPanelManager = {};
+
+ var _isIdFitToContent = _dynamicPanelManager.isIdFitToContent = function(id) {
+ var obj = $obj(id);
+ if (!obj || !$ax.public.fn.IsDynamicPanel(obj.type) || !obj.fitToContent) return false;
+
+ var jpanel = $jobj(id);
+ return !jpanel.attr('data-notfit');
+ };
+
+ //this function fit parent panel, also check for parent layer or repeaters
+ var _fitParentPanel = function (widgetId) {
+
+ var parentLayer = getParentLayer(widgetId);
+ if(parentLayer) {
+ if(_updateLayerRectCache(parentLayer)) _fitParentPanel(parentLayer);
+ return;
+ }
+
+ // Find parent panel if there is one.
+ var parentPanelInfo = getParentPanel(widgetId);
+ if(parentPanelInfo) {
+ var parentId = parentPanelInfo.parent;
+ if(_updateFitPanel(parentId, parentPanelInfo.state)) _fitParentPanel(parentId);
+ return;
+ }
+
+ // Otherwise, try to get parent repeater
+ var parentRepeaterId = $ax.getParentRepeaterFromElementId(widgetId);
+ var repeaterObj = $obj(parentRepeaterId);
+ if(!repeaterObj || widgetId == parentRepeaterId || !repeaterObj.repeaterPropMap.fitToContent) return;
+ var itemId = $ax.repeater.getItemIdFromElementId(widgetId);
+ var size = getContainerSize($ax.repeater.createElementId(parentRepeaterId, itemId));
+ $ax.repeater.setItemSize(parentRepeaterId, itemId, size.width, size.height);
+ };
+ _dynamicPanelManager.fitParentPanel = _fitParentPanel;
+
+ _dynamicPanelManager.initialize = function() {
+ $axure.resize(_handleResize);
+ };
+
+ var percentPanelToLeftCache = [];
+ var percentPanelsInitialized = false;
+ var _handleResize = function() {
+ if(percentPanelsInitialized) {
+ for(var key in percentPanelToLeftCache) {
+ //could optimize to only update non-contained panels
+ _updatePanelPercentWidth(key);
+ }
+ } else {
+ $ax('*').each(function(obj, elementId) {
+ if(_isPercentWidthPanel(obj)) _updatePanelPercentWidth(elementId);
+ });
+ percentPanelsInitialized = true;
+ }
+ };
+
+ var _isPercentWidthPanel = _dynamicPanelManager.isPercentWidthPanel = function(obj) {
+ return obj && $ax.public.fn.IsDynamicPanel(obj.type) && obj.percentWidth;
+ };
+
+ _dynamicPanelManager.updatePanelContentPercentWidth = function(elementId) {
+ // if(_isPercentWidthPanel($obj(elementId))) return;
+ var stateChildrenQuery = $jobj(elementId).children('.panel_state');
+ stateChildrenQuery.children('.panel_state_content').each(
+ function() {
+ $(this).children('.ax_dynamic_panel').each(
+ function() { _updatePanelPercentWidth(this.id); }
+ );
+ }
+ );
+ };
+
+ _dynamicPanelManager.updatePercentPanelCache = function(query) {
+ query.each(function(obj, elementId) {
+ if(_isPercentWidthPanel(obj)) {
+ if(_updatePercentPanelToLeftCache(obj, elementId, true)) {
+ _updatePanelPercentWidth(elementId);
+ }
+ }
+ });
+ };
+
+ _dynamicPanelManager.resetFixedPanel = function(obj, domElement) {
+ if(obj.fixedHorizontal == 'center') domElement.style.marginLeft = "";
+ if(obj.fixedVertical == 'middle') domElement.style.marginTop = "";
+ };
+
+ _dynamicPanelManager.resetAdaptivePercentPanel = function(obj, domElement) {
+ if(!_isPercentWidthPanel(obj)) return;
+
+ if(obj.fixedHorizontal == 'center') domElement.style.marginLeft = "";
+ else if(obj.fixedHorizontal == 'right') domElement.style.width = "";
+ };
+
+ var _updatePercentPanelToLeftCache = function(obj, elementId, overwrite) {
+ var wasUpdated = false;
+ var jObj = $jobj(elementId);
+ var axObj = $ax('#' + elementId);
+ if(percentPanelToLeftCache[elementId] == undefined || overwrite) {
+ if(obj.fixedHorizontal == 'center') percentPanelToLeftCache[elementId] = Number(jObj.css('margin-left').replace("px", ""));
+ else if(obj.fixedHorizontal == 'right') percentPanelToLeftCache[elementId] = axObj.width() + Number(jObj.css('right').replace("px", ""));
+ else percentPanelToLeftCache[elementId] = Number(jObj.css('left').replace("px", ""));
+ wasUpdated = true;
+ }
+
+ if(obj.fixedHorizontal == 'right' && _isIdFitToContent(elementId)) {
+ var fitWidth = getContainerSize($ax.visibility.GetPanelState(elementId) + '_content').width;
+ percentPanelToLeftCache[elementId] = fitWidth + Number(jObj.css('right').replace("px", ""));
+ wasUpdated = true;
+ }
+ return wasUpdated;
+ };
+
+ var _updatePanelPercentWidth = _dynamicPanelManager.updatePanelPercentWidth = function(elementId) {
+ var obj = $obj(elementId);
+ if(!_isPercentWidthPanel(obj)) return;
+
+ _updatePercentPanelToLeftCache(obj, elementId, false);
+
+ var width;
+ var x;
+
+ if(obj.fixedHorizontal) {
+ x = 0;
+ width = $(window).width();
+ } else {
+ var parentPanelInfo = getParentPanel(elementId);
+ if(parentPanelInfo) {
+ var parentId = parentPanelInfo.parent;
+ width = $ax('#' + parentId).width();
+ var parentObj = $obj(parentId);
+ if(parentObj.percentWidth) {
+ var stateId = $ax.repeater.applySuffixToElementId(parentId, '_state' + parentPanelInfo.state);
+ var stateContentId = stateId + '_content';
+ x = -Number($jobj(stateContentId).css('margin-left').replace("px", ""));
+ } else x = 0;
+ } else {
+ var parentRepeater = $ax.getParentRepeaterFromScriptId($ax.repeater.getScriptIdFromElementId(elementId));
+ if(parentRepeater) {
+ var itemId = $ax.repeater.getItemIdFromElementId(elementId);
+ var itemContainerId = $ax.repeater.createElementId(parentRepeater, itemId);
+ x = 0;
+ width = $ax('#' + itemContainerId).width();
+ } else {
+ var $window = $(window);
+ width = $window.width();
+ var bodyLeft = Number($('body').css('left').replace("px", ""));
+ var bodyWidth = Number($('body').css('width').replace("px", ""));
+ var isCenter = $ax.adaptive.getPageStyle().pageAlignment == 'center';
+ width = Math.max(width, bodyWidth);
+ x = isCenter ? -(width - bodyWidth) / 2 - bodyLeft : 0;
+ }
+ }
+ }
+
+ var jObj = $jobj(elementId);
+ if(obj.fixedHorizontal == 'left') jObj.css('left', x + 'px');
+ else if(obj.fixedHorizontal == 'center') {
+ jObj.css('left', x + 'px');
+ jObj.css('margin-left', 0 + 'px');
+ } else jObj.css('left', x + 'px');
+
+ jObj.css('width', width + 'px');
+
+ var panelLeft = percentPanelToLeftCache[elementId];
+ var stateParent = jObj;
+ while(stateParent.children()[0].id.indexOf($ax.visibility.CONTAINER_SUFFIX) != -1) stateParent = stateParent.children();
+ var stateChildrenQuery = stateParent.children('.panel_state');
+ stateChildrenQuery.css('width', width + 'px');
+
+ if(obj.fixedHorizontal == 'center')
+ stateChildrenQuery.children('.panel_state_content').css('left', '50%').css('margin-left', panelLeft + 'px');
+ else if(obj.fixedHorizontal == 'right')
+ stateChildrenQuery.children('.panel_state_content').css('left', width - panelLeft + 'px');
+ else stateChildrenQuery.children('.panel_state_content').css('margin-left', panelLeft - x + 'px');
+ };
+
+
+ _dynamicPanelManager.updateParentsOfNonDefaultFitPanels = function () {
+ $ax('*').each(function (diagramObject, elementId) {
+ if(!$ax.public.fn.IsDynamicPanel(diagramObject.type) || !diagramObject.fitToContent) return;
+ if($ax.visibility.isElementIdLimboOrInLimboContainer(elementId)) return;
+
+ var stateId = $ax.visibility.GetPanelState(elementId);
+ if(stateId != $ax.repeater.applySuffixToElementId(elementId, '_state0')) _fitParentPanel(elementId);
+ });
+ };
+
+ //_dynamicPanelManager.updateAllFitPanelsAndLayerSizeCaches = function() {
+ // var fitToContent = [];
+ // var layers = [];
+ // $ax('*').each(function (obj, elementId) {
+ // var isFitPanel = $ax.public.fn.IsDynamicPanel(obj.type) && obj.fitToContent;
+ // var isLayer = $ax.public.fn.IsLayer(obj.type);
+ // if(!isFitPanel && !isLayer) return;
+ // if($ax.visibility.isElementIdLimboOrInLimboContainer(elementId)) return;
+
+ // if(isFitPanel) {
+ // fitToContent[fitToContent.length] = elementId;
+ // } else if(isLayer) {
+ // layers[layers.length] = elementId;
+ // }
+ // });
+ // for(var i = fitToContent.length - 1; i >= 0; i--) {
+ // var panelId = fitToContent[i];
+ // var stateCount = $obj(panelId).diagrams.length;
+ // for(var j = 0; j < stateCount; j++) {
+ // $ax.dynamicPanelManager.setFitToContentCss(panelId, true);
+ // _updateFitPanel(panelId, j, true);
+ // }
+ // }
+ // for(var i = layers.length - 1; i >= 0; i--) {
+ // var layerId = layers[i];
+ // _updateLayerSizeCache(layerId);
+ // }
+ //};
+
+ var _getCachedLayerRect = function (elementId) {
+ var element = document.getElementById(elementId);
+ var rect = {};
+ rect.width = Number(element.getAttribute('data-width'));
+ rect.height = Number(element.getAttribute('data-height'));
+ rect.x = Number(element.getAttribute('data-left'));
+ rect.y = Number(element.getAttribute('data-top'));
+ return rect;
+ }
+
+ var _updateLayerRectCache = function (elementId) {
+ var oldRect = _getCachedLayerRect(elementId);
+
+ var axObj = $ax('#' + elementId);
+ var size = axObj.size();
+ var loc = {};
+ loc.x = axObj.locRelativeIgnoreLayer(false);
+ loc.y = axObj.locRelativeIgnoreLayer(true);
+
+ var sizeChange = oldRect.width != size.width || oldRect.height != size.height;
+ var locChange = oldRect.x != loc.x || oldRect.y != loc.y;
+ if(sizeChange || locChange) {
+ var element = document.getElementById(elementId);
+ if(sizeChange) {
+ element.setAttribute('data-width', size.width);
+ element.setAttribute('data-height', size.height);
+ $ax.event.raiseSyntheticEvent(elementId, 'onResize');
+ }
+ if(locChange) {
+ element.setAttribute('data-left', loc.x);
+ element.setAttribute('data-top', loc.y);
+ $ax.event.raiseSyntheticEvent(elementId, 'onMove');
+ }
+ return true;
+ }
+ return false;
+ }
+
+ _dynamicPanelManager.setFitToContentCss = function(elementId, fitToContent, oldWidth, oldHeight) {
+
+ if($ax.dynamicPanelManager.isIdFitToContent(elementId) == fitToContent) return;
+
+ var panel = $jobj(elementId);
+ var stateCss;
+ var scrollbars = $obj(elementId).scrollbars;
+
+ if(fitToContent) {
+ panel.attr('style', '');
+ panel.removeAttr('data-notfit');
+ stateCss = {};
+ stateCss.position = 'relative';
+ if(scrollbars != 'none') {
+ stateCss.overflow = 'visible';
+ stateCss['-webkit-overflow-scrolling'] = 'visible';
+ }
+ if(scrollbars == 'verticalAsNeeded') {
+ stateCss['overflow-x'] = 'visible';
+ stateCss['-ms-overflow-x'] = 'visible';
+ } else if(scrollbars == 'horizontalAsNeeded') {
+ stateCss['overflow-y'] = 'visible';
+ stateCss['-ms-overflow-y'] = 'visible';
+ }
+ panel.children().css(stateCss);
+ } else {
+ panel.attr('data-notfit', 'true');
+ var panelCss = { width: oldWidth, height: oldHeight };
+ stateCss = { width: oldWidth, height: oldHeight };
+ panelCss.overflow = 'hidden';
+ stateCss.position = 'absolute';
+ if(scrollbars != 'none') {
+ stateCss.overflow = 'auto';
+ stateCss['-webkit-overflow-scrolling'] = 'touch';
+ }
+ if(scrollbars == 'verticalAsNeeded') {
+ stateCss['overflow-x'] = 'hidden';
+ stateCss['-ms-overflow-x'] = 'hidden';
+ } else if(scrollbars == 'horizontalAsNeeded') {
+ stateCss['overflow-y'] = 'hidden';
+ stateCss['-ms-overflow-y'] = 'hidden';
+ }
+ panel.css(panelCss);
+ panel.children().css(stateCss);
+ }
+ };
+
+ var _getShownStateId = function (id) {
+ var obj = $obj(id);
+ if (!obj || !$ax.public.fn.IsDynamicPanel(obj.type)) return id;
+
+ var children = $ax.visibility.applyWidgetContainer(id, true, false, true).children();
+ for (var i = 0; i < children.length; i++) {
+ var child = children[i];
+ while ($ax.visibility.isContainer(child.id)) child = $(child).children()[0];
+ if (child && child.style && child.style.display != 'none') return child.id;
+ }
+ return id;
+ };
+
+ var _getShownStateObj = function(id) { return $ax('#' + _getShownStateId(id));}
+
+ _dynamicPanelManager.getShownState = function (id) { return $jobj(_getShownStateId(id)); };
+
+ var _getClamp = function(id) {
+ var obj = $obj(id);
+ if(!obj) return $ax('#' + id);
+ if ($ax.public.fn.IsDynamicPanel(obj.type)) return _getShownStateObj(id);
+ return $ax('#' + id);
+ };
+
+ var _updateFitPanel = function(panelId, stateIndex, initializingView) {
+ if(!panelId) return false;
+
+ // Only fit if fitToContent is true
+ if(!$ax.dynamicPanelManager.isIdFitToContent(panelId)) return false;
+
+ // Traverse through children to find what size it should be.
+ var stateId = $ax.repeater.applySuffixToElementId(panelId, '_state' + stateIndex);
+
+ var stateContentId = stateId + '_content';
+ var stateQuery = $jobj(stateId);
+ var size = getContainerSize(stateContentId);
+
+ // Skip if size hasn't changed
+ var oldWidth = stateQuery.width();
+ var oldHeight = stateQuery.height();
+ if(oldWidth == size.width && oldHeight == size.height) return false;
+
+ if(!$obj(panelId).percentWidth) stateQuery.width(size.width);
+ stateQuery.height(size.height);
+
+ //updatePercentWidth on all child panels
+ $jobj(stateContentId).children('.ax_dynamic_panel').each(
+ function() { _updatePanelPercentWidth(this.id); }
+ );
+
+ //do the following only if it is the current state
+ if(stateId != $ax.visibility.GetPanelState(panelId)) return false;
+
+ if(!initializingView) _adjustFixed(panelId, oldWidth, oldHeight, size.width, size.height);
+ else if(stateIndex != 0) {
+ var state0 = $jobj($ax.repeater.applySuffixToElementId(panelId, '_state0'));
+ _adjustFixed(panelId, state0.width(), state0.height(), size.width, size.height);
+ }
+
+ $ax.event.raiseSyntheticEvent(panelId, 'onResize');
+ $ax.flyoutManager.updateFlyout(panelId);
+
+ return true;
+ };
+
+ // widgetId is the one that crawls up masters until it finds a parent panel, targetId is the original widgetId (not the crawling master)
+ // finds the immediate parent panel and crawls up through masters but not repeaters
+ var getParentPanel = function(widgetId, path, targetId) {
+ path = path || $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(widgetId));
+
+ var obj = $obj(widgetId);
+ if(obj.parentDynamicPanel) {
+ path[path.length - 1] = obj.parentDynamicPanel;
+ var parentId = $ax.getScriptIdFromPath(path);
+ if(!parentId) return undefined;
+ parentId = $ax.repeater.getElementId(parentId, widgetId);
+ var parentObj = $obj(parentId);
+ var retVal = { parent: parentId };
+ for(var i = 0; i < parentObj.diagrams.length; i++) {
+ var stateId = $ax.repeater.applySuffixToElementId(parentId, '_state' + i);
+ var stateQuery = $jobj(stateId);
+ if(stateQuery.find('#' + (targetId || widgetId)).length != 0) {
+ retVal.state = i;
+ break;
+ }
+ }
+ return retVal;
+ }
+
+ if(path.length == 1) return undefined;
+
+ path.pop();
+ var parentMaster = $ax.getScriptIdFromPath(path);
+ if(!parentMaster) return undefined;
+ parentMaster = $ax.repeater.getElementId(parentMaster, widgetId);
+
+ //check if the master is in the same repeater as the widgetId widget
+ var parentMasterItemId = $ax.repeater.getItemIdFromElementId(parentMaster);
+ var widgetItemId = $ax.repeater.getItemIdFromElementId(widgetId);
+ if(parentMasterItemId != widgetItemId) return undefined;
+
+ return getParentPanel(parentMaster, path, targetId || widgetId);
+ };
+
+ // finds the immediate parent layer and crawls up through masters but not repeaters or panels
+ var getParentLayer = function (widgetId, path) {
+ path = path || $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(widgetId));
+
+ //gets immediate parent layer only
+ var layerId = $ax.getLayerParentFromElementId(widgetId);
+ if(layerId) return layerId;
+
+ if(path.length == 1) return undefined;
+
+ path.pop();
+ var parentMaster = $ax.getScriptIdFromPath(path);
+ if(!parentMaster) return undefined;
+ parentMaster = $ax.repeater.getElementId(parentMaster, widgetId);
+
+ //check if the master is in the same panel as the widgetId widget
+ var widgetParentPanel = getParentPanel(widgetId);
+ if(widgetParentPanel) {
+ var parentMasterParentPanel = getParentPanel(parentMaster);
+ if(!parentMasterParentPanel || widgetParentPanel.parent != parentMasterParentPanel.parent) return undefined;
+ }
+
+ //check if the master is in the same repeater as the widgetId widget
+ var parentMasterItemId = $ax.repeater.getItemIdFromElementId(parentMaster);
+ var widgetItemId = $ax.repeater.getItemIdFromElementId(widgetId);
+ if(parentMasterItemId != widgetItemId) return undefined;
+
+ return getParentLayer(parentMaster, path);
+ };
+
+ // TODO: May be a better location for this. Used currently for rdo and panel state containers
+ var getContainerSize = function(containerId) {
+ var containerQuery = containerId ? $jobj(containerId) : $('#base');
+ var children = containerQuery.children();
+ // Default size
+ var size = { width: 0, height: 0 };
+ for(var i = 0; i < children.length; i++) {
+ var child = $(children[i]);
+ var childId = child.attr('id');
+ //var axChild = $ax('#' + childId).width();
+
+ var childObj = $obj(childId);
+ if(!childObj) {
+ // On the body there are some children that should be ignored, as they are not objects.
+ if(!child.hasClass('basiclink') || child.get(0).tagName.toLowerCase() != 'a') continue;
+
+ // Otherwise it should be a basic link
+ var linkChildren = child.children();
+ if(!linkChildren.length) continue;
+ child = $(linkChildren[0]);
+ childId = child.attr('id');
+ childObj = $obj(childId);
+ }
+
+ // Ignore fixed
+ if(!childId || $ax.visibility.limboIds[childId] || !$ax.visibility.IsIdVisible(childId)
+ || $ax.public.fn.IsDynamicPanel(childObj.type) && childObj.fixedHorizontal) continue;
+
+ var boundingRect = $ax.public.fn.getWidgetBoundingRect(childId);
+ var position = { left: boundingRect.left, top: boundingRect.top };
+ var width = boundingRect.width;
+ var height = boundingRect.height;
+
+ if($ax.public.fn.IsMaster(childObj.type)) {
+ var masterSize = getContainerSize(childId);
+ width = masterSize.width;
+ height = masterSize.height;
+ // } else if($ax.public.fn.IsRepeater(childObj.type)) {
+ // var repeaterSize = $ax.repeater.getRepeaterSize(childId);
+ // width = repeaterSize.width;
+ // height = repeaterSize.height;
+
+ // if(width == 0 && height == 0) continue;
+
+ // position.left += childObj.x;
+ // position.top += childObj.y;
+ } else if ($ax.public.fn.IsDynamicPanel(childObj.type)) {
+ if($ax.dynamicPanelManager.isIdFitToContent(childId)) {
+ var stateQuery = $jobj($ax.visibility.GetPanelState(childId));
+ width = stateQuery.width();
+ height = stateQuery.height();
+ }
+ }
+
+ size.width = Math.max(size.width, position.left + width);
+ size.height = Math.max(size.height, position.top + height);
+ }
+
+ return size;
+ };
+
+ var _adjustFixed = _dynamicPanelManager.adjustFixed = function(panelId, oldWidth, oldHeight, width, height) {
+ var loc = _getFixedPosition(panelId, oldWidth, oldHeight, width, height);
+ if(loc) {
+ $ax.action.addAnimation(panelId, $ax.action.queueTypes.move, function() {
+ $ax.move.MoveWidget(panelId, loc[0], loc[1], { easing: 'none', duration: 0 }, false, null, true);
+ });
+ }
+ };
+
+ var _getFixedPosition = _dynamicPanelManager.getFixedPosition = function(panelId, oldWidth, oldHeight, width, height) {
+ var panelObj = $obj(panelId);
+ var x = 0;
+ var y = 0;
+ if(panelObj.fixedHorizontal == 'center') {
+ x = (oldWidth - width) / 2;
+ }
+ if(panelObj.fixedVertical == 'middle') {
+ y = (oldHeight - height) / 2;
+ }
+ return x == 0 && y == 0 ? undefined : [x, y];
+ };
+
+ _dynamicPanelManager.getFixedInfo = function(panelId) {
+ var panelObj = $obj(panelId);
+ if (!panelObj || !$ax.public.fn.IsDynamicPanel(panelObj.type)) return {};
+ var jobj = $jobj(panelId);
+ if(jobj.css('position') == 'absolute') return {};
+
+ var info = {};
+ var horizontal = panelObj.fixedHorizontal;
+ if(!horizontal) return info;
+
+ info.fixed = true;
+ info.horizontal = horizontal;
+ info.vertical = panelObj.fixedVertical;
+
+ if(info.horizontal == 'left') info.x = Number(jobj.css('left').replace('px', ''));
+ else if(info.horizontal == 'center') info.x = Number(jobj.css('margin-left').replace('px', ''));
+ else if(info.horizontal == 'right') info.x = Number(jobj.css('right').replace('px', ''));
+
+ if(info.vertical == 'top') info.y = Number(jobj.css('top').replace('px', ''));
+ else if(info.vertical == 'middle') info.y = Number(jobj.css('margin-top').replace('px', ''));
+ else if(info.vertical == 'bottom') info.y = Number(jobj.css('bottom').replace('px', ''));
+
+ return info;
+ };
+
+ // Show isn't necessary if this is always done before toggling (which is currently true), but I don't want that
+ // change (if it happened) to break this.
+ var _compressToggle = function (id, vert, show, easing, duration) {
+ var layer = $ax.getTypeFromElementId(id) == $ax.constants.LAYER_TYPE;
+ var locProp = vert ? 'top' : 'left';
+ var dimProp = vert ? 'height' : 'width';
+
+ var threshold;
+ var delta;
+
+ threshold = $ax('#' + id)[locProp](true);
+ delta = layer ? $ax('#' + id)[dimProp]() : _getShownStateObj(id)[dimProp]();
+
+ if(!show) {
+ // Need to make threshold bottom/right
+ threshold += delta;
+ // Delta is in the opposite direction
+ delta *= -1;
+ }
+
+ _compress(id, vert, threshold, delta, easing, duration);
+ };
+ _dynamicPanelManager.compressToggle = _compressToggle;
+
+ // Used when setting state of dynamic panel
+ var _compressDelta = function(id, oldState, newState, vert, easing, duration) {
+ var oldQuery = $jobj(oldState);
+ var newQuery = $jobj(newState);
+
+ var thresholdProp = vert ? 'top' : 'left';
+ var thresholdOffset = vert ? 'height' : 'width';
+ var threshold = $ax('#' + id)[thresholdProp](true);
+ threshold += oldQuery[thresholdOffset]();
+
+ var delta = newQuery[thresholdOffset]() - oldQuery[thresholdOffset]();
+
+ var clampOffset = vert ? 'width' : 'height';
+ var clampWidth = Math.max(oldQuery[clampOffset](), newQuery[clampOffset]());
+
+ _compress(id, vert, threshold, delta, easing, duration, clampWidth);
+ };
+ _dynamicPanelManager.compressDelta = _compressDelta;
+
+ var _compress = function (id, vert, threshold, delta, easing, duration, clampWidth) {
+ // If below, a horizantal clamp, otherwise a vertical clamp
+ var clamp = {
+ prop: vert ? 'left' : 'top',
+ offset: vert ? 'width' : 'height'
+ };
+
+ // Get clamp in coords relative to parent. Account for layers farther down
+ if($ax.getTypeFromElementId(id) == $ax.constants.LAYER_TYPE) {
+ clamp.start = $ax('#' + id)[clamp.prop](true);
+ clamp.end = clamp.start + $ax('#' + id)[clamp.offset]();
+ } else {
+ var clampLoc = $jobj(id);
+ if(typeof clampWidth == 'undefined') clampWidth = _getClamp(id)[clamp.offset]();
+
+ clamp.start = Number(clampLoc.css(clamp.prop).replace('px', ''));
+
+ clamp.end = clamp.start + clampWidth;
+ }
+
+ // If clamps, threshold, or delta is not a number, can't compress.
+ if (isNaN(clamp.start) || isNaN(clamp.end) || isNaN(threshold) || isNaN(delta)) return;
+
+ // Update clamp if fixed, to account for body position (only necessary when page centered)
+ if($jobj(id).css('position') == 'fixed') {
+ var clampDelta = $('#base').position().left;
+ clamp.start -= clampDelta;
+ clamp.end -= clampDelta;
+ }
+
+ if(!easing) {
+ easing = 'none';
+ duration = 0;
+ }
+ var parent = $ax('#' + id).getParents(false, ['item', 'state', 'layer'])[0];
+ var obj = parent && $ax.getObjectFromElementId($ax.repeater.removeSuffixFromElementId(parent));
+ // Go until you hit a parent item or state, or a layer that is hidden to use as parent.
+ // Account for layer container positions as you go.
+ while(obj && $ax.public.fn.IsLayer(obj.type) && $ax.visibility.IsIdVisible(parent)) {
+ var container = $ax.visibility.applyWidgetContainer(parent, true, true);
+ // If layer is using container, offset is going to be necessary
+ if(container.length) {
+ var offsetX = $ax.getNumFromPx(container.css('left'));
+ var offsetY = $ax.getNumFromPx(container.css('top'));
+ var clampProp = clamp.prop == 'left' ? offsetX : offsetY;
+ var threshProp = clamp.prop == 'left' ? offsetY : offsetX;
+ threshold += threshProp;
+ clamp.start += clampProp;
+ clamp.end += clampProp;
+ }
+
+ parent = $ax('#' + parent).getParents(false, ['item', 'state', 'layer'])[0];
+ obj = parent && $ax.getObjectFromElementId($ax.repeater.removeSuffixFromElementId(parent));
+ }
+
+ // Add container mid push causes strange behavior because we take container into account as we go down, but if after we accounted for it,
+ // a container is added, that container is not accounted for with threshold and clamp values.
+ var layer = obj && $ax.public.fn.IsLayer(obj.type) && parent;
+ if(layer) {
+ // If your parent layer is invisible, you want to be relative to it's container. That is true already if it has a container,
+ // but if you are just adding one now, then you need to offset your values
+ var needsOffset = !$jobj(layer + '_container').length && !$ax.visibility.IsIdVisible(layer);
+ $ax.visibility.pushContainer(layer, false);
+ if(needsOffset) {
+ container = $jobj(layer + '_container');
+ offsetX = $ax.getNumFromPx(container.css('left'));
+ offsetY = $ax.getNumFromPx(container.css('top'));
+ clampProp = clamp.prop == 'left' ? offsetX : offsetY;
+ threshProp = clamp.prop == 'left' ? offsetY : offsetX;
+ threshold -= threshProp;
+ clamp.start -= clampProp;
+ clamp.end -= clampProp;
+ }
+ }
+
+ // Note: If parent is body, some of these aren't widgets
+ if(parent && $jobj(parent + '_content').length > 0) parent = parent + '_content';
+ if(parent && $jobj(parent + '_container').length > 0) parent = parent + '_container';
+ _compressChildrenHelper(id, $(parent ? '#' + parent : '#base').children(), vert, threshold, delta, clamp, easing, duration);
+
+ if(layer) $ax.visibility.popContainer(layer, false);
+
+ // Do item push
+ var itemId = $ax.repeater.getItemIdFromElementId(id);
+ if(!itemId) return;
+
+ var repeaterId = $ax.getParentRepeaterFromElementId(id);
+ // Only need to push when parent is an item directly.
+ if(parent != $ax.repeater.createElementId(repeaterId, itemId)) return;
+
+ // If repeater is fit to content, then don't worry about it, it'll be handled elsewhere
+ if(!obj.repeaterPropMap.fitToContent) $ax.repeater.pushItems(repeaterId, itemId, delta, vert);
+ };
+
+ var _compressChildrenHelper = function (id, children, vert, threshold, delta, clamp, easing, duration, parentLayer) {
+ var toMove = [];
+ var allMove = true;
+ for (var i = 0; i < children.length; i++) {
+ var child = $(children[i]);
+
+ // Check for basic links
+ if(child[0] && child[0].tagName == 'A' && child.hasClass('basiclink')) child = child.children();
+ var childId = child.attr('id');
+
+ // Don't move self, and check id to make sure it is a widget and lastly check if it is a fixed panel.
+ if(childId == id || !childId || childId[0] != 'u' || childId.indexOf('ann') != -1 || childId.indexOf('ref') != -1 || $obj(childId).fixedVertical) {
+ allMove = false;
+ continue;
+ }
+
+ if ($ax.getTypeFromElementId(childId) == $ax.constants.LAYER_TYPE) {
+ $ax.visibility.pushContainer(childId, false);
+ var addSelf;
+ var container = $ax.visibility.applyWidgetContainer(childId, true, true);
+ var layerChildren = $ax.visibility.getRealChildren(child.children());
+ //if(container.length) {
+ var offsetX = -$ax.getNumFromPx(container.css('left'));
+ var offsetY = -$ax.getNumFromPx(container.css('top'));
+ var clampProp = clamp.prop == 'left' ? offsetX : offsetY;
+ var threshProp = clamp.prop == 'left' ? offsetY : offsetX;
+ var layerClamp = { prop: clamp.prop, offset: clamp.offset, start: clamp.start + clampProp, end: clamp.end + clampProp };
+ addSelf = _compressChildrenHelper(id, layerChildren, vert, threshold + threshProp, delta, layerClamp, easing, duration, childId);
+ //} else addSelf = _compressChildrenHelper(id, layerChildren, vert, threshold, delta, clamp, easing, duration, childId);
+
+ if(addSelf) toMove.push(childId);
+ else allMove = false;
+ $ax.visibility.popContainer(childId, false);
+ continue;
+ }
+
+ var numbers = childId.substring(1).split('-');
+ if(numbers.length < 1 || isNaN(Number(numbers[0])) || (numbers.length == 2 && isNaN(Number(numbers[1]))) || numbers.length > 2) continue;
+
+ var marker, childClamp;
+
+ var axChild = $ax('#' + childId);
+ var markerProp = vert ? 'top' : 'left';
+ marker = Number(axChild[markerProp](true));
+ childClamp = [Number(axChild[clamp.prop](true))];
+ // Dynamic panels are not reporting correct size sometimes, so pull it from the state. Get shown state just returns the widget if it is not a dynamic panel.
+ var sizeChild = _getShownStateObj(childId);
+ childClamp[1] = childClamp[0] + sizeChild[clamp.offset]();
+
+ if(isNaN(marker) || isNaN(childClamp[0]) || isNaN(childClamp[1]) ||
+ marker < threshold || childClamp[1] <= clamp.start || childClamp[0] >= clamp.end) {
+ allMove = false;
+ continue;
+ }
+
+ toMove.push(childId);
+ }
+
+ if (allMove && parentLayer) {
+ return true;
+ } else {
+ for(var i = 0; i < toMove.length; i++) {
+ $ax('#' + toMove[i]).moveBy(vert ? 0 : delta, vert ? delta : 0, easing == 'none' ? {} : { duration: duration, easing: easing });
+ }
+ }
+ return false;
+ };
+
+ var _parentHandlesStyles = function(id) {
+ var parents = $ax('#' + id).getParents(true, ['dynamicPanel', 'layer'])[0];
+ if(!parents) return false;
+ var directParent = true;
+ for(var i = 0; i < parents.length; i++) {
+ var parentId = parents[i];
+ var parentObj = $obj(parentId);
+ if(!parentObj.propagate) {
+ directParent = false;
+ continue;
+ }
+ return { id: parentId, direct: directParent };
+ }
+ return false;
+ };
+ _dynamicPanelManager.parentHandlesStyles = _parentHandlesStyles;
+
+ var _propagateMouseOver = function(id, value) {
+ propagate(id, true, value);
+ };
+ _dynamicPanelManager.propagateMouseOver = _propagateMouseOver;
+
+ var _propagateMouseDown = function(id, value) {
+ propagate(id, false, value);
+ };
+ _dynamicPanelManager.propagateMouseDown = _propagateMouseDown;
+
+ var propagate = function(id, hover, value) {
+ var hoverChildren = function(children) {
+ if(!children) return;
+ for(var i = 0; i < children.length; i++) {
+ var elementId = children[i].id;
+ var obj = $obj(elementId);
+ if(obj == null) {
+ elementId = elementId.split('_')[0];
+ obj = $obj(elementId);
+ }
+ if(obj == null) continue;
+ if (($ax.public.fn.IsDynamicPanel(obj.type) || $ax.public.fn.IsLayer(obj.type)) && !obj.propagate) continue;
+
+ if(hover) $ax.style.SetWidgetHover(elementId, value);
+ else $ax.style.SetWidgetMouseDown(elementId, value);
+ $ax.annotation.updateLinkLocations(elementId);
+
+ hoverChildren(children[i].children);
+ }
+ };
+ hoverChildren($ax('#' + id).getChildren(true)[0].children);
+ };
+});
+
+//***** sto.js *****//
+
+$axure.internal(function($ax) {
+ var funcs = {};
+
+ var weekday = new Array(7);
+ weekday[0] = "Sunday";
+ weekday[1] = "Monday";
+ weekday[2] = "Tuesday";
+ weekday[3] = "Wednesday";
+ weekday[4] = "Thursday";
+ weekday[5] = "Friday";
+ weekday[6] = "Saturday";
+
+ funcs.getDayOfWeek = function() {
+ return _getDayOfWeek(this.getDay());
+ };
+
+ var _getDayOfWeek = $ax.getDayOfWeek = function(day) {
+ return weekday[day];
+ };
+
+ var month = new Array(12);
+ month[0] = "January";
+ month[1] = "February";
+ month[2] = "March";
+ month[3] = "April";
+ month[4] = "May";
+ month[5] = "June";
+ month[6] = "July";
+ month[7] = "August";
+ month[8] = "September";
+ month[9] = "October";
+ month[10] = "November";
+ month[11] = "December";
+
+ funcs.getMonthName = function() {
+ return _getMonthName(this.getMonth());
+ };
+
+ var _getMonthName = $ax.getMonthName = function(monthNum) {
+ return month[monthNum];
+ };
+
+ funcs.getMonth = function() {
+ return this.getMonth() + 1;
+ };
+
+ funcs.addYears = function(years) {
+ var retVal = new Date(this.valueOf());
+ retVal.setFullYear(this.getFullYear() + Number(years));
+ return retVal;
+ };
+
+ funcs.addMonths = function(months) {
+ var retVal = new Date(this.valueOf());
+ retVal.setMonth(this.getMonth() + Number(months));
+ return retVal;
+ };
+
+ funcs.addDays = function(days) {
+ var retVal = new Date(this.valueOf());
+ retVal.setDate(this.getDate() + Number(days));
+ return retVal;
+ };
+
+ funcs.addHours = function(hours) {
+ var retVal = new Date(this.valueOf());
+ retVal.setHours(this.getHours() + Number(hours));
+ return retVal;
+ };
+
+ funcs.addMinutes = function(minutes) {
+ var retVal = new Date(this.valueOf());
+ retVal.setMinutes(this.getMinutes() + Number(minutes));
+ return retVal;
+ };
+
+ funcs.addSeconds = function(seconds) {
+ var retVal = new Date(this.valueOf());
+ retVal.setSeconds(this.getSeconds() + Number(seconds));
+ return retVal;
+ };
+
+ funcs.addMilliseconds = function(milliseconds) {
+ var retVal = new Date(this.valueOf());
+ retVal.setMilliseconds(this.getMilliseconds() + Number(milliseconds));
+ return retVal;
+ };
+
+ var _stoHandlers = {};
+
+ _stoHandlers.literal = function(sto, scope, eventInfo) {
+ return sto.value;
+ };
+
+ //need angle bracket syntax because var is a reserved word
+ _stoHandlers['var'] = function(sto, scope, eventInfo) {
+ // Can't us 'A || B' here, because the first value can be false, true, or empty string and still be valid.
+ var retVal = scope.hasOwnProperty(sto.name) ? scope[sto.name] : $ax.globalVariableProvider.getVariableValue(sto.name, eventInfo);
+ // Handle desired type here?
+
+ if(retVal && retVal.exprType) {
+ retVal = $ax.expr.evaluateExpr(retVal, eventInfo);
+ }
+
+ if((sto.desiredType == 'int' || sto.desiredType == 'float')) {
+ var num = new Number(retVal);
+ retVal = isNaN(num.valueOf()) ? retVal : num;
+ }
+
+
+ return retVal;
+ };
+
+ //TODO: Perhaps repeaterId can be detirmined at generation, and stored in the sto info.
+ _stoHandlers.item = function(sto, scope, eventInfo, prop) {
+ prop = prop || (eventInfo.data ? 'data' : eventInfo.link ? 'url' : eventInfo.image ? 'img' : 'text');
+ var id = sto.isTarget || !$ax.repeater.hasData(eventInfo.srcElement, sto.name) ? eventInfo.targetElement : eventInfo.srcElement;
+ return getData(eventInfo, id, sto.name, prop);
+ };
+
+ var getData = function(eventInfo, id, name, prop) {
+ var repeaterId = $ax.getParentRepeaterFromScriptId($ax.repeater.getScriptIdFromElementId(id));
+ var itemId = $ax.repeater.getItemIdFromElementId(id);
+ return $ax.repeater.getData(eventInfo, repeaterId, itemId, name, prop);
+ };
+
+ _stoHandlers.paren = function(sto, scope, eventInfo) {
+ return _evaluateSTO(sto.innerSTO, scope, eventInfo);
+ };
+
+ _stoHandlers.fCall = function(sto, scope, eventInfo) {
+ //TODO: [mas] handle required type
+ var thisObj = _evaluateSTO(sto.thisSTO, scope, eventInfo);
+ if(sto.thisSTO.desiredType == 'string' && sto.thisSTO.computedType != 'string') thisObj = thisObj.toString();
+
+ var args = [];
+ for(var i = 0; i < sto.arguments.length; i++) {
+ args[i] = _evaluateSTO(sto.arguments[i], scope, eventInfo);
+ }
+ var fn = (funcs.hasOwnProperty(sto.func) && funcs[sto.func]) || thisObj[sto.func];
+ return fn.apply(thisObj, args);
+ };
+
+ _stoHandlers.propCall = function(sto, scope, eventInfo) {
+ //TODO: [mas] handle required type
+ if((sto.prop == 'url' || sto.prop == 'img') && sto.thisSTO.sto == 'item') return _stoHandlers.item(sto.thisSTO, scope, eventInfo, sto.prop);
+ var thisObj = _evaluateSTO(sto.thisSTO, scope, eventInfo);
+ var prop = thisObj[sto.prop] instanceof Function ? thisObj[sto.prop]() : thisObj[sto.prop];
+ return prop;
+ };
+
+ var _binOps = {};
+ _binOps['+'] = function(left, right) {
+ if(left instanceof Date) return addDayToDate(left, right);
+ if(right instanceof Date) return addDayToDate(right, left);
+
+ var num = Number(left) + Number(right);
+ return isNaN(num) ? (String(left) + String(right)) : num;
+ };
+ _binOps['-'] = function(left, right) {
+ if(left instanceof Date) return addDayToDate(left, -right);
+ return left - right;
+ };
+ _binOps['*'] = function(left, right) { return Number(left) * Number(right); };
+ _binOps['/'] = function(left, right) { return Number(left) / Number(right); };
+ _binOps['%'] = function(left, right) { return Number(left) % Number(right); };
+ _binOps['=='] = function(left, right) { return _getBool(left) == _getBool(right); };
+ _binOps['!='] = function(left, right) { return _getBool(left) != _getBool(right); };
+ _binOps['<'] = function(left, right) { return Number(left) < Number(right); };
+ _binOps['<='] = function(left, right) { return Number(left) <= Number(right); };
+ _binOps['>'] = function(left, right) { return Number(left) > Number(right); };
+ _binOps['>='] = function(left, right) { return Number(left) >= Number(right); };
+ _binOps['&&'] = function(left, right) { return _getBool(left) && _getBool(right); };
+ _binOps['||'] = function(left, right) { return _getBool(left) || _getBool(right); };
+
+ // TODO: Move this to generic place to be used.
+ var addDayToDate = function(date, days) {
+ var retVal = new Date(date.valueOf());
+ retVal.setDate(date.getDate() + days);
+ return retVal;
+ };
+
+ var _unOps = {};
+ _unOps['+'] = function(arg) { return +arg; };
+ _unOps['-'] = function(arg) { return -arg; };
+ _unOps['!'] = function(arg) { return !_getBool(arg); };
+
+ _stoHandlers.binOp = function(sto, scope, eventInfo) {
+ var left = _evaluateSTO(sto.leftSTO, scope, eventInfo);
+ var right = _evaluateSTO(sto.rightSTO, scope, eventInfo);
+ return _binOps[sto.op](left, right);
+ };
+
+ _stoHandlers.unOp = function(sto, scope, eventInfo) {
+ var input = _evaluateSTO(sto.inputSTO, scope, eventInfo);
+ return _unOps[sto.op](input);
+ };
+
+ var _getBool = function(val) {
+ var lowerVal = val.toLowerCase ? val.toLowerCase() : val;
+ return lowerVal == "false" ? false : lowerVal == "true" ? true : val;
+ };
+ $ax.getBool = _getBool;
+
+ var _evaluateSTO = function(sto, scope, eventInfo) {
+ if(sto.sto == 'error') return undefined;
+ return _tryEscapeRichText(castSto(_stoHandlers[sto.sto](sto, scope, eventInfo), sto), eventInfo);
+ };
+ $ax.evaluateSTO = _evaluateSTO;
+
+ var castSto = function(val, sto) {
+ var type = sto.computedType || sto.desiredType;
+ if(type == 'string') val = String(val);
+ else if(type == 'date' && !(val instanceof Date)) val = new Date(val);
+ else if(type == 'int' || type == 'float') val = Number(val);
+ else if(type == 'bool') val = Boolean(val);
+
+ return val;
+ };
+
+ var _tryEscapeRichText = function(text, eventInfo) {
+ return eventInfo.htmlLiteral ? _escapeRichText(text) : text;
+ };
+
+ var _escapeRichText = function(text) {
+ if(typeof (text) != 'string') return text;
+
+ return text.replace('<', '<');
+ };
+});
+//***** utils.temp.js *****//
+// ******* Deep Copy ******** //
+$axure.internal(function($ax) {
+ // TODO: [ben] Ah, infinite loops cause major issues here. Tried saving objects we've already hit, but that didn't seem to work (at least at my first shot).
+ // TODO: [ben] To continue from above, added a filter to filter out problem keys. Will need a better way of sorting this out eventually.
+ var _deepCopy = function (original, trackCopies, filter) {
+ if(trackCopies) {
+ var index = _getCopyIndex(original);
+ if(index != -1) return _originalToCopy[index][1];
+ }
+ var isArray = original instanceof Array;
+ var isObject = !(original instanceof Function) && !(original instanceof Date) && (original instanceof Object);
+ if(!isArray && !isObject) return original;
+ var copy = isArray ? [] : { };
+ if(trackCopies) _originalToCopy.push([original, copy]);
+ isArray ? deepCopyArray(original, trackCopies, copy, filter) : deepCopyObject(original, trackCopies, copy, filter);
+ return copy;
+ };
+ $ax.deepCopy = _deepCopy;
+
+ // Hacky way to copy event info. Copying dragInfo causes major issues due to infinite loops
+ // Hashmap doesn't map objects well. It just toStrings them, making them all the same key. This has to be slow...
+ var _originalToCopy = [];
+ var _getCopyIndex = function(original) {
+ for(var i = 0; i < _originalToCopy.length; i++) if(original === _originalToCopy[i][0]) return i;
+ return -1;
+ };
+
+ $ax.eventCopy = function(eventInfo) {
+ var copy = _deepCopy(eventInfo, true, ['dragInfo', 'elementQuery', 'obj']);
+ // reset the map. TODO: May need to reset elsewhere too, but this is the only way it's used currently
+ _originalToCopy = [];
+
+ return copy;
+ };
+
+ var deepCopyArray = function(original, trackCopies, copy, filter) {
+ for(var i = 0; i < original.length; i++) {
+ copy[i] = _deepCopy(original[i], trackCopies, filter);
+ }
+ };
+
+ var deepCopyObject = function(original, trackCopies, copy, filter) {
+ for(var key in original) {
+ if(!original.hasOwnProperty(key)) continue; // Continue if the prop was not put there like a dictionary, but just a native part of the object
+
+ if(filter && filter.indexOf[key] != -1) copy[key] = original[key]; // If that key is filtered out, skip recursion on it.
+ else copy[key] = _deepCopy(original[key], trackCopies, filter);
+ }
+ };
+
+ // Our implementation of splice because it is broken in IE8...
+ $ax.splice = function(array, startIndex, count) {
+ var retval = [];
+ if(startIndex >= array.length || startIndex < 0 || count == 0) return retval;
+ if(!count || startIndex + count > array.length) count = array.length - startIndex;
+ for(var i = 0; i < count; i++) retval[i] = array[startIndex + i];
+ for(i = startIndex + count; i < array.length; i++) array[i - count] = array[i];
+ for(i = 0; i < count; i++) array.pop();
+ return retval;
+ };
+});
+
+
+
+// ******* Flow Shape Links ******** //
+$axure.internal(function($ax) {
+
+ if(!$ax.document.configuration.linkFlowsToPages && !$ax.document.configuration.linkFlowsToPagesNewWindow) return;
+
+ $(window.document).ready(function() {
+ $ax(function (dObj) { return ($ax.public.fn.IsVector(dObj.type) || $ax.public.fn.IsSnapshot(dObj.type)) && dObj.referencePageUrl; }).each(function (dObj, elementId) {
+
+ var elementIdQuery = $('#' + elementId);
+
+ if($ax.document.configuration.linkFlowsToPages && !$ax.event.HasClick(dObj)) {
+ elementIdQuery.css("cursor", "pointer");
+ elementIdQuery.click(function() {
+ $ax.navigate({
+ url: dObj.referencePageUrl,
+ target: "current",
+ includeVariables: true
+ });
+ });
+ }
+
+ if($ax.document.configuration.linkFlowsToPagesNewWindow) {
+ $('#' + elementId + "_ref").append("");
+ $('#' + elementId + "PagePopup").click(function() {
+ $ax.navigate({
+ url: dObj.referencePageUrl,
+ target: "new",
+ includeVariables: true
+ });
+ });
+ }
+ });
+ });
+
+});
+
+//***** variables.js *****//
+// ******* GLOBAL VARIABLE PROVIDER ******** //
+$axure.internal(function($ax) {
+ var _globalVariableValues = {};
+
+ var _globalVariableProvider = {};
+ $ax.globalVariableProvider = _globalVariableProvider;
+
+ var setVariableValue = function(variable, value, suppressBroadcast) {
+ if(!(value instanceof Object)) value = value.toString();
+
+ variable = variable.toLowerCase();
+ _globalVariableValues[variable] = value;
+
+ if(suppressBroadcast !== true) {
+ var varData = {
+ globalVarName: variable,
+ globalVarValue: value.toString()
+ };
+
+ $axure.messageCenter.postMessage('setGlobalVar', varData);
+ }
+
+ //Post global var values only if pageData is loaded (suppresses exception which occurs when page loads)
+ if($ax.pageData) {
+ _postGlobalVarVals();
+ }
+ };
+ _globalVariableProvider.setVariableValue = setVariableValue;
+
+ var getVariableValue = function(variable, eventInfo, ignoreDefaultsForLinkUrl) {
+ variable = variable.toLowerCase();
+ if(_globalVariableValues[variable] !== undefined) {
+ //If this is for the GetLinkUrl function and
+ //the current value of the global variable is the same as the default defined in the document, don't return it
+ if(ignoreDefaultsForLinkUrl == true && $ax.document.globalVariables[variable] == _globalVariableValues[variable]) {
+ return null;
+ }
+
+ return _globalVariableValues[variable];
+ }
+ if($ax.document.globalVariables[variable] !== undefined) return ignoreDefaultsForLinkUrl == true ? null : $ax.document.globalVariables[variable];
+ switch(variable) {
+ case "pagename": return $ax.pageData.page.name;
+
+ case "now": return eventInfo.now;
+ case "gendate": return $ax.pageData.generationDate;
+
+ case "dragx": return $ax.drag.GetDragX();
+ case "dragy": return $ax.drag.GetDragY();
+ case "totaldragx": return $ax.drag.GetTotalDragX();
+ case "totaldragy": return $ax.drag.GetTotalDragY();
+ case "dragtime": return $ax.drag.GetDragTime();
+
+ case "math": return Math;
+ case "date": return Date;
+
+ case "window": return eventInfo && eventInfo.window;
+ case "this": return eventInfo && eventInfo.thiswidget && $ax.getWidgetInfo(eventInfo.thiswidget.elementId);
+ case "item": return (eventInfo && eventInfo.item && eventInfo.item.valid && eventInfo.item) || getVariableValue('targetitem', eventInfo, ignoreDefaultsForLinkUrl);
+ case "targetitem": return eventInfo && eventInfo.targetElement && $ax.getItemInfo(eventInfo.targetElement);
+ case "repeater": return eventInfo && eventInfo.repeater;
+ case "target": return eventInfo && eventInfo.targetElement && $ax.getWidgetInfo(eventInfo.targetElement);
+ case "cursor": return eventInfo && eventInfo.cursor;
+ default:
+ var gen = variable.substr(0, 3) == "gen";
+ var date = gen ? $ax.pageData.generationDate : new Date();
+ var prop = gen ? variable.substr(3) : variable;
+ switch(prop) {
+ case "day": return date.getDate();
+ case "month": return date.getMonth() + 1;
+ case "monthname": return $ax.getMonthName(date.getMonth());
+ case "dayofweek": return $ax.getDayOfWeek(date.getDay());
+ case "year": return date.getFullYear();
+ case "time": return date.toLocaleTimeString();
+ case "hours": return date.getHours();
+ case "minutes": return date.getMinutes();
+ case "seconds": return date.getSeconds();
+ default: return '';
+ }
+ }
+ };
+ _globalVariableProvider.getVariableValue = getVariableValue;
+
+ var load = function() {
+ var csum = false;
+
+ var query = (window.location.href.split("#")[1] || ''); //hash.substring(1); Firefox decodes this so & in variables breaks
+ if(query.length > 0) {
+ var vars = query.split("&");
+ for(var i = 0; i < vars.length; i++) {
+ var pair = vars[i].split("=");
+ var varName = pair[0];
+ var varValue = pair[1];
+ if(varName) {
+ if(varName == 'CSUM') {
+ csum = true;
+ } else setVariableValue(varName, decodeURIComponent(varValue), true);
+ }
+ }
+
+ if(!csum && query.length > 250) {
+ window.alert('Axure Warning: The variable values were too long to pass to this page.\n\nIf you are using IE, using Chrome or Firefox will support more data.');
+ }
+ }
+ };
+
+ var getLinkUrl = function(baseUrl) {
+ var toAdd = '';
+ var definedVariables = _getDefinedVariables();
+ for(var i = 0; i < definedVariables.length; i++) {
+ var key = definedVariables[i];
+ var val = getVariableValue(key, undefined, true);
+ if(val != null) {
+ if(toAdd.length > 0) toAdd += '&';
+ toAdd += key + '=' + encodeURIComponent(val);
+ }
+ }
+ return toAdd.length > 0 ? baseUrl + ($axure.shouldSendVarsToServer() ? '?' : '#') + toAdd + "&CSUM=1" : baseUrl;
+ };
+ _globalVariableProvider.getLinkUrl = getLinkUrl;
+
+ var _getDefinedVariables = function() {
+ return $ax.pageData.variables;
+ };
+ _globalVariableProvider.getDefinedVariables = _getDefinedVariables;
+
+ var _postGlobalVarVals = function() {
+ var retVal = {};
+ var definedVariables = _getDefinedVariables();
+ for(var i = 0; i < definedVariables.length; i++) {
+ var key = definedVariables[i];
+ var val = getVariableValue(key);
+ if(val != null) {
+ retVal[key] = val;
+ }
+ }
+
+ $ax.messageCenter.postMessage('globalVariableValues', retVal);
+ };
+
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ if(message == 'getGlobalVariables') {
+ _postGlobalVarVals();
+ } else if(message == 'resetGlobalVariables') {
+ _globalVariableValues = {};
+ _postGlobalVarVals();
+ }
+ });
+
+ load();
+});
+//***** drag.js *****//
+$axure.internal(function($ax) {
+ var widgetDragInfo = new Object();
+ var _drag = {};
+ $ax.drag = _drag;
+
+ $ax.drag.GetWidgetDragInfo = function() {
+ return $.extend({}, widgetDragInfo);
+ };
+
+ $ax.drag.StartDragWidget = function(event, id) {
+ $ax.setjBrowserEvent(jQuery.Event(event));
+ if(event.donotdrag) return;
+
+ var x, y;
+ var tg;
+ if(IE_10_AND_BELOW) {
+ x = window.event.clientX + window.document.documentElement.scrollLeft + window.document.body.scrollLeft;
+ y = window.event.clientY + window.document.documentElement.scrollTop + window.document.body.scrollTop;
+ tg = window.event.srcElement;
+ } else {
+ if(event.changedTouches) {
+ x = event.changedTouches[0].pageX;
+ y = event.changedTouches[0].pageY;
+ } else {
+ x = event.pageX;
+ y = event.pageY;
+ event.preventDefault();
+ }
+ tg = event.target;
+ }
+
+ widgetDragInfo.hasStarted = false;
+ widgetDragInfo.widgetId = id;
+ widgetDragInfo.cursorStartX = x;
+ widgetDragInfo.cursorStartY = y;
+ widgetDragInfo.lastX = x;
+ widgetDragInfo.lastY = y;
+ widgetDragInfo.currentX = x;
+ widgetDragInfo.currentY = y;
+
+ widgetDragInfo.movedWidgets = new Object();
+ widgetDragInfo.startTime = (new Date()).getTime();
+ widgetDragInfo.targetWidget = tg;
+
+ var movedownName = IE_10_AND_BELOW && $ax.features.supports.windowsMobile ?
+ $ax.features.eventNames.mouseDownName : $ax.features.eventNames.mouseMoveName;
+ $ax.event.addEvent(document, movedownName, _dragWidget, true);
+ $ax.event.addEvent(document, $ax.features.eventNames.mouseUpName, _stopDragWidget, true);
+
+// if(IE && BROWSER_VERSION < 9) {
+// if($ax.features.supports.windowsMobile) {
+// window.document.attachEvent($ax.features.eventNames.mouseDownName, _dragWidget);
+// window.document.attachEvent($ax.features.eventNames.mouseUpName, _stopDragWidget);
+// } else {
+// window.document.attachEvent('on' + $ax.features.eventNames.mouseMoveName, _dragWidget);
+// window.document.attachEvent('on' + $ax.features.eventNames.mouseUpName, _stopDragWidget);
+// }
+// } else {
+// window.document.addEventListener($ax.features.eventNames.mouseMoveName, _dragWidget, true);
+// window.document.addEventListener($ax.features.eventNames.mouseUpName, _stopDragWidget, true);
+// }
+ $ax.legacy.SuppressBubble(event);
+ };
+
+ var _dragWidget = function(event) {
+ $ax.setjBrowserEvent(jQuery.Event(event));
+
+ var x, y;
+ if(IE_10_AND_BELOW) {
+ x = window.event.clientX + window.document.documentElement.scrollLeft + window.document.body.scrollLeft;
+ y = window.event.clientY + window.document.documentElement.scrollTop + window.document.body.scrollTop;
+ } else {
+ if(event.changedTouches) {
+ x = event.changedTouches[0].pageX;
+ y = event.changedTouches[0].pageY;
+ //allow scroll (defaults) if only swipe events have cases and delta x is less than 5px and not blocking scrolling
+ var deltaX = x - widgetDragInfo.currentX;
+ var target = window.document.getElementById(widgetDragInfo.widgetId);
+ if($ax.event.hasSyntheticEvent(widgetDragInfo.widgetId, "onDrag") || $ax.event.hasSyntheticEvent(widgetDragInfo.widgetId, "onSwipeUp") ||
+ $ax.event.hasSyntheticEvent(widgetDragInfo.widgetId, "onSwipeDown") || (deltaX * deltaX) > 25
+ || ($ax.document.configuration.preventScroll && $ax.legacy.GetScrollable(target) == window.document.body)) {
+ event.preventDefault();
+ }
+ } else {
+ x = event.pageX;
+ y = event.pageY;
+ }
+ }
+ widgetDragInfo.xDelta = x - widgetDragInfo.currentX;
+ widgetDragInfo.yDelta = y - widgetDragInfo.currentY;
+ widgetDragInfo.lastX = widgetDragInfo.currentX;
+ widgetDragInfo.lastY = widgetDragInfo.currentY;
+ widgetDragInfo.currentX = x;
+ widgetDragInfo.currentY = y;
+
+ widgetDragInfo.currentTime = (new Date()).getTime();
+
+ $ax.legacy.SuppressBubble(event);
+
+ if(!widgetDragInfo.hasStarted) {
+ widgetDragInfo.hasStarted = true;
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onDragStart");
+
+ widgetDragInfo.oldBodyCursor = window.document.body.style.cursor;
+ window.document.body.style.cursor = 'move';
+ var widget = window.document.getElementById(widgetDragInfo.widgetId);
+ widgetDragInfo.oldCursor = widget.style.cursor;
+ widget.style.cursor = 'move';
+ }
+
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onDrag");
+ };
+
+ var _suppressClickAfterDrag = function(event) {
+ _removeSuppressEvents();
+
+ $ax.legacy.SuppressBubble(event);
+ };
+
+ var _removeSuppressEvents = function () {
+ if(IE_10_AND_BELOW) {
+ $ax.event.removeEvent(event.srcElement, 'click', _suppressClickAfterDrag, undefined, true);
+ $ax.event.removeEvent(widgetDragInfo.targetWidget, 'mousemove', _removeSuppressEvents, undefined, true);
+ } else {
+ $ax.event.removeEvent(document, "click", _suppressClickAfterDrag, true);
+ $ax.event.removeEvent(document, 'mousemove', _removeSuppressEvents, true);
+ }
+ };
+
+ var _stopDragWidget = function(event) {
+ $ax.setjBrowserEvent(jQuery.Event(event));
+
+ var tg;
+
+
+ var movedownName = IE_10_AND_BELOW && $ax.features.supports.windowsMobile ?
+ $ax.features.eventNames.mouseDownName : $ax.features.eventNames.mouseMoveName;
+ $ax.event.removeEvent(document, movedownName, _dragWidget, true);
+ $ax.event.removeEvent(document, $ax.features.eventNames.mouseUpName, _stopDragWidget, true);
+
+ tg = IE_10_AND_BELOW ? window.event.srcElement : event.target;
+//
+//
+// if(OLD_IE && BROWSER_VERSION < 9) {
+// if($ax.features.supports.windowsMobile) {
+// window.document.detachEvent($ax.features.eventNames.mouseDownName, _dragWidget);
+// window.document.detachEvent($ax.features.eventNames.mouseUpName, _stopDragWidget);
+//
+// } else {
+// window.document.detachEvent('on' + $ax.features.eventNames.mouseMoveName, _dragWidget);
+// window.document.detachEvent('on' + $ax.features.eventNames.mouseUpName, _stopDragWidget);
+// }
+// tg = window.event.srcElement;
+// } else {
+// window.document.removeEventListener($ax.features.eventNames.mouseMoveName, _dragWidget, true);
+// window.document.removeEventListener($ax.features.eventNames.mouseUpName, _stopDragWidget, true);
+// tg = event.target;
+// }
+
+ if(widgetDragInfo.hasStarted) {
+ widgetDragInfo.currentTime = (new Date()).getTime();
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onDragDrop");
+
+ if($ax.globalVariableProvider.getVariableValue('totaldragx') < -30 && $ax.globalVariableProvider.getVariableValue('dragtime') < 1000) {
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onSwipeLeft");
+ }
+
+ if($ax.globalVariableProvider.getVariableValue('totaldragx') > 30 && $ax.globalVariableProvider.getVariableValue('dragtime') < 1000) {
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onSwipeRight");
+ }
+
+ var totalDragY = $ax.globalVariableProvider.getVariableValue('totaldragy');
+ if(totalDragY < -30 && $ax.globalVariableProvider.getVariableValue('dragtime') < 1000) {
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onSwipeUp");
+ }
+
+ if(totalDragY > 30 && $ax.globalVariableProvider.getVariableValue('dragtime') < 1000) {
+ $ax.event.raiseSyntheticEvent(widgetDragInfo.widgetId, "onSwipeDown");
+ }
+
+ window.document.body.style.cursor = widgetDragInfo.oldBodyCursor;
+ var widget = window.document.getElementById(widgetDragInfo.widgetId);
+ // It may be null if OnDragDrop filtered out the widget
+ if(widget != null) widget.style.cursor = widgetDragInfo.oldCursor;
+
+ if(widgetDragInfo.targetWidget == tg && !event.changedTouches) {
+ // suppress the click after the drag on desktop browsers
+ if(IE_10_AND_BELOW && widgetDragInfo.targetWidget) {
+ $ax.event.addEvent(widgetDragInfo.targetWidget, 'click', _suppressClickAfterDrag, true, true);
+ $ax.event.addEvent(widgetDragInfo.targetWidget, "onmousemove", _removeSuppressEvents, true, true);
+ } else {
+ $ax.event.addEvent(document, "click", _suppressClickAfterDrag, true);
+ $ax.event.addEvent(document, "mousemove", _removeSuppressEvents, true);
+
+ }
+//
+//
+// if(IE && BROWSER_VERSION < 9 && widgetDragInfo.targetWidget) {
+// widgetDragInfo.targetWidget.attachEvent("onclick", _suppressClickAfterDrag);
+// widgetDragInfo.targetWidget.attachEvent("onmousemove", _removeSuppressEvents);
+// } else {
+// window.document.addEventListener("click", _suppressClickAfterDrag, true);
+// window.document.addEventListener("mousemove", _removeSuppressEvents, true);
+// }
+ }
+ }
+
+ widgetDragInfo.hasStarted = false;
+ widgetDragInfo.movedWidgets = new Object();
+
+ return false;
+ };
+
+ $ax.drag.GetDragX = function() {
+ if(widgetDragInfo.hasStarted) return widgetDragInfo.xDelta;
+ return 0;
+ };
+
+ $ax.drag.GetDragY = function() {
+ if(widgetDragInfo.hasStarted) return widgetDragInfo.yDelta;
+ return 0;
+ };
+
+ $ax.drag.GetTotalDragX = function() {
+ if(widgetDragInfo.hasStarted) return widgetDragInfo.currentX - widgetDragInfo.cursorStartX;
+ return 0;
+ };
+
+ $ax.drag.GetTotalDragY = function() {
+ if(widgetDragInfo.hasStarted) return widgetDragInfo.currentY - widgetDragInfo.cursorStartY;
+ return 0;
+ };
+
+ $ax.drag.GetDragTime = function() {
+ if(widgetDragInfo.hasStarted) return widgetDragInfo.currentTime - widgetDragInfo.startTime;
+ return 600000;
+ };
+
+ // $ax.drag.GetCursorRectangles = function() {
+ // var rects = new Object();
+ // rects.lastRect = new rect($ax.lastMouseLocation.x, $ax.lastMouseLocation.y, 1, 1);
+ // rects.currentRect = new rect($ax.mouseLocation.x, $ax.mouseLocation.y, 1, 1);
+ // return rects;
+ // };
+
+ // $ax.drag.GetWidgetRectangles = function(id) {
+ // var widget = window.document.getElementById(id);
+ // var rects = new Object();
+ // rects.lastRect = new rect($ax.legacy.getAbsoluteLeft(widget), $ax.legacy.getAbsoluteTop(widget), Number($('#' + id).css('width').replace("px", "")), Number($('#' + id).css('height').replace("px", "")));
+ // rects.currentRect = rects.lastRect;
+ // return rects;
+ // };
+
+ // $ax.drag.IsEntering = function(movingRects, targetRects) {
+ // return !movingRects.lastRect.IntersectsWith(targetRects.currentRect) && movingRects.currentRect.IntersectsWith(targetRects.currentRect);
+ // };
+
+ // $ax.drag.IsLeaving = function(movingRects, targetRects) {
+ // return movingRects.lastRect.IntersectsWith(targetRects.currentRect) && !movingRects.currentRect.IntersectsWith(targetRects.currentRect);
+ // };
+
+ // function IsOver(movingRects, targetRects) {
+ // return movingRects.currentRect.IntersectsWith(targetRects.currentRect);
+ // }
+
+ // function IsNotOver(movingRects, targetRects) {
+ // return !IsOver(movingRects, targetRects);
+ // }
+
+ $ax.drag.LogMovedWidgetForDrag = function (id, dragInfo) {
+ dragInfo = dragInfo || widgetDragInfo;
+ if(dragInfo.hasStarted) {
+ var containerIndex = id.indexOf('_container');
+ if(containerIndex != -1) id = id.substring(0, containerIndex);
+
+ // If state or other non-widget id, this should not be dragged, and should exit out to avoid exceptions.
+ if(!$obj(id)) return;
+
+ var query = $ax('#' + id);
+ var x = query.left();
+ var y = query.top();
+
+ var movedWidgets = dragInfo.movedWidgets;
+ if(!movedWidgets[id]) {
+ movedWidgets[id] = new Location(x, y);
+ }
+ }
+ };
+
+ var Location = function(x, y) {
+ this.x = x;
+ this.y = y;
+ };
+ $ax.drag.location = Location;
+
+ var Rectangle = $ax.drag.Rectangle = function(x, y, width, height) {
+ this.x = x;
+ this.y = y;
+ this.width = width;
+ this.height = height;
+ this.right = x + width;
+ this.bottom = y + height;
+ };
+
+ Rectangle.prototype.IntersectsWith = function(rect) {
+ if(this.Invalid()) return false;
+ if(rect.length) {
+ for(var i = 0; i < rect.length; i++) if(!rect[i].Invalid && this.IntersectsWith(rect[i])) return true;
+ return false;
+ }
+ if(rect.Invalid()) return false;
+ return this.x < rect.right && this.right > rect.x && this.y < rect.bottom && this.bottom > rect.y;
+ };
+
+ Rectangle.prototype.Invalid = function() {
+ return this.x == -1 && this.y == -1 && this.width == -1 && this.height == -1;
+ };
+
+ Rectangle.prototype.Move = function(x, y) {
+ return new Rectangle(x, y, this.width, this.height);
+ };
+});
+//***** move.js *****//
+$axure.internal(function($ax) {
+ var _move = {};
+ $ax.move = _move;
+
+ var widgetMoveInfo = {};
+ //register and return move info, also create container for rootlayer if needed
+ $ax.move.PrepareForMove = function (id, x, y, to, options, jobj, rootLayer, skipContainerForRootLayer) {
+ var fixedInfo = jobj ? {} : $ax.dynamicPanelManager.getFixedInfo(id);
+
+ var widget = $jobj(id);
+ var query = $ax('#' + id);
+ var isLayer = $ax.getTypeFromElementId(id) == $ax.constants.LAYER_TYPE;
+ if(!rootLayer) {
+ rootLayer = _move.getRootLayer(id);
+ if (rootLayer && !skipContainerForRootLayer) {
+ $ax.visibility.pushContainer(rootLayer, false);
+ if (isLayer) widget = $ax.visibility.applyWidgetContainer(id, true);
+ }
+ }
+ if (!jobj) jobj = widget;
+
+ var horzProp = 'left';
+ var vertProp = 'top';
+ var horzX = to ? x - query.locRelativeIgnoreLayer(false) : x;
+ var vertY = to ? y - query.locRelativeIgnoreLayer(true) : y;
+
+ if (fixedInfo.horizontal == 'right') {
+ horzProp = 'right';
+ horzX = to ? $(window).width() - x - Number(jobj.css('right').replace('px', '')) - query.width() : -x;
+ var leftChanges = -horzX;
+ } else if(fixedInfo.horizontal == 'center') {
+ horzProp = 'margin-left';
+ if (to) horzX = x - $(window).width() / 2;
+ }
+
+ if (fixedInfo.vertical == 'bottom') {
+ vertProp = 'bottom';
+ vertY = to ? $(window).height() - y - Number(jobj.css('bottom').replace('px', '')) - query.height() : -y;
+ var topChanges = -vertY;
+ } else if (fixedInfo.vertical == 'middle') {
+ vertProp = 'margin-top';
+ if (to) vertY = y - $(window).height() / 2;
+ }
+
+ //todo currently this always save the info, which is not needed for compound vector children and maybe some other cases
+ //let's optimize it later, only register if registerid is valid..
+ widgetMoveInfo[id] = {
+ x: leftChanges === undefined ? horzX : leftChanges,
+ y: topChanges === undefined ? vertY : topChanges,
+ options: options
+ };
+
+ return {
+ horzX: horzX,
+ vertY: vertY,
+ horzProp: horzProp,
+ vertProp: vertProp,
+ rootLayer: rootLayer,
+ jobj: jobj
+ };
+ };
+ $ax.move.GetWidgetMoveInfo = function() {
+ return $.extend({}, widgetMoveInfo);
+ };
+
+ _move.getRootLayer = function (id) {
+ var isLayer = $ax.getTypeFromElementId(id) == $ax.constants.LAYER_TYPE;
+ var rootLayer = isLayer ? id : '';
+
+ var parentIds = $ax('#' + id).getParents(true, '*')[0];
+ for(var i = 0; i < parentIds.length; i++) {
+ var parentId = parentIds[i];
+ // Keep climbing up layers until you hit a non-layer. At that point you have your root layer
+ if($ax.public.fn.IsLayer($ax.getTypeFromElementId(parentId))) rootLayer = parentId;
+ else break;
+ }
+
+ return rootLayer;
+ };
+
+ $ax.move.MoveWidget = function (id, x, y, options, to, animationCompleteCallback, shouldFire, jobj, skipOnMoveEvent) {
+ var moveInfo = $ax.move.PrepareForMove(id, x, y, to, options, jobj);
+ $ax.drag.LogMovedWidgetForDrag(id, options.dragInfo);
+
+ var object = $obj(id);
+ if(object && $ax.public.fn.IsLayer(object.type)) {
+ var childrenIds = $ax.public.fn.getLayerChildrenDeep(id, true);
+ //don't push container when register moveinfo for child
+ if(!skipOnMoveEvent) {
+ for(var i = 0; i < childrenIds.length; i++) $ax.move.PrepareForMove(childrenIds[i], x, y, to, options, null, moveInfo.rootLayer, true);
+ }
+ }
+
+ //if(!moveInfo) moveInfo = _getMoveInfo(id, x, y, to, options, jobj);
+
+ jobj = moveInfo.jobj;
+
+ _moveElement(id, options, animationCompleteCallback, shouldFire, jobj, moveInfo);
+
+ if(skipOnMoveEvent) return;
+ $ax.event.raiseSyntheticEvent(id, "onMove");
+ if(childrenIds) {
+ for(var i = 0; i < childrenIds.length; i++) $ax.event.raiseSyntheticEvent(childrenIds[i], 'onMove');
+ }
+ };
+
+ var _moveElement = function (id, options, animationCompleteCallback, shouldFire, jobj, moveInfo){
+ var cssStyles = {};
+
+ if(!$ax.dynamicPanelManager.isPercentWidthPanel($obj(id))) cssStyles[moveInfo.horzProp] = '+=' + moveInfo.horzX;
+ cssStyles[moveInfo.vertProp] = '+=' + moveInfo.vertY;
+
+ // I don't think root layer is necessary anymore after changes to layer container structure.
+ // Wait to try removing it until more stable.
+ var rootLayer = moveInfo.rootLayer;
+
+ var query = $addAll(jobj, id);
+ if(options.easing == 'none') {
+ query.animate(cssStyles, { duration: 0, queue: false });
+
+ if(rootLayer) $ax.visibility.popContainer(rootLayer, false);
+ if(animationCompleteCallback) animationCompleteCallback();
+ //if this widget is inside a layer, we should just remove the layer from the queue
+ if(shouldFire) $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.move);
+ } else {
+ var completeCount = query.length;
+ query.animate(cssStyles, {
+ duration: options.duration, easing: options.easing, queue: false, complete: function () {
+ completeCount--;
+ if(completeCount == 0 && rootLayer) $ax.visibility.popContainer(rootLayer, false);
+ if(animationCompleteCallback) animationCompleteCallback();
+ if(shouldFire) $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.move);
+ }});
+ }
+
+ // //moveinfo is used for moving 'with this'
+ // var moveInfo = new Object();
+ // moveInfo.x = horzX;
+ // moveInfo.y = vertY;
+ // moveInfo.options = options;
+ // widgetMoveInfo[id] = moveInfo;
+
+
+ };
+
+ _move.nopMove = function(id, options) {
+ var moveInfo = new Object();
+ moveInfo.x = 0;
+ moveInfo.y = 0;
+ moveInfo.options = {};
+ moveInfo.options.easing = 'none';
+ moveInfo.options.duration = 0;
+ widgetMoveInfo[id] = moveInfo;
+
+ // Layer move using container now.
+ var obj = $obj(id);
+ if($ax.public.fn.IsLayer(obj.type)) if(options.onComplete) options.onComplete();
+
+ $ax.event.raiseSyntheticEvent(id, "onMove");
+ };
+
+ //rotationDegree: total degree to rotate
+ //centerPoint: the center of the circular path
+
+
+ var _noRotateOnlyMove = function (id, moveDelta, rotatableMove, fireAnimationQueue, easing, duration, completionCallback) {
+ moveDelta.x += rotatableMove.x;
+ moveDelta.y += rotatableMove.y;
+ if (moveDelta.x == 0 && moveDelta.y == 0) {
+ if(fireAnimationQueue) {
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.rotate);
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.move);
+ }
+ } else {
+ $jobj(id).animate({ top: '+=' + moveDelta.y, left: '+=' + moveDelta.x }, {
+ duration: duration,
+ easing: easing,
+ queue: false,
+ complete: function () {
+ if(fireAnimationQueue) {
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.move);
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.rotate);
+ }
+ if (completionCallback) completionCallback();
+ }
+ });
+ }
+ }
+
+
+ _move.circularMove = function (id, degreeDelta, centerPoint, moveDelta, rotatableMove, resizeOffset, options, fireAnimationQueue, completionCallback, willDoRotation) {
+ var elem = $jobj(id);
+ if(!willDoRotation) elem = $addAll(elem, id);
+
+ var moveInfo = $ax.move.PrepareForMove(id, moveDelta.x, moveDelta.y, false, options);
+ // If not rotating, still need to check moveDelta and may need to handle that.
+ if (degreeDelta === 0) {
+ _noRotateOnlyMove(id, moveDelta, rotatableMove, fireAnimationQueue, options.easing, options.duration, completionCallback);
+ return;
+ }
+
+ var stepFunc = function(newDegree) {
+ var deg = newDegree - rotation.degree;
+ var widgetCenter = $ax.public.fn.getWidgetBoundingRect(id).centerPoint;
+ //console.log("widget center of " + id + " x " + widgetCenter.x + " y " + widgetCenter.y);
+ var widgetNewCenter = $axure.fn.getPointAfterRotate(deg, widgetCenter, centerPoint);
+
+ // Start by getting the move not related to rotation, and make sure to update center point to move with it.
+ var ratio = deg / degreeDelta;
+
+ var xdelta = (moveDelta.x + rotatableMove.x) * ratio;
+ var ydelta = (moveDelta.y + rotatableMove.y) * ratio;
+ if(resizeOffset) {
+ var resizeShift = {};
+ resizeShift.x = resizeOffset.x * ratio;
+ resizeShift.y = resizeOffset.y * ratio;
+ $axure.fn.getPointAfterRotate(rotation.degree, resizeShift, { x: 0, y: 0 });
+ xdelta += resizeShift.x;
+ ydelta += resizeShift.y;
+ }
+ centerPoint.x += xdelta;
+ centerPoint.y += ydelta;
+
+ // Now for the move that is rotatable, it must be rotated
+ rotatableMove = $axure.fn.getPointAfterRotate(deg, rotatableMove, { x: 0, y: 0 });
+
+ // Now add in circular move to the mix.
+ xdelta += widgetNewCenter.x - widgetCenter.x;
+ ydelta += widgetNewCenter.y - widgetCenter.y;
+
+ if(xdelta < 0) elem.css('left', '-=' + -xdelta);
+ else if(xdelta > 0) elem.css('left', '+=' + xdelta);
+
+ if(ydelta < 0) elem.css('top', '-=' + -ydelta);
+ else if(ydelta > 0) elem.css('top', '+=' + ydelta);
+ };
+
+ var onComplete = function() {
+ if(fireAnimationQueue) $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.move);
+ if(completionCallback) completionCallback();
+ if(moveInfo.rootLayer) $ax.visibility.popContainer(moveInfo.rootLayer, false);
+ var isPercentWidthPanel = $ax.dynamicPanelManager.isPercentWidthPanel($obj(id));
+ if(isPercentWidthPanel) {
+ $ax.dynamicPanelManager.updatePanelPercentWidth(id);
+ $ax.dynamicPanelManager.updatePanelContentPercentWidth(id);
+ }
+ if(elem.css('position') == 'fixed') {
+ if(!isPercentWidthPanel) elem.css('left', '');
+ elem.css('top', '');
+ }
+ };
+
+ var rotation = { degree: 0 };
+
+ if(!options.easing || options.easing === 'none' || options.duration <= 0) {
+ stepFunc(degreeDelta);
+ onComplete();
+ } else {
+ $(rotation).animate({ degree: degreeDelta }, {
+ duration: options.duration,
+ easing: options.easing,
+ queue: false,
+ step: stepFunc,
+ complete: onComplete
+ });
+ }
+ };
+
+ //rotate a widget by degree, center is 50% 50%
+ _move.rotate = function (id, degree, easing, duration, to, shouldFire, completionCallback) {
+ var currentDegree = _move.getRotationDegree(id);
+ if(to) degree = degree - currentDegree;
+
+ if(degree === 0) {
+ if (shouldFire) $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.rotate);
+ return;
+ }
+
+ var query = $jobj(id);
+ var stepFunc = function(now) {
+ var degreeDelta = now - rotation.degree;
+ var newDegree = currentDegree + degreeDelta;
+ query.css($ax.public.fn.setTransformHowever("rotate(" + newDegree + "deg)"));
+ currentDegree = newDegree;
+ };
+
+ var onComplete = function() {
+ if(shouldFire) {
+ $ax.action.fireAnimationFromQueue($ax.public.fn.compoundIdFromComponent(id), $ax.action.queueTypes.rotate);
+ }
+ if(completionCallback) completionCallback();
+
+ $ax.annotation.adjustIconLocation(id);
+ };
+
+ var rotation = { degree: 0 };
+
+
+ //if no animation, setting duration to 1, to prevent RangeError in rotation loops without animation
+ if(!easing || easing === 'none' || duration <= 0) {
+ stepFunc(degree);
+ onComplete();
+ } else {
+ $(rotation).animate({ degree: degree }, {
+ duration: duration,
+ easing: easing,
+ queue: false,
+ step: stepFunc,
+ complete: onComplete
+ });
+ }
+ };
+
+ _move.compoundRotateAround = function (id, degreeDelta, centerPoint, moveDelta, rotatableMove, resizeOffset, easing, duration, fireAnimationQueue, completionCallback) {
+ if (degreeDelta === 0) {
+ _noRotateOnlyMove($ax.public.fn.compoundIdFromComponent(id), moveDelta, rotatableMove, fireAnimationQueue, easing, duration, completionCallback, $ax.action.queueTypes.rotate);
+ return;
+ }
+ var elem = $jobj(id);
+ var rotation = { degree: 0 };
+
+ if (!easing || easing === 'none' || duration <= 0) {
+ duration = 1;
+ easing = 'linear'; //it doesn't matter anymore here...
+ }
+
+ var originalWidth = Number(elem.css('width').replace('px', ''));
+ var originalHeight = Number(elem.css('height').replace('px', ''));
+ var originalLeft = Number(elem.css('left').replace('px', ''));
+ var originalTop = Number(elem.css('top').replace('px', ''));
+
+ $(rotation).animate({ degree: degreeDelta }, {
+ duration: duration,
+ easing: easing,
+ queue: false,
+ step: function (newDegree) {
+ var transform = $ax.public.fn.transformFromElement(elem[0]);
+ var originalCenter = { x: originalLeft + 0.5 * originalWidth, y: originalTop + 0.5 * originalHeight};
+ var componentCenter = { x: originalCenter.x + transform[4], y: originalCenter.y + transform[5] };
+ var deg = newDegree - rotation.degree;
+ var ratio = deg / degreeDelta;
+ var xdelta = (moveDelta.x + rotatableMove.x) * ratio;
+ var ydelta = (moveDelta.y + rotatableMove.y) * ratio;
+ if (resizeOffset) {
+ var resizeShift = {};
+ resizeShift.x = resizeOffset.x * ratio;
+ resizeShift.y = resizeOffset.y * ratio;
+ $axure.fn.getPointAfterRotate(rotation.degree, resizeShift, { x: 0, y: 0 });
+ xdelta += resizeShift.x;
+ ydelta += resizeShift.y;
+ }
+
+ var rotationMatrix = $ax.public.fn.rotationMatrix(deg);
+ var compositionTransform = $ax.public.fn.matrixMultiplyMatrix(rotationMatrix,
+ { m11: transform[0], m21: transform[1], m12: transform[2], m22: transform[3] });
+
+ //console.log("widget center of " + id + " x " + widgetCenter.x + " y " + widgetCenter.y);
+ var widgetNewCenter = $axure.fn.getPointAfterRotate(deg, componentCenter, centerPoint);
+ var newMatrix = $ax.public.fn.matrixString(compositionTransform.m11, compositionTransform.m21, compositionTransform.m12, compositionTransform.m22,
+ widgetNewCenter.x - originalCenter.x + xdelta, widgetNewCenter.y - originalCenter.y + ydelta);
+ elem.css($ax.public.fn.setTransformHowever(newMatrix));
+ },
+ complete: function () {
+ if (fireAnimationQueue) {
+ $ax.action.fireAnimationFromQueue(elem.parent()[0].id, $ax.action.queueTypes.rotate);
+ }
+
+ if(completionCallback) completionCallback();
+ }
+ });
+ };
+
+ _move.getRotationDegreeFromElement = function(element) {
+ if(element == null) return NaN;
+
+ var transformString = element.style['transform'] ||
+ element.style['-o-transform'] ||
+ element.style['-ms-transform'] ||
+ element.style['-moz-transform'] ||
+ element.style['-webkit-transform'];
+
+ if(transformString) {
+ var rotateRegex = /rotate\(([-?0-9]+)deg\)/;
+ var degreeMatch = rotateRegex.exec(transformString);
+ if(degreeMatch && degreeMatch[1]) return parseFloat(degreeMatch[1]);
+ }
+
+ if(window.getComputedStyle) {
+ var st = window.getComputedStyle(element, null);
+ } else {
+ console.log('rotation is not supported for ie 8 and below in this version of axure rp');
+ return 0;
+ }
+
+ var tr = st.getPropertyValue("transform") ||
+ st.getPropertyValue("-o-transform") ||
+ st.getPropertyValue("-ms-transform") ||
+ st.getPropertyValue("-moz-transform") ||
+ st.getPropertyValue("-webkit-transform");
+
+ if(!tr || tr === 'none') return 0;
+ var values = tr.split('(')[1];
+ values = values.split(')')[0],
+ values = values.split(',');
+
+ var a = values[0];
+ var b = values[1];
+
+ var radians = Math.atan2(b, a);
+ if(radians < 0) {
+ radians += (2 * Math.PI);
+ }
+
+ return radians * (180 / Math.PI);
+ };
+
+ _move.getRotationDegree = function(elementId) {
+ if($ax.public.fn.IsLayer($obj(elementId).type)) {
+ return $jobj(elementId).data('layerDegree');
+ }
+ return _move.getRotationDegreeFromElement(document.getElementById(elementId));
+ }
+});
+//***** visibility.js *****//
+$axure.internal(function($ax) {
+ var document = window.document;
+ var _visibility = {};
+ $ax.visibility = _visibility;
+
+ var _defaultHidden = {};
+ var _defaultLimbo = {};
+
+ // ****************** Visibility and State Functions ****************** //
+
+ var _isIdVisible = $ax.visibility.IsIdVisible = function(id) {
+ return $ax.visibility.IsVisible(window.document.getElementById(id));
+ };
+
+ $ax.visibility.IsVisible = function(element) {
+ //cannot use css('visibility') because that gets the effective visiblity
+ //e.g. won't be able to set visibility on panels inside hidden panels
+ return element.style.visibility != 'hidden';
+ };
+
+ $ax.visibility.SetIdVisible = function(id, visible) {
+ $ax.visibility.SetVisible(window.document.getElementById(id), visible);
+ // Hide lightbox if necessary
+ if(!visible) {
+ $jobj($ax.repeater.applySuffixToElementId(id, '_lightbox')).remove();
+ $ax.flyoutManager.unregisterPanel(id, true);
+ }
+ };
+
+ var _setAllVisible = function(query, visible) {
+ for(var i = 0; i < query.length; i++) {
+ _visibility.SetVisible(query[i], visible);
+ }
+ }
+
+ $ax.visibility.SetVisible = function (element, visible) {
+ //not setting display to none to optimize measuring
+ if(visible) {
+ if($(element).hasClass(HIDDEN_CLASS)) $(element).removeClass(HIDDEN_CLASS);
+ if($(element).hasClass(UNPLACED_CLASS)) $(element).removeClass(UNPLACED_CLASS);
+ element.style.display = '';
+ element.style.visibility = 'inherit';
+ } else {
+ element.style.display = 'none';
+ element.style.visibility = 'hidden';
+ }
+ };
+
+ var _setWidgetVisibility = $ax.visibility.SetWidgetVisibility = function (elementId, options) {
+ var visible = $ax.visibility.IsIdVisible(elementId);
+ // If limboed, just fire the next action then leave.
+ if(visible == options.value || _limboIds[elementId]) {
+ if(!_limboIds[elementId]) options.onComplete && options.onComplete();
+ $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.fade);
+ return;
+ }
+
+ options.containInner = true;
+ var query = $jobj(elementId);
+ var parentId = query.parent().attr('id');
+ var axObj = $obj(elementId);
+ var preserveScroll = false;
+ var isPanel = $ax.public.fn.IsDynamicPanel(axObj.type);
+ var isLayer = $ax.public.fn.IsLayer(axObj.type);
+ if(!options.noContainer && (isPanel || isLayer)) {
+ //if dp has scrollbar, save its scroll position
+ if(isPanel && axObj.scrollbars != 'none') {
+ var shownState = $ax.dynamicPanelManager.getShownState(elementId);
+ preserveScroll = true;
+ //before hiding, try to save scroll location
+ if(!options.value && shownState) {
+ DPStateAndScroll[elementId] = {
+ shownId: shownState.attr('id'),
+ left: shownState.scrollLeft(),
+ top: shownState.scrollTop()
+ }
+ }
+ }
+
+ _pushContainer(elementId, isPanel);
+ if(isPanel && !options.value) _tryResumeScrollForDP(elementId);
+ var complete = options.onComplete;
+ options.onComplete = function () {
+ if(complete) complete();
+ _popContainer(elementId, isPanel);
+ //using containers stops mouseleave from firing on IE/Edge and FireFox
+ if(!options.value && $ax.event.mouseOverObjectId && (FIREFOX || $axure.browser.isEdge || IE)) {
+ var mouseOveredElement = $('#' + $ax.event.mouseOverObjectId);
+ if(mouseOveredElement && !mouseOveredElement.is(":visible")) {
+ var axObj = $obj($ax.event.mouseOverObjectId);
+
+ if(($ax.public.fn.IsDynamicPanel(axObj.type) || $ax.public.fn.IsLayer(axObj.type)) && axObj.propagate) {
+ mouseOveredElement.trigger('mouseleave');
+ } else mouseOveredElement.trigger('mouseleave.ixStyle');
+ }
+ }
+ //after showing dp, restore the scoll position
+ if(isPanel && options.value) _tryResumeScrollForDP(elementId, true);
+ }
+ options.containerExists = true;
+ }
+ _setVisibility(parentId, elementId, options, preserveScroll);
+
+ //set the visibility of the annotation box as well if it exists
+ var ann = document.getElementById(elementId + "_ann");
+ if(ann) _visibility.SetVisible(ann, options.value);
+
+ //set ref visibility for ref of flow shape, if that exists
+ var ref = document.getElementById(elementId + '_ref');
+ if(ref) _visibility.SetVisible(ref, options.value);
+ };
+
+ var _setVisibility = function(parentId, childId, options, preserveScroll) {
+ var wrapped = $jobj(childId);
+ var completeTotal = 1;
+ var visible = $ax.visibility.IsIdVisible(childId);
+
+ if(visible == options.value) {
+ options.onComplete && options.onComplete();
+ $ax.action.fireAnimationFromQueue(childId, $ax.action.queueTypes.fade);
+ return;
+ }
+
+ var child = $jobj(childId);
+ var size = options.size || (options.containerExists ? $(child.children()[0]) : child);
+
+ var isIdFitToContent = $ax.dynamicPanelManager.isIdFitToContent(parentId);
+ //fade and resize won't work together when there is a container... but we still needs the container for fit to content DPs
+ var needContainer = options.easing && options.easing != 'none' && (options.easing != 'fade' || isIdFitToContent);
+ var cullPosition = options.cull ? options.cull.css('position') : '';
+ var containerExists = options.containerExists;
+
+ var isFullWidth = $ax.dynamicPanelManager.isPercentWidthPanel($obj(childId));
+
+ // If fixed fit to content panel, then we must set size on it. It will be size of 0 otherwise, because container in it is absolute position.
+ var needSetSize = false;
+ var sizeObj = {};
+ if(needContainer) {
+ var sizeId = '';
+ if($ax.dynamicPanelManager.isIdFitToContent(childId)) sizeId = childId;
+ else {
+ var panelId = $ax.repeater.removeSuffixFromElementId(childId);
+ if($ax.dynamicPanelManager.isIdFitToContent(panelId)) sizeId = panelId;
+ }
+
+ if(sizeId) {
+ needSetSize = true;
+
+ sizeObj = $jobj(sizeId);
+ var newSize = options.cull || sizeObj;
+ var newAxSize = $ax('#' + newSize.attr('id'));
+ sizeObj.width(newAxSize.width());
+ sizeObj.height(newAxSize.height());
+ }
+ }
+
+ var wrappedOffset = { left: 0, top: 0 };
+ var visibleWrapped = wrapped;
+ if(needContainer) {
+ var childObj = $obj(childId);
+ if (options.cull) {
+ var axCull = $ax('#' + options.cull.attr('id'));
+ var containerWidth = axCull.width();
+ var containerHeight = axCull.height();
+ } else {
+ if(childObj && ($ax.public.fn.IsLayer(childObj.type))) {// || childObj.generateCompound)) {
+ var boundingRectangle = $ax.public.fn.getWidgetBoundingRect(childId);
+ wrappedOffset.left = boundingRectangle.left;
+ wrappedOffset.top = boundingRectangle.top;
+ containerWidth = boundingRectangle.width;
+ containerHeight = boundingRectangle.height;
+ } else if (childObj && childObj.generateCompound) {
+ var image = $jobj(childId + '_img');
+ containerWidth = $ax.getNumFromPx(image.css('width'));
+ containerHeight = $ax.getNumFromPx(image.css('height'));
+ wrappedOffset.left = $ax.getNumFromPx(image.css('left'));
+ wrappedOffset.top = $ax.getNumFromPx(image.css('top'));
+ } else {
+ containerWidth = $ax('#' + childId).width();
+ containerHeight = $ax('#' + childId).height();
+ }
+ }
+
+ var containerId = $ax.visibility.applyWidgetContainer(childId);
+// var container = _makeContainer(containerId, options.cull || boundingRectangle, isFullWidth, options.easing == 'flip', wrappedOffset, options.containerExists);
+ var container = _makeContainer(containerId, containerWidth, containerHeight, isFullWidth, options.easing == 'flip', wrappedOffset, options.containerExists);
+
+ if(options.containInner) {
+ wrapped = _wrappedChildren(containerExists ? $(child.children()[0]) : child);
+
+ // Filter for visibile wrapped children
+ visibleWrapped = [];
+ for (var i = 0; i < wrapped.length; i++) if($ax.visibility.IsVisible(wrapped[i])) visibleWrapped.push(wrapped[i]);
+ visibleWrapped = $(visibleWrapped);
+
+ completeTotal = visibleWrapped.length;
+ if(!containerExists) container.prependTo(child);
+
+ // Offset items if necessary
+ if(!containerExists && (wrappedOffset.left != 0 || wrappedOffset.top != 0)) {
+ for(var i = 0; i < wrapped.length; i++) {
+ var inner = $(wrapped[i]);
+ inner.css('left', $ax.getNumFromPx(inner.css('left')) - wrappedOffset.left);
+ inner.css('top', $ax.getNumFromPx(inner.css('top')) - wrappedOffset.top);
+ // Parent layer is now size 0, so have to have to use conatiner since it's the real size.
+ // Should we use container all the time? This may make things easier for fit panels too.
+ size = container;
+ }
+ }
+ } else if(!containerExists) container.insertBefore(child);
+ if(!containerExists) wrapped.appendTo(container);
+
+ if (options.value && options.containInner) {
+ //has to set children first because flip to show needs children invisible
+ _setAllVisible(visibleWrapped, false);
+ _updateChildAlignment(childId);
+ _setAllVisible(child, true);
+ }
+ }
+
+ var completeCount = 0;
+ var onComplete = function () {
+ completeCount++;
+ if (needContainer && completeCount == completeTotal) {
+ if ($ax.public.fn.isCompoundVectorHtml(container.parent()[0])) {
+ wrappedOffset.left = $ax.getNumFromPx(container.css('left'));
+ wrappedOffset.top = $ax.getNumFromPx(container.css('top'));
+ }
+
+ if (options.containInner && !containerExists && (wrappedOffset.left != 0 || wrappedOffset.top != 0)) {
+ for (i = 0; i < wrapped.length; i++) {
+ inner = $(wrapped[i]);
+ //if ($ax.public.fn.isCompoundVectorComponentHtml(inner[0])) break;
+ inner.css('left', $ax.getNumFromPx(inner.css('left')) + wrappedOffset.left);
+ inner.css('top', $ax.getNumFromPx(inner.css('top')) + wrappedOffset.top);
+ }
+ }
+
+ if(options.containInner && !options.value) {
+ _setAllVisible(child, false);
+ _setAllVisible(visibleWrapped, true);
+ }
+
+ if(containerExists) {
+ if(!options.settingChild) container.css('position', 'relative;');
+ } else {
+ wrapped.insertBefore(container);
+ container.remove();
+ }
+
+ if(childObj && $ax.public.fn.IsDynamicPanel(childObj.type) && window.modifiedDynamicPanleParentOverflowProp) {
+ child.css('overflow', 'hidden');
+ window.modifiedDynamicPanleParentOverflowProp = false;
+ }
+ }
+
+ if(options.value) _updateChildAlignment(childId);
+
+ if(!needContainer || completeTotal == completeCount) {
+ if(options.cull) options.cull.css('position', cullPosition);
+
+ if(needSetSize) {
+ sizeObj.css('width', 'auto');
+ sizeObj.css('height', 'auto');
+ }
+
+ options.onComplete && options.onComplete();
+
+ if(options.fire) {
+ $ax.event.raiseSyntheticEvent(childId, options.value ? 'onShow' : 'onHide');
+ $ax.action.fireAnimationFromQueue(childId, $ax.action.queueTypes.fade);
+ }
+ }
+ };
+
+ // Nothing actually being animated, all wrapped elements invisible
+ if(!visibleWrapped.length) {
+ if(!options.easing || options.easing == 'none') {
+ $ax.visibility.SetIdVisible(childId, options.value);
+ completeTotal = 1;
+ onComplete();
+ } else {
+ window.setTimeout(function() {
+ completeCount = completeTotal - 1;
+ onComplete();
+ },options.duration);
+ }
+
+ return;
+ }
+
+ if(!options.easing || options.easing == 'none') {
+ $ax.visibility.SetIdVisible(childId, options.value);
+ completeTotal = 1;
+ onComplete();
+ } else if(options.easing == 'fade') {
+ if(options.value) {
+ if(preserveScroll) {
+ visibleWrapped.css('opacity', 0);
+ visibleWrapped.css('visibility', 'inherit');
+ visibleWrapped.css('display', 'block');
+ //was hoping we could just use fadein here, but need to set display before set scroll position
+ _tryResumeScrollForDP(childId);
+ visibleWrapped.animate({ opacity: 1 }, {
+ duration: options.duration,
+ easing: 'swing',
+ queue: false,
+ complete: function() {
+ $ax.visibility.SetIdVisible(childId, true);
+ visibleWrapped.css('opacity', '');
+ onComplete();
+ }
+ });
+ } else {
+ // Can't use $ax.visibility.SetIdVisible, because we only want to set visible, we don't want to set display, fadeIn will handle that.
+ visibleWrapped.css('visibility', 'inherit');
+ visibleWrapped.fadeIn({
+ queue: false,
+ duration: options.duration,
+ complete: onComplete
+ });
+ }
+ } else {
+ // Fading here is being strange...
+ visibleWrapped.animate({ opacity: 0 }, { duration: options.duration, easing: 'swing', queue: false, complete: function() {
+ $ax.visibility.SetIdVisible(childId, false);
+ visibleWrapped.css('opacity', '');
+
+ onComplete();
+ }});
+ }
+ } else if (options.easing == 'flip') {
+ //this container will hold
+ var trapScroll = _trapScrollLoc(childId);
+ var innerContainer = $('
');
+ innerContainer.attr('id', containerId + "_inner");
+ innerContainer.data('flip', options.direction == 'left' || options.direction == 'right' ? 'y' : 'x');
+ innerContainer.css({
+ position: 'relative',
+ 'width': containerWidth,
+ 'height': containerHeight
+ });
+
+ innerContainer.appendTo(container);
+ wrapped.appendTo(innerContainer);
+
+ if(childObj && $ax.public.fn.IsDynamicPanel(childObj.type)) var containerDiv = child;
+ else containerDiv = parentId ? $jobj(parentId) : child.parent();
+
+ completeTotal = 1;
+ var flipdegree;
+
+ var originForUpOrDown = '100% ' + containerHeight / 2 + 'px';
+ if(options.value) {
+ //options.value == true means in or show, note to get here, the element must be currently hidden to show,
+ // we need to first flip it +/- 90deg without animation (180 if we want to show the back of the flip)
+ switch(options.direction) {
+ case 'right':
+ case 'left':
+ _setRotateTransformation(innerContainer, _getRotateString(true, options.direction === 'right', options.showFlipBack));
+ flipdegree = 'rotateY(0deg)';
+ break;
+ case 'up':
+ case 'down':
+ innerContainer.css({
+ '-webkit-transform-origin': originForUpOrDown,
+ '-ms-transform-origin': originForUpOrDown,
+ 'transform-origin': originForUpOrDown,
+ });
+ _setRotateTransformation(innerContainer, _getRotateString(false, options.direction === 'up', options.showFlipBack));
+ flipdegree = 'rotateX(0deg)';
+ break;
+ }
+
+ var onFlipShowComplete = function() {
+ var trapScroll = _trapScrollLoc(childId);
+ $ax.visibility.SetIdVisible(childId, true);
+
+ wrapped.insertBefore(innerContainer);
+ innerContainer.remove();
+ trapScroll();
+
+ onComplete();
+ };
+
+ innerContainer.css({
+ '-webkit-backface-visibility': 'hidden',
+ 'backface-visibility': 'hidden'
+ });
+
+ child.css({
+ 'display': '',
+ 'visibility': 'inherit'
+ });
+
+ visibleWrapped.css({
+ 'display': '',
+ 'visibility': 'inherit'
+ });
+
+ innerContainer.css({
+ '-webkit-transition-duration': options.duration + 'ms',
+ 'transition-duration': options.duration + 'ms'
+ });
+
+ if(preserveScroll) _tryResumeScrollForDP(childId);
+ _setRotateTransformation(innerContainer, flipdegree, containerDiv, onFlipShowComplete, options.duration, true);
+ } else { //hide or out
+ switch(options.direction) {
+ case 'right':
+ case 'left':
+ flipdegree = _getRotateString(true, options.direction !== 'right', options.showFlipBack);
+ break;
+ case 'up':
+ case 'down':
+ //_setRotateTransformation(wrapped, 'rotateX(0deg)');
+ innerContainer.css({
+ '-webkit-transform-origin': originForUpOrDown,
+ '-ms-transform-origin': originForUpOrDown,
+ 'transform-origin': originForUpOrDown,
+ });
+ flipdegree = _getRotateString(false, options.direction !== 'up', options.showFlipBack);
+ break;
+ }
+
+ var onFlipHideComplete = function() {
+ var trapScroll = _trapScrollLoc(childId);
+ wrapped.insertBefore(innerContainer);
+ $ax.visibility.SetIdVisible(childId, false);
+
+ innerContainer.remove();
+ trapScroll();
+
+ onComplete();
+ };
+
+ innerContainer.css({
+ '-webkit-backface-visibility': 'hidden',
+ 'backface-visibility': 'hidden',
+ '-webkit-transition-duration': options.duration + 'ms',
+ 'transition-duration': options.duration + 'ms'
+ });
+
+ if(preserveScroll) _tryResumeScrollForDP(childId);
+ _setRotateTransformation(innerContainer, flipdegree, containerDiv, onFlipHideComplete, options.duration, true);
+ }
+
+ trapScroll();
+ } else {
+ // Because the move is gonna fire on annotation and ref too, need to update complete total
+ completeTotal = $addAll(visibleWrapped, childId).length;
+ if(options.value) {
+ _slideStateIn(childId, childId, options, size, false, onComplete, visibleWrapped, preserveScroll);
+ } else {
+ var tops = [];
+ var lefts = [];
+ for(var i = 0; i < visibleWrapped.length; i++) {
+ var currWrapped = $(visibleWrapped[i]);
+
+ tops.push(fixAuto(currWrapped, 'top'));
+ lefts.push(fixAuto(currWrapped, 'left'));
+ }
+
+ var onOutComplete = function () {
+ //bring back SetIdVisible on childId for hiding lightbox
+ $ax.visibility.SetIdVisible(childId, false);
+ for(i = 0; i < visibleWrapped.length; i++) {
+ currWrapped = $(visibleWrapped[i]);
+ $ax.visibility.SetVisible(currWrapped[0], false);
+ currWrapped.css('top', tops[i]);
+ currWrapped.css('left', lefts[i]);
+ }
+ onComplete();
+ };
+ _slideStateOut(size, childId, options, onOutComplete, visibleWrapped);
+ }
+ }
+
+ // If showing, go through all rich text objects inside you, and try to redo alignment of them
+ if(options.value && !options.containInner) {
+ _updateChildAlignment(childId);
+ }
+ };
+
+ // IE/Safari are giving auto here instead of calculating to for us. May need to calculate this eventually, but for now we can assume auto === 0px for the edge case found
+ var fixAuto = function (jobj, prop) {
+ var val = jobj.css(prop);
+ return val == 'auto' ? '0px' : val;
+ };
+
+ var _getRotateString = function (y, neg, showFlipBack) {
+ // y means flip on y axis, or left/right, neg means flipping it left/down, and show back is for set panel state
+ // and will show the back of the widget (transparent) for the first half of a show, or second half of a hide.
+ return 'rotate' + (y ? 'Y' : 'X') + '(' + (neg ? '-' : '') + (showFlipBack ? 180 : IE ? 91 : 90) + 'deg)';
+ }
+
+ var _updateChildAlignment = function(childId) {
+ var descendants = $jobj(childId).find('.text');
+ for(var i = 0; i < descendants.length; i++) $ax.style.updateTextAlignmentForVisibility(descendants[i].id);
+ };
+
+ var _wrappedChildren = function (child) {
+ return child.children();
+ //var children = child.children();
+ //var valid = [];
+ //for(var i = 0; i < children.length; i++) if($ax.visibility.IsVisible(children[i])) valid.push(children[i]);
+ //return $(valid);
+ };
+
+ var requestAnimationFrame = window.requestAnimationFrame ||
+ window.webkitRequestAnimationFrame ||
+ window.mozRequestAnimationFrame || window.msRequestAnimationFrame ||
+ function (callback) {
+ window.setTimeout(callback, 1000 / 60);
+ };
+
+ var _setRotateTransformation = function(elementsToSet, transformValue, elementParent, flipCompleteCallback, flipDurationMs, useAnimationFrame) {
+ if(flipCompleteCallback) {
+ //here we didn't use 'transitionend' event to fire callback
+ //when show/hide on one element, changing transition property will stop the event from firing
+ window.setTimeout(flipCompleteCallback, flipDurationMs);
+ }
+
+ var trasformCss = {
+ '-webkit-transform': transformValue,
+ '-moz-transform': transformValue,
+ '-ms-transform': transformValue,
+ '-o-transform': transformValue,
+ 'transform': transformValue
+ };
+
+ if(useAnimationFrame) {
+ requestAnimationFrame(function() {
+ elementsToSet.css(trasformCss);
+ });
+ } else elementsToSet.css(trasformCss);
+
+ //when deal with dynamic panel, we need to set it's parent's overflow to visible to have the 3d effect
+ //NOTE: we need to set this back when both flips finishes in DP, to prevents one animation finished first and set this back
+ if(elementParent && elementParent.css('overflow') === 'hidden') {
+ elementParent.css('overflow', 'visible');
+ window.modifiedDynamicPanleParentOverflowProp = true;
+ }
+ };
+
+ $ax.visibility.GetPanelState = function(id) {
+ var children = $ax.visibility.getRealChildren($jobj(id).children());
+ for(var i = 0; i < children.length; i++) {
+ if(children[i].style && $ax.visibility.IsVisible(children[i])) return children[i].id;
+ }
+ return '';
+ };
+
+ var containerCount = {};
+ $ax.visibility.SetPanelState = function(id, stateId, easingOut, directionOut, durationOut, easingIn, directionIn, durationIn, showWhenSet) {
+ var show = !$ax.visibility.IsIdVisible(id) && showWhenSet;
+ if(show) $ax.visibility.SetIdVisible(id, true);
+
+ // Exit here if already at desired state.
+ if($ax.visibility.IsIdVisible(stateId)) {
+ if(show) {
+ $ax.event.raiseSyntheticEvent(id, 'onShow');
+ // If showing size changes and need to update parent panels
+ $ax.dynamicPanelManager.fitParentPanel(id);
+ }
+
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.setState);
+ return;
+ }
+
+ _pushContainer(id, true);
+
+ var state = $jobj(stateId);
+ var oldStateId = $ax.visibility.GetPanelState(id);
+ var oldState = $jobj(oldStateId);
+ //pin to browser
+ $ax.dynamicPanelManager.adjustFixed(id, oldState.width(), oldState.height(), state.width(), state.height());
+
+ _bringPanelStateToFront(id, stateId, oldStateId, easingIn == 'none' || durationIn == '0');
+
+ var fitToContent = $ax.dynamicPanelManager.isIdFitToContent(id);
+ var resized = false;
+ if(fitToContent) {
+ // Set resized
+ resized = state.width() != oldState.width() || state.height() != oldState.height();
+ }
+
+ //edge case for sliding
+ var movement = (directionOut == 'left' || directionOut == 'up' || state.children().length == 0) && oldState.children().length != 0 ? oldState : state;
+ var onCompleteCount = 0;
+ var onComplete = function () {
+ //move this call from _setVisibility() for animate out.
+ //Because this will make the order of dp divs consistence: the showing panel is always in front after both animation finished
+ //tested in the cases where one panel is out/show slower/faster/same time/instantly.
+ _bringPanelStateToFront(id, stateId, oldStateId, false);
+
+ if (window.modifiedDynamicPanleParentOverflowProp) {
+ var parent = id ? $jobj(id) : child.parent();
+ parent.css('overflow', 'hidden');
+ window.modifiedDynamicPanleParentOverflowProp = false;
+ }
+
+ $ax.dynamicPanelManager.fitParentPanel(id);
+ $ax.dynamicPanelManager.updatePanelPercentWidth(id);
+ $ax.dynamicPanelManager.updatePanelContentPercentWidth(id);
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.setState);
+ $ax.event.raiseSyntheticEvent(id, "onPanelStateChange");
+ $ax.event.leavingState(oldStateId);
+ _popContainer(id, true);
+ };
+ // Must do state out first, so if we cull by new state, location is correct
+ _setVisibility(id, oldStateId, {
+ value: false,
+ easing: easingOut,
+ direction: directionOut,
+ duration: durationOut,
+ containerExists: true,
+ onComplete: function() {
+// if(easingIn !== 'flip') _bringPanelStateToFront(id, stateId);
+ if (++onCompleteCount == 2) onComplete();
+ },
+ settingChild: true,
+ size: movement,
+ //cull for
+ cull: easingOut == 'none' || state.children().length == 0 ? oldState : state,
+ showFlipBack: true
+ });
+
+ _setVisibility(id, stateId, {
+ value: true,
+ easing: easingIn,
+ direction: directionIn,
+ duration: durationIn,
+ containerExists: true,
+ onComplete: function () {
+// if (easingIn === 'flip') _bringPanelStateToFront(id, stateId);
+ if (++onCompleteCount == 2) onComplete();
+ },
+ settingChild: true,
+ //size for offset
+ size: movement,
+ showFlipBack: true
+ });
+
+ if(show) $ax.event.raiseSyntheticEvent(id, 'onShow');
+ if(resized) $ax.event.raiseSyntheticEvent(id, 'onResize');
+ };
+
+ var containedFixed = {};
+ var _pushContainer = _visibility.pushContainer = function(id, panel) {
+ var count = containerCount[id];
+ if(count) containerCount[id] = count + 1;
+ else {
+ var trapScroll = _trapScrollLoc(id);
+ var jobj = $jobj(id);
+ var children = jobj.children();
+ var css = {
+ position: 'relative',
+ top: 0,
+ left: 0
+ };
+
+ if(!panel) {
+ var boundingRect = $axure.fn.getWidgetBoundingRect(id);
+ css.top = boundingRect.top;
+ css.left = boundingRect.left;
+ }
+
+ var container = $('
');
+ container.attr('id', ''); // Placeholder id, so we won't try to recurse the container until it is ready
+ container.css(css);
+ //container.append(jobj.children());
+ jobj.append(container);
+ containerCount[id] = 1;
+
+ // Panel needs to wrap children
+ if(panel) {
+ for(var i = 0; i < children.length; i++) {
+ var child = $(children[i]);
+ var childContainer = $('
');
+ childContainer.attr('id', $ax.visibility.applyWidgetContainer(child.attr('id')));
+ childContainer.css(css);
+ child.after(childContainer);
+ childContainer.append(child);
+ container.append(childContainer);
+ }
+ } else {
+ var focus = _getCurrFocus();
+ if(focus) $ax.event.addSuppressedEvent($ax.repeater.removeSuffixFromElementId(focus), 'OnLostFocus');
+
+ // Layer needs to fix top left
+ var childIds = $ax('#' + id).getChildren()[0].children;
+ for(var i = 0; i < childIds.length; i++) {
+ var childId = childIds[i];
+ var childObj = $jobj(childId);
+ var fixedInfo = $ax.dynamicPanelManager.getFixedInfo(childId);
+ if(fixedInfo.fixed) {
+ var axObj = $ax('#' + childId);
+ var left = axObj.left();
+ var top = axObj.top();
+ containedFixed[childId] = { left: left, top: top, fixed: fixedInfo };
+ childObj.css('left', left);
+ childObj.css('top', top);
+ childObj.css('margin-left', 0);
+ childObj.css('margin-top', 0);
+ childObj.css('right', 'auto');
+ childObj.css('bottom', 'auto');
+ childObj.css('position', 'absolute');
+ }
+ var cssChange = {
+ left: '-=' + css.left,
+ top: '-=' + css.top
+ };
+ if($ax.getTypeFromElementId(childId) == $ax.constants.LAYER_TYPE) {
+ _pushContainer(childId, false);
+ $ax.visibility.applyWidgetContainer(childId, true).css(cssChange);
+ } else {
+ //if ($ax.public.fn.isCompoundVectorHtml(jobj[0])) {
+ // var grandChildren = jobj[0].children;
+ // //while (grandChildren.length > 0 && grandChildren[0].id.indexOf('container') >= 0) grandChildren = grandChildren[0].children;
+
+ // for (var j = 0; j < grandChildren.length; j++) {
+ // var grandChildId = grandChildren[j].id;
+ // if (grandChildId.indexOf(childId + 'p') >= 0 || grandChildId.indexOf('_container') >= 0) $jobj(grandChildId).css(cssChange);
+ // }
+ //} else
+ // Need to include ann and ref in move.
+ childObj = $addAll(childObj, childId);
+ childObj.css(cssChange);
+ }
+
+ container.append(childObj);
+ }
+ _setCurrFocus(focus);
+ }
+ container.attr('id', $ax.visibility.applyWidgetContainer(id)); // Setting the correct final id for the container
+ trapScroll();
+ }
+ };
+
+ var _popContainer = _visibility.popContainer = function (id, panel) {
+ var count = containerCount[id];
+ if(!count) return;
+ count--;
+ containerCount[id] = count;
+ if(count != 0) return;
+
+ var trapScroll = _trapScrollLoc(id);
+
+ var jobj = $jobj(id);
+ var container = $ax.visibility.applyWidgetContainer(id, true);
+
+ // If layer is at bottom or right of page, unwrapping could change scroll by temporarily reducting page size.
+ // To avoid this, we let container persist on page, with the size it is at this point, and don't remove container completely
+ // until the children are back to their proper locations.
+ var size = $ax('#' + id).size();
+ container.css('width', size.width);
+ container.css('height', size.height);
+ var focus = _getCurrFocus();
+ if(focus) $ax.event.addSuppressedEvent($ax.repeater.removeSuffixFromElementId(focus), 'OnLostFocus');
+ jobj.append(container.children());
+ _setCurrFocus(focus);
+ $('body').append(container);
+
+ // Layer doesn't have children containers to clean up
+ if(panel) {
+ var children = jobj.children();
+ for(var i = 0; i < children.length; i++) {
+ var childContainer = $(children[i]);
+ var child = $(childContainer.children()[0]);
+ childContainer.after(child);
+ childContainer.remove();
+ }
+ } else {
+ var left = container.css('left');
+ var top = container.css('top');
+ var childIds = $ax('#' + id).getChildren()[0].children;
+ for (var i = 0; i < childIds.length; i++) {
+ var childId = childIds[i];
+ var cssChange = {
+ left: '+=' + left,
+ top: '+=' + top
+ };
+ if($ax.getTypeFromElementId(childId) == $ax.constants.LAYER_TYPE) {
+ $ax.visibility.applyWidgetContainer(childId, true).css(cssChange);
+ _popContainer(childId, false);
+ } else {
+ var childObj = $jobj(childId);
+ // if ($ax.public.fn.isCompoundVectorHtml(jobj[0])) {
+ // var grandChildren = jobj[0].children;
+ // //while (grandChildren.length > 0 && grandChildren[0].id.indexOf('container') >= 0) grandChildren = grandChildren[0].children;
+ // for (var j = 0; j < grandChildren.length; j++) {
+ // var grandChildId = grandChildren[j].id;
+ // if (grandChildId.indexOf(childId + 'p') >= 0 || grandChildId.indexOf('_container') >= 0) $jobj(grandChildId).css(cssChange);
+ // }
+ //} else
+ var allObjs = $addAll(childObj, childId); // Just include other objects for initial css. Fixed panels need to be dealt with separately.
+ allObjs.css(cssChange);
+
+ var fixedInfo = containedFixed[childId];
+ if(fixedInfo) {
+ delete containedFixed[childId];
+
+ childObj.css('position', 'fixed');
+ var deltaX = $ax.getNumFromPx(childObj.css('left')) - fixedInfo.left;
+ var deltaY = $ax.getNumFromPx(childObj.css('top')) - fixedInfo.top;
+
+ fixedInfo = fixedInfo.fixed;
+ if(fixedInfo.horizontal == 'left') childObj.css('left', fixedInfo.x + deltaX);
+ else if(fixedInfo.horizontal == 'center') {
+ childObj.css('left', '50%');
+ childObj.css('margin-left', fixedInfo.x + deltaX);
+ } else {
+ childObj.css('left', 'auto');
+ childObj.css('right', fixedInfo.x - deltaX);
+ }
+
+ if(fixedInfo.vertical == 'top') childObj.css('top', fixedInfo.y + deltaY);
+ else if(fixedInfo.vertical == 'middle') {
+ childObj.css('top', '50%');
+ childObj.css('margin-top', fixedInfo.y + deltaY);
+ } else {
+ childObj.css('top', 'auto');
+ childObj.css('bottom', fixedInfo.y - deltaY);
+ }
+
+ $ax.dynamicPanelManager.updatePanelPercentWidth(childId);
+ $ax.dynamicPanelManager.updatePanelContentPercentWidth(childId);
+
+ }
+ }
+ }
+ }
+ container.remove();
+ trapScroll();
+ };
+
+ var _trapScrollLoc = function(id) {
+ var locs = {};
+ var states = $jobj(id).find('.panel_state');
+ for(var i = 0; i < states.length; i++) {
+ var state = $(states[i]);
+ locs[state.attr('id')] = { x: state.scrollLeft(), y: state.scrollTop() };
+ }
+ return function() {
+ for(var key in locs) {
+ var state = $jobj(key);
+ state.scrollLeft(locs[key].x);
+ state.scrollTop(locs[key].y);
+ }
+ };
+ }
+
+ var _getCurrFocus = function () {
+ // Only care about focused a tags and inputs
+ var id = window.lastFocusedClickable && window.lastFocusedClickable.id;
+
+ if(!id) return id;
+ var jobj = $(window.lastFocusedClickable);
+ return jobj.is('a') || jobj.is('input') ? id : '';
+ }
+
+ var _setCurrFocus = function(id) {
+ if(id) {
+ // This is really just needed for IE, so if this causes issues on other browsers, try adding that check here
+ var trap = $ax.event.blockEvent($ax.repeater.removeSuffixFromElementId(id), 'OnFocus');
+ window.setTimeout(function () {
+ $jobj(id).focus();
+ trap();
+ }, 0);
+ }
+ }
+
+ //use this to save & restore DP's scroll position when show/hide
+ //key => dp's id (not state's id, because it seems we can change state while hiding)
+ //value => first state's id & scroll position
+ //we only need to store one scroll position for one DP, and remove the key after shown.
+ var DPStateAndScroll = {}
+ var _tryResumeScrollForDP = function (dpId, deleteId) {
+ var scrollObj = DPStateAndScroll[dpId];
+ if(scrollObj) {
+ var shownState = document.getElementById(scrollObj.shownId);
+ if(scrollObj.left) shownState.scrollLeft = scrollObj.left;
+ if(scrollObj.top) shownState.scrollTop = scrollObj.top;
+ if(deleteId) delete DPStateAndScroll[dpId];
+ }
+ };
+// var _makeContainer = function (containerId, rect, isFullWidth, isFlip, offset, containerExists) {
+ var _makeContainer = function (containerId, width, height, isFullWidth, isFlip, offset, containerExists) {
+ if(containerExists) var container = $jobj(containerId);
+ else {
+ container = $('
');
+ container.attr('id', containerId);
+ }
+ var css = {
+ position: 'absolute',
+ width: width,
+ height: height,
+ };
+
+ if(!containerExists) {
+ // If container exists, may be busy updating location. Will init and update it correctly.
+ css.top = offset.top;
+ css.left = offset.left;
+ }
+
+
+ if(isFlip) {
+ css.perspective = '800px';
+ css.webkitPerspective = "800px";
+ css.mozPerspective = "800px";
+ } else css.overflow = 'hidden';
+
+ //perspective on container will give us 3d effect when flip
+ //if(!isFlip) css.overflow = 'hidden';
+
+ // Rect should be a jquery not axquery obj
+ //_getFixedCss(css, rect.$ ? rect.$() : rect, fixedInfo, isFullWidth);
+
+ container.css(css);
+ return container;
+ };
+
+ var CONTAINER_SUFFIX = _visibility.CONTAINER_SUFFIX = '_container';
+ var CONTAINER_INNER = CONTAINER_SUFFIX + '_inner';
+ _visibility.getWidgetFromContainer = function(id) {
+ var containerIndex = id.indexOf(CONTAINER_SUFFIX);
+ if(containerIndex == -1) return id;
+ return id.substr(0, containerIndex) + id.substr(containerIndex + CONTAINER_SUFFIX.length);
+ };
+
+ // Apply container to widget id if necessary.
+ // returnJobj: True if you want the jquery object rather than id returned
+ // skipCheck: True if you want the query returned reguardless of container existing
+ // checkInner: True if inner container should be checked
+ _visibility.applyWidgetContainer = function (id, returnJobj, skipCheck, checkInner) {
+ // If container exists, just return (return query if requested)
+ if(id.indexOf(CONTAINER_SUFFIX) != -1) return returnJobj ? $jobj(id) : id;
+
+ // Get desired id, and return it if query is not desired
+ var containerId = $ax.repeater.applySuffixToElementId(id, checkInner ? CONTAINER_INNER : CONTAINER_SUFFIX);
+ if(!returnJobj) return containerId;
+
+ // If skipping check or container exists, just return innermost container requested
+ var container = $jobj(containerId);
+ if(skipCheck || container.length) return container;
+ // If inner container was not checked, then no more to check, return query for widget
+ if(!checkInner) return $jobj(id);
+
+ // If inner container was checked, check for regular container still
+ container = $jobj($ax.repeater.applySuffixToElementId(id, CONTAINER_SUFFIX));
+ return container.length ? container : $jobj(id);
+ };
+
+ _visibility.isContainer = function(id) {
+ return id.indexOf(CONTAINER_SUFFIX) != -1;
+ };
+
+ _visibility.getRealChildren = function(query) {
+ while(query.length && $(query[0]).attr('id').indexOf(CONTAINER_SUFFIX) != -1) query = query.children();
+ return query;
+ };
+
+ var _getFixedCss = function(css, rect, fixedInfo, isFullWidth) {
+ // todo: **mas** make sure this is ok
+ if(fixedInfo.fixed) {
+ css.position = 'fixed';
+
+ if(fixedInfo.horizontal == 'left') css.left = fixedInfo.x;
+ else if(fixedInfo.horizontal == 'center') {
+ css.left = isFullWidth ? '0px' : '50%';
+ css['margin-left'] = fixedInfo.x;
+ } else if(fixedInfo.horizontal == 'right') {
+ css.left = 'auto';
+ css.right = fixedInfo.x;
+ }
+
+ if(fixedInfo.vertical == 'top') css.top = fixedInfo.y;
+ else if(fixedInfo.vertical == 'middle') {
+ css.top = '50%';
+ css['margin-top'] = fixedInfo.y;
+ } else if(fixedInfo.vertical == 'bottom') {
+ css.top = 'auto';
+ css.bottom = fixedInfo.y;
+ }
+ } else {
+ css.left = Number(rect.css('left').replace('px', '')) || 0;
+ css.top = Number(rect.css('top').replace('px', '')) || 0;
+ }
+ };
+
+ var _slideStateOut = function (container, stateId, options, onComplete, jobj) {
+ var directionOut = options.direction;
+ var axObject = $ax('#' + container.attr('id'));
+ var width = axObject.width();
+ var height = axObject.height();
+
+ if(directionOut == "right") {
+ $ax.move.MoveWidget(stateId, width, 0, options, false, onComplete, false, jobj, true);
+ } else if(directionOut == "left") {
+ $ax.move.MoveWidget(stateId, -width, 0, options, false, onComplete, false, jobj, true);
+ } else if(directionOut == "up") {
+ $ax.move.MoveWidget(stateId, 0, -height, options, false, onComplete, false, jobj, true);
+ } else if(directionOut == "down") {
+ $ax.move.MoveWidget(stateId, 0, height, options, false, onComplete, false, jobj, true);
+ }
+ };
+
+ var _slideStateIn = function (id, stateId, options, container, makePanelVisible, onComplete, jobj, preserveScroll) {
+ var directionIn = options.direction;
+ var axObject = $ax('#' +container.attr('id'));
+ var width = axObject.width();
+ var height = axObject.height();
+
+ for(var i = 0; i < jobj.length; i++) {
+ var child = $(jobj[i]);
+ var oldTop = $ax.getNumFromPx(fixAuto(child, 'top'));
+ var oldLeft = $ax.getNumFromPx(fixAuto(child, 'left'));
+ if (directionIn == "right") {
+ child.css('left', oldLeft - width + 'px');
+ } else if(directionIn == "left") {
+ child.css('left', oldLeft + width + 'px');
+ } else if(directionIn == "up") {
+ child.css('top', oldTop + height + 'px');
+ } else if(directionIn == "down") {
+ child.css('top', oldTop - height + 'px');
+ }
+ }
+
+ if (makePanelVisible) $ax.visibility.SetIdVisible(id, true);
+ for(i = 0; i < jobj.length; i++) $ax.visibility.SetVisible(jobj[i], true);
+
+ if(preserveScroll) _tryResumeScrollForDP(id);
+ if(directionIn == "right") {
+ $ax.move.MoveWidget(stateId, width, 0, options, false, onComplete, false, jobj, true);
+ } else if(directionIn == "left") {
+ $ax.move.MoveWidget(stateId, -width, 0, options, false, onComplete, false, jobj, true);
+ } else if(directionIn == "up") {
+ $ax.move.MoveWidget(stateId, 0, -height, options, false, onComplete, false, jobj, true);
+ } else if(directionIn == "down") {
+ $ax.move.MoveWidget(stateId, 0, height, options, false, onComplete, false, jobj, true);
+ }
+ };
+
+ $ax.visibility.GetPanelStateId = function(dpId, index) {
+ var itemNum = $ax.repeater.getItemIdFromElementId(dpId);
+ var panelStateId = $ax.repeater.getScriptIdFromElementId(dpId) + '_state' + index;
+ return $ax.repeater.createElementId(panelStateId, itemNum);
+ };
+
+ $ax.visibility.GetPanelStateCount = function(id) {
+ return $ax.visibility.getRealChildren($jobj(id).children()).length;
+ };
+
+ var _bringPanelStateToFront = function (dpId, stateId, oldStateId, oldInFront) {
+ var panel = $jobj(dpId);
+ var frontId = oldInFront ? oldStateId : stateId;
+ if(containerCount[dpId]) {
+ frontId = $ax.visibility.applyWidgetContainer(frontId);
+ panel = $ax.visibility.applyWidgetContainer(dpId, true, false, true);
+ }
+ $jobj(frontId).appendTo(panel);
+ //when bring a panel to front, it will be focused, and the previous front panel should fire blur event if it's lastFocusedClickableSelector
+ //ie(currently 11) and firefox(currently 34) doesn't fire blur event, this is the hack to fire it manually
+ if((IE || FIREFOX) && window.lastFocusedClickable && $ax.event.getFocusableWidgetOrChildId(window.lastFocusedControl) == window.lastFocusedClickable.id) {
+ // Only need to do this if the currently focused widget is in the panel state that is being hidden.
+ if($jobj(oldStateId).find('#' + window.lastFocusedClickable.id.split('_')[0]).length) $(window.lastFocusedClickable).triggerHandler('blur');
+ }
+ };
+
+ var _limboIds = _visibility.limboIds = {};
+ // limboId's is a dictionary of id->true, essentially a set.
+ var _addLimboAndHiddenIds = $ax.visibility.addLimboAndHiddenIds = function(newLimboIds, newHiddenIds, query, skipRepeater) {
+ var limboedByMaster = {};
+ for(var key in newLimboIds) {
+ if (!$ax.public.fn.IsReferenceDiagramObject($ax.getObjectFromElementId(key).type)) continue;
+ var ids = $ax.model.idsInRdoToHideOrLimbo(key);
+ for(var i = 0; i < ids.length; i++) limboedByMaster[ids[i]] = true;
+ }
+
+ var hiddenByMaster = {};
+ for(key in newHiddenIds) {
+ if (!$ax.public.fn.IsReferenceDiagramObject($ax.getObjectFromElementId(key).type)) continue;
+ ids = $ax.model.idsInRdoToHideOrLimbo(key);
+ for(i = 0; i < ids.length; i++) hiddenByMaster[ids[i]] = true;
+ }
+
+ // Extend with children of rdos
+ newLimboIds = $.extend(newLimboIds, limboedByMaster);
+ newHiddenIds = $.extend(newHiddenIds, hiddenByMaster);
+
+ // something is only visible if it's not hidden and limboed
+ query.each(function(diagramObject, elementId) {
+ // Rdos already handled, contained widgets are limboed by the parent, and sub menus should be ignored
+ if(diagramObject.isContained || $ax.public.fn.IsReferenceDiagramObject(diagramObject.type) || $ax.public.fn.IsTableCell(diagramObject.type) || $jobj(elementId).hasClass('sub_menu')) return;
+ if(diagramObject.type == 'table' && $jobj(elementId).parent().hasClass('ax_menu')) return;
+ if(skipRepeater) {
+ // Any item in a repeater should return
+ if($ax.getParentRepeaterFromElementIdExcludeSelf(elementId)) return;
+ }
+
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ var shouldBeVisible = Boolean(!newLimboIds[scriptId] && !newHiddenIds[scriptId]);
+ var isVisible = Boolean(_isIdVisible(elementId));
+ if(shouldBeVisible != isVisible) {
+ _setWidgetVisibility(elementId, { value: shouldBeVisible, noContainer: true });
+ }
+ });
+
+ _limboIds = _visibility.limboIds = $.extend(_limboIds, newLimboIds);
+
+ };
+
+ var _clearLimboAndHidden = $ax.visibility.clearLimboAndHidden = function(ids) {
+ _limboIds = _visibility.limboIds = {};
+ };
+
+ $ax.visibility.clearLimboAndHiddenIds = function(ids) {
+ for(var i = 0; i < ids.length; i++) {
+ var scriptId = $ax.repeater.getScriptIdFromElementId(ids[i]);
+ delete _limboIds[scriptId];
+ }
+ };
+
+ $ax.visibility.resetLimboAndHiddenToDefaults = function (query) {
+ if(!query) query = $ax('*');
+ _clearLimboAndHidden();
+ _addLimboAndHiddenIds(_defaultLimbo, _defaultHidden, query);
+ };
+
+ $ax.visibility.isScriptIdLimbo = function(scriptId) {
+ if(_limboIds[scriptId]) return true;
+
+ var repeater = $ax.getParentRepeaterFromScriptId(scriptId);
+ if(!repeater) return false;
+
+ var itemId = $ax.getItemIdsForRepeater(repeater)[0];
+ return _limboIds[$ax.repeater.createElementId(scriptId, itemId)];
+ }
+
+ $ax.visibility.isElementIdLimboOrInLimboContainer = function (elementId) {
+ var parent = document.getElementById(elementId);
+ while(parent) {
+ var scriptId = $ax.repeater.getScriptIdFromElementId($(parent).attr('id'));
+ if(_limboIds[scriptId]) return true;
+ parent = parent.parentElement;
+ }
+ return false;
+ }
+
+ $ax.visibility.initialize = function() {
+ // initialize initial visible states
+ $('.' + HIDDEN_CLASS).each(function (index, diagramObject) {
+ _defaultHidden[$ax.repeater.getScriptIdFromElementId(diagramObject.id)] = true;
+ });
+
+ $('.' + UNPLACED_CLASS).each(function (index, diagramObject) {
+ _defaultLimbo[$ax.repeater.getScriptIdFromElementId(diagramObject.id)] = true;
+ });
+
+ _addLimboAndHiddenIds(_defaultLimbo, _defaultHidden, $ax('*'), true);
+ };
+
+ _visibility.initRepeater = function(repeaterId) {
+ var html = $('
');
+ html.append($jobj(repeaterId + '_script').html());
+
+ html.find('.' + HIDDEN_CLASS).each(function (index, element) {
+ _defaultHidden[$ax.repeater.getScriptIdFromElementId(element.id)] = true;
+ });
+
+ html.find('.' + UNPLACED_CLASS).each(function (index, element) {
+ _defaultLimbo[$ax.repeater.getScriptIdFromElementId(element.id)] = true;
+ });
+ }
+
+ var HIDDEN_CLASS = _visibility.HIDDEN_CLASS = 'ax_default_hidden';
+ var UNPLACED_CLASS = _visibility.UNPLACED_CLASS = 'ax_default_unplaced';
+
+});
+//***** style.js *****//
+$axure.internal(function($ax) {
+ var _style = {};
+ $ax.style = _style;
+
+ var _disabledWidgets = {};
+ var _selectedWidgets = {};
+
+ // A table to cache the outerHTML of the _rtf elements before the rollover state is applied.
+ var _originalTextCache = {};
+ // A table to exclude the normal style from adaptive overrides
+ var _shapesWithSetRichText = {};
+
+ // just a listing of shape ids
+ var _adaptiveStyledWidgets = {};
+
+ var _setLinkStyle = function(id, styleName) {
+ var parentId = $ax.GetParentIdFromLink(id);
+ var style = _computeAllOverrides(id, parentId, styleName, $ax.adaptive.currentViewId);
+
+ var textId = $ax.GetTextPanelId(parentId);
+ if(!_originalTextCache[textId]) {
+ $ax.style.CacheOriginalText(textId);
+ }
+ if($.isEmptyObject(style)) return;
+
+ var textCache = _originalTextCache[textId].styleCache;
+
+ _transformTextWithVerticalAlignment(textId, function() {
+ var cssProps = _getCssStyleProperties(style);
+ $('#' + id).find('*').andSelf().each(function(index, element) {
+ element.setAttribute('style', textCache[element.id]);
+ _applyCssProps(element, cssProps);
+ });
+ });
+ };
+
+ var _resetLinkStyle = function(id) {
+ var textId = $ax.GetTextPanelId($ax.GetParentIdFromLink(id));
+ var textCache = _originalTextCache[textId].styleCache;
+
+ _transformTextWithVerticalAlignment(textId, function() {
+ $('#' + id).find('*').andSelf().each(function(index, element) {
+ element.style.cssText = textCache[element.id];
+ });
+ });
+ if($ax.event.mouseDownObjectId) {
+ $ax.style.SetWidgetMouseDown($ax.event.mouseDownObjectId, true);
+ } else if($ax.event.mouseOverObjectId) {
+ $ax.style.SetWidgetHover($ax.event.mouseOverObjectId, true);
+ }
+ };
+
+ $ax.style.SetLinkHover = function(id) {
+ _setLinkStyle(id, MOUSE_OVER);
+ };
+
+ $ax.style.SetLinkNotHover = function(id) {
+ _resetLinkStyle(id);
+ };
+
+ $ax.style.SetLinkMouseDown = function(id) {
+ _setLinkStyle(id, MOUSE_DOWN);
+ };
+
+ $ax.style.SetLinkNotMouseDown = function(id) {
+ _resetLinkStyle(id);
+ var style = _computeAllOverrides(id, $ax.event.mouseOverObjectId, MOUSE_OVER, $ax.adaptive.currentViewId);
+
+ if(!$.isEmptyObject(style)) $ax.style.SetLinkHover(id);
+ //we dont do anything here because the widget not mouse down has taken over here
+ };
+
+ var _widgetHasState = function(id, state) {
+ if($ax.style.getElementImageOverride(id, state)) return true;
+ var diagramObject = $ax.getObjectFromElementId(id);
+
+ var adaptiveIdChain = $ax.adaptive.getAdaptiveIdChain($ax.adaptive.currentViewId);
+
+ for(var i = 0; i < adaptiveIdChain.length; i++) {
+ var viewId = adaptiveIdChain[i];
+ var adaptiveStyle = diagramObject.adaptiveStyles[viewId];
+ if(adaptiveStyle && adaptiveStyle.stateStyles && adaptiveStyle.stateStyles[state]) return true;
+ }
+
+ if(diagramObject.style.stateStyles) return diagramObject.style.stateStyles[state];
+
+ return false;
+ };
+
+ // Returns what overrides the hover, or false if nothing.
+ var _hoverOverride = function(id) {
+ if($ax.style.IsWidgetDisabled(id)) return DISABLED;
+ if($ax.style.IsWidgetSelected(id)) return SELECTED;
+ var obj = $ax.getObjectFromElementId(id);
+ if(!obj.isContained) return false;
+ var path = $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(id));
+ path[path.length - 1] = obj.parent.id;
+ var itemId = $ax.repeater.getItemIdFromElementId(id);
+ return _hoverOverride($ax.getElementIdFromPath(path, { itemNum: itemId }));
+ };
+
+ $ax.style.SetWidgetHover = function(id, value) {
+ var override = _hoverOverride(id);
+ if(override == DISABLED) return;
+ if(!_widgetHasState(id, MOUSE_OVER)) return;
+
+ var valToSet = value || _isRolloverOverride(id);
+ var state = _generateMouseState(id, valToSet ? MOUSE_OVER : NORMAL, override == SELECTED);
+ _applyImageAndTextJson(id, state);
+ _updateElementIdImageStyle(id, state);
+ };
+
+ var _rolloverOverrides = [];
+ var _isRolloverOverride = function(id) {
+ return _rolloverOverrides.indexOf(id) != -1;
+ };
+
+ $ax.style.AddRolloverOverride = function(id) {
+ if(_isRolloverOverride(id)) return;
+ _rolloverOverrides[_rolloverOverrides.length] = id;
+ if($ax.event.mouseOverIds.indexOf(id) == -1) $ax.style.SetWidgetHover(id, true);
+ };
+
+ $ax.style.RemoveRolloverOverride = function(id) {
+ var index = _rolloverOverrides.indexOf(id);
+ if(index == -1) return;
+ $ax.splice(_rolloverOverrides, index, 1);
+ if($ax.event.mouseOverIds.indexOf(id) == -1) $ax.style.SetWidgetHover(id, false);
+ };
+
+ // function GetWidgetCurrentState(id) {
+ // if($ax.style.IsWidgetDisabled(id)) return "disabled";
+ // if($ax.style.IsWidgetSelected(id)) return "selected";
+ // if($ax.event.mouseOverObjectId == id) return "mouseOver";
+ // if($ax.event.mouseDownObjectId == id) return "mouseDown";
+
+ // return "normal";
+ // }
+
+ $ax.style.ObjHasMouseDown = function(id) {
+ var obj = $obj(id);
+ if($ax.style.getElementImageOverride(id, 'mouseDown') || obj.style && obj.style.stateStyles && obj.style.stateStyles.mouseDown) return true;
+
+ var chain = $ax.adaptive.getAdaptiveIdChain($ax.adaptive.currentViewId);
+ for(var i = 0; i < chain.length; i++) {
+ var style = obj.adaptiveStyles[chain[i]];
+ if(style && style.stateStyles && style.stateStyles.mouseDown) return true;
+ }
+ return false;
+ };
+
+ $ax.style.SetWidgetMouseDown = function(id, value, checkMouseOver) {
+ if($ax.style.IsWidgetDisabled(id)) return;
+ if(!_widgetHasState(id, MOUSE_DOWN)) return;
+
+ //if set to value is true, it's mousedown, if check mouseover is true,
+ //check if element is currently mouseover and has mouseover state before setting mouseover
+ if(value) var state = MOUSE_DOWN;
+ else if(!checkMouseOver || $ax.event.mouseOverIds.indexOf(id) !== -1 && _widgetHasState(id, MOUSE_OVER)) state = MOUSE_OVER;
+ else state = NORMAL;
+
+ var mouseState = _generateMouseState(id, state, $ax.style.IsWidgetSelected(id));
+ _applyImageAndTextJson(id, mouseState);
+ _updateElementIdImageStyle(id, mouseState);
+ };
+
+ var _generateMouseState = function(id, mouseState, selected) {
+ if (selected) {
+ if (_style.getElementImageOverride(id, SELECTED)) return SELECTED;
+
+ var viewChain = $ax.adaptive.getAdaptiveIdChain($ax.adaptive.currentViewId);
+ viewChain[viewChain.length] = '';
+ var obj = $obj(id);
+ if(obj.type == "dynamicPanel") return SELECTED;
+
+ var any = function(dict) {
+ for(var key in dict) return true;
+ return false;
+ };
+
+ for(var i = 0; i < viewChain.length; i++) {
+ var viewId = viewChain[i];
+ // Need to check seperately for images.
+ if(obj.adaptiveStyles && obj.adaptiveStyles[viewId] && any(obj.adaptiveStyles[viewId])
+ || obj.images && obj.images['selected~' + viewId]) return SELECTED;
+ }
+ var selectedStyle = obj.style && obj.style.stateStyles && obj.style.stateStyles.selected;
+ if(selectedStyle && any(selectedStyle)) return SELECTED;
+ }
+
+ // Not using selected
+ return mouseState;
+ };
+
+ $ax.style.SetWidgetSelected = function(id, value, alwaysApply) {
+ if(_isWidgetDisabled(id)) return;
+ //NOTE: not firing select events if state didn't change
+ var raiseSelectedEvents = $ax.style.IsWidgetSelected(id) != value;
+
+ if(value) {
+ var group = $('#' + id).attr('selectiongroup');
+ if(group) {
+ $("[selectiongroup='" + group + "']").each(function() {
+ var otherId = this.id;
+ if(otherId == id) return;
+ if ($ax.visibility.isScriptIdLimbo($ax.repeater.getScriptIdFromElementId(otherId))) return;
+
+ $ax.style.SetWidgetSelected(otherId, false);
+ });
+ }
+ }
+ var obj = $obj(id);
+ if(obj) {
+ var actionId = id;
+ if ($ax.public.fn.IsDynamicPanel(obj.type) || $ax.public.fn.IsLayer(obj.type)) {
+ if(!value) $jobj(id).removeClass('selected');
+ var children = $axure('#' + id).getChildren()[0].children;
+ for(var i = 0; i < children.length; i++) {
+ var childId = children[i];
+ // Special case for trees
+ var childObj = $jobj(childId);
+ if(childObj.hasClass('treeroot')) {
+ var treenodes = childObj.find('.treenode');
+ for(var j = 0; j < treenodes.length; j++) {
+ $axure('#' + treenodes[j].id).selected(value);
+ }
+ } else $axure('#' + childId).selected(value);
+ }
+ } else {
+ var widgetHasSelectedState = _widgetHasState(id, SELECTED);
+ while(obj.isContained && !widgetHasSelectedState) obj = obj.parent;
+ var itemId = $ax.repeater.getItemIdFromElementId(id);
+ var path = $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(id));
+ path[path.length - 1] = obj.id;
+ actionId = $ax.getElementIdFromPath(path, { itemNum: itemId });
+ if(alwaysApply || widgetHasSelectedState) {
+ var state = _generateSelectedState(actionId, value);
+ _applyImageAndTextJson(actionId, state);
+ _updateElementIdImageStyle(actionId, state);
+ }
+ //added actionId and this hacky logic because we set style state on child, but interaction on parent
+ //then the id saved in _selectedWidgets would be depended on widgetHasSelectedState... more see case 1818143
+ while(obj.isContained && !$ax.getObjectFromElementId(id).interactionMap) obj = obj.parent;
+ path = $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(id));
+ path[path.length - 1] = obj.id;
+ actionId = $ax.getElementIdFromPath(path, { itemNum: itemId });
+ }
+ }
+
+ // ApplyImageAndTextJson(id, value ? 'selected' : 'normal');
+ _selectedWidgets[id] = value;
+ if(raiseSelectedEvents) $ax.event.raiseSelectedEvents(actionId, value);
+ };
+
+ var _generateSelectedState = function(id, selected) {
+ var mouseState = $ax.event.mouseDownObjectId == id ? MOUSE_DOWN : $.inArray(id, $ax.event.mouseOverIds) != -1 ? MOUSE_OVER : NORMAL;
+ //var mouseState = $ax.event.mouseDownObjectId == id ? MOUSE_DOWN : $ax.event.mouseOverIds.indexOf(id) != -1 ? MOUSE_OVER : NORMAL;
+ return _generateMouseState(id, mouseState, selected);
+ };
+
+ $ax.style.IsWidgetSelected = function(id) {
+ return Boolean(_selectedWidgets[id]) || $('#'+id).hasClass('selected');
+ };
+
+ $ax.style.SetWidgetEnabled = function(id, value) {
+ _disabledWidgets[id] = !value;
+ $('#' + id).find('a').css('cursor', value ? 'pointer' : 'default');
+
+ if(!_widgetHasState(id, DISABLED)) return;
+ if(!value) {
+ _applyImageAndTextJson(id, DISABLED);
+ _updateElementIdImageStyle(id, DISABLED);
+ } else $ax.style.SetWidgetSelected(id, $ax.style.IsWidgetSelected(id), true);
+ };
+
+ $ax.style.SetWidgetPlaceholder = function(id, value, text, password) {
+ var inputId = $ax.repeater.applySuffixToElementId(id, '_input');
+
+ // Right now this is the only style on the widget. If other styles (ex. Rollover), are allowed
+ // on TextBox/TextArea, or Placeholder is applied to more widgets, this may need to do more.
+ var obj = $jobj(inputId);
+
+ var height = document.getElementById(inputId).style['height'];
+ var width = document.getElementById(inputId).style['width'];
+ obj.attr('style', '');
+ //removing all styles, but now we can change the size, so we should add them back
+ //this is more like a quick hack
+ if (height) obj.css('height', height);
+ if (width) obj.css('width', width);
+
+ if(!value) {
+ try { //ie8 and below error
+ if(password) document.getElementById(inputId).type = 'password';
+ } catch(e) { }
+ } else {
+ var element = $('#' + inputId)[0];
+ var style = _computeAllOverrides(id, undefined, HINT, $ax.adaptive.currentViewId);
+ var styleProperties = _getCssStyleProperties(style);
+
+ //moved this out of GetCssStyleProperties for now because it was breaking un/rollovers with gradient fills
+ if(style.fill) styleProperties.allProps.backgroundColor = _getColorFromFill(style.fill);
+
+ _applyCssProps(element, styleProperties, true);
+ try { //ie8 and below error
+ if(password) document.getElementById(inputId).type = 'text';
+ } catch(e) { }
+ }
+ obj.val(text);
+ };
+
+ var _isWidgetDisabled = $ax.style.IsWidgetDisabled = function(id) {
+ return Boolean(_disabledWidgets[id]);
+ };
+
+ var _elementIdsToImageOverrides = {};
+ $ax.style.mapElementIdToImageOverrides = function (elementId, override) {
+ for(var key in override) _addImageOverride(elementId, key, override[key]);
+ };
+
+ var _addImageOverride = function (elementId, state, val) {
+ if (!_elementIdsToImageOverrides[elementId]) _elementIdsToImageOverrides[elementId] = {};
+ _elementIdsToImageOverrides[elementId][state] = val;
+ }
+
+ $ax.style.deleteElementIdToImageOverride = function(elementId) {
+ delete _elementIdsToImageOverrides[elementId];
+ };
+
+ $ax.style.getElementImageOverride = function(elementId, state) {
+ var url = _elementIdsToImageOverrides[elementId] && _elementIdsToImageOverrides[elementId][state];
+ return url;
+ };
+
+ $ax.style.elementHasAnyImageOverride = function(elementId) {
+ return Boolean(_elementIdsToImageOverrides[elementId]);
+ };
+
+ var NORMAL = 'normal';
+ var MOUSE_OVER = 'mouseOver';
+ var MOUSE_DOWN = 'mouseDown';
+ var SELECTED = 'selected';
+ var DISABLED = 'disabled';
+ var HINT = 'hint';
+
+ var _generateState = _style.generateState = function(id) {
+ return $ax.placeholderManager.isActive(id) ? HINT : _style.IsWidgetDisabled(id) ? DISABLED : _generateSelectedState(id, _style.IsWidgetSelected(id));
+ };
+
+ var _progressState = _style.progessState = function(state) {
+ if(state == NORMAL) return false;
+ if(state == MOUSE_DOWN) return MOUSE_OVER;
+ return NORMAL;
+ };
+
+ var _unprogressState = function(state, goal) {
+ state = state || NORMAL;
+ if(state == goal) return undefined;
+ if(state == NORMAL && goal == MOUSE_DOWN) return MOUSE_OVER;
+ return goal;
+ };
+
+ var _updateElementIdImageStyle = _style.updateElementIdImageStyle = function(elementId, state) {
+ if(!_style.elementHasAnyImageOverride(elementId)) return;
+
+ if(!state) state = _generateState(elementId);
+
+ var style = _computeFullStyle(elementId, state, $ax.adaptive.currentViewId);
+
+ var query = $jobj($ax.repeater.applySuffixToElementId(elementId, '_img'));
+ style.size.width = query.width();
+ style.size.height = query.height();
+ var borderId = $ax.repeater.applySuffixToElementId(elementId, '_border');
+ var borderQuery = $jobj(borderId);
+ if(!borderQuery.length) {
+ borderQuery = $('
');
+ borderQuery.attr('id', borderId);
+ query.after(borderQuery);
+ }
+
+ borderQuery.attr('style', '');
+ borderQuery.css('position', 'absolute');
+ query.attr('style', '');
+
+ var borderWidth = Number(style.borderWidth);
+ var hasBorderWidth = borderWidth > 0;
+ if(hasBorderWidth) {
+ borderQuery.css('border-style', 'solid');
+ borderQuery.css('border-width', borderWidth + 'px'); // If images start being able to turn off borders on specific sides, need to update this.
+ borderQuery.css('width', style.size.width - borderWidth * 2);
+ borderQuery.css('height', style.size.height - borderWidth * 2);
+ }
+
+ var linePattern = style.linePattern;
+ if(hasBorderWidth && linePattern) borderQuery.css('border-style', linePattern);
+
+ var borderFill = style.borderFill;
+ if(hasBorderWidth && borderFill) {
+ var color = borderFill.fillType == 'solid' ? borderFill.color :
+ borderFill.fillType == 'linearGradient' ? borderFill.colors[0].color : 0;
+
+ var alpha = Math.floor(color / 256 / 256 / 256);
+ color -= alpha * 256 * 256 * 256;
+ alpha = alpha / 255;
+
+ var red = Math.floor(color / 256 / 256);
+ color -= red * 256 * 256;
+ var green = Math.floor(color / 256);
+ var blue = color - green * 256;
+
+ borderQuery.css('border-color', _rgbaToFunc(red, green, blue, alpha));
+ }
+
+ var cornerRadiusTopLeft = style.cornerRadius;
+ if(cornerRadiusTopLeft) {
+ query.css('border-radius', cornerRadiusTopLeft + 'px');
+ borderQuery.css('border-radius', cornerRadiusTopLeft + 'px');
+ }
+
+ var outerShadow = style.outerShadow;
+ if(outerShadow && outerShadow.on) {
+ var arg = '';
+ arg += outerShadow.offsetX + 'px' + ' ' + outerShadow.offsetY + 'px' + ' ';
+ var rgba = outerShadow.color;
+ arg += outerShadow.blurRadius + 'px' + ' 0px ' + _rgbaToFunc(rgba.r, rgba.g, rgba.b, rgba.a);
+ query.css('-moz-box-shadow', arg);
+ query.css('-wibkit-box-shadow', arg);
+ query.css('box-shadow', arg);
+ query.css('left', '0px');
+ query.css('top', '0px');
+ }
+
+ query.css({ width: style.size.width, height: style.size.height });
+ };
+
+ var _rgbaToFunc = function(red, green, blue, alpha) {
+ return 'rgba(' + red + ',' + green + ',' + blue + ',' + alpha + ')';
+ };
+
+ var _applyImageAndTextJson = function(id, event) {
+ var textId = $ax.GetTextPanelId(id, true);
+ if(textId) _resetTextJson(id, textId);
+
+ // This should never be the case
+ //if(event != '') {
+ var imgQuery = $jobj($ax.GetImageIdFromShape(id));
+ var e = imgQuery.data('events');
+ if(e && e[event]) imgQuery.trigger(event);
+
+ var imageUrl = $ax.adaptive.getImageForStateAndView(id, event);
+ if(imageUrl) _applyImage(id, imageUrl, event);
+
+ var style = _computeAllOverrides(id, undefined, event, $ax.adaptive.currentViewId);
+ if(!$.isEmptyObject(style)) _applyTextStyle(textId, style);
+
+ _updateStateClasses(id, event);
+ _updateStateClasses($ax.repeater.applySuffixToElementId(id, '_div'), event);
+ };
+
+ var _updateStateClasses = function(id, event) {
+ var jobj = $jobj(id);
+
+ //if(jobj[0] && jobj[0].hasAttribute('widgetwidth')) {
+ // for (var x = 0; x < jobj[0].children.length; x++) {
+ // var childId = jobj[0].children[x].id;
+ // if (childId.indexOf('p') < 0) continue;
+
+ // _updateStateClasses(childId, event) ;
+ // }
+ //} else {
+ for (var i = 0; i < ALL_STATES.length; i++) jobj.removeClass(ALL_STATES[i]);
+ if (event == 'mouseDown') jobj.addClass('mouseOver');
+ if(event != 'normal') jobj.addClass(event);
+ //}
+ }
+
+ /* -------------------
+
+ here's the algorithm in a nutshell:
+ [DOWN] -- refers to navigation down the view inheritance heirarchy (default to most specific)
+ [UP] -- navigate up the heirarchy
+
+ ComputeAllOverrides (object):
+ All view styles [DOWN]
+ If hyperlink
+ - DO ComputeStateStyle for parent object
+ - if (MouseOver || MouseDown)
+ - linkMouseOver Style
+ - if (MouseDown)
+ - linkMouseDown style
+ - ComputeStateStyleForViewChain (parent, STATE)
+
+ if (MouseDown) DO ComputeStateStyleForViewChain for object, mouseOver
+ DO ComputeStateStyleForViewChain for object, style
+
+
+ ComputeStateStyleForViewChain (object, STATE)
+ FIRST STATE state style [UP] the chain OR default object STATE style
+
+ ------------------- */
+
+ var FONT_PROPS = {
+ 'typeface': true,
+ 'fontName': true,
+ 'fontWeight': true,
+ 'fontStyle': true,
+ 'fontStretch': true,
+ 'fontSize': true,
+ 'underline': true,
+ 'foreGroundFill': true,
+ 'horizontalAlignment': true
+ };
+
+ var _computeAllOverrides = $ax.style.computeAllOverrides = function(id, parentId, state, currentViewId) {
+ var computedStyle = {};
+ if(parentId) computedStyle = _computeAllOverrides(parentId, null, state, currentViewId);
+
+ var diagramObject = $ax.getObjectFromElementId(id);
+ var viewIdChain = $ax.adaptive.getAdaptiveIdChain(currentViewId);
+
+ var excludeFont = _shapesWithSetRichText[id];
+ for(var i = 0; i < viewIdChain.length; i++) {
+ var viewId = viewIdChain[i];
+ var style = diagramObject.adaptiveStyles[viewId];
+ if(style) {
+ // we want to exclude the normal font style for shapes where the rich text has been set with an interaction
+ // so we copy the style so we don't modify the original, then delete all the font props.
+ if(excludeFont) {
+ style = $ax.deepCopy(style);
+ for(var prop in FONT_PROPS) delete style[prop];
+ }
+
+ if(style) {
+ var customStyle = style.baseStyle && $ax.document.stylesheet.stylesById[style.baseStyle];
+ //make sure not to extend the customStyle this can mutate it for future use
+ $.extend(computedStyle, customStyle);
+ }
+ $.extend(computedStyle, style);
+ }
+ }
+
+ var currState = NORMAL;
+ while(currState) {
+ $.extend(computedStyle, _computeStateStyleForViewChain(diagramObject, currState, viewIdChain, true));
+ currState = _unprogressState(currState, state);
+ }
+
+ return _removeUnsupportedProperties(computedStyle, diagramObject.type);
+ };
+
+ var _computeStateStyleForViewChain = function(diagramObject, state, viewIdChain, excludeNormal) {
+ var styleObject = diagramObject;
+ while(styleObject.isContained) styleObject = styleObject.parent;
+
+ var adaptiveStyles = styleObject.adaptiveStyles;
+
+ for(var i = viewIdChain.length - 1; i >= 0; i--) {
+ var viewId = viewIdChain[i];
+ var viewStyle = adaptiveStyles[viewId];
+ var stateStyle = viewStyle && _getFullStateStyle(viewStyle, state, excludeNormal);
+ if(stateStyle) return $.extend({}, stateStyle);
+ }
+
+ // we dont want to actually include the object style because those are not overrides, hence the true for "excludeNormal" and not passing the val through
+ var stateStyleFromDefault = _getFullStateStyle(styleObject.style, state, true);
+ return $.extend({}, stateStyleFromDefault);
+ };
+
+ // returns the full effective style for an object in a state state and view
+ var _computeFullStyle = function(id, state, currentViewId) {
+ var obj = $obj(id);
+ var overrides = _computeAllOverrides(id, undefined, state, currentViewId);
+ // todo: account for image box
+ var objStyle = obj.style;
+ var customStyle = objStyle.baseStyle && $ax.document.stylesheet.stylesById[objStyle.baseStyle];
+ var returnVal = $.extend({}, $ax.document.stylesheet.defaultStyle, customStyle, objStyle, overrides);
+ return _removeUnsupportedProperties(returnVal, obj.type);
+ };
+
+ var _removeUnsupportedProperties = function(style, objectType) {
+ // for now all we need to do is remove padding from checkboxes and radio buttons
+ if ($ax.public.fn.IsRadioButton(objectType) || $ax.public.fn.IsCheckBox(objectType)) {
+ style.paddingTop = 0;
+ style.paddingLeft = 0;
+ style.paddingRight = 0;
+ style.paddingBottom = 0;
+ }
+ return style;
+ };
+
+ var _getFullStateStyle = function(style, state, excludeNormal) {
+ //'normal' is needed because now DiagramObjects get their image from the Style and unapplying a rollover needs the image
+ var stateStyle = state == 'normal' && !excludeNormal ? style : style && style.stateStyles && style.stateStyles[state];
+ if(stateStyle) {
+ var customStyle = stateStyle.baseStyle && $ax.document.stylesheet.stylesById[stateStyle.baseStyle];
+ //make sure not to extend the customStyle this can mutate it for future use
+ return $.extend({}, customStyle, stateStyle);
+ }
+ return undefined;
+ };
+
+ // commented this out for now... we actually will probably need it for ie
+ var _applyOpacityFromStyle = $ax.style.applyOpacityFromStyle = function(id, style) {
+ return;
+ var opacity = style.opacity || '';
+ $jobj(id).children().css('opacity', opacity);
+ };
+
+ var _initialize = function() {
+ //being handled at on window.load
+ //$ax.style.initializeObjectTextAlignment($ax('*'));
+ };
+ $ax.style.initialize = _initialize;
+
+ var _initTextAlignment = function(elementId) {
+ var textId = $ax.GetTextPanelId(elementId);
+ if(textId) {
+ _storeIdToAlignProps(textId);
+ // now handle vertical alignment
+ if(_getObjVisible(textId)) {
+ _setTextAlignment(textId, _idToAlignProps[textId], false);
+ }
+ }
+ };
+
+ $ax.style.initializeObjectTextAlignment = function(query) {
+ query.filter(function(diagramObject) {
+ return $ax.public.fn.IsVector(diagramObject.type) || $ax.public.fn.IsImageBox(diagramObject.type);
+ }).each(function(diagramObject, elementId) {
+ if($jobj(elementId).length == 0) return;
+ _initTextAlignment(elementId);
+ });
+ };
+
+ var _storeIdToAlignProps = function(textId) {
+ var shapeId = $ax.GetShapeIdFromText(textId);
+ var shapeObj = $obj(shapeId);
+ var state = _generateState(shapeId);
+
+ var style = _computeFullStyle(shapeId, state, $ax.adaptive.currentViewId);
+ var vAlign = style.verticalAlignment || 'middle';
+
+ var paddingLeft = Number(style.paddingLeft) || 0;
+ paddingLeft += (Number(shapeObj && shapeObj.extraLeft) || 0);
+ var paddingTop = style.paddingTop || 0;
+ var paddingRight = style.paddingRight || 0;
+ var paddingBottom = style.paddingBottom || 0;
+ _idToAlignProps[textId] = { vAlign: vAlign, paddingLeft: paddingLeft, paddingTop: paddingTop, paddingRight: paddingRight, paddingBottom: paddingBottom };
+ };
+
+ var ALL_STATES = ['mouseOver', 'mouseDown', 'selected', 'disabled'];
+ var _applyImage = $ax.style.applyImage = function (id, imgUrl, state) {
+ var object = $obj(id);
+ if (object.generateCompound) {
+ for (var i = 0; i < object.compoundChildren.length; i++) {
+ var componentId = object.compoundChildren[i];
+ var childId = $ax.public.fn.getComponentId(id, componentId);
+ var childImgQuery = $jobj(childId + '_img');
+ var childQuery = $jobj(childId);
+ childImgQuery.attr('src', imgUrl[componentId]);
+ for (var j = 0; j < ALL_STATES.length; j++) {
+ childImgQuery.removeClass(ALL_STATES[j]);
+ childQuery.removeClass(ALL_STATES[j]);
+ }
+ if (state != 'normal') {
+ childImgQuery.addClass(state);
+ childQuery.addClass(state);
+ }
+ }
+ } else {
+ var imgQuery = $jobj($ax.GetImageIdFromShape(id));
+ var idQuery = $jobj(id);
+ //it is hard to tell if setting the image or the class first causing less flashing when adding shadows.
+ imgQuery.attr('src', imgUrl);
+ for (var i = 0; i < ALL_STATES.length; i++) {
+ idQuery.removeClass(ALL_STATES[i]);
+ imgQuery.removeClass(ALL_STATES[i]);
+ }
+ if (state != 'normal') {
+ idQuery.addClass(state);
+ imgQuery.addClass(state);
+ }
+ if (imgQuery.parents('a.basiclink').length > 0) imgQuery.css('border', 'none');
+ if (imgUrl.indexOf(".png") > -1) $ax.utils.fixPng(imgQuery[0]);
+ }
+
+ };
+
+ $ax.public.fn.getComponentId = function (id, componentId) {
+ var idParts = id.split('-');
+ idParts[0] = idParts[0] + componentId;
+ return idParts.join('-');
+ }
+
+ var _resetTextJson = function(id, textid) {
+ // reset the opacity
+ $jobj(id).children().css('opacity', '');
+
+ var cacheObject = _originalTextCache[textid];
+ if(cacheObject) {
+ _transformTextWithVerticalAlignment(textid, function() {
+ var styleCache = cacheObject.styleCache;
+ var textQuery = $('#' + textid);
+ textQuery.find('*').each(function(index, element) {
+ element.style.cssText = styleCache[element.id];
+ });
+ });
+ }
+ };
+
+ // Preserves the alingment for the element textid after executing transformFn
+
+ var _getRtfElementHeight = function(rtfElement) {
+ if(rtfElement.innerHTML == '') rtfElement.innerHTML = ' ';
+
+ // To handle render text as image
+ var images = $(rtfElement).children('img');
+ if(images.length) return images.height();
+ return rtfElement.offsetHeight;
+ };
+
+ // why microsoft decided to default to round to even is beyond me...
+ var _roundToEven = function(number) {
+ var numString = number.toString();
+ var parts = numString.split('.');
+ if(parts.length == 1) return number;
+ if(parts[1].length == 1 && parts[1] == '5') {
+ var wholePart = Number(parts[0]);
+ return wholePart % 2 == 0 ? wholePart : wholePart + 1;
+ } else return Math.round(number);
+ };
+
+ var _transformTextWithVerticalAlignment = $ax.style.transformTextWithVerticalAlignment = function(textId, transformFn) {
+ if(!_originalTextCache[textId]) {
+ $ax.style.CacheOriginalText(textId);
+ }
+
+ var rtfElement = window.document.getElementById(textId);
+ if(!rtfElement) return;
+
+ transformFn();
+
+ _storeIdToAlignProps(textId);
+
+ $ax.style.updateTextAlignmentForVisibility(textId);
+ };
+
+ // this is for vertical alignments set on hidden objects
+ var _idToAlignProps = {};
+
+ $ax.style.updateTextAlignmentForVisibility = function (textId) {
+ var textObj = $jobj(textId);
+ // must check if parent id exists. Doesn't exist for text objs in check boxes, and potentially elsewhere.
+ var parentId = textObj.parent().attr('id');
+ if (parentId && $ax.visibility.isContainer(parentId)) return;
+
+ var alignProps = _idToAlignProps[textId];
+ if(!alignProps || !_getObjVisible(textId)) return;
+
+ _setTextAlignment(textId, alignProps);
+ };
+
+ var _getObjVisible = _style.getObjVisible = function (id) {
+ var element = document.getElementById(id);
+ return element && (element.offsetWidth || element.offsetHeight);
+ };
+
+ var _setTextAlignment = function(textId, alignProps, updateProps) {
+ if(updateProps) _storeIdToAlignProps(textId);
+ if(!alignProps) return;
+
+ var vAlign = alignProps.vAlign;
+ var paddingTop = Number(alignProps.paddingTop);
+ var paddingBottom = Number(alignProps.paddingBottom);
+ var paddingLeft = Number(alignProps.paddingLeft);
+ var paddingRight = Number(alignProps.paddingRight);
+
+ var topParam = 0.0;
+ var bottomParam = 1.0;
+ var leftParam = 0.0;
+ var rightParam = 1.0;
+
+ var textObj = $jobj(textId);
+ var textObjParent = textObj.offsetParent();
+ var parentId = textObjParent.attr('id');
+ var isConnector = false;
+ if(parentId) {
+ parentId = $ax.visibility.getWidgetFromContainer(textObjParent.attr('id'));
+ textObjParent = $jobj(parentId);
+ var parentObj = $obj(parentId);
+ if(parentObj['bottomTextPadding']) bottomParam = parentObj['bottomTextPadding'];
+ if(parentObj['topTextPadding']) topParam = parentObj['topTextPadding'];
+ if(parentObj['leftTextPadding']) leftParam = parentObj['leftTextPadding'];
+ if(parentObj['rightTextPadding']) rightParam = parentObj['rightTextPadding'];
+
+ // smart shapes are mutually exclusive from compound vectors.
+ isConnector = parentObj.type == $ax.constants.CONNECTOR_TYPE;
+ }
+ if(isConnector) return;
+
+ var axTextObjectParent = $ax('#' + textObjParent.attr('id'));
+
+ var oldWidth = $ax.getNumFromPx(textObj.css('width'));
+ var oldLeft = $ax.getNumFromPx(textObj.css('left'));
+ var oldTop = $ax.getNumFromPx(textObj.css('top'));
+
+ var newTop = 0;
+ var newLeft = 0.0;
+
+ var width = axTextObjectParent.width();
+ var height = axTextObjectParent.height();
+
+ // If text rotated need to handle getting the correct width for text based on bounding rect of rotated parent.
+ var boundingRotation = -$ax.move.getRotationDegreeFromElement(textObj[0]);
+ var boundingParent = $axure.fn.getBoundingSizeForRotate(width, height, boundingRotation);
+ var extraLeftPadding = (width - boundingParent.width) / 2;
+ width = boundingParent.width;
+ var relativeTop = 0.0;
+ relativeTop = height * topParam;
+ var containerHeight = height * bottomParam - relativeTop;
+
+
+ newLeft = paddingLeft + extraLeftPadding + width * leftParam;
+
+ var newWidth = width * (rightParam - leftParam) - paddingLeft - paddingRight;
+
+ var horizChange = newWidth != oldWidth || newLeft != oldLeft;
+ if(horizChange) {
+ textObj.css('left', newLeft);
+ textObj.width(newWidth);
+ }
+
+ var textHeight = _getRtfElementHeight(textObj[0]);
+
+ if(vAlign == "middle") newTop = _roundToEven(relativeTop + (containerHeight - textHeight + paddingTop - paddingBottom) / 2);
+ else if(vAlign == "bottom") newTop = _roundToEven(relativeTop + containerHeight - textHeight - paddingBottom);
+ else newTop = _roundToEven(paddingTop + relativeTop);
+ var vertChange = oldTop != newTop;
+ if(vertChange) textObj.css('top', newTop + 'px');
+
+ if((vertChange || horizChange)) _updateTransformOrigin(textId);
+ };
+
+ var _updateTransformOrigin = function(textId) {
+ var textObj = $jobj(textId);
+ var transformOrigin = textObj.css('-webkit-transform-origin') ||
+ textObj.css('-moz-transform-origin') ||
+ textObj.css('-ms-transform-origin') ||
+ textObj.css('transform-origin');
+ if(transformOrigin) {
+ var textObjParent = $ax('#' + textObj.parent().attr('id'));
+ var newX = (textObjParent.width() / 2 - textObj.css('left').replace('px', ''));
+ var newY = (textObjParent.height() / 2 - textObj.css('top').replace('px', ''));
+ var newOrigin = newX + 'px ' + newY + 'px';
+ textObj.css('-webkit-transform-origin', newOrigin);
+ textObj.css('-moz-transform-origin', newOrigin);
+ textObj.css('-ms-transform-origin', newOrigin);
+ textObj.css('transform-origin', newOrigin);
+ }
+ };
+
+ $ax.style.reselectElements = function() {
+ for(var id in _selectedWidgets) {
+ // Only looking for the selected widgets that don't have their class set
+ if(!_selectedWidgets[id] || $jobj(id).hasClass('selected')) continue;
+
+ $jobj(id).addClass('selected');
+ _applyImageAndTextJson(id, $ax.style.generateState(id));
+ }
+
+ for(id in _disabledWidgets) {
+ // Only looking for the disabled widgets that don't have their class yet
+ if (!_disabledWidgets[id] || $jobj(id).hasClass('disabled')) continue;
+
+ $jobj(id).addClass('disabled');
+ _applyImageAndTextJson(id, $ax.style.generateState(id));
+ }
+ }
+
+ $ax.style.clearAdaptiveStyles = function() {
+ for(var shapeId in _adaptiveStyledWidgets) {
+ var repeaterId = $ax.getParentRepeaterFromScriptId(shapeId);
+ if(repeaterId) continue;
+ var elementId = $ax.GetButtonShapeId(shapeId);
+ if(elementId) _applyImageAndTextJson(elementId, $ax.style.generateState(elementId));
+ }
+
+ _adaptiveStyledWidgets = {};
+ };
+
+ $ax.style.setAdaptiveStyle = function(shapeId, style) {
+ _adaptiveStyledWidgets[$ax.repeater.getScriptIdFromElementId(shapeId)] = style;
+
+ var textId = $ax.GetTextPanelId(shapeId);
+ if(textId) _applyTextStyle(textId, style);
+
+ $ax.placeholderManager.refreshPlaceholder(shapeId);
+
+ // removing this for now
+ // if(style.location) {
+ // $jobj(shapeId).css('top', style.location.x + "px")
+ // .css('left', style.location.y + "px");
+ // }
+ };
+
+ //-------------------------------------------------------------------------
+ // _applyTextStyle
+ //
+ // Applies a rollover style to a text element.
+ // id : the id of the text object to set.
+ // styleProperties : an object mapping style properties to values. eg:
+ // { 'fontWeight' : 'bold',
+ // 'fontStyle' : 'italic' }
+ //-------------------------------------------------------------------------
+ var _applyTextStyle = function(id, style) {
+ _transformTextWithVerticalAlignment(id, function() {
+ var styleProperties = _getCssStyleProperties(style);
+ $('#' + id).find('*').each(function(index, element) {
+ _applyCssProps(element, styleProperties);
+ });
+ });
+ };
+
+ var _applyCssProps = function(element, styleProperties, applyAllStyle) {
+ if(applyAllStyle) {
+ var allProps = styleProperties.allProps;
+ for(var prop in allProps) element.style[prop] = allProps[prop];
+ } else {
+ var nodeName = element.nodeName.toLowerCase();
+ if(nodeName == 'p') {
+ var parProps = styleProperties.parProps;
+ for(prop in parProps) element.style[prop] = parProps[prop];
+ } else if(nodeName != 'a') {
+ var runProps = styleProperties.runProps;
+ for(prop in runProps) element.style[prop] = runProps[prop];
+ }
+ }
+ };
+
+ var _getCssShadow = function(shadow) {
+ return !shadow.on ? "none"
+ : shadow.offsetX + "px " + shadow.offsetY + "px " + shadow.blurRadius + "px " + _getCssColor(shadow.color);
+ };
+
+ var _getCssStyleProperties = function(style) {
+ var toApply = {};
+ toApply.runProps = {};
+ toApply.parProps = {};
+ toApply.allProps = {};
+
+ if(style.fontName) toApply.allProps.fontFamily = toApply.runProps.fontFamily = style.fontName;
+ // we need to set font size on both runs and pars because otherwise it well mess up the measure and thereby vertical alignment
+ if(style.fontSize) toApply.allProps.fontSize = toApply.runProps.fontSize = toApply.parProps.fontSize = style.fontSize;
+ if(style.fontWeight !== undefined) toApply.allProps.fontWeight = toApply.runProps.fontWeight = style.fontWeight;
+ if(style.fontStyle !== undefined) toApply.allProps.fontStyle = toApply.runProps.fontStyle = style.fontStyle;
+ if(style.underline !== undefined) toApply.allProps.textDecoration = toApply.runProps.textDecoration = style.underline ? 'underline' : 'none';
+ if(style.foreGroundFill) {
+ toApply.allProps.color = toApply.runProps.color = _getColorFromFill(style.foreGroundFill);
+ //if(style.foreGroundFill.opacity) toApply.allProps.opacity = toApply.runProps.opacity = style.foreGroundFill.opacity;
+ }
+ if(style.horizontalAlignment) toApply.allProps.textAlign = toApply.parProps.textAlign = toApply.runProps.textAlign = style.horizontalAlignment;
+ if(style.lineSpacing) toApply.allProps.lineHeight = toApply.parProps.lineHeight = style.lineSpacing;
+ if(style.textShadow) toApply.allProps.textShadow = toApply.parProps.textShadow = _getCssShadow(style.textShadow);
+
+ return toApply;
+ };
+
+ var _getColorFromFill = function(fill) {
+ //var fillString = '00000' + fill.color.toString(16);
+ //return '#' + fillString.substring(fillString.length - 6);
+ var val = fill.color;
+ var color = {};
+ color.b = val % 256;
+ val = Math.floor(val / 256);
+ color.g = val % 256;
+ val = Math.floor(val / 256);
+ color.r = val % 256;
+ color.a = typeof (fill.opacity) == 'number' ? fill.opacity : 1;
+ return _getCssColor(color);
+ };
+
+ var _getCssColor = function(rgbaObj) {
+ return "rgba(" + rgbaObj.r + ", " + rgbaObj.g + ", " + rgbaObj.b + ", " + rgbaObj.a + ")";
+ };
+
+ // //--------------------------------------------------------------------------
+ // // ApplyStyleRecursive
+ // //
+ // // Applies a style recursively to all span and div tags including elementNode
+ // // and all of its children.
+ // //
+ // // element : the element to apply the style to
+ // // styleName : the name of the style property to set (eg. 'font-weight')
+ // // styleValue : the value of the style to set (eg. 'bold')
+ // //--------------------------------------------------------------------------
+ // function ApplyStyleRecursive(element, styleName, styleValue) {
+ // var nodeName = element.nodeName.toLowerCase();
+
+ // if (nodeName == 'div' || nodeName == 'span' || nodeName == 'p') {
+ // element.style[styleName] = styleValue;
+ // }
+
+ // for (var i = 0; i < element.childNodes.length; i++) {
+ // ApplyStyleRecursive(element.childNodes[i], styleName, styleValue);
+ // }
+ // }
+
+ // //---------------------------------------------------------------------------
+ // // ApplyTextProperty
+ // //
+ // // Applies a text property to rtfElement.
+ // //
+ // // rtfElement : the the root text element of the rtf object (this is the
+ // // element named _rtf
+ // // prop : the style property to set.
+ // // value : the style value to set.
+ // //---------------------------------------------------------------------------
+ // function ApplyTextProperty(rtfElement, prop, value) {
+ // /*
+ // var oldHtml = rtfElement.innerHTML;
+ // if (prop == 'fontWeight') {
+ // rtfElement.innerHTML = oldHtml.replace(/< *b *\/?>/gi, "");
+ // } else if (prop == 'fontStyle') {
+ // rtfElement.innerHTML = oldHtml.replace(/< *i *\/?>/gi, "");
+ // } else if (prop == 'textDecoration') {
+ // rtfElement.innerHTML = oldHtml.replace(/< *u *\/?>/gi, "");
+ // }
+ // */
+
+ // for (var i = 0; i < rtfElement.childNodes.length; i++) {
+ // ApplyStyleRecursive(rtfElement.childNodes[i], prop, value);
+ // }
+ // }
+ //}
+
+ //---------------------------------------------------------------------------
+ // GetAndCacheOriginalText
+ //
+ // Gets the html for the pre-rollover state and returns the Html representing
+ // the Rich text.
+ //---------------------------------------------------------------------------
+ var CACHE_COUNTER = 0;
+
+ $ax.style.CacheOriginalText = function(textId, hasRichTextBeenSet) {
+ var rtfQuery = $('#' + textId);
+ if(rtfQuery.length > 0) {
+
+ var styleCache = {};
+ rtfQuery.find('*').each(function(index, element) {
+ var elementId = element.id;
+ if(!elementId) element.id = elementId = 'cache' + CACHE_COUNTER++;
+ styleCache[elementId] = element.style.cssText;
+ });
+
+ _originalTextCache[textId] = {
+ styleCache: styleCache
+ };
+ if(hasRichTextBeenSet) {
+ var shapeId = $ax.GetShapeIdFromText(textId);
+ _shapesWithSetRichText[shapeId] = true;
+ }
+ }
+ };
+
+ $ax.style.ClearCacheForRepeater = function(repeaterId) {
+ for(var elementId in _originalTextCache) {
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ if($ax.getParentRepeaterFromScriptId(scriptId) == repeaterId) delete _originalTextCache[elementId];
+ }
+ };
+
+
+
+ $ax.style.prefetch = function() {
+ var scriptIds = $ax.getAllScriptIds();
+ var image = new Image();
+ for(var i = 0; i < scriptIds.length; i++) {
+ var obj = $obj(scriptIds[i]);
+ if (!$ax.public.fn.IsImageBox(obj.type)) continue;
+ var images = obj.images;
+ for (var key in images) image.src = images[key];
+
+ var imageOverrides = obj.imageOverrides;
+ for(var elementId in imageOverrides) {
+ var override = imageOverrides[elementId];
+ for (var state in override) {
+ _addImageOverride(elementId, state, override[state]);
+ image.src = override[state];
+ }
+ }
+ }
+ };
+});
+//***** adaptive.js *****//
+$axure.internal(function($ax) {
+ $ax.adaptive = {};
+
+ $axure.utils.makeBindable($ax.adaptive, ["viewChanged"]);
+
+ var _auto = true;
+ var _autoIsHandledBySidebar = false;
+
+ var _views;
+ var _idToView;
+ var _enabledViews = [];
+
+ var _initialViewToLoad;
+ var _initialViewSizeToLoad;
+
+ var _loadFinished = false;
+ $ax.adaptive.loadFinished = function() {
+ if(_loadFinished) return;
+ _loadFinished = true;
+ if($ax.adaptive.currentViewId) $ax.viewChangePageAndMasters();
+ else $ax.postAdaptiveViewChanged();
+ };
+
+ var _handleResize = function(forceSwitchTo) {
+ if(!_auto) return;
+ if(_auto && _autoIsHandledBySidebar && !forceSwitchTo) return;
+
+ var $window = $(window);
+ var height = $window.height();
+ var width = $window.width();
+
+ var toView = _getAdaptiveView(width, height);
+ var toViewId = toView && toView.id;
+
+ _switchView(toViewId, forceSwitchTo);
+ };
+
+ var _setAuto = $ax.adaptive.setAuto = function(val) {
+ if(_auto != val) {
+ _auto = Boolean(val);
+ }
+ };
+
+ var _setLineImage = function(id, imageUrl) {
+ var imageQuery = $jobj(id).attr('src', imageUrl);
+ if(imageUrl.indexOf(".png") > -1) $ax.utils.fixPng(imageQuery[0]);
+ };
+
+ var _switchView = function (viewId, forceSwitchTo) {
+ if(!$ax.pageData.isAdaptiveEnabled) return;
+
+ var previousViewId = $ax.adaptive.currentViewId;
+ if(typeof previousViewId == 'undefined') previousViewId = '';
+ if(typeof viewId == 'undefined') viewId = '';
+ if (viewId == previousViewId) {
+ if(forceSwitchTo) $ax.postAdaptiveViewChanged(forceSwitchTo);
+ return;
+ }
+
+ $ax('*').each(function(obj, elementId) {
+ if (!$ax.public.fn.IsTreeNodeObject(obj.type)) return;
+ if(!obj.hasOwnProperty('isExpanded')) return;
+
+ var query = $ax('#' + elementId);
+ var defaultExpanded = obj.isExpanded;
+
+ query.expanded(defaultExpanded);
+ });
+
+ // reset all the inline positioning from move and rotate actions including size and transformation
+ $axure('*').each(function (diagramObject, elementId) {
+ if(diagramObject.isContained) return;
+ if($ax.getParentRepeaterFromElementIdExcludeSelf(elementId)) return;
+
+ var element = document.getElementById(elementId);
+ if(element) {
+ var resetCss = {
+ top: "", left: "", width: "", height: "", opacity: "",
+ transform: "", webkitTransform: "", MozTransform: "", msTransform: "", OTransform: ""
+ };
+ var query = $(element);
+ query.css(resetCss);
+ var isPanel = $ax.public.fn.IsDynamicPanel(diagramObject.type);
+ if(!isPanel || diagramObject.fitToContent) { //keeps size on the panel states when switching adaptive views to optimize fit to panel
+ if(diagramObject.fitToContent) $ax.dynamicPanelManager.setFitToContentCss(elementId, true);
+ var children = query.children();
+ if(children.length) children.css(resetCss);
+ }
+
+ $ax.dynamicPanelManager.resetFixedPanel(diagramObject, element);
+ $ax.dynamicPanelManager.resetAdaptivePercentPanel(diagramObject, element);
+ }
+ });
+
+ $ax.adaptive.currentViewId = viewId; // we need to set this so the enabled and selected styles will apply properly
+ if(previousViewId) {
+ $ax.style.clearAdaptiveStyles();
+ $('*').removeClass(previousViewId);
+ } else {
+ $ax.style.reselectElements();
+ }
+
+ $axure('*').each(function (obj, elementId) {
+ if($ax.getParentRepeaterFromElementIdExcludeSelf(elementId)) return;
+
+ $ax.style.updateElementIdImageStyle(elementId); // When image override exists, fix styling/borders
+ });
+
+ // reset all the images only if we're going back to the default view
+ if(!viewId) {
+ _updateInputVisibility('', $axure('*'));
+ $axure('*').each(function (diagramObject, elementId) {
+ if($ax.getParentRepeaterFromElementIdExcludeSelf(elementId)) return;
+
+ $ax.placeholderManager.refreshPlaceholder(elementId);
+
+ var images = diagramObject.images;
+ if(diagramObject.type == 'horizontalLine' || diagramObject.type == 'verticalLine') {
+ var startImg = images['start~'];
+ _setLineImage(elementId + "_start", startImg);
+ var endImg = images['end~'];
+ _setLineImage(elementId + "_end", endImg);
+ var lineImg = images['line~'];
+ _setLineImage(elementId + "_line", lineImg);
+ } else if(diagramObject.type == $ax.constants.CONNECTOR_TYPE) {
+ _setAdaptiveConnectorImages(elementId, images, '');
+ } else if(images) {
+ if (diagramObject.generateCompound) {
+
+ if($ax.style.IsWidgetDisabled(elementId)) {
+ disabledImage = _getImageWithTag(images, 'disabled~');
+ if(disabledImage) $ax.style.applyImage(elementId, disabledImage, 'disabled');
+ return;
+ }
+ if($ax.style.IsWidgetSelected(elementId)) {
+ selectedImage = _getImageWithTag(images, 'selected~');
+ if(selectedImage) $ax.style.applyImage(elementId, selectedImage, 'selected');
+ return;
+ }
+ $ax.style.applyImage(elementId, _getImageWithTag(images, 'normal~'));
+ } else {
+ if ($ax.style.IsWidgetDisabled(elementId)) {
+ var disabledImage = $ax.style.getElementImageOverride(elementId, 'disabled') || images['disabled~'];
+ if (disabledImage) $ax.style.applyImage(elementId, disabledImage, 'disabled');
+ return;
+ }
+ if ($ax.style.IsWidgetSelected(elementId)) {
+ var selectedImage = $ax.style.getElementImageOverride(elementId, 'selected') || images['selected~'];
+ if (selectedImage) $ax.style.applyImage(elementId, selectedImage, 'selected');
+ return;
+ }
+ $ax.style.applyImage(elementId, $ax.style.getElementImageOverride(elementId, 'normal') || images['normal~']);
+ }
+ }
+
+ //align all text
+ var child = $jobj(elementId).children('.text');
+ if(child.length) $ax.style.transformTextWithVerticalAlignment(child[0].id, function() { });
+ });
+ // we have to reset visibility if we aren't applying a new view
+ $ax.visibility.resetLimboAndHiddenToDefaults();
+ $ax.repeater.refreshAllRepeaters();
+ $ax.dynamicPanelManager.updateParentsOfNonDefaultFitPanels();
+ $ax.dynamicPanelManager.updatePercentPanelCache($ax('*'));
+ } else {
+ $ax.visibility.clearLimboAndHidden();
+ _applyView(viewId);
+ $ax.repeater.refreshAllRepeaters();
+ $ax.dynamicPanelManager.updateParentsOfNonDefaultFitPanels();
+ }
+
+ $ax.adaptive.triggerEvent('viewChanged', {});
+ if(_loadFinished) $ax.viewChangePageAndMasters(forceSwitchTo);
+ };
+
+ var _getImageWithTag = function(image, tag) {
+ var flattened = {};
+ for (var component in image) {
+ var componentImage = image[component][tag];
+ if(componentImage) flattened[component] = componentImage;
+ }
+ return flattened;
+ }
+
+ // gets if input is hidden due to sketch
+ var BORDER_WIDTH = "borderWidth";
+ var COLOR_STYLE = "colorStyle";
+ var SKETCH_FACTOR = "sketchFactor";
+ var _areInputsHidden = function(viewId) {
+ var chain = _getAdaptiveIdChain(viewId);
+ var page = $ax.pageData.page;
+ var adaptiveStyles = page.adaptiveStyles;
+ // keep track of props that are not sketchy, as you continue to climb up your parents;
+ var notSketch = [];
+ for(var i = chain.length - 1; i >= -1; i--) {
+ var style = i == -1 ? page.style : adaptiveStyles[chain[i]];
+ if(notSketch.indexOf(BORDER_WIDTH) == -1 && style.hasOwnProperty(BORDER_WIDTH)) {
+ if(style[BORDER_WIDTH] != 0) return true;
+ notSketch.push(BORDER_WIDTH);
+ }
+ if(notSketch.indexOf(COLOR_STYLE) == -1 && style.hasOwnProperty(COLOR_STYLE)) {
+ if(style[COLOR_STYLE] != 'appliedColor') return true;
+ notSketch.push(COLOR_STYLE);
+ }
+ if(notSketch.indexOf(SKETCH_FACTOR) == -1 && style.hasOwnProperty(SKETCH_FACTOR)) {
+ if(style[SKETCH_FACTOR] != 0) return true;
+ notSketch.push(SKETCH_FACTOR);
+ }
+ }
+ return false;
+ };
+
+ var _updateInputVisibility = function(viewId, query) {
+ var func = _areInputsHidden(viewId) ? 'addClass' : 'removeClass';
+ query.each(function(obj, elementId) {
+ var input = $jobj($ax.repeater.applySuffixToElementId(elementId, '_input'));
+ if(input.length == 0) return;
+ input[func]('form_sketch');
+ });
+ };
+
+ // gets the inheritance chain of a particular view.
+ var _getAdaptiveIdChain = $ax.adaptive.getAdaptiveIdChain = function(viewId) {
+ if(!viewId) return [];
+ var view = _idToView[viewId];
+ var chain = [];
+ var current = view;
+ while(current) {
+ chain[chain.length] = current.id;
+ current = _idToView[current.baseViewId];
+ }
+ return chain.reverse();
+ };
+
+ var _getPageStyle = $ax.adaptive.getPageStyle = function() {
+ var currentViewId = $ax.adaptive.currentViewId;
+ var adaptiveChain = _getAdaptiveIdChain(currentViewId);
+
+ var currentStyle = $.extend({}, $ax.pageData.page.style);
+ for(var i = 0; i < adaptiveChain.length; i++) {
+ var viewId = adaptiveChain[i];
+ $.extend(currentStyle, $ax.pageData.page.adaptiveStyles[viewId]);
+ }
+
+ return currentStyle;
+ };
+
+ var _setAdaptiveLineImages = function(elementId, images, viewIdChain) {
+ for(var i = viewIdChain.length - 1; i >= 0; i--) {
+ var viewId = viewIdChain[i];
+ var startImg = images['start~' + viewId];
+ if(startImg) {
+ _setLineImage(elementId + "_start", startImg);
+ var endImg = images['end~' + viewId];
+ _setLineImage(elementId + "_end", endImg);
+ var lineImg = images['line~' + viewId];
+ _setLineImage(elementId + "_line", lineImg);
+ break;
+ }
+ }
+ };
+
+ var _setAdaptiveConnectorImages = function (elementId, images, view) {
+ var conn = $jobj(elementId);
+ var count = conn.children().length-1; // -1 for rich text panel
+ for(var i = 0; i < count; i++) {
+ var img = images['' + i + '~' + view];
+ $jobj(elementId + '_seg' + i).attr('src', img);
+ }
+ };
+
+ var _applyView = $ax.adaptive.applyView = function(viewId, query) {
+ var limboIds = {};
+ var hiddenIds = {};
+
+ var jquery;
+ if(query) {
+ jquery = query.jQuery();
+ jquery = jquery.add(jquery.find('*'));
+ var jqueryAnn = $ax.annotation.jQueryAnn(query);
+ jquery = jquery.add(jqueryAnn);
+ } else {
+ jquery = $('*');
+ query = $ax('*');
+ }
+ jquery.addClass(viewId);
+ _updateInputVisibility(viewId, query);
+ var viewIdChain = _getAdaptiveIdChain(viewId);
+ // this could be made more efficient by computing it only once per object
+ query.each(function(diagramObject, elementId) {
+ _applyAdaptiveViewOnObject(diagramObject, elementId, viewIdChain, viewId, limboIds, hiddenIds);
+ });
+
+ $ax.visibility.addLimboAndHiddenIds(limboIds, hiddenIds, query);
+ //$ax.dynamicPanelManager.updateAllFitPanelsAndLayerSizeCaches();
+ $ax.dynamicPanelManager.updatePercentPanelCache(query);
+ };
+
+ var _applyAdaptiveViewOnObject = function(diagramObject, elementId, viewIdChain, viewId, limboIds, hiddenIds) {
+ var adaptiveChain = [];
+ for(var i = 0; i < viewIdChain.length; i++) {
+ var viewId = viewIdChain[i];
+ var viewStyle = diagramObject.adaptiveStyles[viewId];
+ if(viewStyle) {
+ adaptiveChain[adaptiveChain.length] = viewStyle;
+ if (viewStyle.size) $ax.public.fn.convertToSingleImage($jobj(elementId));
+ }
+ }
+
+ var state = $ax.style.generateState(elementId);
+
+ // set the image
+ var images = diagramObject.images;
+ if(images) {
+ if(diagramObject.type == 'horizontalLine' || diagramObject.type == 'verticalLine') {
+ _setAdaptiveLineImages(elementId, images, viewIdChain);
+ } else if (diagramObject.type == $ax.constants.CONNECTOR_TYPE) {
+ _setAdaptiveConnectorImages(elementId, images, viewId);
+ } else if (diagramObject.generateCompound) {
+ var compoundUrl = _matchImageCompound(diagramObject, elementId, viewIdChain, state);
+ if (compoundUrl) $ax.style.applyImage(elementId, compoundUrl, state);
+ }else {
+ var imgUrl = _matchImage(elementId, images, viewIdChain, state);
+ if(imgUrl) $ax.style.applyImage(elementId, imgUrl, state);
+ }
+ // for(var i = viewIdChain.length - 1; i >= 0; i--) {
+ // var viewId = viewIdChain[i];
+ // var imgUrl = $ax.style.getElementImageOverride(elementId, state) || images[state + '~' + viewId] || images['normal~' + viewId];
+ // if(imgUrl) {
+ // $ax.style.applyImage(elementId, imgUrl, state);
+ // break;
+ // }
+ // }
+
+ // }
+ }
+ // addaptive override style (not including default style props)
+ var adaptiveStyle = $ax.style.computeAllOverrides(elementId, undefined, state, viewId);
+
+ // this style INCLUDES the object's my style
+ var compoundStyle = $.extend({}, diagramObject.style, adaptiveStyle);
+
+ //$ax.style.setAdaptiveStyle(elementId, adaptiveStyle);
+ if(!diagramObject.isContained) {
+ $ax.style.setAdaptiveStyle(elementId, adaptiveStyle);
+ }
+
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ if(compoundStyle.limbo && !diagramObject.isContained) limboIds[scriptId] = true;
+ // sigh, javascript. we need the === here because undefined means not overriden
+ if(compoundStyle.visible === false) hiddenIds[scriptId] = true;
+ };
+
+ var _matchImage = function(id, images, viewIdChain, state) {
+ var override = $ax.style.getElementImageOverride(id, state);
+ if(override) return override;
+
+ if(!images) return undefined;
+
+ // first check all the images for this state
+ for(var i = viewIdChain.length - 1; i >= 0; i--) {
+ var viewId = viewIdChain[i];
+ var img = images[state + "~" + viewId];
+ if(img) return img;
+ }
+ // check for the default state style
+ var defaultStateImage = images[state + '~'];
+ if(defaultStateImage) return defaultStateImage;
+
+ state = $ax.style.progessState(state);
+ if(state) return _matchImage(id, images, viewIdChain, state);
+
+ // SHOULD NOT REACH HERE! NORMAL SHOULD ALWAYS CATCH AT THE DEFAULT!
+ return images['normal~']; // this is the default
+ };
+
+ var _matchImageCompound = function(diagramObject, id, viewIdChain, state) {
+ var images = [];
+ for(var i = 0; i < diagramObject.compoundChildren.length; i++) {
+ var component = diagramObject.compoundChildren[i];
+ images[component] = _matchImage(id, diagramObject.images[component], viewIdChain, state);
+ }
+ return images;
+ };
+
+
+
+ $ax.adaptive.getImageForStateAndView = function(id, state) {
+ var viewIdChain = _getAdaptiveIdChain($ax.adaptive.currentViewId);
+ var diagramObject = $ax.getObjectFromElementId(id);
+ if (diagramObject.generateCompound) return _matchImageCompound(diagramObject, id, viewIdChain, state);
+ else return _matchImage(id, diagramObject.images, viewIdChain, state);
+ };
+
+ var _getAdaptiveView = function(winWidth, winHeight) {
+ var _isViewOneGreaterThanTwo = function(view1, view2) {
+ return view1.size.width > view2.size.width || (view1.size.width == view2.size.width && view1.size.height > view2.size.height);
+ };
+
+ var _isViewOneLessThanTwo = function(view1, view2) {
+ var width2 = view2.size.width || 1000000; // artificially large number
+ var height2 = view2.size.height || 1000000;
+
+ var width1 = view1.size.width || 1000000;
+ var height1 = view1.size.height || 1000000;
+
+ return width1 < width2 || (width1 == width2 && height1 < height2);
+ };
+
+ var _isWindowGreaterThanView = function(view, width, height) {
+ return width >= view.size.width && height >= view.size.height;
+ };
+
+ var _isWindowLessThanView = function(view1, width, height) {
+ var viewWidth = view1.size.width || 1000000;
+ var viewHeight = view1.size.height || 1000000;
+
+ return width <= viewWidth && height <= viewHeight;
+ };
+
+ var greater = undefined;
+ var less = undefined;
+
+ for(var i = 0; i < _enabledViews.length; i++) {
+ var view = _enabledViews[i];
+ if(view.condition == ">=") {
+ if(_isWindowGreaterThanView(view, winWidth, winHeight)) {
+ if(!greater || _isViewOneGreaterThanTwo(view, greater)) greater = view;
+ }
+ } else {
+ if(_isWindowLessThanView(view, winWidth, winHeight)) {
+ if(!less || _isViewOneLessThanTwo(view, less)) less = view;
+ }
+ }
+ }
+ return less || greater;
+ };
+
+ var _isAdaptiveInitialized = function() {
+ return typeof _idToView != 'undefined';
+ };
+
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ //If the adaptive plugin hasn't been initialized yet then
+ //save the view to load so that it can get set when initialize occurs
+ if(message == 'switchAdaptiveView') {
+ var href = window.location.href.split('#')[0];
+ var lastSlash = href.lastIndexOf('/');
+ href = href.substring(lastSlash + 1);
+ if(href != data.src) return;
+
+ var view = data.view == 'auto' ? undefined : (data.view == 'default' ? '' : data.view);
+
+ if(!_isAdaptiveInitialized()) {
+ _initialViewToLoad = view;
+ } else _handleLoadViewId(view);
+ } else if(message == 'setAdaptiveViewForSize') {
+ _autoIsHandledBySidebar = true;
+ if(!_isAdaptiveInitialized()) {
+ _initialViewSizeToLoad = data;
+ } else _handleSetViewForSize(data.width, data.height);
+ }
+ });
+
+ $ax.adaptive.setAdaptiveView = function(view) {
+ var viewIdForSitemapToUnderstand = view == 'auto' ? undefined : (view == 'default' ? '' : view);
+
+ if(!_isAdaptiveInitialized()) {
+ _initialViewToLoad = viewIdForSitemapToUnderstand;
+ } else _handleLoadViewId(viewIdForSitemapToUnderstand);
+ };
+
+ $ax.adaptive.initialize = function() {
+ _views = $ax.document.adaptiveViews;
+ _idToView = {};
+
+ if(_views && _views.length > 0) {
+ for(var i = 0; i < _views.length; i++) {
+ var view = _views[i];
+ _idToView[view.id] = view;
+ }
+
+ var enabledViewIds = $ax.document.configuration.enabledViewIds;
+ for(var i = 0; i < enabledViewIds.length; i++) {
+ _enabledViews[_enabledViews.length] = _idToView[enabledViewIds[i]];
+ }
+
+ if(_autoIsHandledBySidebar && _initialViewSizeToLoad) _handleSetViewForSize(_initialViewSizeToLoad.width, _initialViewSizeToLoad.height);
+ else _handleLoadViewId(_initialViewToLoad);
+ }
+
+ $axure.resize(function(e) {
+ _handleResize();
+ $ax.postResize(e); //window resize fires after view changed
+ });
+ };
+
+ var _handleLoadViewId = function (loadViewId, forceSwitchTo) {
+ if(typeof loadViewId != 'undefined') {
+ _setAuto(false);
+ _switchView(loadViewId != 'default' ? loadViewId : '', forceSwitchTo);
+ } else {
+ _setAuto(true);
+ _handleResize(forceSwitchTo);
+ }
+ };
+
+ var _handleSetViewForSize = function (width, height) {
+ if(!_auto) return;
+
+ var toView = _getAdaptiveView(width, height);
+ var toViewId = toView && toView.id;
+ _switchView(toViewId);
+ };
+
+ $ax.adaptive.getSketchKey = function() {
+ return $ax.pageData.sketchKeys[$ax.adaptive.currentViewId || ''];
+ }
+});
+//***** tree.js *****//
+// This is actually for BOTH trees and menus
+$axure.internal(function($ax) {
+ var _tree = $ax.tree = {};
+ var _menu = $ax.menu = {};
+
+ $ax.menu.InitializeSubmenu = function(subMenuId, cellId) {
+ var $submenudiv = $('#' + subMenuId);
+
+ //mouseenter and leave for parent table cell
+ $('#' + cellId).mouseenter(function(e) {
+ //show current submenu
+// var submenuElement = document.getElementById(subMenuId);
+// if($ax.visibility.IsVisible(submenuElement) && submenuElement.style.display !== 'none') return;
+ $ax.visibility.SetIdVisible(subMenuId, true);
+ $ax.legacy.BringToFront(subMenuId);
+ $submenudiv.find('.menu_item').each(function() {
+ $ax.style.updateTextAlignmentForVisibility($ax.GetTextPanelId($(this).attr('id')));
+ });
+ _fireEventForSubmenu(subMenuId, "onShow");
+
+ }).mouseleave(function (e) {
+ var offset = $submenudiv.offset();
+ var subcontwidth = $submenudiv.width();
+ var subcontheight = $submenudiv.height();
+ //If mouse is not within the submenu (added 3 pixel margin to top and left calculations), then close the submenu...
+ if(e.pageX + 3 < offset.left || e.pageX > offset.left + subcontwidth || e.pageY + 3 < offset.top || e.pageY > offset.top + subcontheight) {
+ $submenudiv.find('.sub_menu').andSelf().each(function () {
+// if(!$ax.visibility.IsVisible(this)) return;
+ $ax.visibility.SetVisible(this, false);
+ _fireEventForSubmenu(subMenuId, "onHide");
+ });
+ $ax.style.SetWidgetHover(cellId, false);
+ }
+ });
+
+ $submenudiv.css('display', 'none');
+
+ //mouseleave for submenu
+ $submenudiv.mouseleave(function(e) {
+ //close this menu and all menus below it
+ $(this).find('.sub_menu').andSelf().css({ 'visibility': 'hidden', 'display': 'none' }).each(function () {
+// if(!$ax.visibility.IsVisible(this)) return;
+ _fireEventForSubmenu(this.id, "onHide");
+ });
+ $ax.style.SetWidgetHover(cellId, false);
+ });
+ };
+
+ var _fireEventForSubmenu = function(targetId, eventName) {
+ var diagramObject = $ax.getObjectFromElementId(targetId);
+ var event = diagramObject.interactionMap && diagramObject.interactionMap[eventName];
+ if(event) {
+ var eventInfo = $ax.getEventInfoFromEvent($ax.getjBrowserEvent(), false, targetId);
+ $ax.event.handleEvent(targetId, eventInfo, event, false, true);
+ }
+ }
+
+ function IsNodeVisible(nodeId) {
+ var current = window.document.getElementById(nodeId);
+ var parent = current.parentNode;
+
+ //move all the parent's children that are below the node and their annotations
+ while(!$(current).hasClass("treeroot")) {
+ if(!$ax.visibility.IsVisible(parent)) return false;
+ current = parent;
+ parent = parent.parentNode;
+ }
+ return true;
+ }
+
+ $ax.tree.ExpandNode = function(nodeId, childContainerId, plusMinusId) {
+ var container = window.document.getElementById(childContainerId);
+ if(!container || $ax.visibility.IsVisible(container)) return;
+ $ax.visibility.SetVisible(container, true);
+
+ if(plusMinusId != '') $ax.style.SetWidgetSelected(plusMinusId, true);
+
+ var delta = _getExpandCollapseDelta(nodeId, childContainerId);
+
+ var isVisible = IsNodeVisible(nodeId);
+ var current = window.document.getElementById(nodeId);
+ var parent = current.parentNode;
+
+ //move all the parent's children that are below the node and their annotations
+ while(!$(current).hasClass("treeroot")) {
+ var after = false;
+ var i = 0;
+ for(i = 0; i < parent.childNodes.length; i++) {
+ var child = parent.childNodes[i];
+ if(after && child.id && $(child).hasClass("treenode")) {
+ var elementId = child.id;
+ child.style.top = Number($(child).css('top').replace("px", "")) + delta + 'px';
+ var ann = window.document.getElementById(elementId + "_ann");
+ if(ann) ann.style.top = Number($(ann).css('top').replace("px", "")) + delta + 'px';
+ }
+ if(child == current) after = true;
+ }
+ current = parent;
+ parent = parent.parentNode;
+ if(!isVisible && $ax.visibility.IsVisible(parent)) break;
+ }
+ };
+
+ $ax.tree.CollapseNode = function(nodeId, childContainerId, plusMinusId) {
+ var container = window.document.getElementById(childContainerId);
+ if(!container || !$ax.visibility.IsVisible(container)) return;
+
+ if(plusMinusId != '') $ax.style.SetWidgetSelected(plusMinusId, false);
+
+ var delta = _getExpandCollapseDelta(nodeId, childContainerId);
+
+ //hide it after getting the delta, otherwise the delta can't be calculated (offsetParent is null)
+ $ax.visibility.SetVisible(container, false);
+
+ var isVisible = IsNodeVisible(nodeId);
+ var current = window.document.getElementById(nodeId);
+ var parent = current.parentNode;
+
+ //move all the parent's children that are below the node and their annotations
+ while(!$(current).hasClass("treeroot")) {
+ var after = false;
+ var i = 0;
+ for(i = 0; i < parent.childNodes.length; i++) {
+ var child = parent.childNodes[i];
+ if(after && child.id && $(child).hasClass("treenode")) {
+ var elementId = child.id;
+ child.style.top = Number($(child).css('top').replace("px", "")) - delta + 'px';
+ var ann = window.document.getElementById(elementId + "_ann");
+ if(ann) ann.style.top = Number($(ann).css('top').replace("px", "")) - delta + 'px';
+ }
+ if(child == current) after = true;
+ }
+ current = parent;
+ parent = current.parentNode;
+ if(!isVisible && $ax.visibility.IsVisible(parent)) break;
+ }
+ };
+
+ var _getExpandCollapseDelta = function(nodeId, childContainerId) {
+ return _getChildContainerHeightHelper(childContainerId);
+ };
+
+ var _getChildContainerHeightHelper = function(childContainerId) {
+ var height = 0;
+ $('#' + childContainerId).children().each(function() {
+ if($(this).hasClass("treenode")) {
+ height += $(this).height();
+ var subContainer = window.document.getElementById(this.id + '_children');
+ if(subContainer && $ax.visibility.IsVisible(subContainer)) {
+ height += _getChildContainerHeightHelper(subContainer.id);
+ }
+ }
+ });
+ return height;
+ };
+
+ $ax.tree.InitializeTreeNode = function(nodeId, plusminusid, childContainerId, selectText) {
+ var childContainer = window.document.getElementById(childContainerId);
+ if(childContainer) {
+ //relying on the html generator to put this inline so we know to collapse by default
+ var isCollapsed = childContainer.style.visibility == "hidden";
+ if(isCollapsed) $ax.visibility.SetVisible(childContainer, false);
+
+ if(!isCollapsed && plusminusid != '') $ax.style.SetWidgetSelected(plusminusid, true);
+ }
+
+ if(plusminusid != '') {
+ $jobj(plusminusid).click(function() {
+ var visibleSet = $ax.visibility.IsIdVisible(childContainerId);
+
+ if(visibleSet) $ax.tree.CollapseNode(nodeId, childContainerId, plusminusid);
+ else $ax.tree.ExpandNode(nodeId, childContainerId, plusminusid);
+ $ax.tree.SelectTreeNode(nodeId, true);
+
+ return false;
+ }).css('cursor', 'default');
+ }
+ };
+
+ var _getButtonShapeId = function(id) {
+ var obj = $obj(id);
+ return $ax.public.fn.IsTreeNodeObject(obj.type) ? $ax.getElementIdFromPath([obj.buttonShapeId], { relativeTo: id }) : id;
+ };
+
+ $ax.tree.SelectTreeNode = function(id, selected) {
+ $ax.style.SetWidgetSelected(_getButtonShapeId(id), selected);
+ };
+
+});
+//***** init.temp.js *****//
+$axure.internal(function($ax) {
+
+ $(window.document).ready(function() {
+ var readyStart = (new Date()).getTime();
+
+ //this is because the page id is not formatted as a guid
+ var pageId = $ax.pageData.page.packageId;
+
+ var pageData = {
+ id: pageId,
+ pageName: $ax.pageData.page.name,
+ location: window.location.toString(),
+ notes: $ax.pageData.page.notes
+ };
+
+ var anns = [];
+ $ax('*').each(function (dObj, elementId) {
+ pushAnnotation(dObj, elementId);
+ });
+
+ function pushAnnotation(dObj, elementId) {
+ var ann = dObj.annotation;
+ if(ann) {
+ ann = $ax.deepCopy(ann);
+ ann["id"] = elementId;
+ ann["label"] = dObj.label + " (" + dObj.friendlyType + ")";
+ anns.push(ann);
+ }
+
+ if(dObj.type === 'repeater' && dObj.objects) {
+ //if it's repeater, save the id as repeaterId@scriptId
+ for(var i = 0, len = dObj.objects.length; i < len; i++) {
+ var child = dObj.objects[i];
+ var scriptId = $ax.getScriptIdFromPath([child.id], elementId);
+ pushAnnotation(child, elementId + '@' + scriptId);
+ }
+ }
+ }
+
+ pageData.widgetNotes = anns;
+
+ //only trigger the page.data setting if the window is on the mainframe
+ var isMainFrame = false;
+ try {
+ if(window.name == 'mainFrame' ||
+ (!CHROME_5_LOCAL && window.parent.$ && window.parent.$('#mainFrame').length > 0)) {
+ isMainFrame = true;
+
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ if(message == 'finishInit') {
+ _processTempInit();
+ }
+ });
+
+ $axure.messageCenter.setState('page.data', pageData);
+ window.focus();
+ }
+ } catch(e) { }
+
+ //attach here for chrome local
+ $(window).load(function() {
+ $ax.style.initializeObjectTextAlignment($ax('*'));
+ });
+
+ if(!isMainFrame) _processTempInit();
+ });
+
+
+ var _processTempInit = function() {
+ //var start = (new Date()).getTime();
+ //var end = (new Date()).getTime();
+ //window.alert('elapsed ' + (end - start));
+
+ $('iframe').each(function() {
+ var origSrc = $(this).attr('basesrc');
+
+ var $this = $(this);
+ if(origSrc) {
+ var newSrcUrl = origSrc.toLowerCase().indexOf('http://') == -1 ? $ax.globalVariableProvider.getLinkUrl(origSrc) : origSrc;
+ $this.attr('src', newSrcUrl);
+ }
+
+ if(IOS) {
+ $this.parent().css('overflow', 'auto').css('-webkit-overflow-scrolling', 'touch').css('-ms-overflow-x', 'hidden').css('overflow-x', 'hidden');
+ }
+ });
+
+ $axure.messageCenter.addMessageListener(function(message, data) {
+ if(message == 'setGlobalVar') {
+ $ax.globalVariableProvider.setVariableValue(data.globalVarName, data.globalVarValue, true);
+ }
+ });
+
+ window.lastFocusedClickable = null;
+ var _lastFocusedClickableSelector = 'input, a';
+ var shouldOutline = true;
+
+ $ax(function (dObj) { return dObj.tabbable; }).each(function (dObj, elementId) {
+ if ($ax.public.fn.IsLayer(dObj.type)) $ax.event.layerMapFocus(dObj, elementId);
+ var focusableId = $ax.event.getFocusableWidgetOrChildId(elementId);
+ var $focusable = $('#' + focusableId);
+ $focusable.attr("tabIndex", 0);
+ if($focusable.is('div') || $focusable.is('img')) {
+ $focusable.bind($ax.features.eventNames.mouseDownName, function() {
+ shouldOutline = false;
+ });
+ attachFocusAndBlur($focusable);
+ }
+ });
+
+ $(window.document).bind($ax.features.eventNames.mouseUpName, function() {
+ shouldOutline = true;
+ });
+
+ attachFocusAndBlur($(_lastFocusedClickableSelector));
+
+ function attachFocusAndBlur($query) {
+ $query.focus(function () {
+ if(shouldOutline) {
+ $(this).css('outline', '');
+ } else {
+ $(this).css('outline', 'none');
+ }
+ window.lastFocusedClickable = this;
+ }).blur(function () {
+ if(window.lastFocusedClickable == this) window.lastFocusedClickable = null;
+ });
+ }
+
+ $(window.document).bind('keyup', function(e) {
+ if(e.keyCode == '13' || e.keyCode == '32') {
+ if(window.lastFocusedClickable) $(window.lastFocusedClickable).click();
+ }
+ });
+
+ if($ax.document.configuration.hideAddress) {
+ $(window).load(function() {
+ window.setTimeout(function() {
+ window.scrollTo(0, 0.9);
+ }, 0);
+ });
+ }
+
+ if($ax.document.configuration.preventScroll) {
+ $(window.document).bind('touchmove', function(e) {
+ var inScrollable = $ax.legacy.GetScrollable(e.target) != window.document.body;
+ if(!inScrollable) {
+ e.preventDefault();
+ }
+ });
+
+ $ax(function(diagramObject) {
+ return $ax.public.fn.IsDynamicPanel(diagramObject.type) && diagramObject.scrollbars != 'none';
+ }).$().children().bind('touchstart', function() {
+ var target = this;
+ var top = target.scrollTop;
+ if(top <= 0) target.scrollTop = 1;
+ if(top + target.offsetHeight >= target.scrollHeight) target.scrollTop = target.scrollHeight - target.offsetHeight - 1;
+ });
+ }
+
+ if(OS_MAC && WEBKIT) {
+ $ax(function(diagramObject) {
+ return $ax.public.fn.IsComboBox(diagramObject.type);
+ }).each(function(obj, id) {
+ $jobj($ax.INPUT(id)).css('-webkit-appearance', 'menulist-button');
+ });
+ }
+
+ $ax.legacy.BringFixedToFront();
+ $ax.event.initialize();
+ $ax.style.initialize();
+ $ax.visibility.initialize();
+ $ax.repeater.initialize();
+ $ax.dynamicPanelManager.initialize(); //needs to be called after visibility is initialized
+ $ax.adaptive.initialize();
+ $ax.loadDynamicPanelsAndMasters();
+ $ax.adaptive.loadFinished();
+ var start = (new Date()).getTime();
+ $ax.repeater.initRefresh();
+ var end = (new Date()).getTime();
+ console.log('loadTime: ' + (end - start) / 1000);
+ $ax.style.prefetch();
+
+ $(window).resize();
+
+ //var readyEnd = (new Date()).getTime();
+ //window.alert('elapsed ' + (readyEnd - readyStart));
+ };
+});
+
+/* extend canvas */
+var gv_hasCanvas = false;
+(function() {
+ var _canvas = document.createElement('canvas'), proto, abbrev;
+ if(gv_hasCanvas = !!(_canvas.getContext && _canvas.getContext('2d')) && typeof (CanvasGradient) !== 'undefined') {
+ function chain(func) {
+ return function() {
+ return func.apply(this, arguments) || this;
+ };
+ }
+
+ with(proto = CanvasRenderingContext2D.prototype) for(var func in abbrev = {
+ a: arc,
+ b: beginPath,
+ n: clearRect,
+ c: clip,
+ p: closePath,
+ g: createLinearGradient,
+ f: fill,
+ j: fillRect,
+ z: function(s) { this.fillStyle = s; },
+ l: lineTo,
+ w: function(w) { this.lineWidth = w; },
+ m: moveTo,
+ q: quadraticCurveTo,
+ h: rect,
+ r: restore,
+ o: rotate,
+ s: save,
+ x: scale,
+ y: function(s) { this.strokeStyle = s; },
+ u: setTransform,
+ k: stroke,
+ i: strokeRect,
+ t: translate
+ }) proto[func] = chain(abbrev[func]);
+ CanvasGradient.prototype.a = chain(CanvasGradient.prototype.addColorStop);
+ }
+})();
+
+//***** legacy.js *****//
+//stored on each browser event
+var windowEvent;
+
+$axure.internal(function($ax) {
+ var _legacy = {};
+ $ax.legacy = _legacy;
+
+
+ // ************************** GLOBAL VARS *********************************//
+
+ // ************************************************************************//
+ //Check if IE
+ //var bIE = false;
+ //if ((index = navigator.userAgent.indexOf("MSIE")) >= 0) {
+ // bIE = true;
+ //}
+
+ var Forms = window.document.getElementsByTagName("FORM");
+ for(var i = 0; i < Forms.length; i++) {
+ var Form = Forms[i];
+ Form.onclick = $ax.legacy.SuppressBubble;
+ }
+
+ $ax.legacy.SuppressBubble = function(event) {
+ if(IE_10_AND_BELOW) {
+ window.event.cancelBubble = true;
+ window.event.returnValue = false;
+ } else {
+ if(event) {
+ event.stopPropagation();
+ }
+ }
+ };
+
+ // function InsertAfterBegin(dom, html) {
+ // if(!IE) {
+ // var phtml;
+ // var range = dom.ownerDocument.createRange();
+ // range.selectNodeContents(dom);
+ // range.collapse(true);
+ // phtml = range.createContextualFragment(html);
+ // dom.insertBefore(phtml, dom.firstChild);
+ // } else {
+ // dom.insertAdjacentHTML("afterBegin", html);
+ // }
+ // }
+
+ // function InsertBeforeEnd(dom, html) {
+ // if(!IE) {
+ // var phtml;
+ // var range = dom.ownerDocument.createRange();
+ // range.selectNodeContents(dom);
+ // range.collapse(dom);
+ // phtml = range.createContextualFragment(html);
+ // dom.appendChild(phtml);
+ // } else {
+ // dom.insertAdjacentHTML("beforeEnd", html);
+ // }
+ // }
+
+ //Get the id of the Workflow Dialog belonging to element with id = id
+
+ // function Workflow(id) {
+ // return id + 'WF';
+ // }
+
+ $ax.legacy.BringToFront = function(id, skipFixed) {
+ _bringToFrontHelper(id);
+ if(!skipFixed) $ax.legacy.BringFixedToFront();
+ };
+
+ var _bringToFrontHelper = function(id) {
+ var target = window.document.getElementById(id);
+ if(target == null) return;
+ $ax.globals.MaxZIndex = $ax.globals.MaxZIndex + 1;
+ target.style.zIndex = $ax.globals.MaxZIndex;
+ };
+
+ $ax.legacy.BringFixedToFront = function() {
+ $ax(function(diagramObject) { return diagramObject.fixedKeepInFront; }).each(function(diagramObject, scriptId) {
+ _bringToFrontHelper(scriptId);
+ });
+ };
+
+ $ax.legacy.SendToBack = function(id) {
+ var target = window.document.getElementById(id);
+ if(target == null) return;
+ target.style.zIndex = $ax.globals.MinZIndex = $ax.globals.MinZIndex - 1;
+ };
+
+ $ax.legacy.RefreshScreen = function() {
+ var oldColor = window.document.body.style.backgroundColor;
+ var setColor = (oldColor == "rgb(0,0,0)") ? "#FFFFFF" : "#000000";
+ window.document.body.style.backgroundColor = setColor;
+ window.document.body.style.backgroundColor = oldColor;
+ };
+
+ $ax.legacy.getAbsoluteLeft = function(currentNode, elementId) {
+ var oldDisplay = currentNode.css('display');
+ var displaySet = false;
+ if(oldDisplay == 'none') {
+ currentNode.css('display', '');
+ displaySet = true;
+ }
+ var left = currentNode.offset().left;
+
+ // Special Layer code
+ if($ax.getTypeFromElementId(elementId) == 'layer') {
+ var first = true;
+ var children = currentNode.children();
+ for(var i = 0; i < children.length; i++) {
+ var child = $(children[i]);
+ var subDisplaySet = false;
+ if(child.css('display') == 'none') {
+ child.css('display', '');
+ subDisplaySet = true;
+ }
+ if(first) left = child.offset().left;
+ else left = Math.min(child.offset().left, left);
+ first = false;
+
+ if(subDisplaySet) child.css('display', 'none');
+ }
+ }
+
+ if (displaySet) currentNode.css('display', oldDisplay);
+
+ return $axure.fn.bodyToWorld(left, true);
+ };
+
+ $ax.legacy.getAbsoluteTop = function(currentNode, elementId) {
+ var oldDisplay = currentNode.css('display');
+ var displaySet = false;
+ if(oldDisplay == 'none') {
+ currentNode.css('display', '');
+ displaySet = true;
+ }
+ var top = currentNode.offset().top;
+
+ // Special Layer code
+ if ($ax.getTypeFromElementId(elementId) == 'layer') {
+ var first = true;
+ var children = currentNode.children();
+ for (var i = 0; i < children.length; i++) {
+ var child = $(children[i]);
+ var subDisplaySet = false;
+ if (child.css('display') == 'none') {
+ child.css('display', '');
+ subDisplaySet = true;
+ }
+ if (first) top = child.offset().top;
+ else top = Math.min(child.offset().top, top);
+ first = false;
+
+ if (subDisplaySet) child.css('display', 'none');
+ }
+ }
+
+ if(displaySet) currentNode.css('display', oldDisplay);
+ return top;
+ };
+
+ // ****************** Annotation and Link Functions ****************** //
+
+ $ax.legacy.GetAnnotationHtml = function(annJson) {
+ var retVal = "";
+ for(var noteName in annJson) {
+ if(noteName != "label" && noteName != "id") {
+ retVal += "" + noteName + "
";
+ retVal += "" + linkify(annJson[noteName]) + "
";
+ }
+ }
+ return retVal;
+
+ function linkify(text) {
+ var urlRegex = /(\b(((https?|ftp|file):\/\/)|(www\.))[-A-Z0-9+&@#\/%?=~_|!:,.;]*[-A-Z0-9+&@#\/%=~_|])/ig;
+ return text.replace(urlRegex, function (url, b, c) {
+ var url2 = (c == 'www.') ? 'http://' + url : url;
+ return '' + url + ' ';
+ });
+ }
+ };
+
+
+ $ax.legacy.GetScrollable = function(target) {
+ var $target = $(target);
+ var last = $target;
+ // Start past inital target. Can't scroll to target in itself, must be some ancestor.
+ var current = last.parent();
+
+ while(!current.is('body') && !current.is('html')) {
+ var elementId = current.attr('id');
+ var diagramObject = elementId && $ax.getObjectFromElementId(elementId);
+ if(diagramObject && $ax.public.fn.IsDynamicPanel(diagramObject.type) && diagramObject.scrollbars != 'none') {
+ //returns the panel diagram div which handles scrolling
+ return $ax.dynamicPanelManager.getShownState(current.attr('id'))[0];
+ }
+ last = current;
+ current = current.parent();
+ }
+ // Need to do this because of ie
+ if(IE_10_AND_BELOW) return window.document.documentElement;
+ else return window.document.body;
+ };
+
+
+
+});
+//***** viewer.js *****//
+// ******* SITEMAP TOOLBAR VIEWER ACTIONS ******** //
+$axure.internal(function ($ax) {
+ var userTriggeredEventNames = ['onClick', 'onDoubleClick', 'onMouseOver', 'onMouseMove', 'onMouseOut', 'onMouseDown', 'onMouseUp',
+ 'onKeyDown', 'onKeyUp', 'onFocus', 'onLostFocus', 'onTextChange', 'onSelectionChange', 'onSelectedChange', 'onSelect', 'onUnselect',
+ 'onSwipeLeft', 'onSwipeRight', 'onSwipeUp', 'onSwipeDown', 'onDragStart', 'onDrag', 'onDragDrop', 'onScroll', 'onContextMenu', 'onMouseHover', 'onLongClick'];
+
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ //If annotation toggle message received from sitemap, toggle footnotes
+ if(message == 'annotationToggle') {
+ if(data == true) {
+ $('div.annotation').show();
+ $('div.annnotelabel').show();
+ $('div.annnoteimage').show();
+ } else {
+ $('div.annotation').hide();
+ $('div.annnotelabel').hide();
+ $('div.annnoteimage').hide();
+ }
+ }
+ });
+
+ var _toggleSelectWidgetNoteForRepeater = function (repeaterId, scriptId, select) {
+ var itemIds = $ax.getItemIdsForRepeater(repeaterId);
+
+ for(var i = 0; i < itemIds.length; i++) {
+ var itemId = itemIds[i];
+ var elementId = $ax.repeater.createElementId(scriptId, itemId);
+ if(select) $('#' + elementId).addClass('widgetNoteSelected');
+ else $('#' + elementId).removeClass('widgetNoteSelected');
+ }
+ }
+
+ var lastSelectedWidgetNote;
+ $ax.messageCenter.addMessageListener(function (message, data) {
+ //If annotation toggle message received from sitemap, toggle footnotes
+ if(message == 'toggleSelectWidgetNote') {
+ var dataSplit = data.split('@');
+
+ if(lastSelectedWidgetNote == data) {
+ if(dataSplit.length === 2) {
+ _toggleSelectWidgetNoteForRepeater(dataSplit[0], dataSplit[1], false);
+ } else {
+ $('#' + lastSelectedWidgetNote).removeClass('widgetNoteSelected');
+ }
+ lastSelectedWidgetNote = null;
+ return;
+ }
+
+ if(lastSelectedWidgetNote) {
+ var lastDataSplit = lastSelectedWidgetNote.split('@');
+ if(lastDataSplit.length === 2) {
+ _toggleSelectWidgetNoteForRepeater(lastDataSplit[0], lastDataSplit[1], false);
+ } else {
+ $('#' + lastSelectedWidgetNote).removeClass('widgetNoteSelected');
+ }
+ }
+
+ if(dataSplit.length > 1) {
+ _toggleSelectWidgetNoteForRepeater(dataSplit[0], dataSplit[1], true);
+ } else {
+ $('#' + data).addClass('widgetNoteSelected');
+ }
+
+ lastSelectedWidgetNote = data;
+ }
+ });
+
+ var highlightEnabled = false;
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ if(message == 'highlightInteractive') {
+ highlightEnabled = data == true;
+ _applyHighlight($ax('*'));
+ }
+ });
+
+ var _applyHighlight = $ax.applyHighlight = function(query, ignoreUnset) {
+ if(ignoreUnset && !highlightEnabled) return;
+
+ var pulsateClassName = 'legacyPulsateBorder';
+ //Determine if the widget has a defined userTriggeredEventName specified in the array above
+ var _isInteractive = function(diagramObject) {
+ if(diagramObject && diagramObject.interactionMap) {
+ for(var index in userTriggeredEventNames) {
+ if(diagramObject.interactionMap[userTriggeredEventNames[index]]) return true;
+ }
+ }
+ return false;
+ };
+
+ //Traverse through parent layers (if any) of an element and see if any have a defined userTriggeredEventName
+ var _findMatchInParent = function(id) {
+ var parents = $ax('#' + id).getParents(true, ['layer'])[0];
+ for(var i in parents) {
+ var parentId = parents[i];
+ var parentObj = $ax.getObjectFromScriptId(parentId);
+ if(_isInteractive(parentObj)) return true;
+ }
+ return false;
+ };
+
+ //Find all widgets with a defined userTriggeredEventName specified in the array above
+ var $matchingElements = query.filter(function (obj, id) {
+
+ //This prevents the top left corner of the page from highlighting with everything else
+ if($ax.public.fn.IsLayer(obj.type)) return false;
+
+ if(_isInteractive(obj)) return true;
+ else if($ax.public.fn.IsVector(obj.type) && obj.referencePageUrl) return true;
+
+ //Last check on the object's parent layer(s), if a layer has a defined userTriggeredEventName
+ //then we shall highlight each member of that layer TODO This is a design decision and is subject to change
+ return _findMatchInParent(id);
+ }).$();
+
+ var isHighlighted = $matchingElements.is('.' + pulsateClassName);
+
+ //Toggle the pulsate class on the matched elements
+ if(highlightEnabled && !isHighlighted) {
+ $matchingElements.addClass(pulsateClassName);
+ } else if(!highlightEnabled && isHighlighted) {
+ $matchingElements.removeClass(pulsateClassName);
+ }
+ };
+});
+//***** math.js *****//
+$axure.internal(function($ax) {
+ $ax.public.fn.matrixMultiply = function(matrix, vector) {
+ if(!matrix.tx) matrix.tx = 0;
+ if(!matrix.ty) matrix.ty = 0;
+ var outX = matrix.m11 * vector.x + matrix.m12 * vector.y + matrix.tx;
+ var outY = matrix.m21 * vector.x + matrix.m22 * vector.y + matrix.ty;
+ return { x: outX, y: outY };
+ }
+
+ $ax.public.fn.matrixInverse = function(matrix) {
+ if(!matrix.tx) matrix.tx = 0;
+ if(!matrix.ty) matrix.ty = 0;
+
+ var determinant = matrix.m11*matrix.m22 - matrix.m12*matrix.m21;
+ //var threshold = (M11 * M11 + M22 *M22 + M12 *M12+ M21 *M21) / 100000;
+ //if(determinant.DeltaEquals(0, threshold) && determinant < 0.01) {
+ // return Invalid;
+ //}
+ return {
+ m11 : matrix.m22/determinant,
+ m12 : -matrix.m12/determinant,
+ tx : (matrix.ty*matrix.m12 - matrix.tx*matrix.m22)/determinant,
+ m21: -matrix.m21 / determinant,
+ m22: matrix.m11 / determinant,
+ ty: (matrix.tx * matrix.m21 - matrix.ty * matrix.m11) / determinant
+ };
+ }
+
+
+ $ax.public.fn.matrixMultiplyMatrix = function (matrix1, matrix2) {
+ if (!matrix1.tx) matrix1.tx = 0;
+ if (!matrix1.ty) matrix1.ty = 0;
+ if (!matrix2.tx) matrix2.tx = 0;
+ if (!matrix2.ty) matrix2.ty = 0;
+
+ return {
+ m11: matrix1.m12*matrix2.m21 + matrix1.m11*matrix2.m11,
+ m12: matrix1.m12*matrix2.m22 + matrix1.m11*matrix2.m12,
+ tx: matrix1.m12 * matrix2.ty + matrix1.m11 * matrix2.tx + matrix1.tx,
+ m21: matrix1.m22 * matrix2.m21 + matrix1.m21 * matrix2.m11,
+ m22: matrix1.m22 * matrix2.m22 + matrix1.m21 * matrix2.m12,
+ ty: matrix1.m22 * matrix2.ty + matrix1.m21 * matrix2.tx + matrix1.ty,
+ };
+ }
+
+
+ $ax.public.fn.transformFromElement = function (element) {
+ var st = window.getComputedStyle(element, null);
+
+ var tr = st.getPropertyValue("-webkit-transform") ||
+ st.getPropertyValue("-moz-transform") ||
+ st.getPropertyValue("-ms-transform") ||
+ st.getPropertyValue("-o-transform") ||
+ st.getPropertyValue("transform");
+
+ if (tr.indexOf('none') < 0) {
+ var matrix = tr.split('(')[1];
+ matrix = matrix.split(')')[0];
+ matrix = matrix.split(',');
+ for (var l = 0; l < matrix.length; l++) {
+ matrix[l] = Number(matrix[l]);
+ }
+
+ } else { matrix = [1.0, 0.0, 0.0, 1.0, 0.0, 0.0]; }
+
+ return matrix;
+ // matrix[0] = cosine, matrix[1] = sine.
+ // Assuming the element is still orthogonal.
+ }
+
+ $ax.public.fn.vectorMinus = function(vector1, vector2) { return { x: vector1.x - vector2.x, y: vector1.y - vector2.y }; }
+
+ $ax.public.fn.vectorPlus = function (vector1, vector2) { return { x: vector1.x + vector2.x, y: vector1.y + vector2.y }; }
+
+ $ax.public.fn.vectorMidpoint = function (vector1, vector2) { return { x: (vector1.x + vector2.x) / 2.0, y: (vector1.y + vector2.y) / 2.0 }; }
+
+ $ax.public.fn.fourCornersToBasis = function (fourCorners) {
+ return {
+ widthVector: $ax.public.fn.vectorMinus(fourCorners.widgetTopRight, fourCorners.widgetTopLeft),
+ heightVector: $ax.public.fn.vectorMinus(fourCorners.widgetBottomLeft, fourCorners.widgetTopLeft)
+ };
+ }
+
+ $ax.public.fn.matrixString = function(m11, m21, m12, m22, tx, ty) {
+ return "Matrix(" + m11 + "," + m21 + "," + m12 + "," + m22 + ", " + tx + ", " + ty + ")";
+ }
+
+ $ax.public.fn.getWidgetBoundingRect = function (widgetId) {
+ var emptyRect = { left: 0, top: 0, centerPoint: { x: 0, y: 0 }, width: 0, height: 0 };
+ var element = document.getElementById(widgetId);
+ if (!element) return emptyRect;
+
+ var object = $obj(widgetId);
+ if (object && object.type && $ax.public.fn.IsLayer(object.type)) {
+ var layerChildren = _getLayerChildrenDeep(widgetId);
+ if (!layerChildren) return emptyRect;
+ else return _getBoundingRectForMultipleWidgets(layerChildren);
+ }
+ return _getBoundingRectForSingleWidget(widgetId);
+ };
+
+ var _getLayerChildrenDeep = $ax.public.fn.getLayerChildrenDeep = function (layerId, includeLayers, includeHidden) {
+ var deep = [];
+ var children = $ax('#' + layerId).getChildren()[0].children;
+ for (var index = 0; index < children.length; index++) {
+ var childId = children[index];
+ if(!includeHidden && !$ax.visibility.IsIdVisible(childId)) continue;
+ if ($ax.public.fn.IsLayer($obj(childId).type)) {
+ if (includeLayers) deep.push(childId);
+ var recursiveChildren = _getLayerChildrenDeep(childId, includeLayers, includeHidden);
+ for (var j = 0; j < recursiveChildren.length; j++) deep.push(recursiveChildren[j]);
+ } else deep.push(childId);
+ }
+ return deep;
+ };
+
+ var _getBoundingRectForMultipleWidgets = function (widgetsIdArray, relativeToPage) {
+ if (!widgetsIdArray || widgetsIdArray.constructor !== Array) return undefined;
+ if (widgetsIdArray.length == 0) return { left: 0, top: 0, centerPoint: { x: 0, y: 0 }, width: 0, height: 0 };
+ var widgetRect = _getBoundingRectForSingleWidget(widgetsIdArray[0], relativeToPage, true);
+ var boundingRect = { left: widgetRect.left, right: widgetRect.right, top: widgetRect.top, bottom: widgetRect.bottom };
+
+ for (var index = 1; index < widgetsIdArray.length; index++) {
+ widgetRect = _getBoundingRectForSingleWidget(widgetsIdArray[index], relativeToPage);
+ boundingRect.left = Math.min(boundingRect.left, widgetRect.left);
+ boundingRect.top = Math.min(boundingRect.top, widgetRect.top);
+ boundingRect.right = Math.max(boundingRect.right, widgetRect.right);
+ boundingRect.bottom = Math.max(boundingRect.bottom, widgetRect.bottom);
+ }
+
+ boundingRect.centerPoint = { x: (boundingRect.right + boundingRect.left) / 2.0, y: (boundingRect.bottom + boundingRect.top) / 2.0 };
+ boundingRect.width = boundingRect.right - boundingRect.left;
+ boundingRect.height = boundingRect.bottom - boundingRect.top;
+ return boundingRect;
+ };
+
+ var _getBoundingRectForSingleWidget = function (widgetId, relativeToPage, justSides) {
+ var element = document.getElementById(widgetId);
+ var boundingRect, tempBoundingRect, position;
+ var displayChanged = _displayHackStart(element);
+
+ if (_isCompoundVectorHtml(element)) {
+ //tempBoundingRect = _getCompoundImageBoundingClientSize(widgetId);
+ //position = { left: tempBoundingRect.left, top: tempBoundingRect.top };
+ position = $(element).position();
+ tempBoundingRect = {};
+ tempBoundingRect.left = position.left; //= _getCompoundImageBoundingClientSize(widgetId);
+ tempBoundingRect.top = position.top;
+ tempBoundingRect.width = Number(element.getAttribute('WidgetWidth'));
+ tempBoundingRect.height = Number(element.getAttribute('WidgetHeight'));
+ } else {
+ var boundingElement = element;
+ if($ax.dynamicPanelManager.isIdFitToContent(widgetId)) {
+ var stateId = $ax.visibility.GetPanelState(widgetId);
+ if(stateId != '') boundingElement = document.getElementById(stateId);
+ }
+ tempBoundingRect = boundingElement.getBoundingClientRect();
+
+ var jElement = $(element);
+ position = jElement.position();
+ if(jElement.css('position') == 'fixed') {
+ position.left += Number(jElement.css('margin-left').replace("px", ""));
+ position.top += Number(jElement.css('margin-top').replace("px", ""));
+ }
+ }
+
+ var layers = $ax('#' + widgetId).getParents(true, ['layer'])[0];
+ var flip = '';
+ var mirrorWidth = 0;
+ var mirrorHeight = 0;
+ for (var i = 0; i < layers.length; i++) {
+
+ //should always be 0,0
+ var layerPos = $jobj(layers[i]).position();
+ position.left += layerPos.left;
+ position.top += layerPos.top;
+
+ var outer = $ax.visibility.applyWidgetContainer(layers[i], true, true);
+ if (outer.length) {
+ var outerPos = outer.position();
+ position.left += outerPos.left;
+ position.top += outerPos.top;
+ }
+
+ //when a group is flipped we find the unflipped position
+ var inner = $jobj(layers[i] + '_container_inner');
+ var taggedFlip = inner.data('flip');
+ if (inner.length && taggedFlip) {
+ //only account for flip if transform is applied
+ var matrix = taggedFlip && (inner.css("-webkit-transform") || inner.css("-moz-transform") ||
+ inner.css("-ms-transform") || inner.css("-o-transform") || inner.css("transform"));
+ if (matrix !== 'none') {
+ flip = taggedFlip;
+ mirrorWidth = $ax.getNumFromPx(inner.css('width'));
+ mirrorHeight = $ax.getNumFromPx(inner.css('height'));
+ }
+ }
+ }
+ //Now account for flip
+ if (flip == 'x') position.top = mirrorHeight - position.top - element.getBoundingClientRect().height;
+ else if (flip == 'y') position.left = mirrorWidth - position.left - element.getBoundingClientRect().width;
+
+ boundingRect = {
+ left: position.left,
+ right: position.left + tempBoundingRect.width,
+ top: position.top,
+ bottom: position.top + tempBoundingRect.height
+ };
+
+ _displayHackEnd(displayChanged);
+ if (justSides) return boundingRect;
+
+ boundingRect.width = boundingRect.right - boundingRect.left;
+ boundingRect.height = boundingRect.bottom - boundingRect.top;
+
+ boundingRect.centerPoint = {
+ x: boundingRect.width / 2 + boundingRect.left,
+ y: boundingRect.height / 2 + boundingRect.top
+ };
+
+ return boundingRect;
+ };
+
+ var _getPointAfterRotate = $ax.public.fn.getPointAfterRotate = function (angleInDegrees, pointToRotate, centerPoint) {
+ var displacement = $ax.public.fn.vectorMinus(pointToRotate, centerPoint);
+ var rotationMatrix = $ax.public.fn.rotationMatrix(angleInDegrees);
+ rotationMatrix.tx = centerPoint.x;
+ rotationMatrix.ty = centerPoint.y;
+ return $ax.public.fn.matrixMultiply(rotationMatrix, displacement);
+ };
+
+ $ax.public.fn.getBoundingSizeForRotate = function(width, height, rotation) {
+ // point to rotate around doesn't matter since we just care about size, if location matter we need more args and location matters.
+
+ var origin = { x: 0, y: 0 };
+
+ var corner1 = { x: width, y: 0 };
+ var corner2 = { x: 0, y: height };
+ var corner3 = { x: width, y: height };
+
+ corner1 = _getPointAfterRotate(rotation, corner1, origin);
+ corner2 = _getPointAfterRotate(rotation, corner2, origin);
+ corner3 = _getPointAfterRotate(rotation, corner3, origin);
+
+ var left = Math.min(0, corner1.x, corner2.x, corner3.x);
+ var right = Math.max(0, corner1.x, corner2.x, corner3.x);
+ var top = Math.min(0, corner1.y, corner2.y, corner3.y);
+ var bottom = Math.max(0, corner1.y, corner2.y, corner3.y);
+
+ return { width: right - left, height: bottom - top };
+ }
+
+ $ax.public.fn.getPositionRelativeToParent = function (elementId) {
+ var element = document.getElementById(elementId);
+ var list = _displayHackStart(element);
+ var position = $(element).position();
+ _displayHackEnd(list);
+ return position;
+ };
+
+ var _displayHackStart = $ax.public.fn.displayHackStart = function (element) {
+ // TODO: Options: 1) stop setting display none. Big change for this late in the game. 2) Implement our own bounding.
+ // TODO: 3) Current method is look for any parents that are set to none, and and temporarily unblock. Don't like it, but it works.
+ var parent = element;
+ var displays = [];
+ while (parent) {
+ if (parent.style.display == 'none') {
+ displays.push(parent);
+ //use block to overwrites default hidden objects' display
+ parent.style.display = 'block';
+ }
+ parent = parent.parentElement;
+ }
+
+ return displays;
+ };
+
+ var _displayHackEnd = $ax.public.fn.displayHackEnd = function (displayChangedList) {
+ for (var i = 0; i < displayChangedList.length; i++) displayChangedList[i].style.display = 'none';
+ };
+
+
+ var _isCompoundVectorHtml = $ax.public.fn.isCompoundVectorHtml = function(hElement) {
+ return hElement.hasAttribute('compoundmode') && hElement.getAttribute('compoundmode') == "true";
+ }
+
+ $ax.public.fn.removeCompound = function (jobj) { if(_isCompoundVectorHtml(jobj[0])) jobj.removeClass('compound'); }
+ $ax.public.fn.restoreCompound = function (jobj) { if (_isCompoundVectorHtml(jobj[0])) jobj.addClass('compound'); }
+
+ $ax.public.fn.compoundIdFromComponent = function(id) {
+
+ var pPos = id.indexOf('p');
+ var dashPos = id.indexOf('-');
+ if (pPos < 1) return id;
+ else if (dashPos < 0) return id.substring(0, pPos);
+ else return id.substring(0, pPos) + id.substring(dashPos);
+ }
+
+ $ax.public.fn.l2 = function (x, y) { return Math.sqrt(x * x + y * y); }
+
+ $ax.public.fn.convertToSingleImage = function (jobj) {
+ if(!jobj[0]) return;
+
+ var widgetId = jobj[0].id;
+ var object = $obj(widgetId);
+
+ if ($ax.public.fn.IsLayer(object.type)) {
+ var recursiveChildren = _getLayerChildrenDeep(widgetId, true);
+ for (var j = 0; j < recursiveChildren.length; j++)
+ $ax.public.fn.convertToSingleImage($jobj(recursiveChildren[j]));
+ return;
+ }
+
+ //var layer =
+
+ if(!_isCompoundVectorHtml(jobj[0])) return;
+
+
+ $('#' + widgetId).removeClass("compound");
+ $('#' + widgetId + '_img').removeClass("singleImg");
+ jobj[0].setAttribute('compoundmode', 'false');
+
+ var components = object.compoundChildren;
+ delete object.generateCompound;
+ for (var i = 0; i < components.length; i++) {
+ var componentJobj = $jobj($ax.public.fn.getComponentId(widgetId, components[i]));
+ componentJobj.css('display', 'none');
+ componentJobj.css('visibility', 'hidden');
+ }
+ }
+
+
+ $ax.public.fn.getContainerDimensions = function(query) {
+ // returns undefined if no containers found.
+ var containerDimensions;
+ for (var i = 0; i < query[0].children.length; i++) {
+ var node = query[0].children[i];
+ if (node.id.indexOf(query[0].id) >= 0 && node.id.indexOf('container') >= 0) {
+ containerDimensions = node.style;
+ }
+ }
+ return containerDimensions;
+ }
+
+
+ $ax.public.fn.rotationMatrix = function (angleInDegrees) {
+ var angleInRadians = angleInDegrees * (Math.PI / 180);
+ var cosTheta = Math.cos(angleInRadians);
+ var sinTheta = Math.sin(angleInRadians);
+
+ return { m11: cosTheta, m12: -sinTheta, m21: sinTheta, m22: cosTheta, tx: 0.0, ty: 0.0 };
+ }
+
+ $ax.public.fn.GetFieldFromStyle = function (query, field) {
+ var raw = query[0].style[field];
+ if (!raw) raw = query.css(field);
+ return Number(raw.replace('px', ''));
+ }
+
+
+ $ax.public.fn.setTransformHowever = function (transformString) {
+ return {
+ '-webkit-transform': transformString,
+ '-moz-transform': transformString,
+ '-ms-transform': transformString,
+ '-o-transform': transformString,
+ 'transform': transformString
+ };
+ }
+
+ $ax.public.fn.getCornersFromComponent = function (id) {
+ var element = document.getElementById(id);
+ var matrix = $ax.public.fn.transformFromElement(element);
+ var currentMatrix = { m11: matrix[0], m21: matrix[1], m12: matrix[2], m22: matrix[3], tx: matrix[4], ty: matrix[5] };
+ var dimensions = {};
+ var axObj = $ax('#' + id);
+ dimensions.left = axObj.left(true);
+ dimensions.top = axObj.top(true);
+ var size = axObj.size();
+ dimensions.width = size.width;
+ dimensions.height = size.height;
+ //var transformMatrix1 = { m11: 1, m12: 0, m21: 0, m22: 1, tx: -invariant.x, ty: -invariant.y };
+ //var transformMatrix2 = { m11: 1, m12: 0, m21: 0, m22: 1, tx: 500, ty: 500 };
+
+ var halfWidth = dimensions.width * 0.5;
+ var halfHeight = dimensions.height * 0.5;
+ //var preTransformTopLeft = { x: -halfWidth, y: -halfHeight };
+ //var preTransformBottomLeft = { x: -halfWidth, y: halfHeight };
+ var preTransformTopRight = { x: halfWidth, y: -halfHeight };
+ var preTransformBottomRight = { x: halfWidth, y: halfHeight };
+
+ return {
+ //relativeTopLeft: $ax.public.fn.matrixMultiply(currentMatrix, preTransformTopLeft),
+ //relativeBottomLeft: $ax.public.fn.matrixMultiply(currentMatrix, preTransformBottomLeft),
+ relativeTopRight: $ax.public.fn.matrixMultiply(currentMatrix, preTransformTopRight),
+ relativeBottomRight: $ax.public.fn.matrixMultiply(currentMatrix, preTransformBottomRight),
+ centerPoint: { x: dimensions.left + halfWidth, y: dimensions.top + halfHeight }
+ //originalDimensions: dimensions,
+ //transformShift: { x: matrix[4], y: matrix[5] }
+ }
+ }
+});
\ No newline at end of file
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/prototypePre.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/prototypePre.js
new file mode 100644
index 0000000..804989a
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/prototypePre.js
@@ -0,0 +1,3073 @@
+// 8.0.0.3355. Generated 8/24/2017 4:38:58 AM UTC
+
+//***** axQuery.js *****//
+$axure = function(query) {
+ return $axure.query(query);
+};
+
+// ******* AxQuery and Page metadata ******** //
+(function() {
+ var $ax = function() {
+ var returnVal = $axure.apply(this, arguments);
+ var axFn = $ax.fn;
+ for (var key in axFn) {
+ returnVal[key] = axFn[key];
+ }
+
+ return returnVal;
+ };
+
+ $ax.public = $axure;
+ $ax.fn = {};
+
+ $axure.internal = function(initFunction) {
+ //Attach messagecenter to $ax object so that it can be used in viewer.js, etc in internal scope
+ if(!$ax.messageCenter) $ax.messageCenter = $axure.messageCenter;
+
+ return initFunction($ax);
+ };
+
+ var _lastFiredResize = 0;
+ var _resizeFunctions = [];
+ var _lastTimeout;
+ var _fireResize = function() {
+ if (_lastTimeout) window.clearTimeout(_lastTimeout);
+ _lastTimeout = undefined;
+ _lastFiredResize = new Date().getTime();
+ for(var i = 0; i < _resizeFunctions.length; i++) _resizeFunctions[i]();
+ };
+
+ $axure.resize = function(fn) {
+ if(fn) _resizeFunctions[_resizeFunctions.length] = fn;
+ else $(window).resize();
+ };
+
+ $(window).resize(function() {
+ var THRESHOLD = 50;
+ var now = new Date().getTime();
+ if(now - _lastFiredResize > THRESHOLD) {
+ _fireResize();
+ } else if(!_lastTimeout) {
+ _lastTimeout = window.setTimeout(_fireResize, THRESHOLD);
+ }
+ });
+
+ window.$obj = function(id) {
+ return $ax.getObjectFromElementId(id);
+ };
+
+ window.$id = function(obj) {
+ return obj.scriptIds[0];
+ };
+
+ window.$jobj = function(id) {
+ return $(document.getElementById(id));
+ };
+
+ window.$jobjAll = function(id) {
+ return $addAll($jobj(id), id);
+ };
+
+ window.$addAll = function(jobj, id) {
+ return jobj.add($jobj(id + '_ann')).add($jobj(id + '_ref'));
+ };
+
+ $ax.INPUT = function(id) { return id + "_input"; };
+ $ax.IsImageFocusable = function (type) { return $ax.public.fn.IsImageBox(type) || $ax.public.fn.IsVector(type) || $ax.public.fn.IsTreeNodeObject(type) || $ax.public.fn.IsTableCell(type); };
+ $ax.IsTreeNodeObject = function (type) { return $ax.public.fn.IsTreeNodeObject(type); };
+ $ax.IsSelectionButton = function (type) { return $ax.public.fn.IsCheckBox(type) || $ax.public.fn.IsRadioButton(type); };
+
+ var _fn = {};
+ $axure.fn = _fn;
+ $axure.fn.jQuery = function() {
+ var elements = this.getElements();
+ return $(elements);
+ };
+ $axure.fn.$ = $axure.fn.jQuery;
+
+ var _query = function(query, queryArg) {
+ var returnVal = {};
+ var _axQueryObject = returnVal.query = { };
+ _axQueryObject.filterFunctions = [];
+
+ if (query == '*') {
+ _axQueryObject.filterFunctions[0] = function() { return true; };
+ } else if (typeof(query) === 'function') {
+ _axQueryObject.filterFunctions[0] = query;
+ } else {
+ var firstString = $.trim(query.toString());
+ if (firstString.charAt(0) == '@') {
+ _axQueryObject.filterFunctions[0] = function(diagramObject) {
+ return diagramObject.label == firstString.substring(1);
+ };
+ } else if (firstString.charAt(0) == '#') {
+ _axQueryObject.elementId = firstString.substring(1);
+ } else {
+ if (firstString == 'label') {
+ _axQueryObject.filterFunctions[0] = function(diagramObject) {
+ return queryArg instanceof Array && queryArg.indexOf(diagramObject.label) > 0 ||
+ queryArg instanceof RegExp && queryArg.test(diagramObject.label) ||
+ diagramObject.label == queryArg;
+ };
+ } else if(firstString == 'elementId') {
+ _axQueryObject.filterFunctions[0] = function(diagramObject, elementId) {
+ return queryArg instanceof Array && queryArg.indexOf(elementId) > 0 ||
+ elementId == queryArg;
+ };
+ }
+ }
+ }
+
+ var axureFn = $axure.fn;
+ for (var key in axureFn) {
+ returnVal[key] = axureFn[key];
+ }
+ return returnVal;
+ };
+ $axure.query = _query;
+
+ var _getFilterFnFromQuery = function(query) {
+ var filter = function(diagramObject, elementId) {
+ // Non diagram objects are allowed to be queryed, such as text inputs.
+ if (diagramObject && !$ax.public.fn.IsReferenceDiagramObject(diagramObject.type) && !document.getElementById(elementId)) return false;
+ var retVal = true;
+ for(var i = 0; i < query.filterFunctions.length && retVal; i++) {
+ retVal = query.filterFunctions[i](diagramObject, elementId);
+ }
+ return retVal;
+ };
+ return filter;
+ };
+
+ $ax.public.fn.filter = function(query, queryArg) {
+ var returnVal = _query(query, queryArg);
+
+ if(this.query.elementId) returnVal.query.elementId = this.query.elementId;
+
+ //If there is already a function, offset by 1 when copying other functions over.
+ var offset = returnVal.query.filterFunctions[0] ? 1 : 0;
+
+ //Copy all functions over to new array.
+ for(var i = 0; i < this.query.filterFunctions.length; i++) returnVal.query.filterFunctions[i+offset] = this.query.filterFunctions[i];
+
+ //Functions are in reverse order now
+ returnVal.query.filterFunctions.reverse();
+
+ return returnVal;
+ };
+
+ $ax.public.fn.each = function(fn) {
+ var filter = _getFilterFnFromQuery(this.query);
+ var elementIds = this.query.elementId ? [this.query.elementId] : $ax.getAllElementIds();
+ for (var i = 0; i < elementIds.length; i++) {
+ var elementId = elementIds[i];
+ var diagramObject = $ax.getObjectFromElementId(elementId);
+ if (filter(diagramObject, elementId)) {
+ fn.apply(diagramObject, [diagramObject, elementId]);
+ }
+ }
+ };
+
+ $ax.public.fn.getElements = function() {
+ var elements = [];
+ this.each(function(dObj, elementId) {
+ var elementById = document.getElementById(elementId);
+ if(elementById) elements[elements.length] = elementById;
+ });
+ return elements;
+ };
+
+ $ax.public.fn.getElementIds = function() {
+ var elementIds = [];
+ this.each(function(dObj, elementId) { elementIds[elementIds.length] = elementId; });
+ return elementIds;
+ };
+
+ // Deep means to keep getting parents parent until at the root parent. Parent is then an array instead of an id.
+ // Filter options: layer, rdo, repeater, item, dynamicPanel, state
+ $ax.public.fn.getParents = function (deep, filter) {
+ if(filter == '*') filter = ['layer', 'rdo', 'repeater', 'item', 'dynamicPanel', 'state'];
+ var elementIds = this.getElementIds();
+ var parentIds = [];
+
+ var getParent = function(elementId) {
+ var containerIndex = elementId.indexOf('_container');
+ if(containerIndex !== -1) elementId = elementId.substring(0, containerIndex);
+ if(elementId.indexOf('_text') !== -1) elementId = $ax.GetShapeIdFromText(elementId);
+
+ // Check repeater item before layer, because repeater item detects it's parent layer, but wants to go directly to it's repeater first.
+ // if repeater item, then just return repeater
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ var itemNum = $ax.repeater.getItemIdFromElementId(elementId);
+ var parentRepeater = $ax.getParentRepeaterFromScriptId(scriptId);
+
+ // scriptId is item or repeater itself
+ if (parentRepeater == scriptId) {
+ // If you are repeater item, return your repeater
+ if (itemNum) return filter.indexOf('repeater') != -1 ? scriptId : getParent(scriptId);
+ // Otherwise you are actually at repeater, clean parentRepeater, or else you loop
+ parentRepeater = undefined;
+ }
+
+ // Layer only references it if it is a direct layer to it
+ var parent = $ax.getLayerParentFromElementId(elementId);
+ // If layer is allowed we found parent, otherwise ignore and keep climbing
+ if (parent) return filter.indexOf('layer') != -1 ? parent : getParent(parent);
+
+ // if state, then just return panel
+ if(scriptId.indexOf('_state') != -1) {
+ var panelId = $ax.repeater.createElementId(scriptId.split('_')[0], itemNum);
+ // If dynamic panel is allowed we found parent, otherwise ignore and keep climbing
+ return filter.indexOf('dynamicPanel') != -1 ? panelId : getParent(panelId);
+ }
+
+ var parentType = '';
+ if(parentRepeater) {
+ parentType = 'item';
+ parent = $ax.repeater.createElementId(parentRepeater, itemNum);
+ }
+
+ var masterPath = $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(elementId));
+ masterPath.pop();
+ if(masterPath.length > 0) {
+ var masterId = $ax.getElementIdFromPath(masterPath, { itemNum: itemNum });
+ if(!masterId) return undefined;
+ var masterRepeater = $ax.getParentRepeaterFromElementId($ax.repeater.getScriptIdFromElementId(masterId));
+ if(!parentRepeater || masterRepeater) {
+ parentType = 'rdo';
+ parent = masterId;
+ }
+ }
+
+ var obj = $obj(elementId);
+ var parentDynamicPanel = obj.parentDynamicPanel;
+ if(parentDynamicPanel) {
+ // Make sure the parent if not parentRepeater, or dynamic panel is also in that repeater
+ // If there is a parent master, the dynamic panel must be in it, otherwise parentDynamicPanel would be undefined.
+ var panelPath = masterPath;
+ panelPath[panelPath.length] = parentDynamicPanel;
+ panelId = $ax.getElementIdFromPath(panelPath, { itemNum: itemNum });
+ if(!panelId) return undefined;
+ var panelRepeater = $ax.getParentRepeaterFromElementId(panelId);
+ if(!parentRepeater || panelRepeater) {
+ parentType = 'state';
+ parent = panelId + '_state' + obj.panelIndex;
+ }
+ }
+
+ // If at top or parent type is desired, then return parent, otherwise keep climbing
+ return !parent || filter.indexOf(parentType) != -1 ? parent : getParent(parent);
+ };
+
+ for(var i = 0; i < elementIds.length; i++) {
+ var parent = getParent(elementIds[i]);
+ if(deep) {
+ var parents = [];
+ while(parent) {
+ parents[parents.length] = parent;
+ // If id is not a valid object, you are either repeater item or dynamic panel state
+ //if(!$obj(parent)) parent = $ax.visibility.getWidgetFromContainer($jobj(parent).parent().attr('id'));
+
+ parent = getParent(parent);
+ }
+ parent = parents;
+ }
+ parentIds[parentIds.length] = parent;
+ }
+ return parentIds;
+ };
+
+ // Get the path to the child, where non leaf nodes can be masters, layers, dynamic panels, and repeaters.
+ $ax.public.fn.getChildren = function(deep) {
+ var elementIds = this.getElementIds();
+ var children = [];
+
+ var getChildren = function(elementId) {
+ var obj = $obj(elementId);
+ if(!obj) return undefined;
+
+ var isRepeater = obj.type == $ax.constants.REPEATER_TYPE;
+ var isDynamicPanel = obj.type == $ax.constants.DYNAMIC_PANEL_TYPE;
+ var isLayer = obj.type == $ax.constants.LAYER_TYPE;
+ var isMaster = obj.type == $ax.constants.MASTER_TYPE;
+
+ var isMenu = obj.type == $ax.constants.MENU_OBJECT_TYPE;
+ var isTreeNode = obj.type == $ax.constants.TREE_NODE_OBJECT_TYPE;
+ var isTable = obj.type == $ax.constants.TABLE_TYPE;
+ //var isCompoundVector = obj.type == $ax.constants.VECTOR_SHAPE_TYPE && obj.generateCompound;
+
+ if (isRepeater || isDynamicPanel || isLayer || isMaster || isMenu || isTreeNode || isTable) {// || isCompoundVector) {
+ // Find parent that children should be pulled from. Default is just the elementId query (used by table and master)
+ var parent = $jobj(elementId);
+ if(isRepeater) {
+ parent = $();
+ var itemIds = $ax.getItemIdsForRepeater(elementId);
+ for(var itemIndex = 0; itemIndex < itemIds.length; itemIndex++) parent = parent.add($jobj($ax.repeater.createElementId(elementId, itemIds[itemIndex])));
+ } else if(isDynamicPanel) {
+ // Really only need to do active state probably...
+ parent = $jobj(elementId).children();
+ // Get through all containers
+ while ($(parent[0]).attr('id').indexOf('container') != -1) parent = parent.children();
+ // Now at states, but want states content
+ parent = parent.children();
+ } else if(isTreeNode) parent = $jobj($ax.repeater.applySuffixToElementId(elementId, '_children'));
+
+ // Menu doesn't want all children, only tables and menus, so it must be handled specially
+ var children = isMenu ? parent.children('.ax_table').add(parent.children('.ax_menu')) : parent.children();
+ children = $ax.visibility.getRealChildren(_fixForBasicLinks(children));
+
+ // For tree nodes you want the the button shape contained by the elementQuery too
+ if(isTreeNode) {
+ var treeNodeChildren = $jobj(elementId).children();
+ for(var treeNodeIndex = 0; treeNodeIndex < treeNodeChildren.length; treeNodeIndex++) {
+ var treeNodeChild = $(treeNodeChildren[treeNodeIndex]);
+ var childObj = $obj(treeNodeChild.attr('id'));
+ if (childObj && $ax.public.fn.IsVector(childObj.type)) children = children.add(treeNodeChild);
+ }
+ }
+
+
+ var childrenIds = [];
+ for(var childIndex = 0; childIndex < children.length; childIndex++) {
+ var childObj = $(children[childIndex]);
+ var id = childObj.attr('id');
+ if(typeof(id) == 'undefined' && childObj.is('a')) id = $(childObj.children()[0]).attr('id');
+ // Ignore annotations and any other children that are not elements
+ if (id.split('_').length > 1) continue;
+
+ childrenIds.push(id);
+ }
+
+ if(deep) {
+ var childObjs = [];
+ for(var i = 0; i < childrenIds.length; i++) {
+ var childId = childrenIds[i];
+ childObjs[i] = { id: childId, children: getChildren(childId) };
+ }
+ childrenIds = childObjs;
+ }
+
+ return childrenIds;
+ }
+
+ return undefined;
+ };
+
+ for(var i = 0; i < elementIds.length; i++) {
+ children[children.length] = { id : elementIds[i], children : getChildren(elementIds[i])};
+ }
+ return children;
+ };
+
+ var _fixForBasicLinks = function(query) {
+ var hasBasicLinks = query.filter('.basiclink').length > 0;
+ if(!hasBasicLinks) return query;
+
+ var retval = $();
+ for(var i = 0; i < query.length; i++) {
+ var child = $(query[i]);
+ if(child.hasClass('basiclink')) retval = retval.add(child.children());
+ else retval = retval.add(child);
+ }
+ return retval;
+ };
+
+})();
+//***** globals.js *****//
+$axure.internal(function($ax) {
+ var _globals = $ax.globals = {};
+
+ $ax.globals.MaxZIndex = 1000;
+ $ax.globals.MinZIndex = -1000;
+
+});
+//***** axutils.js *****//
+/*
+ *
+ *
+ *
+ *
+ */
+
+ (function() {
+ // define the root namespace object
+ if(!window.$axure) window.$axure = {};
+
+ $axure.utils = {};
+
+ // ------------------------------------------------------------------------
+ // Makes an object bindable
+ // ------------------------------------------------------------------------
+ $axure.utils.makeBindable = function(obj, events) {
+ if(obj.registeredBindings != null) return;
+
+ // copy the events
+ obj.bindableEvents = events.slice();
+ obj.registeredBindings = {};
+
+ obj.bind = function(eventName, fn) {
+ var binding = {};
+ binding.eventName = eventName;
+ binding.action = fn;
+
+ var bindingList = this.registeredBindings[eventName];
+ if(bindingList == null) {
+ bindingList = [];
+ this.registeredBindings[eventName] = bindingList;
+ }
+ bindingList[bindingList.length] = binding;
+ };
+
+ obj.unbind = function(eventName) {
+ if(eventName.indexOf('.') >= 0) {
+ this.registeredBindings[eventName] = null;
+ } else {
+ var event = eventName.split('.')[0];
+ for(var bindingKey in this.registeredBindings) {
+ if(bindingKey.split('.')[0] == event) {
+ this.registeredBindings[bindingKey] = null;
+ }
+ }
+ }
+ };
+
+ obj.triggerEvent = function(eventName, arg) {
+ for(var bindingKey in this.registeredBindings) {
+ if(bindingKey.split('.')[0] == eventName) {
+ var bindings = this.registeredBindings[bindingKey];
+ for(var i = 0; i < bindings.length; i++) {
+ if(arg == null) {
+ bindings[i].action();
+ } else {
+ bindings[i].action(arg);
+ }
+ }
+ }
+ }
+ };
+ };
+
+
+ $axure.utils.loadCSS = function(url) {
+ $('head').append('
')
+ .appendTo('body')
+ .html($ax.legacy.GetAnnotationHtml(ann))
+ .dialog({
+ title: dObj.label,
+ width: width,
+ height: height,
+ minHeight: 150,
+ zIndex: $ax.globals.MaxZIndex,
+ position: [left, top],
+ dialogClass: 'dialogFix',
+ autoOpen: false
+ });
+ $dialog.parent().appendTo('#base');
+ $dialog.dialog('open');
+ dialogs[id] = $dialog;
+
+ // scroll ... just for IE
+ window.scrollTo(scrollX, scrollY);
+ };
+
+ $ax.annotation.InitializeAnnotations = function (query) {
+ if(!$ax.document.configuration.showAnnotations) return;
+
+ query.each(function(dObj, elementId) {
+ if(!dObj.annotation) return;
+
+ if(dObj.type == 'hyperlink') {
+ var textId = $ax.GetParentIdFromLink(elementId);
+
+ var elementIdQuery = $('#' + elementId);
+ elementIdQuery.after(" ");
+
+ if($ax.document.configuration.useLabels) {
+ var label = $('#' + elementId).attr("data-label");
+ if(!label || label == "") label = "?";
+ $('#' + textId).append("" + label + "
");
+ } else {
+ $('#' + textId).append("
");
+ }
+ $('#' + elementId + 'Note').click(function(e) {
+ $ax.annotation.ToggleWorkflow(e, elementId, 300, 200, false);
+ return false;
+ });
+
+ _updateLinkLocations(elementId);
+ } else {
+ if($ax.document.configuration.useLabels) {
+ var label = $('#' + elementId).attr("data-label");
+ if(!label || label == "") label = "?";
+ $('#' + elementId + "_ann").append("" + label + "
");
+ } else {
+ $('#' + elementId + "_ann").append("
");
+ }
+ $('#' + elementId + 'Note').click(function(e) {
+ $ax.annotation.ToggleWorkflow(e, elementId, 300, 200, false);
+ return false;
+ });
+ }
+
+ $('#' + elementId + 'Note.annnoteimage').append("
");
+ });
+ };
+
+ $ax.annotation.jQueryAnn = function(query) {
+ var elementIds = [];
+ query.each(function(diagramObject, elementId) {
+ if(diagramObject.annotation) elementIds[elementIds.length] = elementId;
+ });
+ var elementIdSelectors = jQuery.map(elementIds, function(elementId) { return '#' + elementId + '_ann'; });
+ var jQuerySelectorText = (elementIdSelectors.length > 0) ? elementIdSelectors.join(', ') : '';
+ return $(jQuerySelectorText);
+ };
+
+ $(window.document).ready(function() {
+ $ax.annotation.InitializeAnnotations($ax(function(dObj) { return dObj.annotation; }));
+
+ $ax.messageCenter.addMessageListener(function(message, data) {
+ //If the annotations are being hidden via the Sitemap toggle button, hide any open dialogs
+ if(message == 'annotationToggle') {
+ if(data == false) {
+ for(var index in dialogs) {
+ var $dialog = dialogs[index];
+ if($dialog.dialog("isOpen")) {
+ $dialog.dialog("close");
+ }
+ }
+ }
+ }
+ });
+ });
+
+ //adjust annotation location to a element's top right corner
+ $ax.annotation.adjustIconLocation = function(id) {
+ var ann = document.getElementById(id + "_ann");
+ if(ann) {
+ var corners = $ax.public.fn.getCornersFromComponent(id);
+ var newTopRight = $ax.public.fn.vectorPlus(corners.relativeTopRight, corners.centerPoint);
+ //note size is 14x8, this is how rp calculated it as well
+ ann.style.left = (newTopRight.x - 7) + "px";
+ ann.style.top = (newTopRight.y - 4) + "px";
+ }
+
+ var ref = document.getElementById(id + "_ref");
+ if(ref) {
+ if(!corners) corners = $ax.public.fn.getCornersFromComponent(id);
+ var newBottomRight = $ax.public.fn.vectorPlus(corners.relativeBottomRight, corners.centerPoint);
+
+ ref.style.left = (newBottomRight.x - 8) + 'px';
+ ref.style.top = (newBottomRight.y - 10) + 'px';
+ }
+ }
+});
+//***** axQuery.std.js *****//
+// ******* AxQuery Plugins ******** //
+
+$axure.internal(function($ax) {
+ $ax.constants = {};
+
+ $ax.constants.TABLE_TYPE = 'table';
+ $ax.constants.MENU_OBJECT_TYPE = 'menuObject';
+ $ax.constants.MASTER_TYPE = 'master';
+ $ax.constants.PAGE_TYPE = 'page';
+ $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE = 'referenceDiagramObject';
+ $ax.constants.REPEATER_TYPE = 'repeater';
+ $ax.constants.DYNAMIC_PANEL_TYPE = 'dynamicPanel';
+ $ax.constants.LAYER_TYPE = 'layer';
+ $ax.constants.TEXT_BOX_TYPE = 'textBox';
+ $ax.constants.TEXT_AREA_TYPE = 'textArea';
+ $ax.constants.LIST_BOX_TYPE = 'listBox';
+ $ax.constants.COMBO_BOX_TYPE = 'comboBox';
+ $ax.constants.CHECK_BOX_TYPE = 'checkbox';
+ $ax.constants.RADIO_BUTTON_TYPE = 'radioButton';
+ $ax.constants.BUTTON_TYPE = 'button'; //html button
+ $ax.constants.IMAGE_MAP_REGION_TYPE = 'imageMapRegion';
+ $ax.constants.IMAGE_BOX_TYPE = 'imageBox';
+ $ax.constants.VECTOR_SHAPE_TYPE = 'vectorShape';
+ $ax.constants.SNAPSHOT_TYPE = 'screenshot';
+ $ax.constants.TREE_NODE_OBJECT_TYPE = 'treeNodeObject';
+ $ax.constants.TABLE_CELL_TYPE = 'tableCell';
+ $ax.constants.VERTICAL_LINE_TYPE = 'verticalLine';
+ $ax.constants.HORIZONTAL_LINE_TYPE = 'horizontalLine';
+ $ax.constants.INLINE_FRAME_TYPE = 'inlineFrame';
+ $ax.constants.CONNECTOR_TYPE = 'connector';
+ $ax.constants.ALL_TYPE = '*';
+
+ $ax.constants.TEXT_TYPE = 'richTextPanel';
+ $ax.constants.LINK_TYPE = 'hyperlink';
+
+ $ax.public.fn.IsTable = function (type) { return type == $ax.constants.TABLE_TYPE; }
+ $ax.public.fn.IsMenuObject = function (type) { return type == $ax.constants.MENU_OBJECT_TYPE; }
+ $ax.public.fn.IsMaster = function (type) { return type == $ax.constants.MASTER_TYPE; }
+ $ax.public.fn.IsPage = function (type) { return type == $ax.constants.PAGE_TYPE; }
+ $ax.public.fn.IsReferenceDiagramObject = function (type) { return type == $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE; }
+ $ax.public.fn.IsRepeater = function (type) { return type == $ax.constants.REPEATER_TYPE; }
+ $ax.public.fn.IsDynamicPanel = function (type) { return type == $ax.constants.DYNAMIC_PANEL_TYPE; }
+ $ax.public.fn.IsLayer = function (type) { return type == $ax.constants.LAYER_TYPE; }
+ $ax.public.fn.IsTextBox = function (type) { return type == $ax.constants.TEXT_BOX_TYPE; }
+ $ax.public.fn.IsTextArea = function (type) { return type == $ax.constants.TEXT_AREA_TYPE; }
+ $ax.public.fn.IsListBox = function (type) { return type == $ax.constants.LIST_BOX_TYPE; }
+ $ax.public.fn.IsComboBox = function (type) { return type == $ax.constants.COMBO_BOX_TYPE; }
+ $ax.public.fn.IsCheckBox = function (type) { return type == $ax.constants.CHECK_BOX_TYPE; }
+ $ax.public.fn.IsRadioButton = function (type) { return type == $ax.constants.RADIO_BUTTON_TYPE; }
+ $ax.public.fn.IsButton = function (type) { return type == $ax.constants.BUTTON_TYPE; }
+ $ax.public.fn.IsIamgeMapRegion = function (type) { return type == $ax.constants.IMAGE_MAP_REGION_TYPE; }
+ $ax.public.fn.IsImageBox = function (type) { return type == $ax.constants.IMAGE_BOX_TYPE; }
+ $ax.public.fn.IsVector = function (type) { return type == $ax.constants.VECTOR_SHAPE_TYPE; }
+ $ax.public.fn.IsSnapshot = function (type) { return type == $ax.constants.SNAPSHOT_TYPE; }
+ $ax.public.fn.IsTreeNodeObject = function (type) { return type == $ax.constants.TREE_NODE_OBJECT_TYPE; }
+ $ax.public.fn.IsTableCell = function (type) { return type == $ax.constants.TABLE_CELL_TYPE; }
+ $ax.public.fn.IsInlineFrame = function (type) { return type == $ax.constants.INLINE_FRAME_TYPE; }
+ $ax.public.fn.IsConnector = function (type) { return type == $ax.constants.CONNECTOR_TYPE; }
+ $ax.public.fn.IsContainer = function (type) { return type== $ax.constants.VECTOR_SHAPE_TYPE || type == $ax.constants.TABLE_TYPE || type == $ax.constants.MENU_OBJECT_TYPE || type == $ax.constants.TREE_NODE_OBJECT_TYPE; }
+
+ var PLAIN_TEXT_TYPES = [$ax.constants.TEXT_BOX_TYPE, $ax.constants.TEXT_AREA_TYPE, $ax.constants.LIST_BOX_TYPE,
+ $ax.constants.COMBO_BOX_TYPE, $ax.constants.CHECK_BOX_TYPE, $ax.constants.RADIO_BUTTON_TYPE, $ax.constants.BUTTON_TYPE];
+
+ $ax.public.fn.IsResizable = function (type) { return $.inArray(type, RESIZABLE_TYPES) !== -1; }
+ var RESIZABLE_TYPES = [
+ $ax.constants.BUTTON_TYPE, $ax.constants.DYNAMIC_PANEL_TYPE, $ax.constants.IMAGE_BOX_TYPE, $ax.constants.IMAGE_MAP_REGION_TYPE,
+ $ax.constants.INLINE_FRAME_TYPE, $ax.constants.LAYER_TYPE, $ax.constants.LIST_BOX_TYPE, $ax.constants.COMBO_BOX_TYPE,
+ $ax.constants.VECTOR_SHAPE_TYPE, $ax.constants.TEXT_AREA_TYPE, $ax.constants.TEXT_BOX_TYPE, $ax.constants.SNAPSHOT_TYPE
+ ];
+
+ $ax.public.fn.SupportsRichText = function() {
+ var obj = $obj(this.getElementIds()[0]);
+ // Catch root tree nodes as they are not supported.
+ if(obj.type == $ax.constants.TREE_NODE_OBJECT_TYPE) return obj.friendlyType == 'Tree Node';
+ // Do the same for tree node icons maybe?
+
+ return $.inArray(obj.type, SUPPORTS_RICH_TEXT_TYPES) != -1;
+ }
+ var SUPPORTS_RICH_TEXT_TYPES = [$ax.constants.CHECK_BOX_TYPE, $ax.constants.RADIO_BUTTON_TYPE,
+ $ax.constants.IMAGE_BOX_TYPE, $ax.constants.VECTOR_SHAPE_TYPE, $ax.constants.TABLE_CELL_TYPE, $ax.constants.CONNECTOR_TYPE];
+
+ var _addJQueryFunction = function(name) {
+ $ax.public.fn[name] = function() {
+ var val = $.fn[name].apply(this.jQuery(), arguments);
+ return arguments[0] ? this : val;
+ };
+ };
+ var _jQueryFunctionsToAdd = ['text', 'val', 'css'];
+ for (var jqueryFunctionIndex = 0; jqueryFunctionIndex < _jQueryFunctionsToAdd.length; jqueryFunctionIndex++) _addJQueryFunction(_jQueryFunctionsToAdd[jqueryFunctionIndex]);
+
+
+ // var _addJQueryEventFunction = function(name) {
+ // $ax.public.fn[name] = function() {
+ // $.fn[name].apply(this.jQuery(), arguments);
+ // return this;
+ // };
+ // };
+
+ // var _addJQueryEventFunction = function(name) {
+ // $ax.public.fn[name] = (function(nn) {
+ // return function() {
+ // $.fn[nn].apply(this.jQuery(), arguments);
+ // return this;
+ // };
+ // })(name);
+ // };
+
+ var _addJQueryEventFunction = function(name) {
+ $ax.public.fn[name] = function() {
+ //With Martin - No idea why this is necessary. We tried encapsulating the function thinking it was related to closure (above),
+ //but that didn't fix the problem. If we don't add this Repeaters will give "Uncaught TypeError: Object # has no method 'apply'"
+ //here (but Indeterminately, often on larger/slower Repeaters) because it is Undefined. However it seems the catch is never hit
+ //if we surround the statement with the try/catch. Perhaps the try/catch block creates a scope or closure.
+ try {
+ $.fn[name].apply(this.jQuery(), arguments);
+ } catch(e) {
+ console.log("Couldn't find the event: " + name);
+ }
+
+ return this;
+ };
+ };
+ var _jQueryEventFunctionsToAdd = ['click', 'mouseenter', 'mouseleave', 'bind'];
+ for(var jqueryEventIndex = 0; jqueryEventIndex < _jQueryEventFunctionsToAdd.length; jqueryEventIndex++) _addJQueryEventFunction(_jQueryEventFunctionsToAdd[jqueryEventIndex]);
+
+
+ $ax.public.fn.openLink = function(url, includeVariables) {
+ this.jQuery().each(function() {
+ if(!($(this).is('iframe'))) {
+ return;
+ }
+
+ var objIframe = $(this).get(0);
+
+ $ax.navigate({
+ url: url,
+ target: "frame",
+ includeVariables: includeVariables,
+ frame: objIframe
+ });
+ });
+
+ return this;
+ };
+
+ $ax.public.fn.SetPanelState = function(stateNumber, options, showWhenSet) {
+
+ var animateInInfo = _getAnimateInfo(options && options.animateIn, 500);
+ var animateOutInfo = _getAnimateInfo(options && options.animateOut, 500);
+
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+ if ($ax.public.fn.IsDynamicPanel($ax.getTypeFromElementId(elementId))) {
+ var stateName = $ax.visibility.GetPanelStateId(elementId, Number(stateNumber) - 1);
+ var wasVisible = $ax.visibility.IsIdVisible(elementId);
+ // If compressing because you are fit to content and the change of state may change size, must be before the change.
+ if(options.compress && $ax.dynamicPanelManager.isIdFitToContent(elementId) && wasVisible) {
+ $ax.dynamicPanelManager.compressDelta(elementId, $ax.visibility.GetPanelState(elementId), stateName, options.vertical, options.compressEasing, options.compressDuration);
+ }
+ $ax.visibility.SetPanelState(elementId, stateName, animateOutInfo.easingType, animateOutInfo.direction, animateOutInfo.duration,
+ animateInInfo.easingType, animateInInfo.direction, animateInInfo.duration, showWhenSet);
+ // If compressing because of a show, must be after state is set.
+ if(options.compress && !wasVisible && showWhenSet) {
+ $ax.dynamicPanelManager.compressToggle(elementId, options.vertical, true, options.compressEasing, options.compressDuration);
+ }
+ }
+ }
+
+ return this;
+ };
+
+ $ax.public.fn.show = function(options, eventInfo) {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+
+ var lightboxId = $ax.repeater.applySuffixToElementId(elementId, '_lightbox');
+ var lightbox = $jobj(lightboxId);
+ if(options && options.showType == 'lightbox') {
+ $ax.flyoutManager.unregisterPanel(elementId, true);
+ // Add lightbox if there isn't one
+ if(lightbox.length == 0) {
+ lightbox = $('
');
+ lightbox.attr('id', lightboxId);
+ var color = 'rgb(' + options.lightbox.r + ',' + options.lightbox.g + ',' + options.lightbox.b + ')';
+ lightbox.css({
+ position: 'fixed',
+ left: '0px',
+ top: '0px',
+ width: '10000px',
+ height: '10000px',
+ 'background-color': color,
+ opacity: options.lightbox.a / 255
+ });
+
+ var parents = $ax('#' + elementId).getParents(true, ['dynamicPanel'])[0];
+ var fixedParentPanelId = undefined;
+ for(var j = 0; j < parents.length; j++) {
+ var parentId = parents[j];
+ if($jobj(parentId).css('z-index') != 'auto' || $ax.features.supports.mobile) {
+ fixedParentPanelId = parents[j];
+ break;
+ }
+ }
+
+ if(!fixedParentPanelId) $('#base').append(lightbox);
+ else $jobj(fixedParentPanelId).append(lightbox);
+
+ var wasVisible = $ax.visibility.IsIdVisible(elementId);
+
+ (function(lightbox, query) {
+ $ax.event.attachClick(lightbox, function() {
+ $ax.action.addAnimation(elementId, $ax.action.queueTypes.fade, function() {
+ if(!wasVisible) query.hide();
+ else $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.fade);
+ lightbox.remove();
+ });
+ });
+ })(lightbox, this);
+ }
+ $ax.legacy.BringToFront(lightboxId, true);
+ $ax.legacy.BringToFront(elementId, true);
+ } else if(options && options.showType == 'flyout') {
+ // Remove lightbox if there is one
+ lightbox.remove();
+
+ var src = eventInfo.thiswidget;
+ var target = $ax.getWidgetInfo(elementId);
+ var rects = {};
+ if(src.valid) rects.src = $ax.geometry.genRect(src, true);
+ if(target.valid) rects.target = $ax.geometry.genRect(target, true);
+ $ax.flyoutManager.registerFlyout(rects, elementId, eventInfo.srcElement);
+ //$ax.style.AddRolloverOverride(elementId);
+ $ax.legacy.BringToFront(elementId);
+ } else {
+ // Remove lightbox, unregister flyout
+ lightbox.remove();
+ $ax.flyoutManager.unregisterPanel(elementId, true);
+ }
+ _setVisibility(elementId, true, options);
+ }
+
+ return this;
+ };
+
+ var _getAnimateInfo = function (options, defaultDuration, useHide) {
+ var animateInfo = {
+ duration: options && (useHide ? options.durationHide : options.duration) || defaultDuration
+ };
+
+ var easing = options && (useHide ? options.easingHide : options.easing) || 'none';
+ switch (easing) {
+ case 'fade':
+ animateInfo.easingType = 'fade';
+ animateInfo.direction = '';
+ break;
+ case 'slideLeft':
+ animateInfo.easingType = 'swing';
+ animateInfo.direction = 'left';
+ break;
+ case 'slideRight':
+ animateInfo.easingType = 'swing';
+ animateInfo.direction = 'right';
+ break;
+ case 'slideUp':
+ animateInfo.easingType = 'swing';
+ animateInfo.direction = 'up';
+ break;
+ case 'slideDown':
+ ;
+ animateInfo.easingType = 'swing';
+ animateInfo.direction = 'down';
+ break;
+ case 'flipLeft':
+ animateInfo.easingType = 'flip';
+ animateInfo.direction = 'left';
+ break;
+ case 'flipRight':
+ animateInfo.easingType = 'flip';
+ animateInfo.direction = 'right';
+ break;
+ case 'flipUp':
+ animateInfo.easingType = 'flip';
+ animateInfo.direction = 'up';
+ break;
+ case 'flipDown':
+ animateInfo.easingType = 'flip';
+ animateInfo.direction = 'down';
+ break;
+ default:
+ animateInfo.easingType = 'none';
+ animateInfo.direction = '';
+ }
+
+ return animateInfo;
+ };
+
+ $ax.public.fn.hide = function(options) {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+// var wasShown = $ax.visibility.IsIdVisible(elementId);
+ _setVisibility(elementId, false, options);
+ }
+
+ return this;
+ };
+
+ $ax.public.fn.toggleVisibility = function(options) {
+ var elementIds = this.getElementIds();
+
+ for (var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+ var show = !$ax.visibility.IsIdVisible(elementId);
+ _setVisibility(elementId, show, options, !show);
+ }
+
+ return this;
+ };
+
+ var _setVisibility = function (elementId, value, options, useHide) {
+ var animateInfo = _getAnimateInfo(options, 0, useHide);
+
+ var wasShown = $ax.visibility.IsIdVisible(elementId);
+ var compress = options && options.showType == 'compress' && wasShown != value;
+ if (compress) $ax.dynamicPanelManager.compressToggle(elementId, options.vertical, value, options.compressEasing, options.compressDuration);
+
+ var onComplete = function () {
+ $ax.dynamicPanelManager.fitParentPanel(elementId);
+ };
+ $ax.visibility.SetWidgetVisibility(elementId, {
+ value: value,
+ easing: animateInfo.easingType,
+ direction: animateInfo.direction,
+ duration: animateInfo.duration,
+ fire: true,
+ onComplete: onComplete
+ });
+
+ if(options && options.bringToFront) $ax.legacy.BringToFront(elementId);
+ };
+
+ $ax.public.fn.setOpacity = function(opacity, easing, duration) {
+ if(!easing || ! duration) {
+ easing = 'none';
+ duration = 0;
+ }
+
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+ var onComplete = function() {
+ $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.fade);
+ };
+
+ var query = $jobj(elementId);
+ if(duration == 0 || easing == 'none') {
+ query.css('opacity', opacity);
+ onComplete();
+ } else query.animate({ opacity: opacity }, { duration: duration, easing: easing, queue: false, complete: onComplete });
+ }
+ }
+ //move one widget. I didn't combine moveto and moveby, since this is in .public, and separate them maybe more clear for the user
+ var _move = function (elementId, x, y, options, moveTo) {
+ if(!options.easing) options.easing = 'none';
+ if(!options.duration) options.duration = 500;
+ var obj = $obj(elementId);
+
+ // Layer move using container now.
+ if($ax.public.fn.IsLayer(obj.type)) {
+ $ax.move.MoveWidget(elementId, x, y, options, moveTo,
+ function () {
+ if(options.onComplete) options.onComplete();
+ $ax.dynamicPanelManager.fitParentPanel(elementId);
+ }, false);
+ } else {
+ var xDelta = x;
+ var yDelta = y;
+ if (moveTo) {
+ var jobj = $jobj(elementId);
+
+ var left = Number(jobj.css('left').replace('px', ''));
+ var top = Number(jobj.css('top').replace('px', ''));
+ xDelta = x - left;
+ yDelta = y - top;
+ }
+ $ax.move.MoveWidget(elementId, xDelta, yDelta, options, false,
+ function () { $ax.dynamicPanelManager.fitParentPanel(elementId); }, true);
+ }
+ };
+
+ $ax.public.fn.moveTo = function (x, y, options) {
+ var elementIds = this.getElementIds();
+ for(var index = 0; index < elementIds.length; index++) {
+ _move(elementIds[index], x, y, options, true);
+ }
+
+ return this;
+ };
+
+ $ax.public.fn.moveBy = function (x, y, options) {
+ var elementIds = this.getElementIds();
+
+ if(x == 0 && y == 0) {
+ for(var i = 0; i < elementIds.length; i++) {
+ var elementId = elementIds[i];
+ $ax.move.nopMove(elementId, options);
+
+ //$ax.event.raiseSyntheticEvent(elementId, "onMove");
+ $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.move);
+
+ //if($axure.fn.IsLayer($obj(elementId).type)) {
+ // var childrenIds = $ax.public.fn.getLayerChildrenDeep(elementId, true);
+ // for(var j = 0; j < childrenIds.length; j++) $ax.event.raiseSyntheticEvent(childrenIds[j], 'onMove');
+ //}
+ }
+ return this;
+ }
+
+ for(var index = 0; index < elementIds.length; index++) {
+ _move(elementIds[index], x, y, options, false);
+ }
+ return this;
+ };
+
+ $ax.public.fn.circularMoveAndRotate = function(degreeChange, options, centerPointLeft, centerPointTop, doRotation, moveDelta, resizeOffset, rotatableMove, moveComplete) {
+ if(!rotatableMove) rotatableMove = { x: 0, y: 0 };
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+
+ var onComplete = function () {
+ $ax.dynamicPanelManager.fitParentPanel(elementId);
+ if (moveComplete) moveComplete();
+ }
+
+ $ax.move.circularMove(elementId, degreeChange, { x: centerPointLeft, y: centerPointTop }, moveDelta, rotatableMove, resizeOffset, options, true, onComplete, doRotation);
+ if(doRotation) $ax.move.rotate(elementId, degreeChange, options.easing, options.duration, false, true, function () { $ax.dynamicPanelManager.fitParentPanel(elementId); });
+ else $ax.action.fireAnimationFromQueue(elementId, $ax.action.queueTypes.rotate);
+ }
+ };
+
+ $ax.public.fn.rotate = function (degree, easing, duration, to, axShouldFire) {
+ var elementIds = this.getElementIds();
+ // this function will no longer handle compound vectors.
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+ degree = parseFloat(degree);
+ $ax.move.rotate(elementId, degree, easing, duration, to, axShouldFire, function () { $ax.dynamicPanelManager.fitParentPanel(elementId); });
+ }
+ };
+
+ $ax.public.fn.resize = function(newLocationAndSizeCss, resizeInfo, axShouldFire, moves, onCompletedFunc) {
+ var elementIds = this.getElementIds();
+ if(!elementIds) return;
+
+ var completeAndFire = function(moved, id) {
+ if(axShouldFire) {
+ $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.resize);
+ if(moves) $ax.action.fireAnimationFromQueue(id, $ax.action.queueTypes.move);
+ }
+
+ if(onCompletedFunc) onCompletedFunc();
+ };
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+
+ var obj = $obj(elementId);
+ if(!$ax.public.fn.IsResizable(obj.type)) {
+ //$ax.dynamicPanelManager.fitParentPanel(elementId);
+ completeAndFire(moves, elementId);
+ continue;
+ }
+
+ var oldSize = $ax('#' + elementId).size();
+ var oldWidth = oldSize.width;
+ var oldHeight = oldSize.height;
+ var query = $jobj(elementId);
+
+ var isDynamicPanel = $ax.public.fn.IsDynamicPanel(obj.type);
+ if(isDynamicPanel) {
+ // No longer fitToContent, calculate additional styling that needs to be done.
+ $ax.dynamicPanelManager.setFitToContentCss(elementId, false, oldWidth, oldHeight);
+
+ if (query.css('position') == 'fixed' && ((obj.fixedHorizontal && obj.fixedHorizontal == 'center') || (obj.fixedVertical && obj.fixedVertical == 'middle'))) {
+ moves = true;
+ var loc = $ax.dynamicPanelManager.getFixedPosition(elementId, oldWidth, oldHeight, newLocationAndSizeCss.width, newLocationAndSizeCss.height);
+ if(loc) {
+ if (loc[0] != 0 && !$ax.dynamicPanelManager.isPercentWidthPanel(obj)) newLocationAndSizeCss['margin-left'] = '+=' + (Number(newLocationAndSizeCss['margin-left'].substr(2)) + loc[0]);
+ if (loc[1] != 0) newLocationAndSizeCss['margin-top'] = '+=' + (Number(newLocationAndSizeCss['margin-top'].substr(2)) + loc[1]);
+ }
+ }
+
+ var onComplete = function() {
+ $ax.flyoutManager.updateFlyout(elementId);
+ $ax.dynamicPanelManager.fitParentPanel(elementId);
+ $ax.dynamicPanelManager.updatePanelPercentWidth(elementId);
+ $ax.dynamicPanelManager.updatePanelContentPercentWidth(elementId);
+
+ completeAndFire(moves, elementId);
+ $ax.event.raiseSyntheticEvent(elementId, 'onResize');
+ };
+
+ } else {
+ //if contains text
+ var textChildren = query.children('div.text');
+ if(textChildren && textChildren.length != 0) {
+ var textDivId = textChildren.attr('id');
+ var textObj = $ax('#' + textDivId);
+ var leftPadding = textObj.left(true);
+ var rightPadding = oldWidth - leftPadding - textObj.width();
+ //greater or equal to 1px
+ var newTextWidth = Math.max(newLocationAndSizeCss.width - leftPadding - rightPadding, 1);
+ var textChildCss = { width: newTextWidth };
+
+ var textStepFunction = function() {
+ //change the width of the text div may effect the height
+ //var currentTextHeight = Number($(textChildren.children('p')[0]).css('height').replace('px', ''));
+ //textChildren.css('height', currentTextHeight);
+ var display = $ax.public.fn.displayHackStart(document.getElementById(textDivId));
+ $ax.style.updateTextAlignmentForVisibility(textDivId);
+ $ax.public.fn.displayHackEnd(display);
+ };
+ }
+
+ //get all the other children that matters
+ onComplete = function() {
+ $ax.dynamicPanelManager.fitParentPanel(elementId);
+ completeAndFire(moves, elementId);
+
+ $ax.annotation.adjustIconLocation(elementId);
+ $ax.event.raiseSyntheticEvent(elementId, 'onResize');
+ };
+ }
+
+ var children = query.children().not('div.text');
+ while(children && children.length && $(children[0]).attr('id').indexOf('container') != -1) {
+ children = children.children().not('div.text');
+ }
+
+ if(children && children.length !== 0) {
+ var childAnimationArray = [];
+ var isConnector = $ax.public.fn.IsConnector(obj.type);
+ children.each(function (i, child) {
+ var childCss = {
+ width: newLocationAndSizeCss.width,
+ height: newLocationAndSizeCss.height
+ };
+
+ //$ax.size() use outerWidth/Height(false), which include padding and borders(no margins)
+ var childSizingObj = $ax('#' + child.id).size();
+ var differentSizedImage = childSizingObj.width - oldWidth != 0 || childSizingObj.height - oldHeight != 0;
+ if ((differentSizedImage || isConnector) && child.tagName == 'IMG') {
+ //oldwidth is zero for connectors
+ var widthOffset = oldWidth ? (childSizingObj.width - oldWidth) * newLocationAndSizeCss.width / oldWidth : childSizingObj.width;
+ var heightOffset = oldHeight ? (childSizingObj.height - oldHeight) * newLocationAndSizeCss.height / oldHeight : childSizingObj.height;
+
+ childCss.width += widthOffset;
+ childCss.height += heightOffset;
+ }
+ //there are elements like inputs, come with a padding and border, so need to use outerwidth for starting point, due to jquery 1.7 css() on width/height bugs
+ if($(child).css('position') === 'absolute') {
+ if(child.offsetLeft) {
+ childSizingObj.left = child.offsetLeft;
+ childCss.left = oldWidth ? child.offsetLeft * newLocationAndSizeCss.width / oldWidth : child.offsetLeft; //- transformedShift.x;
+ }
+ if(child.offsetTop) {
+ childSizingObj.top = child.offsetTop;
+ childCss.top = oldHeight ? child.offsetTop * newLocationAndSizeCss.height / oldHeight : child.offsetTop; //- transformedShift.y;
+ }
+ }
+ childAnimationArray.push({ obj: child, sizingObj: childSizingObj, sizingCss: childCss });
+ });
+ }
+
+ if(!resizeInfo.easing || resizeInfo.easing == 'none') {
+ query.animate(newLocationAndSizeCss, 0);
+ if(childAnimationArray) {
+ $(childAnimationArray).each(function (i, animationObj) {
+ if(animationObj.resizeMatrixFunction) {
+ $(animationObj.obj).css($ax.public.fn.setTransformHowever(animationObj.resizeMatrixFunction(animationObj.width, animationObj.height)));
+ } else {
+ $(animationObj.obj).animate(animationObj.sizingCss, 0);
+ }
+ });
+ }
+ //if(childCss) children.animate(childCss, 0);
+ //if(sketchyImage && sketchyImageCss) $(sketchyImage).animate(sketchyImageCss, 0);
+ if(textChildCss) {
+ textChildren.animate(textChildCss, {
+ duration: 0,
+ step: textStepFunction
+ });
+ }
+ onComplete();
+ } else {
+ if(childAnimationArray) {
+ $(childAnimationArray).each(function (i, animationObj) {
+ if(animationObj.resizeMatrixFunction) {
+ $(animationObj.sizingObj).animate(animationObj.sizingCss, {
+ queue: false,
+ duration: resizeInfo.duration,
+ easing: resizeInfo.easing,
+ step: function (now) {
+ var widthRatio = (animationObj.width - 1.0) * now + 1.0;
+ var heightRatio = (animationObj.height - 1.0) * now + 1.0;
+ $(animationObj.obj).css($ax.public.fn.setTransformHowever(animationObj.resizeMatrixFunction(widthRatio, heightRatio)));
+ }
+ });
+ } else {
+ $(animationObj.sizingObj).animate(animationObj.sizingCss, {
+ queue: false,
+ duration: resizeInfo.duration,
+ easing: resizeInfo.easing,
+ step: function (now, tween) {
+ $(animationObj.obj).css(tween.prop, now);
+ }
+ });
+ }
+ });
+ }
+
+ if(textChildCss) {
+ textChildren.animate(textChildCss, {
+ queue: false,
+ duration: resizeInfo.duration,
+ easing: resizeInfo.easing,
+ step: textStepFunction
+ });
+ }
+
+ if(isDynamicPanel) {
+ query.animate(newLocationAndSizeCss, { queue: false, duration: resizeInfo.duration, easing: resizeInfo.easing, complete: onComplete });
+ } else {
+ var locObj = {
+ left: $ax.public.fn.GetFieldFromStyle(query, 'left'), top: $ax.public.fn.GetFieldFromStyle(query, 'top'),
+ width: $ax.public.fn.GetFieldFromStyle(query, 'width'), height: $ax.public.fn.GetFieldFromStyle(query, 'height'),
+ };
+ $(locObj).animate(newLocationAndSizeCss, {
+ queue: false,
+ duration: resizeInfo.duration,
+ easing: resizeInfo.easing,
+ step: function (now, tween) {
+ query.css(tween.prop, now);
+ },
+ complete: onComplete
+ });
+ }
+ }
+ }
+ };
+
+ $ax.public.fn.bringToFront = function() {
+ var elementIds = this.getElementIds();
+ for(var index = 0; index < elementIds.length; index++) { $ax.legacy.BringToFront(elementIds[index]); }
+ return this;
+ };
+
+ $ax.public.fn.sendToBack = function() {
+ var elementIds = this.getElementIds();
+ for(var index = 0; index < elementIds.length; index++) { $ax.legacy.SendToBack(elementIds[index]); }
+ return this;
+ };
+
+ $ax.public.fn.text = function() {
+ if(arguments[0] == undefined) {
+ var firstId = this.getElementIds()[0];
+
+ if(!firstId) { return undefined; }
+
+ return getWidgetText(firstId);
+ } else {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var currentItem = elementIds[index];
+
+ var widgetType = $ax.getTypeFromElementId(currentItem);
+
+ if($ax.public.fn.IsTextBox(widgetType) || $ax.public.fn.IsTextArea(widgetType)) { //For non rtf
+ SetWidgetFormText(currentItem, arguments[0]);
+ } else {
+ var idRtf = '#' + currentItem;
+ if($(idRtf).length == 0) idRtf = '#u' + (Number(currentItem.substring(1)) + 1);
+
+ if($(idRtf).length != 0) {
+ //If the richtext div already has some text in it,
+ //preserve only the first style and get rid of the rest
+ //If no pre-existing p-span tags, don't do anything
+ if($(idRtf).find('p').find('span').length > 0) {
+ $(idRtf).find('p:not(:first)').remove();
+ $(idRtf).find('p').find('span:not(:first)').remove();
+
+ //Replace new-lines with NEWLINE token, then html encode the string,
+ //finally replace NEWLINE token with linebreak
+ var textWithLineBreaks = arguments[0].replace(/\n/g, '--NEWLINE--');
+ var textHtml = $('
').text(textWithLineBreaks).html();
+ $(idRtf).find('span').html(textHtml.replace(/--NEWLINE--/g, ']*>/ig, '\n').replace(/ /ig, ' ');
+ textOut += $(htmlContent).text();
+ });
+
+ return textOut;
+ } else {
+ var val = idQuery.val();
+ return val == undefined ? '' : val;
+ }
+ };
+
+ var isSoloBr = function(html) {
+ html = $(html);
+ // Html needs one and only one span
+ var spanChildren = html.length == 1 && html.is('span') ? html.children() : false;
+ // Span children needs exactly one br and no text in the span
+ return spanChildren && spanChildren.length == 1 && spanChildren.is('br') && spanChildren.text().trim() == '';
+ };
+
+ $ax.public.fn.setRichTextHtml = function() {
+ if(arguments[0] == undefined) {
+ //No getter function, so just return undefined
+ return undefined;
+ } else {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var currentItem = elementIds[index];
+
+ var widgetType = $ax.getTypeFromElementId(currentItem);
+ if ($ax.public.fn.IsTextBox(widgetType) || $ax.public.fn.IsTextArea(widgetType)) { //Do nothing for non rtf
+ continue;
+ } else {
+ //TODO -- [mas] fix this!
+ var idRtf = '#' + currentItem;
+ if($(idRtf).length == 0) idRtf = '#u' + (parseInt(currentItem.substring(1)) + 1);
+ if($(idRtf).length != 0) SetWidgetRichText(idRtf, arguments[0]);
+ }
+ }
+
+ return this;
+ }
+ };
+
+ $ax.public.fn.value = function() {
+ if(arguments[0] == undefined) {
+ var firstId = this.getElementIds()[0];
+
+ if(!firstId) {
+ return undefined;
+ }
+
+ var widgetType = $ax.getTypeFromElementId(firstId);
+
+ if ($ax.public.fn.IsComboBox(widgetType) || $ax.public.fn.IsListBox(widgetType)) { //for select lists and drop lists
+ return $('#' + firstId + ' :selected').text();
+ } else if ($ax.public.fn.IsCheckBox(widgetType) || $ax.public.fn.IsRadioButton(widgetType)) { //for radio/checkboxes
+ return $('#' + firstId + '_input').is(':checked');
+ } else if ($ax.public.fn.IsTextBox(widgetType)) { //for text box
+ return $('#' + firstId + '_input').val();
+ } else { //for text based form elements
+ return this.jQuery().first().val();
+ }
+ } else {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var widgetType = $ax.getTypeFromElementId(elementIds[index]);
+
+ var elementIdQuery = $('#' + elementIds[index]);
+
+ if ($ax.public.fn.IsCheckBox(widgetType) || $ax.public.fn.IsRadioButton(widgetType)) { //for radio/checkboxes
+ if(arguments[0] == true) {
+ elementIdQuery.attr('checked', true);
+ } else if(arguments[0] == false) {
+ elementIdQuery.removeAttr('checked');
+ }
+ } else { //For select lists, drop lists, text based form elements
+ elementIdQuery.val(arguments[0]);
+ }
+ }
+
+ return this;
+ }
+ };
+
+ $ax.public.fn.checked = function() {
+ if(arguments[0] == undefined) {
+ return this.selected();
+ } else {
+ this.selected(arguments[0]);
+ return this;
+ }
+ };
+
+ var _getRelativeLeft = function (id, parent) {
+ var currentNode = window.document.getElementById(id).offsetParent;
+ var left = $ax('#' + id).left(true);
+ while (currentNode != null && currentNode.tagName != "BODY" && currentNode != parent) {
+ left += currentNode.offsetLeft;
+ currentNode = currentNode.offsetParent;
+ }
+ return left;
+ };
+
+ var _getRelativeTop = function(id, parent) {
+ var currentNode = window.document.getElementById(id).offsetParent;
+ var top = $ax('#' + id).top(true);
+ while(currentNode != null && currentNode.tagName != "BODY" && currentNode != parent) {
+ top += currentNode.offsetTop;
+ currentNode = currentNode.offsetParent;
+ }
+ return top;
+ };
+
+ var _scrollHelper = function(id, scrollX, scrollY, easing, duration) {
+ var target = window.document.getElementById(id);
+ var scrollable = $ax.legacy.GetScrollable(target);
+ var targetLeft = _getRelativeLeft(id, scrollable);
+ var targetTop = _getRelativeTop(id, scrollable);
+ if(!scrollX) targetLeft = scrollable.scrollLeft;
+ if(!scrollY) targetTop = scrollable.scrollTop;
+
+ var $scrollable = $(scrollable);
+ if($scrollable.is('body')) {
+ $scrollable = $('html,body');
+ }
+
+ if(easing == 'none') {
+ if(scrollY) $scrollable.scrollTop(targetTop);
+ if(scrollX) $scrollable.scrollLeft(targetLeft);
+ } else {
+ if(!scrollX) {
+ $scrollable.animate({ scrollTop: targetTop }, duration, easing);
+ } else if(!scrollY) {
+ $scrollable.animate({ scrollLeft: targetLeft }, duration, easing);
+ } else {
+ $scrollable.animate({ scrollTop: targetTop, scrollLeft: targetLeft }, duration, easing);
+ }
+ }
+ };
+
+ $ax.public.fn.scroll = function(scrollOption) {
+ var easing = 'none';
+ var duration = 500;
+
+ if(scrollOption && scrollOption.easing) {
+ easing = scrollOption.easing;
+
+ if(scrollOption.duration) {
+ duration = scrollOption.duration;
+ }
+ }
+
+ var scrollX = true;
+ var scrollY = true;
+
+ if(scrollOption.direction == 'vertical') {
+ scrollX = false;
+ } else if(scrollOption.direction == 'horizontal') {
+ scrollY = false;
+ }
+
+ var elementIds = this.getElementIds();
+ for(var index = 0; index < elementIds.length; index++) {
+ // if($ax.getTypeFromElementId(elementIds[index]) == IMAGE_MAP_REGION_TYPE) {
+ _scrollHelper(elementIds[index], scrollX, scrollY, easing, duration);
+ // }
+ }
+
+ return this;
+ };
+
+ $ax.public.fn.enabled = function() {
+ if(arguments[0] == undefined) {
+ var firstId = this.getElementIds()[0];
+ if(!firstId) return undefined;
+
+ var widgetType = $ax.getTypeFromElementId(firstId);
+ if ($ax.public.fn.IsImageBox(widgetType) || $ax.public.fn.IsVector(widgetType)) return !$ax.style.IsWidgetDisabled(firstId);
+ else return this.jQuery().first().not(':disabled').length > 0;
+ } else {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+ var widgetType = $ax.getTypeFromElementId(elementId);
+
+ var enabled = arguments[0];
+ if ($ax.public.fn.IsImageBox(widgetType) || $ax.public.fn.IsVector(widgetType)) $ax.style.SetWidgetEnabled(elementId, enabled);
+ if ($ax.public.fn.IsDynamicPanel(widgetType) || $ax.public.fn.IsLayer(widgetType)) {
+ $ax.style.SetWidgetEnabled(elementId, enabled);
+ var children = this.getChildren()[index].children;
+ for(var i = 0; i < children.length; i++) {
+ $axure('#' + children[i]).enabled(enabled);
+ }
+ }
+ var obj = $obj(elementId);
+ var images = obj.images;
+ if(PLAIN_TEXT_TYPES.indexOf(widgetType) != -1 && images) {
+ var img = $jobj($ax.repeater.applySuffixToElementId(elementId, '_image_sketch'));
+ var key = (enabled ? 'normal~' : 'disabled~') + ($ax.adaptive.currentViewId || '');
+ img.attr('src', images[key]);
+
+ }
+ var jobj = $jobj(elementId);
+ var input = $jobj($ax.INPUT(elementId));
+ if(input.length) jobj = input;
+
+ if (OS_MAC && WEBKIT && $ax.public.fn.IsComboBox(widgetType)) jobj.css('color', enabled ? '' : 'grayText');
+
+ if(enabled) jobj.removeAttr('disabled');
+ else jobj.attr('disabled', 'disabled');
+ }
+
+ return this;
+ }
+ };
+
+ $ax.public.fn.visible = function() {
+ var ids = this.getElementIds();
+ for(var index = 0; index < ids.length; index++) $ax.visibility.SetIdVisible(ids[index], arguments[0]);
+ return this;
+ };
+
+ $ax.public.fn.selected = function() {
+ if(arguments[0] == undefined) {
+ var firstId = this.getElementIds()[0];
+ if(!firstId) return undefined;
+
+ var widgetType = $ax.getTypeFromElementId(firstId);
+ if ($ax.public.fn.IsTreeNodeObject(widgetType)) {
+ var treeNodeButtonShapeId = '';
+ var allElementIds = $ax.getAllElementIds();
+ for(var i = 0; i < allElementIds.length; i++) {
+ var elementId = allElementIds[i];
+ var currObj = $ax.getObjectFromElementId(elementId);
+
+ if ($ax.public.fn.IsVector(currObj.type) && currObj.parent && currObj.parent.scriptIds && currObj.parent.scriptIds[0] == firstId) {
+ treeNodeButtonShapeId = elementId;
+ break;
+ }
+ }
+
+ if(treeNodeButtonShapeId == '') return undefined;
+ return $ax.style.IsWidgetSelected(treeNodeButtonShapeId);
+ } else if ($ax.public.fn.IsImageBox(widgetType) || $ax.public.fn.IsVector(widgetType) || $ax.public.fn.IsTableCell(widgetType) || $ax.public.fn.IsDynamicPanel(widgetType) || $ax.public.fn.IsLayer(widgetType)) {
+ return $ax.style.IsWidgetSelected(firstId);
+ } else if ($ax.public.fn.IsCheckBox(widgetType) || $ax.public.fn.IsRadioButton(widgetType)) {
+ return $jobj($ax.INPUT(firstId)).prop('checked');
+ }
+ return this;
+ }
+ var elementIds = this.getElementIds();
+ var func = typeof (arguments[0]) === 'function' ? arguments[0] : null;
+ var enabled = arguments[0]; // If this is a function it will be overridden with the return value;
+
+ for(var index = 0; index < elementIds.length; index++) {
+ var elementId = elementIds[index];
+ if(func) {
+ enabled = func($axure('#' + elementId));
+ }
+
+ var widgetType = $ax.getTypeFromElementId(elementId);
+
+ if ($ax.public.fn.IsTreeNodeObject(widgetType)) { //for tree node
+ var treeRootId = $('#' + elementIds[index]).parents('.treeroot').attr('id');
+
+ var treeNodeButtonShapeId = '';
+ var childElementIds = $jobj(elementId).children();
+ for(var i = 0; i < childElementIds.length; i++) {
+ var elementId = childElementIds[i].id;
+ var currObj = $ax.getObjectFromElementId(elementId);
+
+ if (currObj && currObj.type == $ax.constants.VECTOR_SHAPE_TYPE && currObj.parent &&
+ currObj.parent.scriptIds && currObj.parent.scriptIds[0] == elementIds[index]) {
+ treeNodeButtonShapeId = elementId;
+ break;
+ }
+ }
+
+ if(treeNodeButtonShapeId == '') continue;
+
+ $ax.tree.SelectTreeNode(elementId, enabled);
+ } else if ($ax.public.fn.IsImageBox(widgetType) || $ax.public.fn.IsVector(widgetType) || $ax.public.fn.IsVector(widgetType) || $ax.public.fn.IsTableCell(widgetType) || $ax.public.fn.IsDynamicPanel(widgetType) || $ax.public.fn.IsLayer(widgetType)) {
+ $ax.style.SetWidgetSelected(elementIds[index], enabled);
+ } else if ($ax.public.fn.IsCheckBox(widgetType) || $ax.public.fn.IsRadioButton(widgetType)) {
+ var query = $jobj($ax.INPUT(elementId));
+ var curr = query.prop('checked');
+ //NOTE: won't fire onselect nore onunselect event if states didn't changes
+ if(curr != enabled) {
+ query.prop('checked', enabled);
+ $ax.event.TryFireCheckChanged(elementId, enabled);
+ }
+ }
+ }
+ return this;
+ };
+
+ $ax.public.fn.focus = function() {
+ var firstId = this.getElementIds()[0];
+ var focusableId = $ax.event.getFocusableWidgetOrChildId(firstId);
+ $('#' + focusableId).focus();
+
+ return this;
+ };
+
+ $ax.public.fn.expanded = function() {
+ if(arguments[0] == undefined) {
+ var firstId = this.getElementIds()[0];
+ return firstId && !$ax.public.fn.IsTreeNodeObject($ax.getTypeFromElementId(firstId)) && $ax.visibility.IsIdVisible(firstId + '_children');
+ } else {
+ var elementIds = this.getElementIds();
+
+ for(var index = 0; index < elementIds.length; index++) {
+ if ($ax.public.fn.IsTreeNodeObject($ax.getTypeFromElementId(elementIds[index]))) {
+ var treeNodeId = elementIds[index];
+ var childContainerId = treeNodeId + '_children';
+
+ var scriptId = $ax.repeater.getScriptIdFromElementId(treeNodeId);
+ var itemId = $ax.repeater.getItemIdFromElementId(treeNodeId);
+ var plusMinusId = 'u' + (parseInt(scriptId.substring(1)) + 1);
+ if(itemId) plusMinusId = $ax.repeater.createElementId(plusMinusId, itemId);
+ if($('#' + childContainerId).length == 0 || !$jobj(plusMinusId).children().first().is('img'))
+ plusMinusId = '';
+
+ if(arguments[0] == true) {
+ $ax.tree.ExpandNode(treeNodeId, childContainerId, plusMinusId);
+ } else if(arguments[0] == false) {
+ $ax.tree.CollapseNode(treeNodeId, childContainerId, plusMinusId);
+ }
+ }
+ }
+
+ return this;
+ }
+ };
+
+ $ax.public.fn.size = function () {
+ var firstId = this.getElementIds()[0];
+ if(!firstId) return undefined;
+
+ var object = $ax.getObjectFromElementIdDisregardHex(firstId);
+ if(object && (object.type == 'layer' || object.generateCompound)) {
+ var boundingRect = $ax.public.fn.getWidgetBoundingRect(firstId);
+ return { width: boundingRect.width, height: boundingRect.height };
+ }
+
+ var firstIdObject = $jobj(firstId);
+ var trap = _displayWidget($ax.repeater.removeSuffixFromElementId(firstId));
+ var size = { width: firstIdObject.outerWidth(), height: firstIdObject.outerHeight() };
+ trap();
+ return size;
+ };
+
+ $ax.public.fn.width = function() {
+ var firstId = this.getElementIds()[0];
+ if(!firstId) return undefined;
+
+ var object = $ax.getObjectFromElementIdDisregardHex(firstId);
+ if (object && (object.type == 'layer' || object.generateCompound)) {
+ var boundingRect = $ax.public.fn.getWidgetBoundingRect(firstId);
+ return boundingRect.width;
+ }
+
+ var firstIdObject = $jobj(firstId);
+
+ return firstIdObject.outerWidth();
+ };
+
+ $ax.public.fn.height = function() {
+ var firstId = this.getElementIds()[0];
+ if(!firstId) return undefined;
+
+ var object = $ax.getObjectFromElementIdDisregardHex(firstId);
+ if (object && (object.type == 'layer' || object.generateCompound)) {
+ var boundingRect = $ax.public.fn.getWidgetBoundingRect(firstId);
+ return boundingRect.height;
+ }
+
+ var firstIdObject = $jobj(firstId);
+
+ return firstIdObject.outerHeight();
+ };
+
+ $ax.public.fn.readAttribute = function(object, attribute) {
+ if(object && object.hasAttribute(attribute)) {
+ return object.getAttribute(attribute);
+ }
+ return null;
+ };
+
+ $ax.public.fn.locRelativeIgnoreLayer = function (vert) {
+ var elementId = this.getElementIds()[0];
+ if(!elementId) return undefined;
+
+ var parents = this.getParents(true, '*')[0];
+
+ for(var i = 0; i < parents.length; i++) {
+ var type = $ax.getTypeFromElementId(parents[i]);
+ if(!$axure.fn.IsLayer(type) && !$axure.fn.IsReferenceDiagramObject(type)) {
+ var func = vert ? _getRelativeTop : _getRelativeLeft;
+ return func(elementId, $jobj(parents[i])[0]);
+ }
+ }
+ var axThis = $ax('#' + elementId);
+ return vert ? axThis.top() : _bodyToWorld(axThis.left(), true);
+ };
+
+ var _bodyToWorld = $axure.fn.bodyToWorld = function(x, from) {
+ var body = $('body');
+ if (body.css('position') != 'relative') return x;
+ var offset = (Number(body.css('left').replace('px', '')) + Math.max(0, ($(window).width() - body.width()) / 2));
+ if(from) offset *= -1;
+ return x + offset;
+ }
+
+ $ax.public.fn.left = function (relative) {
+ var firstId = this.getElementIds()[0];
+ if(!firstId) return undefined;
+
+ var left = _getLoc(firstId, false, false, relative);
+
+ // If you are absolute, unless your are a pinned panel...
+ if(relative || $obj(firstId) && $obj(firstId).fixedVertical) return left;
+
+ // ... or you are in one...
+ var parentPanels = $ax('#' + firstId).getParents(true, 'dynamicPanel')[0];
+ for(var i = 0; i < parentPanels.length; i++) if ($obj(parentPanels[i]).fixedVertical) return left;
+
+ // ... you must convert from body to world coordinates
+ return _bodyToWorld(left);
+ };
+
+ $ax.public.fn.top = function(relative) {
+ var firstId = this.getElementIds()[0];
+ return firstId && _getLoc(firstId, true, false, relative);
+ };
+
+ var _getLoc = function(id, vert, high, relative) {
+ var mathFunc = high ? 'max' : 'min';
+ var prop = vert ? 'top' : 'left';
+ var dim = vert ? 'height' : 'width';
+
+ var obj = $jobj(id);
+ var strippedId = $ax.repeater.removeSuffixFromElementId(id);
+ var axObj = $obj(strippedId);
+ var oldDisplay = obj.css('display');
+ var displaySet = false;
+ if(oldDisplay == 'none') {
+ obj.css('display', '');
+ displaySet = true;
+ }
+ var loc = Math.NaN;
+ var rdo = axObj.type == $ax.constants.REFERENCE_DIAGRAM_OBJECT_TYPE;
+
+ if (!rdo) loc = $ax.getNumFromPx(obj.css(prop));
+
+ var fixed = _fixedOffset(id, vert);
+ if(fixed.valid) loc = !vert && fixed.fullWidth ? 0 : fixed.offset;
+ else if (!relative) {
+ var parents = [];
+ var parObj = id.indexOf('text') != -1 ? axObj : axObj.parent; // When working with text id, parent widget is the ax obj we are dealing with, so that should be the first parent
+ while($ax.public.fn.IsContainer(parObj.type)) {
+ parents.push($ax.getScriptIdFromPath([parObj.id], strippedId));
+ parObj = parObj.parent;
+ }
+ var otherParents = $ax('#' + id).getParents(true, ['item', 'repeater', 'dynamicPanel', 'layer'])[0];
+ for(var i = 0; i < otherParents.length; i++) {
+ parents.push(otherParents[i]);
+ }
+
+ for(var i = 0; i < parents.length; i++) {
+ var parentId = $ax.visibility.getWidgetFromContainer(parents[i]);
+ var parent = $ax.visibility.applyWidgetContainer(parentId, true);
+
+ // Layer may not have container, and will be at 0,0 otherwise.
+ if (!parent.length) continue;
+
+ fixed = _fixedOffset(parentId, vert);
+ if(fixed.valid) {
+ loc += fixed.offset;
+ break; // If fixed ignore any parents if there are any, they don't matter.
+ } else loc += $ax.getNumFromPx(parent.css(prop));
+ }
+ }
+
+ if (high) loc += obj[dim]();
+
+ // Special Layer code
+ if (axObj.type == 'layer') {
+ // If layer has a container, then use that. Otherwise must deal with children. Children can move in container after created, but ignoring for now.
+ var container = $ax.visibility.applyWidgetContainer(id, true, true);
+ if(container.length) loc += $ax.getNumFromPx(container.css(prop));
+ else loc += (_getChildLoc(axObj.objs, vert, high, dim, true, id) || 0);
+ }
+
+ if(displaySet) obj.css('display', oldDisplay);
+ return loc;
+ };
+
+ var _getChildLoc = function (children, vert, high, dim, root, path, itemId) {
+ if (typeof (path) == 'string') {
+ itemId = $ax.repeater.getItemIdFromElementId(path);
+ path = $ax.getPathFromScriptId(path);
+ path.pop(); // Remove object id, only want rdo path.
+ }
+ var mathFunc = high ? 'max' : 'min';
+ var childLoc = NaN;
+ for (var i = 0; i < children.length; i++) {
+ var childObj = children[i];
+ var childId = $ax.getElementIdFromPath([childObj.id], { relativeTo: path });
+ if (!childId) continue;
+ childId = $ax.repeater.createElementId(childId, itemId);
+ if($ax.public.fn.IsReferenceDiagramObject(childObj.type)) {
+ path.push(childObj.id);
+ var childProp = _getChildLoc($ax.pageData.masters[$obj(childId).masterId].diagram.objects, vert, high, dim, false, path, itemId);
+ path.pop();
+ if(isNaN(childProp)) continue;
+ } else if($ax.public.fn.IsLayer(childObj.type)) {
+ childProp = _getChildLoc(childObj.objs, vert, high, dim, false, path, itemId);
+ } else {
+ if(!$ax.visibility.IsIdVisible(childId)) continue;
+ childProp = $ax('#' + childId).locRelativeIgnoreLayer(vert);
+ if(high) childProp += $jobj(childId)[dim]();
+ }
+
+ if(isNaN(childLoc)) childLoc = childProp;
+ else if(!isNaN(childProp)) childLoc = Math[mathFunc](childLoc, childProp);
+ }
+
+ return root && isNaN(childLoc) ? 0 : childLoc;
+ };
+
+ var _fixedOffset = function (id, vert) {
+ var axObj = $obj(id);
+ //I think this is only for pinned panels? So why are we coming through here for rtps?
+ if(!axObj) return { valid: false };
+
+ var dim = vert ? 'height' : 'width';
+ var alignment = axObj['fixed' + (vert ? 'Vertical' : 'Horizontal')];
+ if(!alignment) return { valid: false };
+ var loc = 0;
+
+ // TODO: This returns 0 for width/height it or any parent is display none. Similar issue when using axquery width/height
+ // TODO: Look into replacing this with axquery width/height and fixing that to use this hack. Potentially want to make js generic trapper.
+ var trap = _displayWidget(id);
+ var query = $jobj(id);
+ var objSize = query[dim]();
+ trap();
+
+ if(alignment == 'center' || alignment == 'middle') {
+ loc = $ax.getNumFromPx(query.css('margin-' + (vert ? 'top' : 'left')));
+ loc += ($(window)[dim]()) / 2;
+ } else if(alignment == 'bottom' || alignment == 'right') {
+ loc = $ax.getNumFromPx(query.css(vert ? 'bottom' : 'right'));
+ loc = $(window)[dim]() - objSize - loc; // subract loc because margin here moves farther left/up as it gets bigger.
+ } else {
+ loc = $ax.getNumFromPx(query.css(vert ? 'top' : 'left'));
+ }
+
+ var scrollKey = 'scroll' + (vert ? 'Top' : 'Left');
+ return { offset: $(window)[scrollKey]() + loc, valid: true, fullWidth: axObj.percentWidth == 1 };
+ };
+
+ var _displayWidget = function(id) {
+ var parents = $ax('#' + id).getParents(true, '*')[0];
+ parents.push(id); // also need to show self
+
+ var displayed = [];
+ for(var i = 0; i < parents.length; i++) {
+ var currId = parents[i];
+ var currObj = $jobj(currId);
+ if(currObj.css('display') == 'none') {
+ currObj.css('display', 'block');
+ displayed.push(currId);
+ }
+ }
+
+ return function() {
+ for(var i = 0; i < displayed.length; i++) {
+ $jobj(displayed[i]).css('display', 'none');
+ }
+ };
+ }
+});
+
+//***** doc.js *****//
+$axure.internal(function($ax) {
+ var _pageData;
+
+
+ var _initializePageFragment = function(pageFragment, objIdToObject) {
+ var objectArrayHelper = function(objects, parent) {
+ for(var i = 0; i < objects.length; i++) {
+ diagramObjectHelper(objects[i], parent);
+ }
+ };
+
+ var diagramObjectHelper = function(diagramObject, parent) {
+ $ax.initializeObject('diagramObject', diagramObject);
+ objIdToObject[pageFragment.packageId + '~' + diagramObject.id] = diagramObject;
+ diagramObject.parent = parent;
+ diagramObject.owner = pageFragment;
+ diagramObject.scriptIds = [];
+ if(diagramObject.diagrams) { //dynamic panel
+ for(var i = 0; i < diagramObject.diagrams.length; i++) {
+ var diagram = diagramObject.diagrams[i];
+ objectArrayHelper(diagram.objects, diagram);
+ }
+ } else if($ax.public.fn.IsLayer(diagramObject.type)) {
+ var layerObjs = diagramObject.objs;
+ objectArrayHelper(layerObjs, parent);
+ }
+ if(diagramObject.objects) objectArrayHelper(diagramObject.objects, diagramObject);
+ };
+ objectArrayHelper(pageFragment.diagram.objects, pageFragment.diagram);
+ };
+
+ var _initalizeStylesheet = function(stylesheet) {
+ var stylesById = {};
+ var customStyles = stylesheet.customStyles;
+ for(var key in customStyles) {
+ var style = customStyles[key];
+ stylesById[style.id] = style;
+ }
+ var duplicateStyles = stylesheet.duplicateStyles;
+ for(var duplicateKey in duplicateStyles) {
+ stylesById[duplicateKey] = stylesById[duplicateStyles[duplicateKey]];
+ }
+
+ stylesheet.stylesById = stylesById;
+ };
+
+
+ var _initializeDocumentData = function() {
+ _initalizeStylesheet($ax.document.stylesheet);
+ };
+
+
+ var _initializePageData;
+ // ******* Dictionaries ******** //
+ (function() {
+ var scriptIdToParentLayer = {};
+ var elementIdToObject = {};
+ var scriptIdToObject = {};
+ var scriptIdToRepeaterId = {};
+ var repeaterIdToScriptIds = {};
+ var repeaterIdToItemIds = {};
+ var scriptIdToPath = {};
+ var _scriptIds = [];
+ var elementIdToText = {};
+ var radioGroupToSelectedElementId = {};
+ _initializePageData = function() {
+ if(!_pageData || !_pageData.page || !_pageData.page.diagram) return;
+
+ var objIdToObject = {};
+ _initializePageFragment(_pageData.page, objIdToObject);
+ for(var masterId in _pageData.masters) {
+ var master = _pageData.masters[masterId];
+ _initializePageFragment(master, objIdToObject);
+ }
+
+ var _pathsToScriptIds = [];
+ _pathToScriptIdHelper(_pageData.objectPaths, [], _pathsToScriptIds, scriptIdToPath);
+
+ for(var i = 0; i < _pathsToScriptIds.length; i++) {
+ var path = _pathsToScriptIds[i].idPath;
+ var scriptId = _pathsToScriptIds[i].scriptId;
+
+ var packageId = _pageData.page.packageId;
+ if(path.length > 1) {
+ for(var j = 0; j < path.length - 1; j++) {
+ var rdoId = path[j];
+ var rdo = objIdToObject[packageId + '~' + rdoId];
+ packageId = rdo.masterId;
+ }
+ }
+ var diagramObject = objIdToObject[packageId + '~' + path[path.length - 1]];
+ diagramObject.scriptIds[diagramObject.scriptIds.length] = scriptId;
+
+ scriptIdToObject[scriptId] = diagramObject;
+ _scriptIds[_scriptIds.length] = scriptId;
+ }
+
+ // Now map scriptIds to repeaters and layers
+ var mapScriptIdToRepeaterId = function(scriptId, repeaterId) {
+ scriptIdToRepeaterId[scriptId] = repeaterId;
+ var scriptIds = repeaterIdToScriptIds[repeaterId];
+ if(scriptIds) scriptIds[scriptIds.length] = scriptId;
+ else repeaterIdToScriptIds[repeaterId] = [scriptId];
+ };
+ var mapScriptIdToLayerId = function(obj, layerId, path) {
+ var pathCopy = $ax.deepCopy(path);
+ pathCopy[path.length] = obj.id;
+ var scriptId = $ax.getScriptIdFromPath(pathCopy);
+ scriptIdToParentLayer[scriptId] = layerId;
+ }
+ var mapIdsToRepeaterAndLayer = function(path, objs, repeaterId) {
+ var pathCopy = $ax.deepCopy(path);
+
+ for(var i = 0; i < objs.length; i++) {
+ var obj = objs[i];
+ pathCopy[path.length] = obj.id;
+ var scriptId = $ax.getScriptIdFromPath(pathCopy);
+ // Rdo have no element on page and are not mapped to the repeater
+ if(repeaterId) mapScriptIdToRepeaterId(scriptId, repeaterId);
+
+ if($ax.public.fn.IsDynamicPanel(obj.type)) {
+ for(var j = 0; j < obj.diagrams.length; j++) mapIdsToRepeaterAndLayer(path, obj.diagrams[j].objects, repeaterId);
+ } else if($ax.public.fn.IsReferenceDiagramObject(obj.type)) {
+ mapIdsToRepeaterAndLayer(pathCopy, $ax.pageData.masters[obj.masterId].diagram.objects, repeaterId);
+ } else if($ax.public.fn.IsRepeater(obj.type)) {
+ mapScriptIdToRepeaterId(scriptId, scriptId);
+ mapIdsToRepeaterAndLayer(path, obj.objects, scriptId);
+ } else if($ax.public.fn.IsLayer(obj.type)) {
+ var layerObjs = obj.objs;
+ for(var j = 0; j < layerObjs.length; j++) {
+ mapScriptIdToLayerId(layerObjs[j], scriptId, path);
+ }
+ mapIdsToRepeaterAndLayer(path, layerObjs, repeaterId);
+ } else if(obj.objects && obj.objects.length) {
+ if(repeaterId) {
+ for(var j = 0; j < obj.objects.length; j++) {
+ mapIdsToRepeaterAndLayer(path, obj.objects, repeaterId);
+ }
+ }
+ }
+ }
+ };
+ mapIdsToRepeaterAndLayer([], $ax.pageData.page.diagram.objects);
+ };
+
+
+ $ax.getPathFromScriptId = function(scriptId) {
+ var reversedPath = [];
+ var path = scriptIdToPath[scriptId];
+ while(path && path.uniqueId) {
+ reversedPath[reversedPath.length] = path.uniqueId;
+ path = path.parent;
+ }
+ return reversedPath.reverse();
+ };
+
+ var _getScriptIdFromFullPath = function(path) {
+ var current = $ax.pageData.objectPaths;
+ for(var i = 0; i < path.length; i++) {
+ current = current[path[i]];
+ if(!current) return current;
+ }
+ return current && current.scriptId;
+ };
+
+
+ var _getScriptIdFromPath = function(path, relativeTo) {
+ var relativePath = [];
+ var includeMasterInPath = false;
+ if(relativeTo) {
+ var relativeToScriptId;
+ if(relativeTo.srcElement) { //this is eventInfo
+ relativeToScriptId = $ax.repeater.getScriptIdFromElementId(relativeTo.srcElement);
+ includeMasterInPath = relativeTo.isMasterEvent;
+ } else if(typeof relativeTo === 'string') { //this is an element id
+ relativeToScriptId = relativeTo;
+ }
+
+ if(relativeToScriptId) {
+ relativePath = $ax.getPathFromScriptId(relativeToScriptId);
+ if(!includeMasterInPath) relativePath = relativePath.slice(0, relativePath.length - 1);
+ } else if(relativeTo instanceof Array) { //this is a path
+ relativePath = relativeTo;
+ }
+ }
+ var fullPath = relativePath.concat(path);
+ var scriptId = _getScriptIdFromFullPath(fullPath);
+ return !$ax.visibility.isScriptIdLimbo(scriptId) && scriptId;
+ };
+ $ax.getScriptIdFromPath = _getScriptIdFromPath;
+
+ var _getElementIdsFromPath = function(path, eventInfo) {
+ var scriptId = _getScriptIdFromPath(path, eventInfo);
+ if(!scriptId) return [];
+ // Don't need placed check hear. If unplaced, scriptId will be undefined and exit out before here.
+ return $ax.getElementIdsFromEventAndScriptId(eventInfo, scriptId);
+ };
+ $ax.getElementIdsFromPath = _getElementIdsFromPath;
+
+ var _getElementIdFromPath = function(path, params) {
+ var scriptId = _getScriptIdFromPath(path, params.relativeTo);
+ if(!scriptId) return scriptId;
+
+ var itemNum = params.itemNum;
+ if(params.relativeTo && typeof params.relativeTo === 'string') {
+ if($jobj(params.relativeTo)) itemNum = $ax.repeater.getItemIdFromElementId(params.relativeTo);
+ }
+ return $ax.repeater.createElementId(scriptId, itemNum);
+ };
+ $ax.getElementIdFromPath = _getElementIdFromPath;
+
+ var _getElementsIdFromEventAndScriptId = function(eventInfo, scriptId) {
+ var itemId = eventInfo && $ax.repeater.getItemIdFromElementId(eventInfo.srcElement);
+ var target = false;
+ // Try to get itemId from target if you can't get it from source.
+ if(!itemId) {
+ itemId = eventInfo && eventInfo.targetElement && $ax.repeater.getItemIdFromElementId(eventInfo.targetElement);
+ if(itemId) target = true;
+ }
+
+ var parentRepeater = $ax.getParentRepeaterFromScriptId(scriptId);
+ if(parentRepeater && scriptId != parentRepeater) {
+ if(itemId && (!eventInfo || parentRepeater == $ax.getParentRepeaterFromScriptId($ax.repeater.getScriptIdFromElementId(target ? eventInfo.targetElement : eventInfo.srcElement)))) {
+ return [$ax.repeater.createElementId(scriptId, itemId)];
+ }
+ var elementIds = [];
+ var itemIds = $ax.getItemIdsForRepeater(parentRepeater);
+ if(!itemIds) return [];
+
+ for(var i = 0; i < itemIds.length; i++) elementIds[i] = $ax.repeater.createElementId(scriptId, itemIds[i]);
+ return elementIds;
+ }
+ return [scriptId];
+ };
+ $ax.getElementIdsFromEventAndScriptId = _getElementsIdFromEventAndScriptId;
+
+ var _getSrcElementIdFromEvent = function(event) {
+ var currentQuery = $(event.srcElement || event.target);
+ while(currentQuery && currentQuery.length && (!$obj(currentQuery.attr('id')) || $jobj(currentQuery.attr('id')).hasClass('text'))) {
+ currentQuery = currentQuery.parent();
+ };
+ return currentQuery.attr('id');
+ };
+ $ax.getSrcElementIdFromEvent = _getSrcElementIdFromEvent;
+
+ var _getEventInfoFromEvent = function(event, skipShowDescriptions, elementId) {
+ var eventInfo = {};
+ eventInfo.srcElement = elementId;
+ eventInfo.now = new Date();
+
+ if(event != null) {
+ //elementId can be empty string, so can't simple use "or" assignment here.
+ eventInfo.srcElement = elementId || elementId == '' ? elementId : _getSrcElementIdFromEvent(event);
+ eventInfo.which = event.which;
+
+ // When getting locations in mobile, need to extract the touch object to get the mouse location attributes
+ var mouseEvent = (event.originalEvent && event.originalEvent.changedTouches && event.originalEvent.changedTouches[0]) || event.originalEvent;
+ if(mouseEvent && !mouseEvent.type) mouseEvent.type = event.type;
+
+ if(skipShowDescriptions) eventInfo.skipShowDescriptions = true;
+
+ // Always update mouse location if possible
+ $ax.event.updateMouseLocation(mouseEvent);
+ }
+
+ // Always set event info about cursor
+ var _cursor = eventInfo.cursor = {};
+ _cursor.x = $ax.mouseLocation.x;
+ _cursor.y = $ax.mouseLocation.y;
+
+ var body = $('body');
+ if(body.css('position') == 'relative') {
+ _cursor.x -= (Number(body.css('left').replace('px', '')) + Math.max(0, ($(window).width() - body.width()) / 2));
+ }
+
+ eventInfo.pageX = _cursor.x + 'px';
+ eventInfo.pageY = _cursor.y + 'px';
+
+ // Do Keyboard Info
+ eventInfo.keyInfo = $ax.event.keyState();
+
+ eventInfo.window = _getWindowInfo();
+
+ eventInfo.thiswidget = _getWidgetInfo(eventInfo.srcElement);
+ eventInfo.item = _getItemInfo(eventInfo.srcElement);
+ eventInfo.dragInfo = $ax.drag.GetWidgetDragInfo();
+
+ return eventInfo;
+ };
+ $ax.getEventInfoFromEvent = _getEventInfoFromEvent;
+
+ $ax.getBasicEventInfo = function() {
+ var eventInfo = {};
+ eventInfo.now = new Date();
+ eventInfo.window = _getWindowInfo();
+ eventInfo.cursor = { x: 0, y: 0};
+ return eventInfo;
+
+ };
+
+ var _getWindowInfo = function() {
+ var win = {};
+ win.width = $(window).width();
+ win.height = $(window).height();
+ win.scrollx = $(window).scrollLeft();
+ win.scrolly = $(window).scrollTop();
+ return win;
+ };
+ $ax.getWindowInfo = _getWindowInfo;
+
+ var repeaterInfoCache = [];
+ $ax.cacheRepeaterInfo = function(repeaterId, repeaterInfo) {
+ repeaterInfoCache[repeaterId] = repeaterInfo;
+ }
+ $ax.removeCachedRepeaterInfo = function(repeaterId) {
+ repeaterInfoCache[repeaterId] = undefined;
+ }
+
+ var _getItemInfo = function(elementId) {
+ if(!elementId) return { valid: false };
+
+ elementId = _getParentElement(elementId);
+
+ var index = $ax.repeater.getItemIdFromElementId(elementId);
+ if(!index) return { valid: false };
+
+ var item = { valid: true };
+
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ var repeaterId = $ax.getParentRepeaterFromScriptId(scriptId);
+ item.repeater = repeaterInfoCache[repeaterId] ? repeaterInfoCache[repeaterId] : _getWidgetInfo(repeaterId);
+ $ax.repeater.setDisplayProps(item, repeaterId, index);
+ item.ismarked = $ax.repeater.isEditItem(repeaterId, index);
+ item.isvisible = Boolean($jobj(elementId).length);
+
+ return item;
+ };
+ $ax.getItemInfo = _getItemInfo;
+
+ var _getWidgetInfo = function(elementId) {
+ if(!elementId) return { valid: false };
+
+ elementId = _getParentElement(elementId);
+
+ var elementAxQuery = $ax('#' + elementId);
+ var elementQuery = $jobj(elementId);
+ var obj = $obj(elementId);
+ var widget = { valid: true, isWidget: true, obj: obj, elementQuery: elementQuery, isLayer: $ax.public.fn.IsLayer(obj.type) };
+ widget.elementId = elementId;
+ widget.name = widget.label = (elementQuery.data('label') ? elementQuery.data('label') : '');
+ widget.text = $ax('#' + elementId).text();
+ widget.opacity = Number(elementQuery.css('opacity')) * 100;
+ widget.rotation = $ax.move.getRotationDegree(widget.elementId);
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ var repeaterId = $ax.getParentRepeaterFromScriptId(scriptId);
+ if(repeaterId) widget.repeater = $ax.public.fn.IsRepeater(obj.type) ? widget : _getWidgetInfo(repeaterId);
+
+ //if($ax.public.fn.IsLayer(obj.type)) {
+ // var boundingRect = $ax.public.fn.getWidgetBoundingRect(elementId);
+ // widget.x = boundingRect.left;
+ // widget.y = boundingRect.top;
+ // widget.width = boundingRect.width;
+ // widget.height = boundingRect.height;
+ // if(elementQuery.length != 0) {
+ // widget.pagex = elementAxQuery.left();
+ // widget.pagey = elementAxQuery.top();
+ // }
+ //} else {
+ // var elementExists = elementQuery.length > 0;
+ // var x = elementExists ? elementAxQuery.locRelativeIgnoreLayer(false) : 0;
+ // var y = elementExists ? elementAxQuery.locRelativeIgnoreLayer(true) : 0;
+
+ // widget.x = x;
+ // widget.y = y;
+
+ // if(elementExists) {
+ // widget.pagex = elementAxQuery.left();
+ // widget.pagey = elementAxQuery.top();
+ // widget.width = elementAxQuery.width();
+ // widget.height = elementAxQuery.height();
+ // }
+
+ // //if (obj.generateCompound) {
+ // // // assume this means that this is a compound vector.
+ // // widget.x = boundingRect.left;
+ // // widget.y = boundingRect.top;
+
+ // // //widget.pagex += boundingRect.left;
+ // // //widget.pagey += boundingRect.top;
+ // //}
+
+ //}
+
+
+ // Right now only dynamic panel can scroll
+ if($ax.public.fn.IsDynamicPanel(obj.type)) {
+ var stateQuery = $('#' + $ax.visibility.GetPanelState(elementId));
+ widget.scrollx = stateQuery.scrollLeft();
+ widget.scrolly = stateQuery.scrollTop();
+ widget.stateQuery = stateQuery;
+
+ //if($ax.dynamicPanelManager.isIdFitToContent(elementId)) {
+ // widget.width = stateQuery.width();
+ // widget.height = stateQuery.height();
+ //}
+ } else {
+ widget.scrollx = 0;
+ widget.scrolly = 0;
+ }
+
+ // repeater only props
+ if($ax.public.fn.IsRepeater(obj.type)) {
+ widget.visibleitemcount = repeaterIdToItemIds[scriptId] ? repeaterIdToItemIds[scriptId].length : $ax.repeater.getVisibleDataCount(scriptId);
+ widget.itemcount = $ax.repeater.getFilteredDataCount(scriptId);
+ widget.datacount = $ax.repeater.getDataCount(scriptId);
+ widget.pagecount = $ax.repeater.getPageCount(scriptId);
+ widget.pageindex = $ax.repeater.getPageIndex(scriptId);
+ }
+
+ //widget.left = widget.leftfixed = widget.x;
+ //widget.top = widget.topfixed = widget.y;
+ //widget.right = widget.rightfixed = widget.x + widget.width;
+ //widget.bottom = widget.bottomfixed = widget.y + widget.height;
+
+ //if(elementQuery.css('position') == 'fixed') {
+ // var windowScrollLeft = $(window).scrollLeft();
+ // var windowScrollTop = $(window).scrollTop();
+ // widget.leftfixed = widget.left - windowScrollLeft;
+ // widget.topfixed = widget.top - windowScrollTop;
+ // widget.rightfixed = widget.right - windowScrollLeft;
+ // widget.bottomfixed = widget.bottom - windowScrollTop;
+ //}
+
+ // Get widget info funcs
+ widget.elementAxQuery = function () {
+ return this.elementAxQueryProp || (this.elementAxQueryProp = $ax('#' + this.elementId));
+ }
+
+ widget.isFitToContent = function () {
+ if (this.isFitToContentProp === undefined) {
+ if (!this.stateQuery) this.isFitToContentProp = false;
+ else this.isFitToContentProp = $ax.dynamicPanelManager.isIdFitToContent(this.elementId);
+ }
+ return this.isFitToContentProp;
+ }
+
+ widget.x = function () { return this.getProp('x'); }
+ widget.y = function () { return this.getProp('y'); }
+ widget.pagex = function () { return this.getProp('pagex'); }
+ widget.pagey = function () { return this.getProp('pagey'); }
+ widget.width = function () { return this.getProp('width'); }
+ widget.height = function () { return this.getProp('height'); }
+ widget.left = function () { return this.x(); }
+ widget.top = function () { return this.y(); }
+ widget.right = function () { return this.x() + this.width(); }
+ widget.bottom = function () { return this.y() + this.height(); }
+
+ widget.getProp = function (prop) {
+ var propName = prop + 'Prop';
+ if (typeof (this[propName]) != 'undefined') return this[propName];
+ return this[propName] = this.cacheProp(prop);
+ };
+
+ widget.cacheProp = function (prop) {
+ // I'm keeping the returned undefineds the same as before, but really I could probably return undefined right away if elementQuery is empty
+ if (this.isLayer) {
+ if (prop == 'pagex' || prop == 'pagey') {
+ if (this.elementQuery.length > 0) {
+ if (prop == 'pagex') return this.elementAxQuery().left();
+ else return this.elementAxQuery().top();
+ }
+ return undefined; // Otherwise, it is undefined as there is no element
+ }
+ var boundingRect = $ax.public.fn.getWidgetBoundingRect(this.elementId);
+ this.xProp = boundingRect.left;
+ this.yProp = boundingRect.top;
+ this.widthProp = boundingRect.width;
+ this.heightProp = boundingRect.height;
+ return this[prop + 'Prop'];
+ }
+
+ if (this.elementQuery.length <= 0) return prop == 'x' || prop == 'y' ? 0 : undefined;
+
+ switch (prop) {
+ case 'x': return this.elementAxQuery().locRelativeIgnoreLayer(false);
+ case 'y': return this.elementAxQuery().locRelativeIgnoreLayer(true);
+ case 'pagex': return this.elementAxQuery().left();
+ case 'pagey': return this.elementAxQuery().top();
+ }
+
+ var val = this.elementAxQuery()[prop]();
+ if (this.isFitToContent()) val = this.stateQuery[prop]();
+
+ return val;
+ };
+
+ widget.leftfixed = function() { this.getFixed('left'); }
+ widget.topfixed = function() { this.getFixed('top'); }
+ widget.rightfixed = function() { this.getFixed('right'); }
+ widget.bottomfixed = function() { this.getFixed('bottom'); }
+
+ widget.isFixed = function() {
+ if(this.isFixedProp === undefined) this.isFixedProp = this.elementQuery.css('position') == 'fixed)';
+ return this.isFixedProp;
+ }
+
+ widget.getFixed = function (prop) {
+ var fixed = prop + 'fixedProp';
+ if(!this.isFixed()) widget[fixed] = widget[prop]();
+ if(widget[fixed] === undefined) {
+
+ if(prop == 'left' || prop == 'right') {
+ if(this.windowScrollX === undefined) this.windowScrollX = $(window).scrollLeft();
+ var windowScroll = this.windowScrollX;
+ } else {
+ if(this.windowScrollY === undefined) this.windowScrollY = $(window).scrollTop();
+ windowScroll = this.windowScrollY;
+ }
+ widget[fixed] = widget[prop]() - windowScroll;
+ }
+ return widget[fixed];
+ }
+
+ return widget;
+ };
+ $ax.getWidgetInfo = _getWidgetInfo;
+
+ $ax.GetTextPanelId = function (id, create) {
+ if(!$ax('#' + id).SupportsRichText()) return '';
+ var buttonShape = $ax.GetButtonShape(id);
+ var panelDiv = buttonShape.find('.text')[0];
+ if(!panelDiv) {
+ if(!create) return "";
+
+ var newId = id + "_text";
+ //var newDiv = $('
');
+ var newDiv = $('');
+ buttonShape.append(newDiv);
+
+ var adaptiveId = $ax.adaptive.currentViewId;
+ if(adaptiveId) $ax.style.setAdaptiveStyle(id, $ax.style.computeAllOverrides(id, undefined, $ax.style.generateState(id), adaptiveId));
+
+ panelDiv = newDiv[0];
+ }
+
+ return panelDiv.id;
+ }
+
+ $ax.GetParentIdFromLink = function(id) {
+ return $ax.GetShapeIdFromText($jobj(id).parentsUntil('.text').parent().attr('id'));
+ };
+
+ $ax.GetButtonShapeId = function(id) {
+ var obj = $obj(id);
+ switch(obj.type) {
+ case $ax.constants.TREE_NODE_OBJECT_TYPE:
+ return obj.buttonShapeId ? $ax.getElementIdFromPath([obj.buttonShapeId], { relativeTo: id }) : "";
+ case $ax.constants.LINK_TYPE:
+ return "";
+ default:
+ return id;
+ }
+ };
+
+ $ax.GetButtonShape = function(id) {
+ return $jobj($ax.GetButtonShapeId(id));
+ };
+
+ $ax.GetShapeIdFromText = function(id) {
+ if(!id) return undefined; // this is to prevent an infinite loop.
+
+ var current = document.getElementById(id);
+ if(!current) return undefined;
+ current = current.parentElement;
+ while(current && current.tagName != 'BODY') {
+ var currentId = current.id;
+ if(currentId && currentId != 'base') return $ax.visibility.getWidgetFromContainer(currentId);
+ current = current.parentElement;
+ }
+
+ return undefined;
+ };
+
+ $ax.GetImageIdFromShape = function(id) {
+ var image = $ax.GetButtonShape(id).find('img[id$=img]');
+ if(!image.length) image = $jobj(id).find('img[id$=image_sketch]');
+ return image.attr('id');
+ };
+
+ var _getParentElement = $ax.getParentElement = function(elementId) {
+ var obj = $obj(elementId);
+ while(obj.isContained) {
+ var path = $ax.getPathFromScriptId($ax.repeater.getScriptIdFromElementId(elementId));
+ var itemId = $ax.repeater.getItemIdFromElementId(elementId);
+ path[path.length - 1] = obj.parent.id;
+ elementId = $ax.getElementIdFromPath(path, { itemNum: itemId });
+ obj = $obj(elementId);
+ }
+
+ return elementId;
+ };
+
+ $ax.addItemIdToRepeater = function(itemId, repeaterId) {
+ var itemIds = repeaterIdToItemIds[repeaterId];
+ if(itemIds) itemIds[itemIds.length] = itemId;
+ else repeaterIdToItemIds[repeaterId] = [itemId];
+
+ var scriptIds = repeaterIdToScriptIds[repeaterId];
+ for(var i = 0; i < scriptIds.length; i++) elementIdToObject[$ax.repeater.createElementId(scriptIds[i], itemId)] = $ax.getObjectFromScriptId(scriptIds[i]);
+ };
+
+ $ax.getAllElementIds = function() {
+ var elementIds = [];
+ for(var i = 0; i < _scriptIds.length; i++) {
+ var scriptId = _scriptIds[i];
+ var repeaterId = scriptIdToRepeaterId[scriptId];
+ if(repeaterId && repeaterId != scriptId) {
+ var itemIds = repeaterIdToItemIds[repeaterId] || [];
+ for(var j = 0; j < itemIds.length; j++) elementIds[elementIds.length] = $ax.repeater.createElementId(scriptId, itemIds[j]);
+ } else elementIds[elementIds.length] = scriptId;
+ }
+ return elementIds;
+ };
+
+ $ax.getAllScriptIds = function() {
+ return _scriptIds;
+ };
+
+ $ax.getObjectFromElementId = function(elementId) {
+ return $ax.getObjectFromScriptId($ax.repeater.getScriptIdFromElementId(elementId));
+ };
+
+ $ax.getObjectFromScriptId = function(scriptId) {
+ return scriptIdToObject[scriptId];
+ };
+
+ $ax.getParentRepeaterFromElementId = function(elementId) {
+ return $ax.getParentRepeaterFromScriptId($ax.repeater.getScriptIdFromElementId(elementId));
+ };
+
+ $ax.getParentRepeaterFromElementIdExcludeSelf = function (elementId) {
+ var repeaterId = $ax.getParentRepeaterFromElementId(elementId);
+ return repeaterId != elementId ? repeaterId : undefined;
+ };
+
+ $ax.getParentRepeaterFromScriptId = function(scriptId) {
+ return scriptIdToRepeaterId[scriptId];
+ };
+
+ var _getChildScriptIdsForRepeater = function(repeaterId) {
+ return repeaterIdToScriptIds[repeaterId];
+ };
+
+ var _getItemIdsForRepeater = function(repeaterId) {
+ return repeaterIdToItemIds[repeaterId] || [];
+ };
+ $ax.getItemIdsForRepeater = _getItemIdsForRepeater;
+
+ var _clearItemIdsForRepeater = function(repeaterId) {
+ repeaterIdToItemIds[repeaterId] = [];
+ };
+ $ax.clearItemsForRepeater = _clearItemIdsForRepeater;
+
+ $ax.getChildElementIdsForRepeater = function(repeaterId) {
+ var scriptIds = _getChildScriptIdsForRepeater(repeaterId);
+ var itemIds = _getItemIdsForRepeater(repeaterId);
+
+ var retVal = [];
+ if(!itemIds || !scriptIds) return retVal;
+
+ for(var i = 0; i < scriptIds.length; i++) {
+ for(var j = 0; j < itemIds.length; j++) {
+ retVal[retVal.length] = $ax.repeater.createElementId(scriptIds[i], itemIds[j]);
+ }
+ }
+ return retVal;
+ };
+
+ $ax.getRdoParentFromElementId = function(elementId) {
+ var scriptId = $ax.repeater.getScriptIdFromElementId(elementId);
+ var rdoId = scriptIdToPath[scriptId].parent.scriptId;
+ if($ax.getParentRepeaterFromScriptId(rdoId)) rdoId = $ax.repeater.createElementId(rdoId, $ax.repeater.getItemIdFromElementId(elementId));
+ return rdoId;
+ };
+
+ $ax.getLayerParentFromElementId = function (elementId) {
+ var itemId = $ax.repeater.getItemIdFromElementId(elementId);
+ var scriptId = scriptIdToParentLayer[$ax.repeater.getScriptIdFromElementId(elementId)];
+ return $ax.getParentRepeaterFromElementId(scriptId) ? $ax.repeater.createElementId(scriptId, itemId) : scriptId;
+ }
+
+ $ax.updateElementText = function(elementId, text) {
+ elementIdToText[elementId] = text;
+ };
+
+ $ax.hasElementTextChanged = function(elementId, text) {
+ return elementIdToText[elementId] != text;
+ };
+
+ $ax.updateRadioButtonSelected = function(group, elementId) {
+ var old = radioGroupToSelectedElementId[group];
+ radioGroupToSelectedElementId[group] = elementId;
+ return old;
+ };
+
+ $ax.hasRadioButtonSelectedChanged = function(group, elementId) {
+ return radioGroupToSelectedElementId[group] != elementId;
+ };
+ })();
+
+ //Recursively populates fullPathArray with:
+ // [ { idPath, scriptId }, ... ]
+ //for every scriptId in the object
+ //also populates an object of scriptId -> path
+ var _pathToScriptIdHelper = function(currentPath, currentChain, fullPathArray, scriptIdToPath) {
+ for(var key in currentPath) {
+ if(key != "scriptId") {
+ var nextPath = currentPath[key];
+ _pathToScriptIdHelper(nextPath, currentChain.concat(key), fullPathArray, scriptIdToPath);
+ nextPath.parent = currentPath;
+ nextPath.uniqueId = key;
+ } else {
+ fullPathArray[fullPathArray.length] = { idPath: currentChain, scriptId: currentPath.scriptId };
+ scriptIdToPath[currentPath.scriptId] = currentPath;
+ }
+ }
+ };
+
+ $ax.public.loadCurrentPage = $ax.loadCurrentPage = function(pageData) {
+ $ax.pageData = _pageData = pageData;
+ _initializePageData();
+ };
+
+ $ax.public.loadDocument = $ax.loadDocument = function(document) {
+ $ax.document = document;
+ _initializeDocumentData();
+ };
+
+
+ /**
+ Navigates to a page
+
+
+ */
+ $ax.public.navigate = $ax.navigate = function(to) { //url, includeVariables, type) {
+ var targetUrl;
+ if(typeof (to) === 'object') {
+ includeVariables = to.includeVariables;
+ targetUrl = !includeVariables ? to.url : $ax.globalVariableProvider.getLinkUrl(to.url);
+
+ if(to.target == "new") {
+ window.open(targetUrl, "");
+ } else if(to.target == "popup") {
+ var features = _getPopupFeatures(to.popupOptions);
+ window.open(targetUrl, "", features);
+ } else {
+ var targetLocation = window.location;
+ if(to.target == "current") {
+ } else if(to.target == "parent") {
+ if(!top.opener) return;
+ targetLocation = top.opener.window.location;
+ } else if(to.target == "parentFrame") {
+ targetLocation = parent.location;
+ } else if(to.target == "frame") {
+ // targetLocation = to.frame.contentWindow.location;
+ $(to.frame).attr('src', targetUrl || 'about:blank');
+ return;
+ }
+
+ if (!_needsReload(targetLocation, to.url)) {
+ targetLocation.href = targetUrl || 'about:blank';
+ } else {
+ targetLocation.href = $axure.utils.getReloadPath() + "#" + encodeURI(targetUrl);
+ }
+ }
+ } else {
+ $ax.navigate({
+ url: to,
+ target: "current",
+ includeVariables: arguments[1]
+ });
+ }
+ };
+
+ var _needsReload = function(oldLocation, newBaseUrl) {
+ var reload = false;
+ try {
+ var oldUrl = oldLocation.href;
+ var oldBaseUrl = oldUrl.split("#")[0];
+ var lastslash = oldBaseUrl.lastIndexOf("/");
+ if(lastslash > 0) {
+ oldBaseUrl = oldBaseUrl.substring(lastslash + 1, oldBaseUrl.length);
+ if(oldBaseUrl == encodeURI(newBaseUrl)) {
+ reload = true;
+ }
+ }
+ } catch(e) {
+ }
+ return reload;
+ };
+
+ var _getPopupFeatures = function(options) {
+ var defaultOptions = {
+ toolbar: true,
+ scrollbars: true,
+ location: true,
+ status: true,
+ menubar: true,
+ directories: true,
+ resizable: true,
+ centerwindow: true,
+ left: -1,
+ top: -1,
+ height: -1,
+ width: -1
+ };
+
+ var selectedOptions = $.extend({}, defaultOptions, options);
+
+ var optionsList = [];
+ optionsList.push('toolbar=' + (selectedOptions.toolbar ? 'yes' : 'no'));
+ optionsList.push('scrollbars=' + (selectedOptions.scrollbars ? 'yes' : 'no'));
+ optionsList.push('location=' + (selectedOptions.location ? 'yes' : 'no'));
+ optionsList.push('status=' + (selectedOptions.status ? 'yes' : 'no'));
+ optionsList.push('menubar=' + (selectedOptions.menubar ? 'yes' : 'no'));
+ optionsList.push('directories=' + (selectedOptions.directories ? 'yes' : 'no'));
+ optionsList.push('resizable=' + (selectedOptions.resizable ? 'yes' : 'no'));
+
+ if(selectedOptions.centerwindow == false) {
+ if(selectedOptions.left > -1) {
+ optionsList.push('left=' + selectedOptions.left);
+ }
+
+ if(selectedOptions.top > -1) {
+ optionsList.push('top=' + selectedOptions.top);
+ }
+ }
+
+ var height = 0;
+ var width = 0;
+ if(selectedOptions.height > 0) {
+ optionsList.push('height=' + selectedOptions.height);
+ height = selectedOptions.height;
+ }
+
+ if(selectedOptions.width > 0) {
+ optionsList.push('width=' + selectedOptions.width);
+ width = selectedOptions.width;
+ }
+
+ var features = optionsList.join(',');
+ if(selectedOptions.centerwindow) {
+ var winl = (window.screen.width - width) / 2;
+ var wint = (window.screen.height - height) / 2;
+ features = features + ',left=' + winl + ',top=' + wint;
+ }
+
+ return features;
+ };
+
+ /**
+ Closes a window
+
+
+ */
+ $ax.public.closeWindow = $ax.closeWindow = function() {
+ parent.window.close();
+ };
+
+ /**
+ Goes back
+
+
+ */
+ $ax.public.back = $ax.back = function() {
+ window.history.go(-1);
+ };
+
+ /**
+ Reloads the current page.
+ # includeVariables: true if it should re-include the variables when the page is reloaded
+ */
+ $ax.public.reload = $ax.reload = function(includeVariables) {
+ var targetUrl = (includeVariables === false)
+ ? $axure.utils.getReloadPath() + "#" + encodeURI($ax.pageData.url)
+ : $axure.utils.getReloadPath() + "#" + encodeURI($ax.globalVariableProvider.getLinkUrl($ax.pageData.url));
+ window.location.href = targetUrl;
+ };
+
+ /**
+ Sets a variable.
+ # name: The name of the global variable to set
+ # value: The value that should be set
+ */
+ $ax.public.setGlobalVariable = $ax.setGlobalVariable = function(name, value) {
+ if(!name || !value) {
+ return;
+ }
+
+ $ax.globalVariableProvider.setVariableValue(name, value);
+ };
+
+ /**
+ Gets the value of a global variable
+ # name: The name of the global variable value to get
+ */
+ $ax.public.getGlobalVariable = $ax.getGlobalVariable = function(name) {
+ $ax.globalVariableProvider.getVariableValue(name);
+ };
+
+ $ax.getObjectFromElementIdDisregardHex = function (elementId) {
+ var elementIdInput = elementId.charAt(0) == '#' ? elementId.substring(1) : elementId;
+ return this.getObjectFromElementId(elementIdInput);
+ }
+
+
+ $ax.getTypeFromElementId = function(elementId) {
+ var obj = this.getObjectFromElementIdDisregardHex(elementId);
+ return obj && obj.type;
+ };
+
+ $ax.getNumFromPx = function(pxNum) {
+ return Number(pxNum.replace('px', ''));
+ }
+
+});
\ No newline at end of file
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/startPost.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/startPost.js
new file mode 100644
index 0000000..d52da38
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/startPost.js
@@ -0,0 +1,818 @@
+// 8.0.0.3355. Generated 8/24/2017 4:38:58 AM UTC
+
+//***** sitemap.js *****//
+var currentNodeUrl = '';
+var allNodeUrls = [];
+
+function openNextPage() {
+ var index = allNodeUrls.indexOf(currentNodeUrl) + 1;
+ if(index >= allNodeUrls.length) return;
+ var nextNodeUrl = allNodeUrls[index];
+ $('.sitemapPageLink[nodeUrl="' + nextNodeUrl + '"]').click();
+}
+
+function openPreviousPage() {
+ var index = allNodeUrls.indexOf(currentNodeUrl) - 1;
+ if(index < 0) return;
+ var nextNodeUrl = allNodeUrls[index];
+ $('.sitemapPageLink[nodeUrl="' + nextNodeUrl + '"]').click();
+}
+
+// use this to isolate the scope
+(function() {
+
+ var SHOW_HIDE_ANIMATION_DURATION = 0;
+
+ var HIGHLIGHT_INTERACTIVE_VAR_NAME = 'hi';
+
+ var currentPageLoc = '';
+ var currentPlayerLoc = '';
+ var currentPageHashString = '';
+
+ $(window.document).ready(function() {
+ $axure.player.createPluginHost({
+ id: 'sitemapHost',
+ context: 'interface',
+ title: 'PAGES',
+ gid: 1
+ });
+
+ generateSitemap();
+
+ $('.sitemapPlusMinusLink').toggle(collapse_click, expand_click);
+ $('.sitemapPageLink').click(node_click);
+
+ $('#sitemapLinksContainer').hide();
+ $('#linksButton').click(links_click);
+ $('#adaptiveButton').click(adaptive_click);
+ $('#adaptiveViewsContainer').hide();
+
+ $('#highlightInteractiveButton').click(highlight_interactive);
+ $('#searchButton').click(search_click);
+ $('#searchBox').keyup(search_input_keyup);
+ $('.sitemapLinkField').click(function() { this.select(); });
+ $('input[value="withoutmap"]').click(withoutSitemapRadio_click);
+ $('input[value="withmap"]').click(withSitemapRadio_click);
+ $('#minimizeBox, #collapseBox, #footnotesBox, #highlightBox').change(sitemapUrlOptions_change);
+ $('#viewSelect').change(sitemapUrlViewSelect_change);
+
+ $(document).on('ContainerHeightChange', function() {
+ updateContainerHeight();
+ });
+
+ // bind to the page load
+ $axure.page.bind('load.sitemap', function() {
+ currentPageLoc = $axure.page.location.split("#")[0];
+ var decodedPageLoc = decodeURI(currentPageLoc);
+ currentNodeUrl = decodedPageLoc.substr(decodedPageLoc.lastIndexOf('/') ? decodedPageLoc.lastIndexOf('/') + 1 : 0);
+ currentPlayerLoc = $(location).attr('href').split("#")[0].split("?")[0];
+ currentPageHashString = '#p=' + currentNodeUrl.substr(0, currentNodeUrl.lastIndexOf('.'));
+
+ setVarInCurrentUrlHash('p', currentNodeUrl.substring(0, currentNodeUrl.lastIndexOf('.html')));
+
+ $('.sitemapPageLink').parent().parent().removeClass('sitemapHighlight');
+ $('.sitemapPageLink[nodeUrl="' + currentNodeUrl + '"]').parent().parent().addClass('sitemapHighlight');
+
+ var pageName = $axure.page.pageName;
+ $('.pageNameHeader').html(pageName);
+
+ $('#sitemapLinksPageName').html($('.sitemapHighlight > .sitemapPageLinkContainer > .sitemapPageLink > .sitemapPageName').html());
+
+ //Click the "Without sitemap" radio button so that it's selected by default
+ $('input[value="withoutmap"]').click();
+
+ //If highlight var is present and set to 1 or else if
+ //sitemap highlight button is selected then highlight interactive elements
+ var hiVal = getHashStringVar(HIGHLIGHT_INTERACTIVE_VAR_NAME);
+ if(hiVal.length > 0 && hiVal == 1) {
+ $('#highlightInteractiveButton').addClass('sitemapToolbarButtonSelected');
+ $axure.messageCenter.postMessage('highlightInteractive', true);
+ } else if($('#highlightInteractiveButton').is('.sitemapToolbarButtonSelected')) {
+ $axure.messageCenter.postMessage('highlightInteractive', true);
+ }
+
+ //Set the current view if it is defined in the hash string
+ //If the view is invalid, set it to 'auto' in the string
+ //ELSE set the view based on the currently selected view in the toolbar menu
+ var viewStr = getHashStringVar(ADAPTIVE_VIEW_VAR_NAME);
+ if(viewStr.length > 0) {
+ var $view = $('.adaptiveViewOption[val="' + viewStr + '"]');
+ if($view.length > 0) $view.click();
+ else $('.adaptiveViewOption[val="auto"]').click();
+ } else if($('.checkedAdaptive').length > 0) {
+ var $viewOption = $('.checkedAdaptive').parents('.adaptiveViewOption');
+ if($viewOption.attr('val') != 'auto') $viewOption.click();
+ }
+
+ $axure.messageCenter.postMessage('finishInit');
+
+ return false;
+ });
+
+ var $adaptiveViewsContainer = $('#adaptiveViewsContainer');
+ var $viewSelect = $('#viewSelect');
+
+ //Fill out adaptive view container with prototype's defined adaptive views, as well as the default, and Auto
+ $adaptiveViewsContainer.append('');
+ $viewSelect.append('Auto ');
+ if(typeof $axure.document.defaultAdaptiveView.name != 'undefined') {
+ //If the name is a blank string, make the view name the width if non-zero, else 'any'
+ var defaultViewName = $axure.document.defaultAdaptiveView.name;
+ $adaptiveViewsContainer.append('');
+ $viewSelect.append('' + defaultViewName + ' ');
+ }
+
+ var enabledViewIds = $axure.document.configuration.enabledViewIds;
+ for(var viewIndex = 0; viewIndex < $axure.document.adaptiveViews.length; viewIndex++) {
+ var currView = $axure.document.adaptiveViews[viewIndex];
+ if(enabledViewIds.indexOf(currView.id) < 0) continue;
+
+ var widthString = currView.size.width == 0 ? 'any' : currView.size.width;
+ var heightString = currView.size.height == 0 ? 'any' : currView.size.height;
+ var conditionString = '';
+ if(currView.condition == '>' || currView.condition == '>=') {
+ conditionString = ' and above';
+ } else if(currView.condition == '<' || currView.condition == '<=') {
+ conditionString = ' and below';
+ }
+
+ var viewString = currView.name + ' (' + widthString + ' x ' + heightString + conditionString + ')';
+ $adaptiveViewsContainer.append('');
+ $viewSelect.append('' + viewString + ' ');
+ }
+
+ $('.adaptiveViewOption').click(adaptiveViewOption_click);
+
+ $('.adaptiveViewOption').mouseup(function(event) {
+ event.stopPropagation();
+ });
+
+ $('#searchBox').focusin(function() {
+ if($(this).is('.searchBoxHint')) {
+ $(this).val('');
+ $(this).removeClass('searchBoxHint');
+ }
+ }).focusout(function() {
+ if($(this).val() == '') {
+ $(this).addClass('searchBoxHint');
+ $(this).val('Search');
+ }
+ });
+
+
+ $('#searchBox').focusout();
+ });
+
+ function updateContainerHeight() {
+ $('#sitemapTreeContainer').height($('#sitemapHost').height() - $('#sitemapHeader').outerHeight());
+ }
+
+ function hideAllContainersExcept(exceptContainer) {
+ //1 - adaptive container, 3 - links container
+ if(exceptContainer != 1) {
+ $('#adaptiveViewsContainer').hide();
+ $('#adaptiveButton').removeClass('sitemapToolbarButtonSelected');
+ }
+ if(exceptContainer != 3) {
+ $('#sitemapLinksContainer').hide();
+ $('#linksButton').removeClass('sitemapToolbarButtonSelected');
+ }
+ }
+
+ function collapse_click(event) {
+ $(this)
+ .children('.sitemapMinus').removeClass('sitemapMinus').addClass('sitemapPlus').end()
+ .closest('li').children('ul').hide(SHOW_HIDE_ANIMATION_DURATION);
+ }
+
+ function expand_click(event) {
+ $(this)
+ .children('.sitemapPlus').removeClass('sitemapPlus').addClass('sitemapMinus').end()
+ .closest('li').children('ul').show(SHOW_HIDE_ANIMATION_DURATION);
+ }
+
+ function node_click(event) {
+ $axure.page.navigate(this.getAttribute('nodeUrl'), true);
+ }
+
+ function links_click(event) {
+ hideAllContainersExcept(3);
+ $('#sitemapLinksContainer').toggle();
+ updateContainerHeight();
+ if($('#sitemapLinksContainer').is(":visible")) {
+ $('#linksButton').addClass('sitemapToolbarButtonSelected');
+ } else {
+ $('#linksButton').removeClass('sitemapToolbarButtonSelected');
+ }
+ }
+
+ $axure.messageCenter.addMessageListener(function(message, data) {
+ if(message == 'adaptiveViewChange') {
+ $('.adaptiveViewOption').removeClass('currentAdaptiveView');
+ if(data.viewId) {$('div[val="' + data.viewId + '"]').addClass('currentAdaptiveView');}
+ else $('div[val="default"]').addClass('currentAdaptiveView');
+
+ //when we set adaptive view through user event, we want to update the checkmark on sitemap
+ if(data.forceSwitchTo) {
+ $('.checkedAdaptive').removeClass('checkedAdaptive');
+ $('div[val="' + data.forceSwitchTo + '"]').find('.adaptiveCheckboxDiv').addClass('checkedAdaptive');
+ }
+ }
+ });
+
+ $(document).on('pluginShown', function (event, data) {
+ if(data == 1) {
+ hideAllContainersExcept(1);
+ updateContainerHeight();
+ }
+ });
+
+ $(document).on('sidebarExpanded', function (event, data) {
+ hideAllContainersExcept(1);
+ updateContainerHeight();
+ });
+
+ function highlight_interactive(event) {
+ if($('#highlightInteractiveButton').is('.sitemapToolbarButtonSelected')) {
+ $('#highlightInteractiveButton').removeClass('sitemapToolbarButtonSelected');
+ $axure.messageCenter.postMessage('highlightInteractive', false);
+ //Delete 'hi' hash string var if it exists since default is unselected
+ deleteVarFromCurrentUrlHash(HIGHLIGHT_INTERACTIVE_VAR_NAME);
+ } else {
+ $('#highlightInteractiveButton').addClass('sitemapToolbarButtonSelected');
+ $axure.messageCenter.postMessage('highlightInteractive', true);
+ //Add 'hi' hash string var so that stay highlighted across reloads
+ setVarInCurrentUrlHash(HIGHLIGHT_INTERACTIVE_VAR_NAME, 1);
+ }
+ }
+
+ function adaptive_click(event) {
+ hideAllContainersExcept(1);
+ $('#adaptiveViewsContainer').toggle();
+ updateContainerHeight();
+ if(!$('#adaptiveViewsContainer').is(":visible")) {
+ $('#adaptiveButton').removeClass('sitemapToolbarButtonSelected');
+ } else {
+ $('#adaptiveButton').addClass('sitemapToolbarButtonSelected');
+ }
+ }
+
+ function adaptiveViewOption_click(event) {
+ var currVal = $(this).attr('val');
+
+ $('.checkedAdaptive').removeClass('checkedAdaptive');
+ $(this).find('.adaptiveCheckboxDiv').addClass('checkedAdaptive');
+
+ currentPageLoc = $axure.page.location.split("#")[0];
+ var decodedPageLoc = decodeURI(currentPageLoc);
+ var nodeUrl = decodedPageLoc.substr(decodedPageLoc.lastIndexOf('/') ? decodedPageLoc.lastIndexOf('/') + 1 : 0);
+ var adaptiveData = {
+ src: nodeUrl
+ };
+
+ adaptiveData.view = currVal;
+ $axure.messageCenter.postMessage('switchAdaptiveView', adaptiveData);
+
+ if(currVal == 'auto') {
+ //Remove view in hash string if one is set
+ deleteVarFromCurrentUrlHash(ADAPTIVE_VIEW_VAR_NAME);
+ } else {
+ //Set current view in hash string so that it can be maintained across reloads
+ setVarInCurrentUrlHash(ADAPTIVE_VIEW_VAR_NAME, currVal);
+ }
+ }
+
+ function search_click(event) {
+ $('#searchDiv').toggle();
+ if(!$('#searchDiv').is(":visible")) {
+ $('#searchButton').removeClass('sitemapToolbarButtonSelected');
+ $('#searchBox').val('');
+ $('#searchBox').keyup();
+ //$('#sitemapToolbar').css('height', '22px');
+ $('#sitemapTreeContainer').css('top', '31px');
+ } else {
+ $('#searchButton').addClass('sitemapToolbarButtonSelected');
+ $('#searchBox').focus();
+ //$('#sitemapToolbar').css('height', '50px');
+ $('#sitemapTreeContainer').css('top', '63px');
+ }
+ }
+
+ function search_input_keyup(event) {
+ var searchVal = $(this).val().toLowerCase();
+ //If empty search field, show all nodes, else grey+hide all nodes and
+ //ungrey+unhide all matching nodes, as well as unhide their parent nodes
+ if(searchVal == '') {
+ $('.sitemapPageName').removeClass('sitemapGreyedName');
+ $('.sitemapNode').show();
+ } else {
+ $('.sitemapNode').hide();
+
+ $('.sitemapPageName').addClass('sitemapGreyedName').each(function() {
+ var nodeName = $(this).text().toLowerCase();
+ if(nodeName.indexOf(searchVal) != -1) {
+ $(this).removeClass('sitemapGreyedName').parents('.sitemapNode:first').show().parents('.sitemapExpandableNode').show();
+ }
+ });
+ }
+ }
+
+ function withoutSitemapRadio_click() {
+ $('#sitemapLinkWithPlayer').val(currentPageLoc);
+ $('#sitemapOptionsDiv').hide();
+ $('#minimizeBox').attr('disabled', 'disabled');
+ $('#collapseBox').attr('disabled', 'disabled');
+ $('#footnotesBox').attr('disabled', 'disabled');
+ $('#highlightBox').attr('disabled', 'disabled');
+ $('#viewSelect').attr('disabled', 'disabled');
+ $('input[value="withmap"]').parent().removeClass('sitemapRadioSelected');
+
+ updateContainerHeight();
+ }
+
+ function withSitemapRadio_click() {
+ $('#sitemapLinkWithPlayer').val(currentPlayerLoc + currentPageHashString);
+ $('#minimizeBox').removeAttr('disabled').change();
+ $('#collapseBox').removeAttr('disabled').change();
+ $('#footnotesBox').removeAttr('disabled').change();
+ $('#highlightBox').removeAttr('disabled').change();
+ $('#viewSelect').removeAttr('disabled').change();
+ $('#sitemapOptionsDiv').show();
+ $('input[value="withmap"]').parent().addClass('sitemapRadioSelected');
+
+ updateContainerHeight();
+ }
+
+ function sitemapUrlOptions_change() {
+ var currLinkHash = '#' + $('#sitemapLinkWithPlayer').val().split("#")[1];
+ var newHash = null;
+ var varName = '';
+ var defVal = 1;
+ if($(this).is('#minimizeBox')) {
+ varName = SITEMAP_COLLAPSE_VAR_NAME;
+ } else if($(this).is('#collapseBox')) {
+ varName = PLUGIN_VAR_NAME;
+ defVal = 0;
+ } else if($(this).is('#footnotesBox')) {
+ varName = FOOTNOTES_VAR_NAME;
+ defVal = 0;
+ } else if($(this).is('#highlightBox')) {
+ varName = HIGHLIGHT_INTERACTIVE_VAR_NAME;
+ }
+
+ newHash = $(this).is(':checked') ? setHashStringVar(currLinkHash, varName, defVal) : deleteHashStringVar(currLinkHash, varName);
+
+ if(newHash != null) {
+ $('#sitemapLinkWithPlayer').val(currentPlayerLoc + newHash);
+ }
+ }
+
+ function sitemapUrlViewSelect_change() {
+ var currLinkHash = '#' + $('#sitemapLinkWithPlayer').val().split("#")[1];
+ var newHash = null;
+ var $selectedOption = $(this).find('option:selected');
+ if($selectedOption.length == 0) return;
+ var selectedVal = $selectedOption.attr('value');
+
+ newHash = selectedVal == 'auto' ? deleteHashStringVar(currLinkHash, ADAPTIVE_VIEW_VAR_NAME) : setHashStringVar(currLinkHash, ADAPTIVE_VIEW_VAR_NAME, selectedVal);
+
+ if(newHash != null) {
+ $('#sitemapLinkWithPlayer').val(currentPlayerLoc + newHash);
+ }
+ }
+
+ function generateSitemap() {
+ var treeUl = "";
+
+ treeUl += "";
+
+ treeUl += '
';
+
+ treeUl += "
";
+ var rootNodes = $axure.document.sitemap.rootNodes;
+ for(var i = 0; i < rootNodes.length; i++) {
+ treeUl += generateNode(rootNodes[i], 0);
+ }
+ treeUl += " ";
+ } else {
+ margin = (21 + level * 17);
+ returnVal = "
";
+
+ if(hasChildren) {
+ returnVal += "";
+ for(var i = 0; i < node.children.length; i++) {
+ var child = node.children[i];
+ returnVal += generateNode(child, level + 1);
+ }
+ returnVal += " ";
+ }
+ returnVal += " ";
+ return returnVal;
+ }
+})();
+
+//***** page_notes.js *****//
+// use this to isolate the scope
+(function () {
+ if(!$axure.document.configuration.showPageNotes && !$axure.document.configuration.showAnnotationsSidebar) { return; }
+
+ $(window.document).ready(function () {
+ $axure.player.createPluginHost({
+ id: 'pageNotesHost',
+ context: 'interface',
+ title: 'NOTES',
+ gid: 2
+ });
+
+ generatePageNotes();
+
+ $(document).on('ContainerHeightChange', function () {
+ updateContainerHeight();
+ });
+
+ $('#footnotesButton').click(footnotes_click).addClass('sitemapToolbarButtonSelected');
+ $('#notesNextButton').click(notesNext_click);
+ $('#notesPreviousButton').click(notesPrevious_click);
+
+ // bind to the page load
+ $axure.page.bind('load.page_notes', function () {
+
+ var hasNotes = false;
+
+ $('#pageNotesContent').html("");
+
+ if($axure.document.configuration.showPageNotes) {
+ //populate the notes
+ var notes = $axure.page.notes;
+ if(notes) {
+ var showNames = $axure.document.configuration.showPageNoteNames;
+
+ for(var noteName in notes) {
+ var pageNoteUi = "
";
+ if(showNames) {
+ pageNoteUi += "
" + noteName + "
";
+ }
+ pageNoteUi += "
" + linkify(notes[noteName]) + "
";
+ pageNoteUi += "
";
+ pageNoteUi += "
";
+ $('#pageNotesContent').append(pageNoteUi);
+
+ hasNotes = true;
+ }
+ }
+ }
+
+ if($axure.document.configuration.showAnnotationsSidebar) {
+ var widgetNotes = $axure.page.widgetNotes;
+ if(widgetNotes) {
+ for(var i = 0; i < widgetNotes.length; i++) {
+ var widgetNote = widgetNotes[i];
+ var widgetNoteUi = "
";
+ widgetNoteUi += "
";
+ $('#pageNotesContent').append(widgetNoteUi);
+ hasNotes = true;
+ }
+ $('.widgetNoteContainer').children(':last-child').remove();
+ $('.widgetNoteFootnote').append("
");
+ $('.widgetNoteContainer').click(function () {
+ var wasSelected = $(this).hasClass('widgetNoteContainerSelected');
+ $('.widgetNoteContainerSelected').removeClass('widgetNoteContainerSelected');
+ if(!wasSelected) $(this).addClass('widgetNoteContainerSelected');
+ $axure.messageCenter.postMessage('toggleSelectWidgetNote', this.getAttribute('data-id'));
+ });
+ }
+ }
+
+ if(hasNotes) $('#pageNotesEmptyState').hide();
+ else $('#pageNotesEmptyState').show();
+
+ //If footnotes enabled for this prototype...
+ if($axure.document.configuration.showAnnotations == true) {
+ //If the fn var is defined and set to 0, hide footnotes
+ //else if hide-footnotes button selected, hide them
+ var fnVal = getHashStringVar(FOOTNOTES_VAR_NAME);
+ if(fnVal.length > 0 && fnVal == 0) {
+ $('#footnotesButton').removeClass('sitemapToolbarButtonSelected');
+ $axure.messageCenter.postMessage('annotationToggle', false);
+ } else if(!$('#footnotesButton').is('.sitemapToolbarButtonSelected')) {
+ //If the footnotes button isn't selected, hide them on this loaded page
+ $axure.messageCenter.postMessage('annotationToggle', false);
+ }
+ }
+
+
+ return false;
+ });
+
+ function linkify(text) {
+ var urlRegex = /(\b(((https?|ftp|file):\/\/)|(www\.))[-A-Z0-9+&@#\/%?=~_|!:,.;]*[-A-Z0-9+&@#\/%=~_|])/ig;
+ return text.replace(urlRegex, function(url, b, c) {
+ var url2 = (c == 'www.') ? 'http://' + url : url;
+ return '
' + url + ' ';
+ });
+ }
+ });
+
+ function updateContainerHeight() {
+ $('#pageNotesScrollContainer').height($('#pageNotesHost').height() - $('#pageNotesHeader').outerHeight());
+ }
+
+ $(document).on('sidebarCollapse', function (event, data) {
+ clearSelection();
+ });
+
+ $(document).on('pluginShown', function (event, data) {
+ if(data != 2) {
+ clearSelection();
+ }
+ });
+
+ function clearSelection() {
+ $('.widgetNoteContainerSelected').removeClass('widgetNoteContainerSelected');
+ $axure.messageCenter.postMessage('toggleSelectWidgetNote', '');
+ }
+
+ function footnotes_click(event) {
+ if($('#footnotesButton').is('.sitemapToolbarButtonSelected')) {
+ $('#footnotesButton').removeClass('sitemapToolbarButtonSelected');
+ $axure.messageCenter.postMessage('annotationToggle', false);
+ //Add 'fn' hash string var so that footnotes stay hidden across reloads
+ setVarInCurrentUrlHash(FOOTNOTES_VAR_NAME, 0);
+ } else {
+ $('#footnotesButton').addClass('sitemapToolbarButtonSelected');
+ $axure.messageCenter.postMessage('annotationToggle', true);
+ //Delete 'fn' hash string var if it exists since default is visible
+ deleteVarFromCurrentUrlHash(FOOTNOTES_VAR_NAME);
+ }
+ }
+
+ function notesNext_click(event) {
+ openNextPage();
+ }
+
+ function notesPrevious_click(event) {
+ openPreviousPage();
+ }
+
+ function generatePageNotes() {
+ var pageNotesUi = "";
+
+
+ pageNotesUi += "
";
+ pageNotesUi += "
";
+ pageNotesUi += "
No notes for this page.
Notes added in Axure RP will appear here.
";
+ pageNotesUi += "
";
+ pageNotesUi += "
";
+
+ $('#pageNotesHost').html(pageNotesUi);
+ updateContainerHeight();
+
+ if(!$axure.document.configuration.showAnnotations) {
+ $('#pageNotesHost .pageNameHeader').css('padding-right', '55px');
+ }
+ }
+
+})();
+//***** debug.js *****//
+// use this to isolate the scope
+(function () {
+
+ if(!$axure.document.configuration.showConsole) { return; }
+
+ $(document).ready(function () {
+ $axure.player.createPluginHost({
+ id: 'debugHost',
+ context: 'interface',
+ title: 'CONSOLE',
+ gid: 3
+ });
+
+ generateDebug();
+
+ $('#variablesClearLink').click(clearvars_click);
+ $('#traceClearLink').click(cleartrace_click);
+
+
+ $(document).on('ContainerHeightChange', function () {
+ updateContainerHeight();
+ });
+
+ //$('#traceContainer').hide();
+ //$('#debugTraceLink').click(function () {
+ // $('#variablesContainer').hide();
+ // $('#traceContainer').show();
+ //});
+ //$('#debugVariablesLink').click(function () {
+ // $('#variablesContainer').show();
+ // $('#traceContainer').hide();
+ //});
+
+ var currentStack= [];
+ var finishedStack = [];
+
+ $axure.messageCenter.addMessageListener(function (message, data) {
+ if(message == 'axCompositeEventMessage') {
+ for(var i = 0; i < data.length; i++) {
+ processMessages(data[i].message, data[i].data);
+ }
+ } else processMessages(message, data);
+ });
+
+ var processMessages = function(message, data) {
+ if(message == 'globalVariableValues') {
+ $('#variablesDiv').empty();
+ for(var key in data) {
+ var value = data[key] == '' ? '(blank)' : data[key];
+ $('#variablesDiv').append('
' + key + '
');
+ }
+ } else if(message == 'axEvent') {
+ var addToStack = "
";
+ addToStack += "
" + new Date().toLocaleTimeString() + "
";
+ addToStack += "
" + data.label + " (" + data.type + ")
";
+ addToStack += "
" + data.event.description + "
";
+ currentStack.push(addToStack);
+ } else if (message == 'axEventComplete') {
+ currentStack[currentStack.length - 1] += "
";
+ finishedStack.push(currentStack.pop());
+ if(currentStack.length == 0) {
+ $('#traceClearLinkContainer').show();
+ $('#traceEmptyState').hide();
+
+ $('.lastAxEvent').removeClass('lastAxEvent');
+ for(var i = finishedStack.length - 1; i >= 0; i--) {
+ if($('#traceDiv').children().length > 99) $('#traceDiv').children().last().remove();
+ $('#traceDiv').prepend(finishedStack[i]);
+ if(i == finishedStack.length - 1) $('#traceDiv').children().first().addClass('lastAxEvent');
+ }
+ finishedStack = [];
+ }
+ } else if (message == 'axCase') {
+ currentStack[currentStack.length - 1] += "
" + data.description + "
";
+ } else if (message == 'axAction') {
+ currentStack[currentStack.length - 1] += "
" + data.description + "
";
+ }
+ }
+
+ // bind to the page load
+ $axure.page.bind('load.debug', function () {
+
+ $axure.messageCenter.postMessage('getGlobalVariables', '');
+
+ return false;
+ });
+
+ function clearvars_click(event) {
+ $axure.messageCenter.postMessage('resetGlobalVariables', '');
+ }
+
+ function cleartrace_click(event) {
+ $('#traceDiv').html('');
+ $('#traceClearLinkContainer').hide();
+ $('#traceEmptyState').show();
+ }
+ });
+
+ function updateContainerHeight() {
+ $('#debugScrollContainer').height($('#debugHost').height() - $('#debugHeader').outerHeight());
+ }
+
+ function generateDebug() {
+ var pageNotesUi = "";
+
+ //var pageNotesUi = "
";
+ pageNotesUi += "
";
+
+ $('#debugHost').html(pageNotesUi);
+ updateContainerHeight();
+
+ $('#traceClearLinkContainer').hide();
+ $('#traceEmptyState').show();
+ }
+
+})();
\ No newline at end of file
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/startPre.js b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/startPre.js
new file mode 100644
index 0000000..5cce375
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/resources/scripts/startPre.js
@@ -0,0 +1,952 @@
+// 8.0.0.3355. Generated 8/24/2017 4:38:58 AM UTC
+
+//***** splitter.js *****//
+/*
+* jQuery.splitter.js - two-pane splitter window plugin
+*
+* version 1.51 (2009/01/09)
+*
+* Dual licensed under the MIT and GPL licenses:
+* http://www.opensource.org/licenses/mit-license.php
+* http://www.gnu.org/licenses/gpl.html
+*/
+
+/**
+* The splitter() plugin implements a two-pane resizable splitter window.
+* The selected elements in the jQuery object are converted to a splitter;
+* each selected element should have two child elements, used for the panes
+* of the splitter. The plugin adds a third child element for the splitbar.
+*
+* For more details see: http://methvin.com/splitter/
+*
+*
+* @example $('#MySplitter').splitter();
+* @desc Create a vertical splitter with default settings
+*
+* @example $('#MySplitter').splitter({type: 'h', accessKey: 'M'});
+* @desc Create a horizontal splitter resizable via Alt+Shift+M
+*
+* @name splitter
+* @type jQuery
+* @param Object options Options for the splitter (not required)
+* @cat Plugins/Splitter
+* @return jQuery
+* @author Dave Methvin (dave.methvin@gmail.com)
+*/
+;(function($){
+
+$.fn.splitter = function(args){
+ args = args || {};
+ return this.each(function() {
+ var zombie; // left-behind splitbar for outline resizes
+ function startSplitMouse(evt) {
+ if ( opts.outline )
+ zombie = zombie || bar.clone(false).insertAfter(A);
+ panes.css("-webkit-user-select", "none"); // Safari selects A/B text on a move
+ bar.addClass(opts.activeClass);
+ $('
').insertAfter(bar);
+ A._posSplit = A[0][opts.pxSplit] - evt[opts.eventPos];
+ $(document)
+ .bind("mousemove", doSplitMouse)
+ .bind("mouseup", endSplitMouse);
+ }
+ function doSplitMouse(evt) {
+ var newPos = A._posSplit+evt[opts.eventPos];
+ if ( opts.outline ) {
+ newPos = Math.max(0, Math.min(newPos, splitter._DA - bar._DA));
+ bar.css(opts.origin, newPos);
+ } else
+ resplit(newPos);
+ }
+ function endSplitMouse(evt) {
+ $('div.splitterMask').remove();
+ bar.removeClass(opts.activeClass);
+ var newPos = A._posSplit+evt[opts.eventPos];
+ if ( opts.outline ) {
+ zombie.remove(); zombie = null;
+ resplit(newPos);
+ }
+ panes.css("-webkit-user-select", "text"); // let Safari select text again
+ $(document)
+ .unbind("mousemove", doSplitMouse)
+ .unbind("mouseup", endSplitMouse);
+ }
+ function resplit(newPos) {
+ // Constrain new splitbar position to fit pane size limits
+ newPos = Math.max(A._min, splitter._DA - B._max,
+ Math.min(newPos, A._max, splitter._DA - bar._DA - B._min));
+ // Resize/position the two panes
+ bar._DA = bar[0][opts.pxSplit]; // bar size may change during dock
+
+ var posOffset = bar.is(':visible') ? bar._DA - 1 : 0;
+
+ bar.css(opts.origin, newPos - posOffset).css(opts.fixed, splitter._DF);
+ A.css(opts.origin, 0).css(opts.split, newPos).css(opts.fixed, splitter._DF);
+ B.css(opts.origin, newPos + bar._DA - posOffset)
+ .css(opts.split, splitter._DA-bar._DA-newPos).css(opts.fixed, splitter._DF);
+ // IE fires resize for us; all others pay cash
+ if ( !IE_10_AND_BELOW )
+ panes.trigger("resize");
+ }
+ function dimSum(jq, dims) {
+ // Opera returns -1 for missing min/max width, turn into 0
+ var sum = 0;
+ for ( var i=1; i < arguments.length; i++ )
+ sum += Math.max(parseInt(jq.css(arguments[i])) || 0, 0);
+ return sum;
+ }
+
+ // Determine settings based on incoming opts, element classes, and defaults
+ var vh = (args.splitHorizontal? 'h' : args.splitVertical? 'v' : args.type) || 'v';
+ var opts = $.extend({
+ activeClass: 'active', // class name for active splitter
+ pxPerKey: 8, // splitter px moved per keypress
+ tabIndex: 0, // tab order indicator
+ accessKey: '' // accessKey for splitbar
+ },{
+ v: { // Vertical splitters:
+ keyLeft: 39, keyRight: 37, cursor: "col-resize",
+ splitbarClass: "vsplitbar", outlineClass: "voutline",
+ type: 'v', eventPos: "pageX", origin: "left",
+ split: "width", pxSplit: "offsetWidth", side1: "Left", side2: "Right",
+ fixed: "height", pxFixed: "offsetHeight", side3: "Top", side4: "Bottom"
+ },
+ h: { // Horizontal splitters:
+ keyTop: 40, keyBottom: 38, cursor: "row-resize",
+ splitbarClass: "hsplitbar", outlineClass: "houtline",
+ type: 'h', eventPos: "pageY", origin: "top",
+ split: "height", pxSplit: "offsetHeight", side1: "Top", side2: "Bottom",
+ fixed: "width", pxFixed: "offsetWidth", side3: "Left", side4: "Right"
+ }
+ }[vh], args);
+
+ // Create jQuery object closures for splitter and both panes
+ var splitter = $(this).css({position: "relative"});
+ var panes = $(">*", splitter[0]).css({
+ position: "absolute", // positioned inside splitter container
+ "z-index": "1", // splitbar is positioned above
+ "-moz-outline-style": "none" // don't show dotted outline
+ });
+ var A = $(panes[0]); // left or top
+ var B = $(panes[1]); // right or bottom
+
+ // Focuser element, provides keyboard support; title is shown by Opera accessKeys
+ var focuser = $('
')
+ .attr({accessKey: opts.accessKey, tabIndex: opts.tabIndex, title: opts.splitbarClass})
+ .bind($.browser.opera?"click":"focus", function(){ this.focus(); bar.addClass(opts.activeClass) })
+ .bind("keydown", function(e){
+ var key = e.which || e.keyCode;
+ var dir = key==opts["key"+opts.side1]? 1 : key==opts["key"+opts.side2]? -1 : 0;
+ if ( dir )
+ resplit(A[0][opts.pxSplit]+dir*opts.pxPerKey, false);
+ })
+ .bind("blur", function(){ bar.removeClass(opts.activeClass) });
+
+ // Splitbar element, can be already in the doc or we create one
+ var bar = $(panes[2] || '
')
+ .insertAfter(A).css("z-index", "100").append(focuser)
+ .attr({"class": opts.splitbarClass, unselectable: "on"})
+ .css({position: "absolute", "user-select": "none", "-webkit-user-select": "none",
+ "-khtml-user-select": "none", "-moz-user-select": "none", "top": "0px"})
+ .bind("mousedown", startSplitMouse);
+ // Use our cursor unless the style specifies a non-default cursor
+ if ( /^(auto|default|)$/.test(bar.css("cursor")) )
+ bar.css("cursor", opts.cursor);
+
+ // Cache several dimensions for speed, rather than re-querying constantly
+ bar._DA = bar[0][opts.pxSplit];
+ splitter._PBF = $.boxModel? dimSum(splitter, "border"+opts.side3+"Width", "border"+opts.side4+"Width") : 0;
+ splitter._PBA = $.boxModel? dimSum(splitter, "border"+opts.side1+"Width", "border"+opts.side2+"Width") : 0;
+ A._pane = opts.side1;
+ B._pane = opts.side2;
+ $.each([A,B], function(){
+ this._min = opts["min"+this._pane] || dimSum(this, "min-"+opts.split);
+ this._max = opts["max"+this._pane] || dimSum(this, "max-"+opts.split) || 9999;
+ this._init = opts["size"+this._pane]===true ?
+ parseInt($.curCSS(this[0],opts.split)) : opts["size"+this._pane];
+ });
+
+ // Determine initial position, get from cookie if specified
+ var initPos = A._init;
+ if ( !isNaN(B._init) ) // recalc initial B size as an offset from the top or left side
+ initPos = splitter[0][opts.pxSplit] - splitter._PBA - B._init - bar._DA;
+ if ( opts.cookie ) {
+ if ( !$.cookie )
+ alert('jQuery.splitter(): jQuery cookie plugin required');
+ var ckpos = parseInt($.cookie(opts.cookie));
+ if ( !isNaN(ckpos) )
+ initPos = ckpos;
+ $(window).bind("unload", function(){
+ var state = String(bar.css(opts.origin)); // current location of splitbar
+ $.cookie(opts.cookie, state, {expires: opts.cookieExpires || 365,
+ path: opts.cookiePath || document.location.pathname});
+ });
+ }
+ if ( isNaN(initPos) ) // King Solomon's algorithm
+ initPos = Math.round((splitter[0][opts.pxSplit] - splitter._PBA - bar._DA)/2);
+
+ // Resize event propagation and splitter sizing
+ if ( opts.anchorToWindow ) {
+ // Account for margin or border on the splitter container and enforce min height
+ splitter._hadjust = dimSum(splitter, "borderTopWidth", "borderBottomWidth", "marginBottom");
+ splitter._hmin = Math.max(dimSum(splitter, "minHeight"), 20);
+ $(window).bind("resize", function(){
+ var top = splitter.offset().top;
+ var wh = $(window).height();
+ splitter.css("height", Math.max(wh-top-splitter._hadjust, splitter._hmin)+"px");
+ if ( !IE_10_AND_BELOW ) splitter.trigger("resize");
+ }).trigger("resize");
+ }
+ else if ( opts.resizeToWidth && !IE_10_AND_BELOW )
+ $(window).bind("resize", function(){
+ splitter.trigger("resize");
+ });
+
+ // Resize event handler; triggered immediately to set initial position
+ splitter.bind("resize", function(e, size){
+ // Custom events bubble in jQuery 1.3; don't Yo Dawg
+ if ( e.target != this ) return;
+ // Determine new width/height of splitter container
+ splitter._DF = splitter[0][opts.pxFixed] - splitter._PBF;
+ splitter._DA = splitter[0][opts.pxSplit] - splitter._PBA;
+ // Bail if splitter isn't visible or content isn't there yet
+ if ( splitter._DF <= 0 || splitter._DA <= 0 ) return;
+ // Re-divvy the adjustable dimension; maintain size of the preferred pane
+ resplit(!isNaN(size)? size : (!(opts.sizeRight||opts.sizeBottom)? A[0][opts.pxSplit] :
+ splitter._DA-B[0][opts.pxSplit]-bar._DA));
+ }).trigger("resize" , [initPos]);
+ });
+};
+
+})(jQuery);
+//***** axutils.js *****//
+/*
+ *
+ *
+ *
+ *
+ */
+
+ (function() {
+ // define the root namespace object
+ if(!window.$axure) window.$axure = {};
+
+ $axure.utils = {};
+
+ // ------------------------------------------------------------------------
+ // Makes an object bindable
+ // ------------------------------------------------------------------------
+ $axure.utils.makeBindable = function(obj, events) {
+ if(obj.registeredBindings != null) return;
+
+ // copy the events
+ obj.bindableEvents = events.slice();
+ obj.registeredBindings = {};
+
+ obj.bind = function(eventName, fn) {
+ var binding = {};
+ binding.eventName = eventName;
+ binding.action = fn;
+
+ var bindingList = this.registeredBindings[eventName];
+ if(bindingList == null) {
+ bindingList = [];
+ this.registeredBindings[eventName] = bindingList;
+ }
+ bindingList[bindingList.length] = binding;
+ };
+
+ obj.unbind = function(eventName) {
+ if(eventName.indexOf('.') >= 0) {
+ this.registeredBindings[eventName] = null;
+ } else {
+ var event = eventName.split('.')[0];
+ for(var bindingKey in this.registeredBindings) {
+ if(bindingKey.split('.')[0] == event) {
+ this.registeredBindings[bindingKey] = null;
+ }
+ }
+ }
+ };
+
+ obj.triggerEvent = function(eventName, arg) {
+ for(var bindingKey in this.registeredBindings) {
+ if(bindingKey.split('.')[0] == eventName) {
+ var bindings = this.registeredBindings[bindingKey];
+ for(var i = 0; i < bindings.length; i++) {
+ if(arg == null) {
+ bindings[i].action();
+ } else {
+ bindings[i].action(arg);
+ }
+ }
+ }
+ }
+ };
+ };
+
+
+ $axure.utils.loadCSS = function(url) {
+ $('head').append('
');
+ };
+
+ $axure.utils.loadJS = function(url) {
+ $('head').append('');
+ };
+
+ $axure.utils.curry = function(fn) {
+ var curriedArgs = Array.prototype.slice.call(arguments, [1]);
+ return function() {
+ fn.apply(this, curriedArgs.concat(Array.prototype.slice.call(arguments)));
+ };
+ };
+
+ $axure.utils.succeeded = function(result) {
+ return result && result.success;
+ };
+
+ $axure.utils.createUniqueTag = function() {
+ return Math.random().toString().substring(2) +
+ Math.random().toString().substring(2) +
+ Math.random().toString().substring(2) +
+ Math.random().toString().substring(2);
+ };
+
+ $axure.utils.formatDate = function(date) {
+ var months = [
+ "Jan", "Feb", "Mar", "Apr", "May", "Jun",
+ "Jul", "Aug", "Sep", "Oct", "Nov", "Dec"];
+ var hours = date.getHours();
+ var amPm = (hours > 11 ? 'PM' : 'AM');
+ hours = hours % 12;
+ if(hours == '0') hours = '12';
+ var minutes = date.getMinutes() + '';
+ if(minutes.length == 1) {
+ minutes = '0' + minutes;
+ }
+ return [
+ months[date.getMonth()], ' ', date.getDate(), ' ', date.getFullYear(), ' ',
+ hours, ':', minutes, ' ', amPm].join('');
+
+ };
+
+ $axure.utils.quickObject = function() {
+ var returnVal = {};
+ for(var i = 0; i < arguments.length; i += 2) {
+ returnVal[arguments[i]] = arguments[i + 1];
+ }
+ return returnVal;
+ };
+
+ var matrixBase = {
+ mul: function(val) {
+ if(val.x !== undefined) {
+ return $axure.utils.Vector2D(
+ this.m11 * val.x + this.m12 * val.y + this.tx,
+ this.m21 * val.x + this.m22 * val.y + this.ty);
+ } else if(val.m11) {
+ return $axure.utils.Matrix2D(
+ this.m11 * val.m11 + this.m12 * val.m21,
+ this.m11 * val.m12 + this.m12 * val.m22,
+ this.m21 * val.m11 + this.m22 * val.m21,
+ this.m21 * val.m12 + this.m22 * val.m22,
+ val.tx + this.tx * val.m11 + this.ty * val.m21,
+ val.ty + this.tx * val.m12 + this.ty * val.m22
+ );
+ } else if(Number(val)) {
+ var num = Number(val);
+ return $axure.utils.Matrix2D(this.m11 * num, this.m12 * num,
+ this.m21 * num, this.m22 * num,
+ this.tx * num, this.ty * num);
+ } else return undefined;
+ },
+ rotate: function(angle) {
+ var angleRad = angle * Math.PI / 180;
+ var c = Math.cos(angleRad);
+ var s = Math.sin(angleRad);
+
+ return this.mul($axure.utils.Matrix2D(c, -s, s, c));
+ },
+ translate: function(tx, ty) {
+ return this.mul($axure.utils.Matrix2D(1, 0, 0, 1, tx, ty));
+ }
+ };
+
+ $axure.utils.Matrix2D = function(m11, m12, m21, m22, tx, ty) {
+ return $.extend({
+ m11: m11 || 0,
+ m12: m12 || 0,
+ m21: m21 || 0,
+ m22: m22 || 0,
+ tx: tx || 0,
+ ty: ty || 0
+ }, matrixBase);
+ };
+
+ $axure.utils.Vector2D = function(x, y) {
+ return { x: x || 0, y: y || 0 };
+ };
+
+ $axure.utils.Matrix2D.identity = function() {
+ return $axure.utils.Matrix2D(1, 0, 0, 1, 0, 0);
+ };
+
+ $axure.utils.fixPng = function(png) {
+ if(!(/MSIE ((5\.5)|6)/.test(navigator.userAgent) && navigator.platform == "Win32")) return;
+
+ var src = png.src;
+ if(!png.style.width) { png.style.width = $(png).width(); }
+ if(!png.style.height) { png.style.height = $(png).height(); }
+ png.onload = function() { };
+ png.src = $axure.utils.getTransparentGifPath();
+ png.runtimeStyle.filter = "progid:DXImageTransform.Microsoft.AlphaImageLoader(src='" + src + "',sizingMethod='scale')";
+ };
+ })();
+
+ // TODO: [mas] simplify this
+ if(window.$axure && window.$axure.internal) {
+ $axure.internal(function($ax) { $ax.utils = $axure.utils; });
+ }
+
+ // Its too much of a pain to escape everything and use regular expresions, just replace manually
+ (function () {
+ var original = String.prototype.replace;
+ // TODO: maybe use flags or object instead to pass options in
+ String.prototype.replace = function (search, newVal, replaceFirst, ignoreCase) {
+ // Use original is some cases
+ if (search instanceof RegExp) return original.apply(this, arguments);
+
+ search = String(search);
+ var searchCompare = ignoreCase ? this.toLowerCase() : this;
+ if (ignoreCase) search = search.toLowerCase();
+
+ var searchLength = search.length;
+ var thisLength = this.length;
+
+ var index = 0;
+ var retVal = '';
+ while (index != -1) {
+ var nextIndex = searchCompare.indexOf(search, index);
+ if (nextIndex != -1) {
+ retVal += this.substring(index, nextIndex) + newVal;
+ index = nextIndex + searchLength;
+ if (index >= thisLength) index = -1;
+ } else {
+ retVal += this.substring(index);
+ index = -1;
+ }
+ if (replaceFirst) break;
+ }
+
+ return retVal;
+ };
+
+ if (!Array.prototype.indexOf) {
+ Array.prototype.indexOf = function (elt /*, from*/) {
+ var len = this.length >>> 0;
+
+ var from = trunc(Number(arguments[1]) || 0);
+ if(from < 0) from += len;
+
+ for(; from < len; from++) {
+ if(from in this && this[from] === elt) return from;
+ }
+ return -1;
+ };
+ }
+
+ var trunc = function(num) {
+ return num < 0 ? Math.ceil(num) : Math.floor(num);
+ };
+
+
+ })();
+
+//***** axplayer.js *****//
+if (!window.$axure) window.$axure = function () { };
+if (typeof console == 'undefined') console = {
+ log: function () { }
+};
+if(window._axUtils) $axure.utils = _axUtils;
+
+$axure.loadDocument = function(document) {
+ $axure.document = document;
+};
+
+function setUpController() {
+
+ //$axure.utils = _axUtils;
+
+ var _page = {};
+ $axure.page = _page;
+
+ $axure.utils.makeBindable(_page, ['load']);
+
+ var _player = function() {
+ };
+ $axure.player = _player;
+
+ //-----------------------------------------
+ //Global Var array, getLinkUrl function and setGlobalVar listener are
+ //for use in setting global vars in page url string when clicking a
+ //page in the sitemap
+ //-----------------------------------------
+ var _globalVars = {};
+
+ //-----------------------------------------
+ //Used by getLinkUrl below to check if local server is running
+ //in order to send back the global variables as a query string
+ //in the page url
+ //-----------------------------------------
+ var _shouldSendVarsToServer = function () {
+ //If exception occurs (due to page in content frame being from a different domain, etc)
+ //then run the check without the url (which will end up checking against sitemap url)
+ try {
+ var mainFrame = document.getElementById("mainFrame");
+ return $axure.shouldSendVarsToServer(mainFrame.contentWindow.location.href);
+ } catch (e) {
+ return $axure.shouldSendVarsToServer();
+ }
+ };
+
+ var _getLinkUrl = function (baseUrl) {
+ var toAdd = '';
+ for(var globalVarName in _globalVars) {
+ var val = _globalVars[globalVarName];
+ if(val != null) {
+ if(toAdd.length > 0) toAdd += '&';
+ toAdd += globalVarName + '=' + encodeURIComponent(val);
+ }
+ }
+ return toAdd.length > 0 ? baseUrl + (_shouldSendVarsToServer() ? '?' : '#') + toAdd + "&CSUM=1" : baseUrl;
+ };
+ $axure.getLinkUrlWithVars = _getLinkUrl;
+
+ $axure.messageCenter.addMessageListener(function(message, data) {
+ if (message == 'setGlobalVar'){
+ _globalVars[data.globalVarName] = data.globalVarValue;
+ }
+ });
+
+ $axure.messageCenter.addStateListener('page.data', function (key, value) {
+ for (var subKey in value) {
+ _page[subKey] = value[subKey];
+ }
+ $axure.page.triggerEvent('load');
+ });
+
+ // ---------------------------------------------
+ // Navigates the main frame (setting the currently visible page). If the link is relative,
+ // this method should test if it is actually a axure rp page being loaded and properly set
+ // up all the controller for the page if it is
+ // ---------------------------------------------
+ _page.navigate = function (url, includeVariables) {
+ var mainFrame = document.getElementById("mainFrame");
+ //var mainFrame = window.parent.mainFrame;
+ // if this is a relative url...
+ var urlToLoad;
+ if (url.indexOf(':') < 0 || url[0] == '/') {
+ var winHref = window.location.href;
+ var page = winHref.substring(0, winHref.lastIndexOf('/') + 1) + url;
+ urlToLoad = page;
+ } else {
+ urlToLoad = url;
+ }
+ if (!includeVariables) {
+ mainFrame.contentWindow.location.href = urlToLoad;
+ return;
+ }
+ var urlWithVars = $axure.getLinkUrlWithVars(urlToLoad);
+ var currentData = $axure.messageCenter.getState('page.data');
+ var currentUrl = currentData && currentData.location;
+ if(currentUrl && currentUrl.indexOf('#') != -1) currentUrl = currentUrl.substring(0, currentUrl.indexOf('#'))
+
+ // this is so we can make sure the current frame reloads if the variables have changed
+ // by default, if the location is the same but the hash code is different, the browser will not
+ // trigger a reload
+ mainFrame.contentWindow.location.href =
+ currentUrl && urlToLoad.toLowerCase() != currentUrl.toLowerCase()
+ ? urlWithVars
+ : 'resources/reload.html#' + encodeURI(urlWithVars);
+
+ };
+
+ var pluginIds = [];
+ var plugins = {};
+ var currentVisibleHostId = null;
+ // ---------------------------------------------
+ // Adds a tool box frame from a url to the interface. This is useful for loading plugins
+ // settings is an object that supports the following properties:
+ // - id : the id of the element for the plugin
+ // - context : the context to create the plugin host for
+ // - title : the user-visible caption for the plugin
+ // ---------------------------------------------
+ _player.createPluginHost = function (settings) {
+ // right now we only understand an interface context
+ if (!(!settings.context || settings.context === 'interface')) {
+ throw ('unknown context type');
+ }
+ if (!settings.id) throw ('each plugin host needs an id');
+
+ var host = $('
')
+ .appendTo('#interfaceControlFrameHostContainer');
+
+ host.hide();
+
+ var headerLink = $('
' + settings.title.toUpperCase() + ' ');
+
+ headerLink
+ .click($axure.utils.curry(interfaceControlHeaderButton_click, settings.id)).wrap('
');
+
+ if((settings.id == 'feedbackHost' || settings.id == 'feedbackContainer') && pluginIds[pluginIds.length - 1] == 'debugHost') headerLink.parent().insertBefore('#debugHostBtn');
+ else headerLink.parent().appendTo('#interfaceControlFrameHeader');
+
+ pluginIds[pluginIds.length] = settings.id;
+ plugins[settings.id] = settings;
+
+ $(document).trigger('pluginCreated', [settings.gid]);
+ };
+
+ // private methods
+ var interfaceControlHeaderButton_click = function (id) {
+ var clickedPlugin = $('#interfaceControlFrameHeader a[pluginId=' + id + ']');
+ if(clickedPlugin.hasClass('selected')) {
+ clickedPlugin.removeClass('selected');
+ $('#' + id).hide();
+ _player.collapseToBar();
+
+ $(document).trigger('pluginShown',['']);
+ } else {
+ $('#interfaceControlFrameHeader a').removeClass('selected');
+ clickedPlugin.addClass('selected');
+
+ $('#' + currentVisibleHostId).hide();
+ $('#' + id).show();
+ currentVisibleHostId = id;
+ _player.expandFromBar();
+
+ $(document).trigger('pluginShown', [plugins[id].gid]);
+ }
+
+ $(document).trigger('ContainerHeightChange');
+ };
+
+ $axure.player.showPlugin = function(gid) {
+ for(var id in plugins) {
+ if(plugins[id].gid == gid) {
+ $('a[pluginId="' + id + '"]').click();
+ break;
+ }
+ }
+ };
+}
+
+function setUpDocumentStateManager() {
+ var mgr = $axure.prototype.documentStateManager = {};
+ $axure.utils.makeBindable(mgr, ['globalVariableChanged']);
+
+ mgr.globalVariableValues = {};
+
+ mgr.setGlobalVariable = function(varname, value, source) {
+ var arg = {};
+ arg.variableName = varname;
+ arg.newValue = value;
+ arg.oldValue = this.getGlobalVariable(varname);
+ arg.source = source;
+
+ mgr.globalVariableValues[varname] = value;
+ this.triggerEvent('globalVariableChanged', arg);
+ };
+
+ mgr.getGlobalVariable = function(varname) {
+ return mgr.globalVariableValues[varname];
+ };
+}
+
+
+function setUpPageStateManager() {
+ var mgr = $axure.prototype.pageStateManager = {};
+
+ mgr.panelToStateIds = {};
+}
+
+//***** messagecenter.js *****//
+if (typeof console == 'undefined') console = {
+ log: function () { }
+};
+
+// sniff chrome
+var CHROME_5_LOCAL = false;
+var CHROME = false;
+var SAFARI = false;
+var FIREFOX = false;
+var WEBKIT = false;
+var OS_MAC = false;
+var IOS = false;
+var ANDROID = false;
+var MOBILE_DEVICE = false;
+
+var IE = false;
+var IE_10_AND_BELOW = false; //ie 10 and lower
+var IE_11_AND_ABOVE = false; //ie 11 and above
+var BROWSER_VERSION = 5000;
+(function () {
+ if(!window.$axure) window.$axure = function() {};
+ var useragent = window.navigator.userAgent;
+
+ var edgeRegex = /Edge\/([0-9]+)/g;
+ var edgeMatch = edgeRegex.exec(useragent);
+ $axure.browser = { isEdge: Boolean(edgeMatch) };
+
+ if(!$axure.browser.isEdge) {
+ var chromeRegex = /Chrome\/([0-9]+).([0-9]+)/g;
+ var chromeMatch = chromeRegex.exec(useragent);
+ CHROME = Boolean(chromeMatch);
+ CHROME_5_LOCAL = chromeMatch &&
+ Number(chromeMatch[1]) >= 5 &&
+ location.href.indexOf('file://') >= 0;
+ }
+
+ var safariRegex = /Safari\/([0-9]+)/g;
+ var safariMatch = safariRegex.exec(useragent);
+ SAFARI = Boolean(safariMatch) && !CHROME; //because chrome also inserts safari string into user agent
+
+ var webkitRegex = /WebKit\//g ;
+ WEBKIT = Boolean(webkitRegex.exec(useragent));
+
+ FIREFOX = useragent.toLowerCase().indexOf('firefox') > -1;
+
+ var macRegex = /Mac/g ;
+ OS_MAC = Boolean(macRegex.exec(window.navigator.platform));
+
+ IOS = useragent.match(/iPhone/i) || useragent.match(/iPad/i) || useragent.match(/iPod/i);
+ ANDROID = useragent.match(/Android/i);
+
+ MOBILE_DEVICE = ANDROID || IOS
+ || navigator.userAgent.match(/webOS/i)
+ || navigator.userAgent.match(/BlackBerry/i)
+ || navigator.userAgent.match(/Tablet PC/i)
+ || navigator.userAgent.match(/Windows Phone/i);
+
+ if($.browser) {
+ if($.browser.msie) IE_10_AND_BELOW = true;
+ else IE_11_AND_ABOVE = useragent.toLowerCase().indexOf('trident') > -1;
+
+ BROWSER_VERSION = $.browser.version;
+ }
+
+ IE = IE_10_AND_BELOW || IE_11_AND_ABOVE;
+
+ //Used by sitemap and variables.js getLinkUrl functions so that they know
+ //whether to embed global variables in URL as query string or hash string
+ //_shouldSendVars persists the value for sitemap instead of re-checking every time
+ var _shouldSendVars;
+ var _shouldSendVarsToServer = function(url) {
+ if(typeof _shouldSendVars != 'undefined') {
+ return _shouldSendVars;
+ }
+
+ if(SAFARI || (IE_10_AND_BELOW && BROWSER_VERSION < 10)) {
+ var urlToCheck = typeof url != 'undefined' ? url : window.location.href;
+ var serverRegex = /http:\/\/127\.0\.0\.1:[0-9]{5}/g;
+ var serverMatch = serverRegex.exec(urlToCheck);
+ var previewRegex = /[0-9]{2}\.[0-9]{2}\.[0-9]{2}/g;
+ var previewMatch = previewRegex.exec(urlToCheck);
+ if(Boolean(serverMatch) && Boolean(previewMatch)) {
+ _shouldSendVars = true;
+ return _shouldSendVars;
+ }
+ }
+
+ _shouldSendVars = false;
+ return _shouldSendVars;
+ };
+ $axure.shouldSendVarsToServer = _shouldSendVarsToServer;
+})();
+
+(function() {
+ var _topMessageCenter;
+ var _messageCenter = {};
+ var _listeners = [];
+ var _stateListeners = [];
+ var _state = {};
+ var _eventObject = null;
+
+ var _queuedMessages = [];
+ var _initialized = false;
+
+ // this is for the non Chrome 5 local scenarios. The "top" message center will dispatch to all the bottom ones
+ var _childrenMessageCenters = [];
+
+ // create $axure if it hasn't been created
+ if (!window.$axure) window.$axure = function() {};
+ $axure.messageCenter = _messageCenter;
+
+ // isolate scope, and initialize _topMessageCenter.
+ (function() {
+ if (!CHROME_5_LOCAL) {
+ var topAxureWindow = window;
+ try {
+ while(topAxureWindow.parent && topAxureWindow.parent !== topAxureWindow
+ && topAxureWindow.parent.$axure) topAxureWindow = topAxureWindow.parent;
+ } catch(e) {}
+ _topMessageCenter = topAxureWindow.$axure.messageCenter;
+ }
+ })();
+
+ $(window.document).ready(function() {
+ if (CHROME_5_LOCAL) {
+ $('body').append("
" +
+ "
");
+
+ _eventObject = window.document.createEvent('Event');
+ _eventObject.initEvent('axureMessageSenderEvent', true, true);
+
+ $('#axureEventReceiverDiv').bind('axureMessageReceiverEvent', function () {
+ var request = JSON.parse($(this).text());
+ _handleRequest(request);
+ });
+ } else {
+ if (_topMessageCenter != _messageCenter) {
+ _topMessageCenter.addChildMessageCenter(_messageCenter);
+ console.log('adding from ' + window.location.toString());
+ }
+ }
+ });
+
+ var _handleRequest = function (request) {
+ // route the request to all the listeners
+ for(var i = 0; i < _listeners.length; i++) _listeners[i](request.message, request.data);
+
+ // now handle the queued messages if we're initializing
+ if (request.message == 'initialize') {
+ _initialized = true;
+ // send all the queued messages and return
+ for (var i = 0; i < _queuedMessages.length; i++) {
+ var qRequest = _queuedMessages[i];
+ _messageCenter.postMessage(qRequest.message, qRequest.data);
+ }
+ _queuedMessages = [];
+ }
+
+ // and then handle the set state messages, if necessary
+ if (request.message == 'setState') {
+ _state[request.data.key] = request.data.value;
+ for (var i = 0; i < _stateListeners.length; i++) {
+ var keyListener = _stateListeners[i];
+ // if thep passed a null or empty value, always post the message
+ if (!keyListener.key || keyListener.key == request.data.key) {
+ keyListener.listener(request.data.key, request.data.value);
+ }
+ }
+ }
+
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // This method allows for dispatching messages in the non-chromelocal scenario.
+ // Each child calls this on _topMessageCenter
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.addChildMessageCenter = function(messageCenter) {
+ _childrenMessageCenters[_childrenMessageCenters.length] = messageCenter;
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // This method allows for dispatching messages in the non-chromelocal scenario.
+ // Each child calls this on _topMessageCenter
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.dispatchMessage = function(message, data) {
+ _handleRequest({
+ message: message,
+ data: data
+ });
+ };
+
+ // -----------------------------------------------------------------------------------------
+ // -----------------------------------------------------------------------------------------
+ _messageCenter.dispatchMessageRecursively = function(message, data) {
+ console.log("dispatched to " + window.location.toString());
+
+ // dispatch to the top center first
+ _messageCenter.dispatchMessage(message, data);
+
+ $('iframe').each(function(index, frame) {
+ //try,catch to handle permissions error in FF when loading pages from another domain
+ try {
+ if (frame.contentWindow.$axure && frame.contentWindow.$axure.messageCenter) {
+ frame.contentWindow.$axure.messageCenter.dispatchMessageRecursively(message, data);
+ }
+ }catch(e) {}
+ });
+ };
+
+ var _combineEventMessages = false;
+ var _compositeEventMessageData = [];
+ _messageCenter.startCombineEventMessages = function() {
+ _combineEventMessages = true;
+ }
+
+ _messageCenter.endCombineEventMessages = function () {
+ _messageCenter.sendCompositeEventMessage();
+ _combineEventMessages = false;
+ }
+
+ _messageCenter.sendCompositeEventMessage = function () {
+ _messageCenter.postMessage('axCompositeEventMessage', _compositeEventMessageData);
+ _compositeEventMessageData = [];
+ }
+
+ _messageCenter.postMessage = function (message, data) {
+ if(_combineEventMessages) {
+ if(message == 'axEvent' || message == 'axCase' || message == 'axAction' || message == 'axEventComplete') {
+ _compositeEventMessageData.push({ 'message': message, 'data': data });
+ if(_compositeEventMessageData.length >= 10) _messageCenter.sendCompositeEventMessage();
+ return;
+ }
+ }
+
+ if(!CHROME_5_LOCAL) {
+ _topMessageCenter.dispatchMessageRecursively(message, data);
+ } else {
+ var request = {
+ message: message,
+ data: data
+ };
+
+ if(_initialized) {
+ var senderDiv = window.document.getElementById('axureEventSenderDiv');
+ var messageText = JSON.stringify(request);
+ // console.log('sending event: ' + messageText);
+ senderDiv.innerText = messageText;
+ senderDiv.dispatchEvent(_eventObject);
+ // console.log('event sent');
+ } else {
+ _queuedMessages[_queuedMessages.length] = request;
+ }
+ }
+ };
+
+ _messageCenter.setState = function(key, value) {
+ var data = {
+ key: key,
+ value: value
+ };
+ _messageCenter.postMessage('setState', data);
+ };
+
+ _messageCenter.getState = function(key) {
+ return _state[key];
+ };
+
+ _messageCenter.addMessageListener = function(listener) {
+ _listeners[_listeners.length] = listener;
+ };
+
+ _messageCenter.addStateListener = function(key, listener) {
+ _stateListeners[_stateListeners.length] = {
+ key: key,
+ listener: listener
+ };
+ };
+
+})();
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/start.html b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/start.html
new file mode 100644
index 0000000..37974b1
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/start.html
@@ -0,0 +1,503 @@
+
+
+
+ Untitled Document
+
+
+
+
+
+
diff --git a/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/start_c_1.html b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/start_c_1.html
new file mode 100644
index 0000000..82de5fd
--- /dev/null
+++ b/HK3/PhanTichVaQuanLyYeuCauPhanMem/YCPM-HCDH/DoAn16HCB/FinalDocument/3_Prototype/Prototype_HTML_1642019_1642021_1642040_1642049_1642051/start_c_1.html
@@ -0,0 +1,12 @@
+
+
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+
+
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+ 
+